summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
Diffstat (limited to 'themes/mantra/resources')
-rw-r--r--themes/mantra/resources/css/editor-style-rtl.css56
-rw-r--r--themes/mantra/resources/css/editor-style.css287
-rw-r--r--themes/mantra/resources/css/rtl.css528
-rw-r--r--themes/mantra/resources/css/style-mobile.css339
-rw-r--r--themes/mantra/resources/fonts/elusive.eotbin0 -> 24152 bytes
-rw-r--r--themes/mantra/resources/fonts/elusive.svg111
-rw-r--r--themes/mantra/resources/fonts/elusive.ttfbin0 -> 23988 bytes
-rw-r--r--themes/mantra/resources/fonts/elusive.woffbin0 -> 14740 bytes
-rw-r--r--themes/mantra/resources/images/back2top.pngbin0 -> 3659 bytes
-rw-r--r--themes/mantra/resources/images/bullet.pngbin0 -> 501 bytes
-rw-r--r--themes/mantra/resources/images/bullets/arrow_black.pngbin0 -> 226 bytes
-rw-r--r--themes/mantra/resources/images/bullets/arrow_white.pngbin0 -> 283 bytes
-rw-r--r--themes/mantra/resources/images/bullets/bullet_dark.pngbin0 -> 304 bytes
-rw-r--r--themes/mantra/resources/images/bullets/bullet_gray.pngbin0 -> 304 bytes
-rw-r--r--themes/mantra/resources/images/bullets/bullet_light.pngbin0 -> 270 bytes
-rw-r--r--themes/mantra/resources/images/bullets/mantra_dot2.pngbin0 -> 181 bytes
-rw-r--r--themes/mantra/resources/images/bullets/square_dark.pngbin0 -> 247 bytes
-rw-r--r--themes/mantra/resources/images/bullets/square_white.pngbin0 -> 250 bytes
-rw-r--r--themes/mantra/resources/images/bullets/triangle_dark.pngbin0 -> 311 bytes
-rw-r--r--themes/mantra/resources/images/bullets/triangle_gray.pngbin0 -> 346 bytes
-rw-r--r--themes/mantra/resources/images/bullets/triangle_white.pngbin0 -> 271 bytes
-rw-r--r--themes/mantra/resources/images/headers/mantra.pngbin0 -> 19384 bytes
-rw-r--r--themes/mantra/resources/images/headers/mantra_thumbnail.pngbin0 -> 19341 bytes
-rw-r--r--themes/mantra/resources/images/icon-back.pngbin0 -> 242 bytes
-rw-r--r--themes/mantra/resources/images/icon-featured.pngbin0 -> 1395 bytes
-rw-r--r--themes/mantra/resources/images/icon-tooltip.pngbin0 -> 619 bytes
-rw-r--r--themes/mantra/resources/images/nivoslider/arrows.pngbin0 -> 824 bytes
-rw-r--r--themes/mantra/resources/images/nivoslider/bullets.pngbin0 -> 1281 bytes
-rw-r--r--themes/mantra/resources/images/nivoslider/loading.gifbin0 -> 1737 bytes
-rw-r--r--themes/mantra/resources/images/pins/Pin1.pngbin0 -> 1114 bytes
-rw-r--r--themes/mantra/resources/images/pins/Pin2.pngbin0 -> 1323 bytes
-rw-r--r--themes/mantra/resources/images/pins/Pin3.pngbin0 -> 1322 bytes
-rw-r--r--themes/mantra/resources/images/pins/Pin4.pngbin0 -> 1146 bytes
-rw-r--r--themes/mantra/resources/images/pins/Pin5.pngbin0 -> 1156 bytes
-rw-r--r--themes/mantra/resources/images/pins/mantra_dot.pngbin0 -> 181 bytes
-rw-r--r--themes/mantra/resources/images/post-formats/brackets.pngbin0 -> 1315 bytes
-rw-r--r--themes/mantra/resources/images/post-formats/brackets2.pngbin0 -> 4552 bytes
-rw-r--r--themes/mantra/resources/images/post-formats/bubble.pngbin0 -> 932 bytes
-rw-r--r--themes/mantra/resources/images/post-formats/link.pngbin0 -> 1606 bytes
-rw-r--r--themes/mantra/resources/images/post-formats/picture.pngbin0 -> 874 bytes
-rw-r--r--themes/mantra/resources/images/post-formats/quotes.pngbin0 -> 691 bytes
-rw-r--r--themes/mantra/resources/images/slider/mantra-column-1.jpgbin0 -> 26107 bytes
-rw-r--r--themes/mantra/resources/images/slider/mantra-column-2.jpgbin0 -> 34733 bytes
-rw-r--r--themes/mantra/resources/images/slider/mantra-column-3.jpgbin0 -> 25492 bytes
-rw-r--r--themes/mantra/resources/images/slider/mantra-slider-1.jpgbin0 -> 125928 bytes
-rw-r--r--themes/mantra/resources/images/slider/mantra-slider-2.jpgbin0 -> 257554 bytes
-rw-r--r--themes/mantra/resources/images/slider/mantra-slider-3.jpgbin0 -> 81487 bytes
-rw-r--r--themes/mantra/resources/images/socials/AIM.pngbin0 -> 1119 bytes
-rw-r--r--themes/mantra/resources/images/socials/AboutMe.pngbin0 -> 722 bytes
-rw-r--r--themes/mantra/resources/images/socials/Amazon.pngbin0 -> 3866 bytes
-rw-r--r--themes/mantra/resources/images/socials/Contact.pngbin0 -> 840 bytes
-rw-r--r--themes/mantra/resources/images/socials/Delicious.pngbin0 -> 708 bytes
-rw-r--r--themes/mantra/resources/images/socials/DeviantArt.pngbin0 -> 1020 bytes
-rw-r--r--themes/mantra/resources/images/socials/Digg.pngbin0 -> 954 bytes
-rw-r--r--themes/mantra/resources/images/socials/Discord.pngbin0 -> 3418 bytes
-rw-r--r--themes/mantra/resources/images/socials/Dribbble.pngbin0 -> 1385 bytes
-rw-r--r--themes/mantra/resources/images/socials/Etsy.pngbin0 -> 915 bytes
-rw-r--r--themes/mantra/resources/images/socials/Facebook.pngbin0 -> 714 bytes
-rw-r--r--themes/mantra/resources/images/socials/Flickr.pngbin0 -> 770 bytes
-rw-r--r--themes/mantra/resources/images/socials/FriendFeed.pngbin0 -> 1165 bytes
-rw-r--r--themes/mantra/resources/images/socials/Github.pngbin0 -> 1391 bytes
-rw-r--r--themes/mantra/resources/images/socials/GoodReads.pngbin0 -> 977 bytes
-rw-r--r--themes/mantra/resources/images/socials/GooglePlus.pngbin0 -> 1214 bytes
-rw-r--r--themes/mantra/resources/images/socials/IMDb.pngbin0 -> 751 bytes
-rw-r--r--themes/mantra/resources/images/socials/Instagram.pngbin0 -> 1005 bytes
-rw-r--r--themes/mantra/resources/images/socials/LastFM.pngbin0 -> 1092 bytes
-rw-r--r--themes/mantra/resources/images/socials/LinkedIn.pngbin0 -> 843 bytes
-rw-r--r--themes/mantra/resources/images/socials/Mail.pngbin0 -> 840 bytes
-rw-r--r--themes/mantra/resources/images/socials/MindVox.pngbin0 -> 1031 bytes
-rw-r--r--themes/mantra/resources/images/socials/MySpace.pngbin0 -> 1061 bytes
-rw-r--r--themes/mantra/resources/images/socials/Newsvine.pngbin0 -> 1079 bytes
-rw-r--r--themes/mantra/resources/images/socials/Patreon.pngbin0 -> 3394 bytes
-rw-r--r--themes/mantra/resources/images/socials/PayPal.pngbin0 -> 3417 bytes
-rw-r--r--themes/mantra/resources/images/socials/Phone.pngbin0 -> 889 bytes
-rw-r--r--themes/mantra/resources/images/socials/Picasa.pngbin0 -> 1285 bytes
-rw-r--r--themes/mantra/resources/images/socials/Pinterest.pngbin0 -> 1090 bytes
-rw-r--r--themes/mantra/resources/images/socials/RSS.pngbin0 -> 1161 bytes
-rw-r--r--themes/mantra/resources/images/socials/Reddit.pngbin0 -> 1281 bytes
-rw-r--r--themes/mantra/resources/images/socials/ShareThis.pngbin0 -> 1025 bytes
-rw-r--r--themes/mantra/resources/images/socials/Skype.pngbin0 -> 1169 bytes
-rw-r--r--themes/mantra/resources/images/socials/SoundCloud.pngbin0 -> 724 bytes
-rw-r--r--themes/mantra/resources/images/socials/Steam-old.pngbin0 -> 3404 bytes
-rw-r--r--themes/mantra/resources/images/socials/Steam-round.pngbin0 -> 3877 bytes
-rw-r--r--themes/mantra/resources/images/socials/Steam.pngbin0 -> 3877 bytes
-rw-r--r--themes/mantra/resources/images/socials/StumbleUpon.pngbin0 -> 1287 bytes
-rw-r--r--themes/mantra/resources/images/socials/Technorati.pngbin0 -> 1100 bytes
-rw-r--r--themes/mantra/resources/images/socials/TripAdvisor.pngbin0 -> 1260 bytes
-rw-r--r--themes/mantra/resources/images/socials/Tumblr.pngbin0 -> 875 bytes
-rw-r--r--themes/mantra/resources/images/socials/Twitch.pngbin0 -> 3547 bytes
-rw-r--r--themes/mantra/resources/images/socials/Twitter-old.pngbin0 -> 863 bytes
-rw-r--r--themes/mantra/resources/images/socials/Twitter.pngbin0 -> 3360 bytes
-rw-r--r--themes/mantra/resources/images/socials/VK.pngbin0 -> 1109 bytes
-rw-r--r--themes/mantra/resources/images/socials/Vimeo.pngbin0 -> 1025 bytes
-rw-r--r--themes/mantra/resources/images/socials/WordPress.pngbin0 -> 1338 bytes
-rw-r--r--themes/mantra/resources/images/socials/Xing.pngbin0 -> 983 bytes
-rw-r--r--themes/mantra/resources/images/socials/Yahoo.pngbin0 -> 842 bytes
-rw-r--r--themes/mantra/resources/images/socials/Yelp.pngbin0 -> 3904 bytes
-rw-r--r--themes/mantra/resources/images/socials/YouTube-old.pngbin0 -> 1151 bytes
-rw-r--r--themes/mantra/resources/images/socials/YouTube.pngbin0 -> 3162 bytes
-rw-r--r--themes/mantra/resources/js/PIE/PIE.htc96
-rw-r--r--themes/mantra/resources/js/PIE/PIE.js88
-rw-r--r--themes/mantra/resources/js/PIE/PIE.php19
-rw-r--r--themes/mantra/resources/js/PIE/PIE_uncompressed.htc4505
-rw-r--r--themes/mantra/resources/js/PIE/PIE_uncompressed.js4474
-rw-r--r--themes/mantra/resources/js/frontend.js190
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.pngbin0 -> 260 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.pngbin0 -> 251 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.pngbin0 -> 178 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.pngbin0 -> 104 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.pngbin0 -> 125 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.pngbin0 -> 105 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.pngbin0 -> 3762 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.pngbin0 -> 90 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.pngbin0 -> 129 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_222222_256x240.pngbin0 -> 4369 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_228ef1_256x240.pngbin0 -> 4369 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_ef8c08_256x240.pngbin0 -> 4369 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_ffd27a_256x240.pngbin0 -> 4369 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_ffffff_256x240.pngbin0 -> 4369 bytes
-rw-r--r--themes/mantra/resources/js/jqueryui/css/ui-lightness/jquery-ui-1.8.16.custom.css568
-rw-r--r--themes/mantra/resources/js/nivo-slider.js10
121 files changed, 11271 insertions, 0 deletions
diff --git a/themes/mantra/resources/css/editor-style-rtl.css b/themes/mantra/resources/css/editor-style-rtl.css
new file mode 100644
index 00000000..e44679af
--- /dev/null
+++ b/themes/mantra/resources/css/editor-style-rtl.css
@@ -0,0 +1,56 @@
+/*
+Theme Name: Mantra
+*/
+/*
+Used to style the TinyMCE editor.
+*/
+html .mceContentBody{
+ direction:rtl;
+ unicode-bidi:embed;
+ float:right;
+}
+* {
+ font-family: Arial, Tahoma, sans-serif;
+}
+/* Text elements */
+ul {
+ margin: 0 -18px 18px 0;
+}
+ol {
+ margin: 0 -18px 18px 0;
+}
+dd {
+ margin-right: 0;
+}
+blockquote {
+ font-style: normal;
+}
+table {
+ text-align: right;
+ margin: 0 0 24px -1px;
+}
+html .mceContentBody{
+ direction:rtl;
+ unicode-bidi:embed;
+ float:right;
+}
+* {
+ font-family: Arial, Tahoma, sans-serif;
+}
+/* Text elements */
+ul {
+ margin: 0 -18px 18px 0;
+}
+ol {
+ margin: 0 -18px 18px 0;
+}
+dd {
+ margin-right: 0;
+}
+blockquote {
+ font-style: normal;
+}
+table {
+ text-align: right;
+ margin: 0 0 24px -1px;
+} \ No newline at end of file
diff --git a/themes/mantra/resources/css/editor-style.css b/themes/mantra/resources/css/editor-style.css
new file mode 100644
index 00000000..9eefb8bc
--- /dev/null
+++ b/themes/mantra/resources/css/editor-style.css
@@ -0,0 +1,287 @@
+/*
+Theme Name: Mantra
+*/
+/*
+Used to style the TinyMCE editor.
+*/
+
+* {
+ font-family: Georgia, "Bitstream Charter", serif;
+ color: #444;
+ line-height: 1.5;
+}
+p,
+dl,
+td,
+th,
+ul,
+ol,
+blockquote {
+ font-size: 16px;
+}
+tr th,
+thead th,
+label,
+tr th,
+thead th {
+ font-family: "Helvetica Neue", Arial, Helvetica, "Nimbus Sans L", sans-serif;
+}
+pre {
+ font-family: "Courier 10 Pitch", Courier, monospace;
+}
+code, code var {
+ font-family: Monaco, Consolas, "Andale Mono", "DejaVu Sans Mono", monospace;
+}
+body, input, textarea {
+ font-size: 12px;
+ line-height: 18px;
+}
+hr {
+ background-color: #e7e7e7;
+ border:0;
+ height: 1px;
+ margin-bottom: 18px;
+ clear:both;
+}
+/* Text elements */
+p {
+ margin-bottom: 18px;
+}
+ul {
+ list-style: square;
+ margin: 0 0 18px 1.5em;
+}
+ol {
+ list-style: decimal;
+ margin: 0 0 18px 1.5em;
+}
+ol ol {
+ list-style:upper-alpha;
+}
+ol ol ol {
+ list-style:lower-roman;
+}
+ol ol ol ol {
+ list-style:lower-alpha;
+}
+ul ul,
+ol ol,
+ul ol,
+ol ul {
+ margin-bottom:0;
+}
+dl {
+ margin:0 0 24px 0;
+}
+dt {
+ font-weight: bold;
+}
+dd {
+ margin-bottom: 18px;
+}
+strong {
+ font-weight: bold;
+ color: #000;
+}
+cite,
+em,
+i {
+ font-style: italic;
+ border: none;
+}
+big {
+ font-size: 131.25%;
+}
+ins {
+ background: #ffffcc;
+ border: none;
+ color: #333;
+}
+del {
+ text-decoration: line-through;
+ color: #555;
+}
+blockquote {
+ font-style: italic;
+ padding: 0 3em;
+}
+blockquote cite,
+blockquote em,
+blockquote i {
+ font-style: normal;
+}
+pre {
+ background: #f7f7f7;
+ color: #222;
+ line-height: 18px;
+ margin-bottom: 18px;
+ padding: 1.5em;
+}
+abbr,
+acronym {
+ border-bottom: 1px dotted #666;
+ cursor: help;
+}
+ins {
+ text-decoration: none;
+}
+sup,
+sub {
+ height: 0;
+ line-height: 1;
+ vertical-align: baseline;
+ position: relative;
+ font-size: 10px;
+}
+sup {
+ bottom: 1ex;
+}
+sub {
+ top: .5ex;
+}
+a:link {
+ color:#0066cc;
+}
+a:visited {
+ color:#743399;
+}
+a:active,
+a:hover {
+ color: #ff4b33;
+}
+p,
+ul,
+ol,
+dd,
+pre,
+hr {
+ margin-bottom:24px;
+}
+ul ul,
+ol ol,
+ul ol,
+ol ul {
+ margin-bottom:0;
+}
+pre,
+kbd,
+tt,
+var {
+ font-size: 15px;
+ line-height: 21px;
+}
+code {
+ font-size: 13px;
+}
+strong,
+b,
+dt,
+th {
+ color: #000;
+}
+h1,
+h2,
+h3,
+h4,
+h5,
+h6 {
+ color: #000;
+ margin: 0 0 20px 0;
+ line-height: 1.5em;
+ font-weight: normal;
+}
+h1 {
+ font-size: 2.4em;
+}
+h2 {
+ font-size: 1.8em;
+}
+h3 {
+ font-size: 1.4em;
+}
+h4 {
+ font-size: 1.2em;
+}
+h5 {
+ font-size: 1em;
+}
+h6 {
+ font-size: 0.9em;
+}
+table {
+ border: 1px solid #e7e7e7 !important;
+ text-align: left;
+ margin: 0 -1px 24px 0;
+ width: 100%;
+ border-collapse: collapse;
+ border-spacing: 0;
+}
+tr th,
+thead th {
+ border: none !important;
+ color: #888;
+ font-size: 12px;
+ font-weight: bold;
+ line-height: 18px;
+ padding: 9px 24px;
+}
+tr td {
+ border: none !important;
+ border-top: 1px solid #e7e7e7 !important;
+ padding: 6px 24px;
+}
+
+
+img {
+ margin: 0;
+ height:auto;
+}
+.alignleft,
+img.alignleft {
+ display: inline;
+ float: left;
+ margin-right: 24px;
+ margin-top: 4px;
+}
+.alignright,
+img.alignright {
+ display: inline;
+ float: right;
+ margin-left: 24px;
+ margin-top: 4px;
+}
+.aligncenter,
+img.aligncenter {
+ clear: both;
+ display: block;
+ margin-left: auto;
+ margin-right: auto;
+}
+img.alignleft,
+img.alignright,
+img.aligncenter {
+ margin-bottom: 12px;
+}
+.wp-caption {
+ border: none;
+ background: #f1f1f1;
+ color: #888;
+ font-size: 12px;
+ line-height: 18px;
+ text-align: center;
+ margin-bottom: 20px;
+ padding: 4px;
+ -moz-border-radius: 0;
+ -khtml-border-radius: 0;
+ -webkit-border-radius: 0;
+ border-radius: 0;
+}
+.wp-caption img {
+ margin: 5px;
+}
+.wp-caption p.wp-caption-text {
+ margin: 0 0 4px;
+}
+.wp-smiley {
+ margin:0;
+} \ No newline at end of file
diff --git a/themes/mantra/resources/css/rtl.css b/themes/mantra/resources/css/rtl.css
new file mode 100644
index 00000000..83f7bd6d
--- /dev/null
+++ b/themes/mantra/resources/css/rtl.css
@@ -0,0 +1,528 @@
+/*
+ * Right To Left Styling
+*/
+
+body {
+ direction:rtl;
+ unicode-bidi:embed;
+}
+
+/* =Fonts
+-------------------------------------------------------------- */
+
+.entry-content code {
+ border-left: none;
+ border-right: 3px solid #EEEEEE;
+
+}
+
+/* =Structure
+-------------------------------------------------------------- */
+
+#branding {
+ float: right;
+}
+
+.footerfour .widget-area {
+ float: right;
+ margin-right: 0;
+ margin-left: 6%;
+}
+
+.footerthree .widget-area {
+ float: right;
+ margin-right: 0;
+ margin-left: 8%;
+}
+
+.footertwo .widget-area {
+ float: right;
+ margin-right: 0;
+ margin-left: 5%;
+}
+
+.footerone .widget-area {
+ float: right;
+}
+
+#footer-widget-area .widget-area:last-child {
+ margin-left: 0;
+}
+
+#site-generator {
+ float: left;
+}
+
+.entry-content ul, .entry-summary ul {
+ margin-left: 0;
+ margin-right: 1.5em;
+}
+
+.entry-content ul > li {
+ padding-left: 0;
+ padding-right: 20px;
+}
+
+.entry-content li li {
+ margin-left: 0;
+ margin-right: 15px;
+}
+
+ol {
+ margin-left: 0;
+ margin-right: 1.5em;
+}
+
+input[type="text"],
+input[type="password"],
+input[type="email"],
+textarea {
+ padding-right: .5em;
+}
+
+/* Text meant only for screen readers */
+.screen-reader-text {
+ position: absolute;
+ left: auto;
+ right: -9000px;
+}
+
+
+/* =Header
+-------------------------------------------------------------- */
+
+#site-description {
+ float: right;
+}
+
+#header-container > div {
+ margin-left: 0;
+ margin-right: 40px;
+}
+
+/* =Menu -PRIMARY
+-------------------------------------------------------------- */
+
+#access {
+ float: right;
+}
+
+#access ul li {
+ float: right;
+}
+
+#access ul ul {
+ margin-right: 0;
+}
+
+#access ul ul li { /* level 2 */
+ float: right;
+}
+
+#access ul ul ul {
+ left: auto;
+ right: 100%;
+}
+
+/* =Menu -SECONDARY
+-------------------------------------------------------------- */
+
+.topmenu ul {
+ float: left;
+}
+
+.topmenu ul li {
+ float: right;
+}
+
+.footermenu ul li{
+ float: right;
+}
+
+
+/* =Content
+-------------------------------------------------------------- */
+
+.entry-content table {
+ text-align: right;
+}
+
+.entry-meta .comments-link {
+ float: left;
+}
+
+.entry-content blockquote.left {
+ float: right;
+ margin-left: 24px;
+ margin-right: 0;
+ text-align: left;
+}
+.entry-content blockquote.right {
+ float: left;
+ margin-right: 24px;
+ margin-left: 0;
+ text-align: right;
+}
+
+.tag-links {
+ margin-left: 0;
+ margin-right: 30px;
+}
+
+.page-link {
+ margin: 20px 0 20px 10px;
+}
+
+#entry-author-info #author-avatar,
+#author-info #author-avatar {
+ float: right;
+ margin: 0 0 0 -104px;
+
+}
+
+#entry-author-info #author-description,
+#author-info #author-description {
+ float: right;
+ margin: 0 104px 0 0;
+}
+
+article.format-link header,
+article.format-quote header,
+article.format-image header,
+article.format-chat header,
+article.format-aside header {
+ padding-left: 0;
+ padding-right: 60px;
+}
+
+
+/**
+ * 5.4 Galleries
+ * ----------------------------------------------------------------------------
+ */
+
+.gallery-item {
+ float: right;
+ margin: 0 0 4px 4px;
+}
+
+.gallery-columns-1 .gallery-item:nth-of-type(1n),
+.gallery-columns-2 .gallery-item:nth-of-type(2n),
+.gallery-columns-3 .gallery-item:nth-of-type(3n),
+.gallery-columns-4 .gallery-item:nth-of-type(4n),
+.gallery-columns-5 .gallery-item:nth-of-type(5n),
+.gallery-columns-6 .gallery-item:nth-of-type(6n),
+.gallery-columns-7 .gallery-item:nth-of-type(7n),
+.gallery-columns-8 .gallery-item:nth-of-type(8n),
+.gallery-columns-9 .gallery-item:nth-of-type(9n) {
+ margin-left: 0;
+}
+
+.gallery-caption {
+ left: auto;
+ right: 0;
+}
+
+/* =Status
+-------------------------------------------------------------- */
+
+#content .format-status .entry-meta2 {
+ float: right;
+ clear: left;
+ padding-right: 0;
+}
+
+.status_content {
+ float: right;
+}
+
+#content .format-status h3.entry-format {
+ margin-right: 0;
+ padding-right: 0;
+}
+
+.format-status .avatar {
+ float: right;
+ margin-left: 10px;
+ margin-right: 0;
+}
+
+#content .alignleft,
+#content img.alignleft {
+ float: right;
+ margin-left: 24px;
+ margin-right: 0;
+}
+
+#content .alignright,
+#content img.alignright {
+ float: left;
+ margin-left: 0;
+ margin-right: 24px;
+}
+
+
+/* =Navigation
+-------------------------------------------------------------- */
+
+.nav-previous {
+ float: right;
+}
+
+.nav-next {
+ float: left;
+ text-align: left;
+}
+
+
+/* =Comments
+-------------------------------------------------------------- */
+
+.commentlist img.avatar {
+ left: auto;
+ right: 0;
+}
+
+.comment-author {
+ float: right;
+}
+
+.comment-meta {
+ float: right;
+ margin-left: 0;
+ margin-right: 10px;
+}
+
+.commentlist .children {
+ margin: 0 -40px 0 0;
+}
+
+.children #respond {
+ margin: 0 0 0 48px;
+ min-width: 400px;
+}
+
+#commentform {
+ float: right;
+}
+
+.comment-form-comment textarea {
+ float: left;
+ margin-left: 0;
+ margin-right: 12px;
+}
+
+.comment-form-author label,
+.comment-form-email label,
+.comment-form-email label,
+.comment-form-url label,
+.comment-form-comment label {
+ float: left;
+}
+
+.comment-form-author input,
+.comment-form-email input,
+.comment-form-email input,
+.comment-form-url input,
+.comment-form-comment input {
+ float: left;
+}
+
+#respond .form-allowed-tags {
+ margin-left: 0;
+ margin-right: 12px;
+}
+
+#respond .form-submit {
+ text-align: left;
+}
+
+
+/* =Widget Areas
+-------------------------------------------------------------- */
+
+.widget-area ul {
+ margin-right: 0;
+}
+
+.widget-area ul ul {
+ margin-right: 0;
+}
+
+.widget-area ul li {
+ margin-right: 0;
+}
+
+.contentsearch .s {
+ float: right;
+ padding-left: 0;
+ padding-right: 1em;
+}
+
+.contentsearch .searchsubmit {
+ left: auto;
+ right: -40px;
+ float: right;
+}
+#main #searchform,
+#footer #searchform {
+ margin-right: 0;
+ margin-left: 10px;
+}
+
+.widget_search .s,
+#search .s {/* This keeps the search inputs in line This is the Sidebar Search*/
+ right: auto;
+ left: 0;
+ padding-left: 0;
+ padding-right: 1em;
+}
+
+.widget_search .searchsubmit {
+ right: auto;
+ left: 0;
+ border-radius: 100px 0 0 100px;
+}
+
+#footer-widget-area ul ul li {
+ padding-right: 0;
+ margin-right: 0;
+}
+
+#calendar_wrap {
+ margin-left: 0;
+ margin-right: 10px;
+}
+
+#wp-calendar caption {
+ text-align: right;
+ margin-left: 0;
+ margin-right: 10px;
+}
+
+/* Main sidebars */
+#main .widget-area ul {
+ margin-right: 0;
+}
+
+#main .widget-area ul ul {
+ margin-right: 0;
+}
+
+.widget-area ul ul li {
+ padding-left: 0;
+ padding-right: 15px;
+ background-position: right calc(2em / 2 - 4px);
+}
+
+/* =Footer
+-------------------------------------------------------------- */
+
+/* SOCIALS */
+.socials {
+ float: left;
+}
+
+.socials a {
+ float: right;
+ margin-right: 0;
+ margin-left: 5px;
+}
+
+#header-container > div#sheader {
+ right: auto;
+ left: 10px;
+}
+
+#sfooter {
+ float: left;
+}
+
+#sfooter a {
+ margin-left: 0;
+ margin-right: 5px;
+}
+
+/* ARTICLES */
+#toTop {
+ right: auto;
+ left: 20px;
+}
+
+/* EDIT POST LINK */
+.edit-link {
+ float: left;
+}
+
+.pagination span,
+.pagination a {
+ float: right;
+ margin-right: 0;
+ margin-left: 10px;
+}
+
+/* PRESENTATION PAGE */
+
+#front-columns > div {
+ float: right;
+}
+
+#front-columns.front-columns-4 > div {
+ margin-right: 0;
+ margin-left: 4%;
+}
+
+#front-columns.front-columns-3 > div {
+ margin-right: 0;
+ margin-left: 5.5%;
+}
+
+#front-columns.front-columns-2 > div {
+ margin-right: 0;
+ margin-left: 5%;
+}
+
+#front-columns.front-columns-4 > div:last-child,
+#front-columns.front-columns-3 > div:last-child,
+#front-columns.front-columns-2 > div:last-child {
+ margin-left: 0;
+}
+
+/* Front page columns */
+.nivoSlider img {
+ left: auto;
+ right: 0;
+}
+
+/* If an image is wrapped in a link */
+.nivoSlider a.nivo-imageLink {
+ left: auto;
+ right: 0;
+}
+
+.nivo-prevNav {
+ left: auto;
+ right: 0;
+}
+
+.nivo-nextNav {
+ right: auto;
+ left: 0;
+}
+
+.theme-default .nivoSlider img {
+ left: auto;
+ right: 0;
+}
+
+.theme-default a.nivo-nextNav {
+ right: auto;
+ left: 30px;
+}
+
+.theme-default a.nivo-prevNav {
+ left: auto;
+ right: 30px;
+}
+
+/* FIN! */
diff --git a/themes/mantra/resources/css/style-mobile.css b/themes/mantra/resources/css/style-mobile.css
new file mode 100644
index 00000000..44d09164
--- /dev/null
+++ b/themes/mantra/resources/css/style-mobile.css
@@ -0,0 +1,339 @@
+/* =Responsive Structure
+----------------------------------------------- */
+
+@media (max-width: 960px) {
+
+ #content,
+ #frontpage,
+ #frontpage + #container > #content,
+ #footer-widget-area {
+ padding: 2em;
+ }
+
+
+ #primary,
+ #secondary {
+ padding-top: 2em;
+ }
+
+}
+
+@media (max-width: 800px) {
+
+ body {
+ font-size: .95em;
+ }
+
+ #content,
+ #frontpage,
+ #frontpage + #container > #content,
+ #footer-widget-area {
+ max-width: 100%;
+ padding: 1.5em;
+ }
+
+ #content {
+ margin: 0;
+ }
+
+ #primary,
+ #secondary {
+ padding-left: 1.5em;
+ padding-right: 1.5em;
+ }
+
+ .widget-title {
+ border-radius: 15px 15px 0 0;
+ }
+
+ #access,
+ #branding {
+ width: 100%;
+ }
+
+ #linky {
+ width: auto;
+ }
+
+ #branding {
+ height: auto;
+ min-height: 90px;
+ }
+
+ #bg_image {
+ min-height: 90px;
+ width: 100%;
+ }
+
+ #header-container > div {
+ margin-top: 7px;
+ margin-left: 14px;
+ height: 100%;
+ }
+
+ a#logo {
+ height: 100%;
+ display: block !important;
+ }
+
+ a#logo img {
+ height: 80%;
+ width: auto;
+ max-width: 90%;
+ }
+
+ .safari a#logo img {
+ max-height: 80px;
+ height: auto;
+ }
+
+ .socials a {
+ margin: 0;
+ padding-left: 5px;
+ display: block;
+ }
+
+ .socials a img {
+ width: 24px;
+ }
+
+ #smenur,
+ #smenul {
+ display: none;
+ }
+
+ #access .menu-header,
+ div.menu {
+ margin: 0;
+ }
+
+ #primary,
+ #secondary {
+ width: 100%;
+ height: auto;
+ }
+
+ #slider,
+ #slider img {
+ width: 100%;
+ }
+
+ #site-title {
+ margin-top: 20px;
+ font-size: 28px;
+ line-height: 35px;
+ padding-left: 15px;
+ }
+
+ #site-description {
+ margin-top: 5px;
+ font-size: 13px;
+ line-height: 18px;
+ padding-left: 15px;
+ }
+
+ #site-copyright {
+ max-width: 90%
+ }
+
+ .entry-meta .bl_sep {
+ margin: 0;
+ }
+
+ .nivo-caption {
+ left: 0;
+ right: 0;
+ bottom: 0;
+ padding: 20px;
+ line-height: 1.4;
+ }
+
+ #nav-toggle {
+ display: block;
+ float: left;
+ margin: 20px auto 0;
+ cursor:pointer;
+ width: 100%;
+ padding: 5px 4%;
+ letter-spacing: 2px;
+ text-transform: uppercase;
+ }
+
+ #nav-toggle span:before {
+ content: "\e820";
+ font-family: "elusive";
+ font-size: 16px;
+ height: 40px;
+ line-height: 40px;
+ }
+
+ #access {
+ display: none;
+ margin-top: 0;
+ margin-bottom: 20px;
+ padding-bottom: 5px;
+ font-size: 15px;
+ }
+
+ #access .menu ul,
+ #access .menu ul li {
+ width: 100%;
+ margin: 0;
+ box-shadow: none;
+ }
+
+ #access .menu ul li {
+ border-radius: 0;
+ padding-top: 5px;
+ box-shadow: none !important;
+ }
+
+ #access > .menu > ul > li {
+ border-top: 1px solid rgba(0,0,0,.07);
+ }
+
+ #access > .menu li ul {
+ position: inherit;
+ margin-top: 0;
+ }
+
+ #access > .menu ul ul {
+ width: 95%;
+ left: 5%;
+ }
+
+ #access > .menu > ul > li > a > span {
+ border-width: 0 0 1px 0;
+ border-style: solid;
+ border-color: rgba(128,128,128,0.3);
+ }
+
+ .mantra-menu-center #access > .menu > ul > li > a > span {
+ text-align: left;
+ }
+
+ #access > .menu ul li > a:not(:only-child) > span:after {
+ font-family:"Elusive";
+ content: '\e80a';
+ position: absolute;
+ right: 5px;
+ top: 10px;
+ z-index: 251;
+ -webkit-transition:all .2s ease-in-out;
+ transition:all .2s ease-in-out;
+ }
+
+ #access > .menu ul li:hover > a:not(:only-child) > span:after {
+ top: 20px;
+ opacity: 0;
+ }
+
+ #access > .menu > ul ul > li a:not(:only-child) > span:after {
+ -webkit-transform: rotate(0);
+ -ms-transform: rotate(0);
+ transform: rotate(0);
+ }
+
+ #access > .menu ul li > a:not(:only-child) > span {
+ padding-right: 18px;
+ }
+
+}
+
+@media (max-width: 640px) {
+
+ #front-text1 h1,
+ #front-text2 h1 {
+ font-size: 2em;
+ line-height: 2em;
+ }
+
+ .entry-meta {
+ display: table;
+ width: 100%;
+ padding: 0;
+ }
+
+ .short-columns {
+ width: 100%;
+ }
+
+ #footer-widget-area .widget-area {
+ width: 100%;
+ float: none;
+ }
+
+ #front-columns > div[id^=column],
+ #front-columns > div[id^=column]:last-child {
+ float: none;
+ width: 100%;
+ margin: 0 auto 48px;
+ max-width: 400px;
+ text-align: center;
+ }
+
+ #front-columns .column-image {
+ max-height: none;
+ margin: 0 auto;
+ }
+
+ #front-columns .column-text {
+ text-align: center;
+ }
+
+ .nivo-caption {
+ padding: 10px;
+ font-size: 0.9em;
+ }
+
+ .nivo-directionNav {
+ display: none;
+ }
+
+}
+
+@media (max-width: 480px) {
+
+ body {
+ font-size: .9em;
+ }
+
+ #branding {
+ border-top: none;
+ }
+
+ #site-title {
+ font-size: 26px;
+ line-height: 30px;
+ padding-left: 5px;
+ }
+
+ #site-description {
+ font-size: 13px;
+ line-height: 18px;
+ padding-left: 5px;
+ letter-spacing: 1px;
+ }
+
+ .post-thumbnail-link,
+ .post-thumbnail {
+ display: table;
+ margin: 0.5em auto;
+ overflow: hidden;
+ text-align: center;
+ }
+
+ .nivo-caption .nivo-description {
+ display: none;
+ }
+
+
+ .nivo-caption h3 {
+ margin-bottom: 0;
+ }
+
+ #toTop {
+ opacity: 0;
+ }
+
+}
diff --git a/themes/mantra/resources/fonts/elusive.eot b/themes/mantra/resources/fonts/elusive.eot
new file mode 100644
index 00000000..97768a70
--- /dev/null
+++ b/themes/mantra/resources/fonts/elusive.eot
Binary files differ
diff --git a/themes/mantra/resources/fonts/elusive.svg b/themes/mantra/resources/fonts/elusive.svg
new file mode 100644
index 00000000..725733ff
--- /dev/null
+++ b/themes/mantra/resources/fonts/elusive.svg
@@ -0,0 +1,111 @@
+<?xml version="1.0" standalone="no"?>
+<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd">
+<svg xmlns="http://www.w3.org/2000/svg">
+<metadata>Copyright (C) 2014 by original authors @ fontello.com</metadata>
+<defs>
+<font id="elusive" horiz-adv-x="1000" >
+<font-face font-family="elusive" font-weight="400" font-stretch="normal" units-per-em="1000" ascent="850" descent="-150" />
+<missing-glyph horiz-adv-x="1000" />
+<glyph glyph-name="comment" unicode="&#xe800;" d="m0 96l0 713 1000 0 0-713-473 0-320-205 0 205-207 0z" horiz-adv-x="1000" />
+<glyph glyph-name="user" unicode="&#xe801;" d="m0-150l0 156q0 24 58 58t159 71q99 35 137 73t37 101q0 29-27 72t-32 59q-12 35-29 135-10 52-14 93-2 22 6 50t28 60 67 51 110 21 110-21 67-51 28-60 6-50q-4-41-14-93-17-100-29-135-6-16-32-59t-27-72q0-64 37-101t137-73q217-80 217-129l0-156-1000 0z" horiz-adv-x="1000" />
+<glyph glyph-name="tag" unicode="&#xe802;" d="m0 483l0 287q2 31 24 54t52 22l287 0q88-6 133-55l426-472q19-28 19-58t-19-52l-334-334q-25-21-57-21t-52 21l-424 475q-55 64-55 133z m125 164q2-31 23-52t51-20q32 0 52 22t21 50q0 33-23 54t-50 20q-33-2-53-23t-21-51z" horiz-adv-x="941" />
+<glyph glyph-name="down-dir" unicode="&#xe803;" d="m571 457q0-14-10-25l-250-250q-11-11-25-11t-25 11l-250 250q-11 11-11 25t11 25 25 11h500q14 0 25-11t10-25z" horiz-adv-x="571.4" />
+<glyph glyph-name="edit" unicode="&#xe804;" d="m0-143l68 343 274-273z m137 392l422 422 259-260-421-422z m531 494q2 39 31 69t69 31 66-26l131-130q25-26 24-66t-30-69-69-30-66 24l-131 131q-27 27-25 66z" horiz-adv-x="989" />
+<glyph glyph-name="category" unicode="&#xe805;" d="m0-150l0 438 438 0 0-438-438 0z m0 563l0 437 438 0 0-437-438 0z m563-563l0 438 437 0 0-438-437 0z m0 563l0 437 437 0 0-437-437 0z" horiz-adv-x="1000" />
+<glyph glyph-name="right-dir" unicode="&#xe806;" d="m321 350q0-14-10-25l-250-250q-11-11-25-11t-25 11-11 25v500q0 15 11 25t25 11 25-11l250-250q10-10 10-25z" horiz-adv-x="357.1" />
+<glyph glyph-name="angle-left" unicode="&#xe807;" d="m350 546q0-7-6-12l-219-220 219-219q6-6 6-13t-6-13l-28-28q-5-5-12-5t-13 5l-260 260q-6 6-6 13t6 13l260 260q5 6 13 6t12-6l28-28q6-5 6-13z" horiz-adv-x="357.1" />
+<glyph glyph-name="angle-right" unicode="&#xe808;" d="m332 314q0-7-6-13l-260-260q-5-5-12-5t-13 5l-28 28q-6 6-6 13t6 13l219 219-219 220q-6 5-6 12t6 13l28 28q5 6 13 6t12-6l260-260q6-5 6-13z" horiz-adv-x="357.1" />
+<glyph glyph-name="angle-up" unicode="&#xe809;" d="m600 189q0-7-6-13l-28-27q-5-6-12-6t-13 6l-220 219-219-219q-5-6-13-6t-13 6l-27 27q-6 6-6 13t6 13l260 260q5 6 12 6t13-6l260-260q6-5 6-13z" horiz-adv-x="642.9" />
+<glyph glyph-name="angle-down" unicode="&#xe80a;" d="m600 439q0-7-6-13l-260-260q-5-5-13-5t-12 5l-260 260q-6 6-6 13t6 13l27 28q6 6 13 6t13-6l219-219 220 219q5 6 13 6t12-6l28-28q6-5 6-13z" horiz-adv-x="642.9" />
+<glyph glyph-name="minus" unicode="&#xe80b;" d="m0 209l0 282 1000 0 0-282-1000 0z" horiz-adv-x="1000" />
+<glyph glyph-name="left-open" unicode="&#xe80c;" d="m0 350l148 149 352 351 148-148-351-352 351-352-148-148-352 352z" horiz-adv-x="648" />
+<glyph glyph-name="time" unicode="&#xe80d;" d="m0 349q0 188 134 322t322 134 321-134 133-322-133-321-321-133-322 133-134 321z m119 0q0-140 99-238t238-99 238 99 99 238-99 238-238 99-238-99-99-238z m172-69l0 117 117 0 0 213 117 0 0-330-234 0z" horiz-adv-x="910" />
+<glyph glyph-name="up" unicode="&#xe80e;" d="m0 264l391 586 390-586-211 0 0-414-359 0 0 414-211 0z" horiz-adv-x="781" />
+<glyph glyph-name="quote" unicode="&#xe80f;" d="m0-62l0 437q0 71 15 129t38 97 61 67 72 45 83 28 82 14 81 7l37-176q-49-9-81-20t-66-31-48-53-10-77l131 0 0-467-395 0z m529 0l0 437q0 71 16 129t38 97 61 67 72 45 83 28 81 14 81 7l39-176q-51-9-83-20t-65-31-47-53-12-77l131 0 0-467-395 0z" horiz-adv-x="1000" />
+<glyph glyph-name="bookmark" unicode="&#xe810;" d="m0-56l0 906 609 0 0-1000-304 305-305-305 0 94z" horiz-adv-x="609" />
+<glyph glyph-name="left-dir" unicode="&#xe811;" d="m357 600v-500q0-14-10-25t-26-11-25 11l-250 250q-10 11-10 25t10 25l250 250q11 11 25 11t26-11 10-25z" horiz-adv-x="357.1" />
+<glyph glyph-name="up-open" unicode="&#xe812;" d="m0 174l352 352 148 148 148-148 352-352-148-148-352 351-352-351z" horiz-adv-x="1000" />
+<glyph glyph-name="ok" unicode="&#xe813;" d="m0 260l162 162 166-164 508 510 164-164-510-510-162-162-162 164z" horiz-adv-x="1000" />
+<glyph glyph-name="cancel" unicode="&#xe814;" d="m0 71l279 279-279 279 221 221 279-279 279 279 221-221-279-279 279-279-221-221-279 279-279-279z" horiz-adv-x="1000" />
+<glyph glyph-name="comments" unicode="&#xe815;" d="m0 192l0 607 854 0 0-607-405 0-273-176 0 176-176 0z m348-112l119 77 129 0 9-6 170-112 0 118 149 0 0 433-31 0 0 76 107 0 0-586-148 0 0-179-59 37-221 142-224 0z" horiz-adv-x="1000" />
+<glyph glyph-name="search" unicode="&#xe816;" d="m335 246l25-25q-28-28-85-86t-73-74l-27 27q16 15 74 73t86 85z m245 551q136 0 234-97t97-234-97-234-234-96q-64 0-123 24l-255-257-184 185 256 255q-26 63-26 123 0 137 98 234t234 97z m0-551q91 0 155 64t64 156-64 155-155 64-156-64-64-155 64-156 156-64z" horiz-adv-x="928" />
+<glyph glyph-name="category2" unicode="&#xe817;" d="m0-150l0 250 250 0 0-250-250 0z m0 375l0 250 250 0 0-250-250 0z m0 375l0 250 250 0 0-250-250 0z m391-750l0 250 609 0 0-250-609 0z m0 375l0 250 609 0 0-250-609 0z m0 375l0 250 609 0 0-250-609 0z" horiz-adv-x="1000" />
+<glyph glyph-name="link" unicode="&#xe818;" d="m812 171q0 23-15 38l-116 116q-16 16-38 16-24 0-40-18 1-1 10-10t12-12 9-11 7-14 2-15q0-23-16-38t-38-16q-8 0-15 2t-14 7-11 9-12 12-10 10q-19-17-19-40 0-23 16-38l115-116q15-15 38-15 22 0 38 15l82 81q15 16 15 37z m-392 394q0 22-15 38l-115 115q-16 16-38 16-22 0-38-15l-82-82q-16-15-16-37 0-22 16-38l116-116q15-15 38-15 23 0 40 17-2 2-11 11t-12 12-8 10-7 14-2 16q0 22 15 38t38 15q9 0 16-2t14-7 10-8 12-12 11-11q18 17 18 41z m500-394q0-67-48-113l-82-81q-46-47-113-47-68 0-114 48l-115 115q-46 47-46 114 0 68 49 116l-49 49q-48-49-116-49-67 0-114 47l-116 116q-47 47-47 114t47 113l82 82q47 46 114 46 67 0 114-47l114-116q47-46 47-113 0-69-49-117l49-49q48 49 116 49 67 0 114-47l116-116q47-47 47-114z" horiz-adv-x="928.6" />
+<glyph glyph-name="up-dir" unicode="&#xe819;" d="m571 171q0-14-10-25t-25-10h-500q-15 0-25 10t-11 25 11 26l250 250q10 10 25 10t25-10l250-250q10-11 10-26z" horiz-adv-x="571.4" />
+<glyph glyph-name="info" unicode="&#xe81a;" d="m357 100v-71q0-15-10-25t-26-11h-285q-15 0-25 11t-11 25v71q0 15 11 25t25 11h35v214h-35q-15 0-25 11t-11 25v71q0 15 11 25t25 11h214q15 0 25-11t11-25v-321h35q15 0 26-11t10-25z m-71 643v-107q0-15-11-25t-25-11h-143q-14 0-25 11t-11 25v107q0 14 11 25t25 11h143q15 0 25-11t11-25z" horiz-adv-x="357.1" />
+<glyph glyph-name="share" unicode="&#xe81b;" d="m0-121q0 143 24 256t60 186 95 124 107 76 122 38 114 15 107 2l0 245 371-372-371-371 0 268q-102 0-151-1t-126-10-114-26-86-51-74-83-47-124-31-172z" horiz-adv-x="1000" />
+<glyph glyph-name="folder-close" unicode="&#xe81c;" d="m0-52l0 560 1000 0 0-560-1000 0z m0 594l0 121 139 0 68 90 217 0 68-90 508 0 0-121-1000 0z" horiz-adv-x="1000" />
+<glyph glyph-name="folder-open" unicode="&#xe81d;" d="m0-52l0 55 147 505 853 0-172-560-828 0z m0 205l0 510 139 0 68 90 217 0 68-90 336 0 0-121-724 0z" horiz-adv-x="1000" />
+<glyph glyph-name="right-open" unicode="&#xe81e;" d="m0-2l352 352-352 352 148 148 352-351 148-149-148-148-352-352z" horiz-adv-x="648" />
+<glyph glyph-name="home" unicode="&#xe81f;" d="m786 296v-267q0-15-11-26t-25-10h-214v214h-143v-214h-214q-15 0-25 10t-11 26v267q0 1 0 2t0 2l321 264 321-264q1-1 1-4z m124 39l-34-41q-5-5-12-6h-2q-7 0-12 3l-386 322-386-322q-7-4-13-4-7 2-12 7l-35 41q-4 5-3 13t6 12l401 334q18 15 42 15t43-15l136-114v109q0 8 5 13t13 5h107q8 0 13-5t5-13v-227l122-102q5-5 6-12t-4-13z" horiz-adv-x="928.6" />
+<glyph glyph-name="menu" unicode="&#xe820;" d="m0 850v-200h1000v200h-1000z m0-400v-200h1000v200h-1000z m0-400v-200h1000v200h-1000z" horiz-adv-x="1000" />
+<glyph glyph-name="plus" unicode="&#xe821;" d="m0 209l0 282 359 0 0 359 282 0 0-359 359 0 0-282-359 0 0-359-282 0 0 359-359 0z" horiz-adv-x="1000" />
+<glyph glyph-name="down-open" unicode="&#xe822;" d="m0 526l148 148 352-351 352 351 148-148-352-352-148-148-148 148z" horiz-adv-x="1000" />
+<glyph glyph-name="audio" unicode="&#xe823;" d="m1-16q-8 57 38 103t118 57q64 10 119-17l25 652 690 53q-32-727-34-756-1-51-45-91t-109-50q-72-10-129 22t-64 89 37 105 117 58q68 9 125-22l25 465-539-55-5-131q-6-131-12-277t-8-176l0-6q-6-50-49-89t-107-47q-70-10-127 23t-66 90z" horiz-adv-x="991" />
+<glyph glyph-name="image" unicode="&#xe824;" d="m0-68l0 836 1000 0 0-836-1000 0z m76 78l848 0 0 680-848 0 0-680z m90 80l0 59 150 195 102-86 193 291 223-228 0-231-668 0z m0 416q0 37 24 62t62 24q33 0 58-24t24-62q0-33-24-57t-58-25q-37 0-62 25t-24 57z" horiz-adv-x="1000" />
+<glyph glyph-name="camera" unicode="&#xe825;" d="m0-27l0 627 295 0 31 127 362 0 31-127 281 0 0-627-1000 0z m221 346q0-117 83-199t199-82 198 82 82 199-82 199-198 82-199-82-83-199z m84 0q0 82 57 140t140 59 141-59 58-140-58-140-141-57-140 57-57 140z m527 139l143 0 0 82-143 0 0-82z" horiz-adv-x="1000" />
+<glyph glyph-name="down" unicode="&#xe826;" d="m0 436l211 0 0 414 359 0 0-414 211 0-390-586z" horiz-adv-x="781" />
+<glyph glyph-name="left" unicode="&#xe827;" d="m0 350l586 391 0-211 414 0 0-360-414 0 0-211z" horiz-adv-x="1000" />
+<glyph glyph-name="right" unicode="&#xe828;" d="m0 170l0 360 414 0 0 211 586-391-586-391 0 211-414 0z" horiz-adv-x="1000" />
+<glyph glyph-name="video" unicode="&#xe829;" d="m0-150l0 1000 883 0 0-1000-883 0z m45 119l109 0 0 82-109 0 0-82z m0 184l109 0 0 84-109 0 0-84z m0 185l109 0 0 82-109 0 0-82z m0 186l109 0 0 82-109 0 0-82z m0 183l109 0 0 83-109 0 0-83z m156-826l481 0 0 436-481 0 0-436z m0 467l481 0 0 436-481 0 0-436z m528-379l109 0 0 82-109 0 0-82z m0 184l109 0 0 84-109 0 0-84z m0 185l109 0 0 82-109 0 0-82z m0 186l109 0 0 82-109 0 0-82z m0 183l109 0 0 83-109 0 0-83z" horiz-adv-x="883" />
+<glyph glyph-name="aside" unicode="&#xe82a;" d="m0 344l0 123q2 35 26 60t58 24l270 0q138 8 272 65t229 152q36-2 59-26t23-58l0-199q28-8 45-30t18-50q-2-30-19-51t-44-27l0-201q-1-36-26-59t-56-24q-207 184-449 211-66-33-53-127t77-142q-28-47-96-52t-105 30q-16 45-25 76t-16 71-7 78 10 72l-107 0q-35 2-60 27t-24 57z m438-10q240-44 419-183l0 508q-203-151-419-182l0-143z" horiz-adv-x="1000" />
+<glyph glyph-name="date" unicode="&#xe82b;" d="m0-150l0 649 893 0 0-649-893 0z m0 705l0 221 109 0 0-141 200 0 0 141 275 0 0-141 199 0 0 141 110 0 0-221-893 0z m168 139l0 156 82 0 0-156-82 0z m59-619q0-112 123-112 47 0 84 32 39 31 39 80 0 68-78 90 48 15 64 48 12 28-2 73-27 62-107 62-51 0-86-26t-37-77l72 0q0 45 49 46 43 0 45-52 0-49-84-47l0-57q48 0 68-8 23-11 23-46 0-57-54-61-43 0-47 55l-72 0z m281 146q49 14 88 47l0-297 70 0 0 371-64 0q-38-37-94-58l0-63z m135 473l0 156 82 0 0-156-82 0z" horiz-adv-x="893" />
+<glyph glyph-name="star-empty" unicode="&#xe82c;" d="m0 471l94 0 285-2 96 270 29 90 29-92 88-272 285-6 94-2-76-54-233-166 82-274 28-91-76 56-231 168-232-162-78-53 29 90 90 270-227 174z m189-64l168-129 20-14-8-21-66-203 176 123 17 11 18-13 172-125-61 203-6 21 18 14 174 125-215 4-22 2-8 21-64 201-70-199-8-21-235 0z" horiz-adv-x="1000" />
+<glyph glyph-name="star" unicode="&#xe82d;" d="m0 471l379-2 125 360 117-364 379-8-309-220 110-366-307 225-310-215 119 360z" horiz-adv-x="1000" />
+<glyph glyph-name="mail" unicode="&#xe82e;" d="m0-29l324 342 176-100 176 100 324-342-1000 0z m0 114l0 414 254-147z m0 503l0 141 1000 0 0-141-500-285z m746-236l254 147 0-414z" horiz-adv-x="1000" />
+<glyph glyph-name="home-1" unicode="&#xe82f;" d="m0-150l0 649 453 351 453-351 0-649-312 0 0 391-281 0 0-391-313 0z" horiz-adv-x="906" />
+<glyph glyph-name="attach" unicode="&#xe830;" d="m0 65q8 68 67 127l383 383q117 115 211 33 84-86-36-209l-353-351-66 70 349 349q2 0 8 6l8 8t7 9 6 10 6 9 4 11l0 10t-2 12q-19 17-74-37l-381-381q-37-35-41-69-4-39 35-78 41-33 70-28t71 46q82 80 218 215t194 195q2 2 18 17t17 17 15 16 15 17 12 17 13 19 11 20 10 25q16 57-33 123t-115 75q-68 7-152-73l-418-418-69 67 418 420q98 95 199 100t190-83q105-107 74-236-19-74-94-151-86-83-246-244l-209-209q-70-70-150-72-68 0-125 57-70 70-64 156z" horiz-adv-x="896" />
+<glyph glyph-name="eye" unicode="&#xe831;" d="m0 350q6 49 64 110 79 80 176 129 129 60 260 60 137-2 260-60 103-53 176-129 64-73 64-110-6-49-64-109-79-80-176-129-129-61-260-61-137 2-260 61-103 53-176 129-64 72-64 109z m264 0q0-94 69-159t167-65 167 65 69 159-69 159-167 66-167-66-69-159z m86 1q0 60 44 102t106 42 106-42 44-102-44-102-106-43-106 43-44 102z" horiz-adv-x="1000" />
+<glyph glyph-name="eye-off" unicode="&#xe832;" d="m0 326q6 49 64 110 79 80 176 128 129 61 260 61 29 0 59-2l74 129q10 16 23 18 4 0 8-2l51-32q17-7 2-33l-57-102-47-78-41-72-144-250-41-72-47-80-57-100q-15-25-31-15l-53 31q-15 8 0 33l49 86-8 4q-103 53-176 129-64 72-64 109z m264 0q0-74 47-133l48 84q-9 24-9 49 0 51 34 91t85 50l49 84-18 0q-98 0-167-66t-69-159z m177-295l41 71 18 0q98 0 167 65t69 159q0 74-47 133l63 109q2-2 4-3t4-1q103-52 176-129 64-72 64-109-6-49-64-109-79-80-176-129-129-61-260-61-25 0-59 4z m90 155l110 189q9-25 9-49 0-51-34-90t-85-50z" horiz-adv-x="1000" />
+<glyph glyph-name="tags" unicode="&#xe833;" d="m0 460l0 240q2 27 21 46t43 19l241 0q43 0 88-28l377-414q17-23 17-48t-17-44l-280-277q-21-18-47-18t-43 18l-355 397q-45 54-45 109z m104 138q0-25 17-42 22-20 46-19t42 19q18 19 18 44t-18 43q-20 18-45 17t-43-17q-17-21-17-45z m316 165l92 0q72-4 109-45l356-397q17-21 17-48t-17-44l-280-277q-60-35-95 8l271 271q18 22 18 47t-18 45l-318 356q-24 31-71 56t-64 28z" horiz-adv-x="994" />
+<glyph glyph-name="flag" unicode="&#xe834;" d="m0-79l0 803q68 41 136 51t124-3 112-35 112-43 114-31 124 2 137 59l0-459q-52-53-109-67t-110 1-117 40-124 51-135 35-151-11l0-393-113 0z" horiz-adv-x="859" />
+<glyph glyph-name="warning" unicode="&#xe835;" d="m0-150l500 1000 500-1000-1000 0z m461 180l78 0 0 82-78 0 0-82z m0 342l19-186 40 0 19 186 0 130-78 0 0-130z" horiz-adv-x="1000" />
+<glyph glyph-name="location" unicode="&#xe836;" d="m0 473q0 156 110 267t267 110 267-110 110-267q0-123-53-193l-324-430-324 430q-53 70-53 193z m219 0q0-66 46-112t112-46 112 46 46 112-46 112-112 46-112-46-46-112z" horiz-adv-x="754" />
+<glyph glyph-name="trash" unicode="&#xe837;" d="m0 633l0 141 289 0 0 76 246 0 0-76 289 0 0-141-824 0z m43-783l0 676 738 0 0-676-738 0z" horiz-adv-x="824" />
+<glyph glyph-name="doc" unicode="&#xe838;" d="m0-150l0 674 338 0 0 326 371 0 0-1000-709 0z m0 756l0 62 189 182 65 0 0-244-254 0z" horiz-adv-x="709" />
+<glyph glyph-name="phone" unicode="&#xe839;" d="m0 615q0 50 28 76l138 138q45 37 77-13l113-211q18-39-14-71l-51-52q-5-6-5-14 25-98 132-195l31-30t36-34 34-26 41-25 40-14q20-6 27 2l61 60q39 30 72 12l203-121q22-14 25-37t-13-39l-141-139q-27-27-74-27-140 4-318 121-258 185-375 406-72 151-67 233z" horiz-adv-x="988" />
+<glyph glyph-name="cog" unicode="&#xe83a;" d="m0 272l0 156 150 16q14 45 38 88l-96 117 109 109 117-95q41 23 88 37l16 150 156 0 16-150q45-14 88-37l117 95 109-109-96-117q24-43 38-88l150-16 0-156-150-16q-14-47-38-88l96-117-109-109-117 96q-43-24-88-38l-16-150-156 0-16 150q-47 14-88 38l-117-96-109 109 96 117q-24 41-38 88z m355 78q0-60 42-102t103-42 103 42 42 102-42 103-103 42-103-42-42-103z" horiz-adv-x="1000" />
+<glyph glyph-name="basket" unicode="&#xe83b;" d="m2 791q8 20 27 29t38 4l150-48q32-10 35-43l10-84 686-77q23-5 35-22t10-38l-43-238q-8-43-49-43l-608 0-11-69 578 0q21 0 36-14t15-36q-2-22-17-37t-34-14l-641 0q-25 2-39 19t-12 41l28 149-41 418-119 39q-45 17-34 64z m217-839q0 32 24 56t55 23 56-23 23-56-23-55-56-24-55 24-24 55z m469 0q0 32 23 56t56 23 56-23 23-56-23-55-56-24-56 24-23 55z" horiz-adv-x="993" />
+<glyph glyph-name="basket-circled" unicode="&#xe83c;" d="m0 350q0 207 147 354t353 146 354-146 146-354-146-354-354-146-353 146-147 354z m213 246q6-12 18-15l68-22 25-246-15-88q-2-14 6-23t23-12l377 0q12 0 20 9t9 20-9 21-20 10l-342 0 8 40 357 0q24 0 30 25l25 141q2 11-6 22t-21 13l-403 45-6 48q-2 20-19 28l-90 27q-12 4-23-2-26-15-12-41z m123-471q0-19 14-33t33-13 33 13 14 33-14 34-33 13-33-13-14-34z m275 0q0-19 14-33t33-13 33 13 14 33-14 34-33 13-33-13-14-34z" horiz-adv-x="1000" />
+<glyph glyph-name="wrench" unicode="&#xe83d;" d="m0 21l463 463q-25 68-10 145t72 134 133 72 147-10l-162-162 45-117 115-45 164 164q25-70 9-147t-73-133-132-72-148 8l-463-462z m113-2q0-20 14-34t33-13 33 13 14 34-14 33-33 14-33-14-14-33z" horiz-adv-x="982" />
+<glyph glyph-name="wrench-circled" unicode="&#xe83e;" d="m0 350q0 207 147 354t353 146 354-146 146-354-146-354-354-146-353 146-147 354z m199-201l100-100 283 284q41-16 89-6t82 44 44 81-6 89l-100-99-72 27-27 72 99 100q-25 10-54 10-69 0-115-49-36-33-45-81t5-89z m77-23q-20 21 1 42 20 20 41 0 20-21-1-42t-41 0z" horiz-adv-x="1000" />
+<glyph glyph-name="mic" unicode="&#xe83f;" d="m0 131l0 282 64 0 0-248q120-96 270-96t270 96l0 248 64 0 0-282q-31-27-64-50-82-53-178-71l0 32-184 0 0-32q-95 18-178 71-33 23-64 50z m109 90l0 549q30 25 69 45l0-113 54 0 0 134q38 12 75 14l0-148 54 0 0 148q37-4 77-14l0-134 54 0 0 111q37-18 67-43l0-549q-98-80-225-80t-225 80z m26-303l107 0 0 92q45-8 92-8t92 8l0-92 107 0 0-68-398 0 0 68z" horiz-adv-x="668" />
+<glyph glyph-name="volume" unicode="&#xe840;" d="m0 142l0 416 236 0 354 289 0-994-354 289-236 0z m652 35q73 74 73 176t-73 178l71 74q105-106 107-254 0-145-107-246z m118-119q123 119 123 295t-123 299l76 74q154-154 154-372t-154-372z" horiz-adv-x="1000" />
+<glyph glyph-name="volume-down" unicode="&#xe841;" d="m0 141l0 418 236 0 358 291 0-1000-358 291-236 0z m656 37q74 74 74 174 0 104-74 180l73 74q103-106 107-256 0-144-107-246z" horiz-adv-x="836" />
+<glyph glyph-name="volume-off" unicode="&#xe842;" d="m0 551l305 0 345 282 0-965-345 279-229 0z m713-283q0 4 2 6l76 76-76 76q-2 2-2 6t2 6l53 53q2 2 5 2t6-2l76-76 77 76q4 2 6 2t5-2l55-53q2-2 2-6t-2-6l-76-76 76-76q2-4 2-7t-2-5l-55-55q-2-1-5-1t-6 1l-77 79-76-79q-2-1-5-1t-6 1l-53 55q-2 2-2 6z" horiz-adv-x="1000" />
+<glyph glyph-name="headphones" unicode="&#xe843;" d="m0 69l0 250q0 207 147 353t353 147 354-147 146-353l0-250q-4-41-35-54t-61 5-29 49l0 250q0 156-109 265t-266 110-266-110-109-265l0-250q-4-41-35-54t-61 5-29 49z m188-157l0 313q0 14 8 22t23 9l62 0q14 0 23-9t9-22l0-313q0-13-9-22t-23-9l-62 0q-14 0-23 9t-8 22z m500 0l0 313q0 14 8 22t23 9l62 0q14 0 23-9t9-22l0-313q0-13-9-22t-23-9l-62 0q-14 0-23 9t-8 22z" horiz-adv-x="1000" />
+<glyph glyph-name="lightbulb" unicode="&#xe844;" d="m1 309q-2 12 7 22t22 11l90 16q14 2 26-5t13-20-7-23-24-13l-88-13q-14-2-25 5t-14 20z m2 251q-6 13 0 24t19 16 26-4l82-35q14-6 19-18t0-23-18-16-26 0l-82 39q-14 4-20 17z m160 207q2 13 14 21 10 5 22 2t21-16l49-76q7-12 5-26t-11-19-23-3-20 15l-51 76q-8 13-6 26z m57-241q17 39 49 66t75 41 94 14l4 0q51 0 94-14t75-41 50-66q43-104-15-227-22-43-47-92-14-25-25-73t-16-61q-4-12-16-14l-203 0q-12 2-18 14-29 111-39 134-25 49-47 92-58 131-15 227z m99-623q0 8 5 12t13 5l209 0q6 0 11-5t5-12l0-35q0-8-5-13t-11-5l-209 0q-18 0-18 18l0 35z m0 68l0 35q0 18 18 18l209 0q6 0 11-5t5-13l0-35q0-8-5-13t-11-4l-209 0q-8 0-13 4t-5 13z m94 754l0 90q0 16 8 25t21 10q12 0 21-10t9-25l0-90q0-14-9-23t-21-10q-13 0-21 10t-8 23z m193-53q-1 14 6 26l49 76q10 12 22 16t23-2q10-8 12-21t-6-26l-49-76q-10-12-21-15t-23 3-13 19z m118-339q2 13 12 20t25 5l90-16q13-2 22-12t7-21q-2-14-13-21t-26-4l-90 13q-14 2-22 13t-5 23z m8 187q-4 12 1 23t18 18l84 35q12 8 24 4t19-16 0-24-20-17l-82-39q-13-4-26 0t-18 16z" horiz-adv-x="881" />
+<glyph glyph-name="resize-full" unicode="&#xe845;" d="m0-150l0 441 148-148 202 201 144-144-201-202 148-148-441 0z m506 650l201 202-148 148 441 0 0-441-148 148-202-201z" horiz-adv-x="1000" />
+<glyph glyph-name="resize-full-alt" unicode="&#xe846;" d="m0-150l0 342 119-119 278 277-276 275-121-121 0 346 342 0-119-119 277-277 275 275-121 121 346 0 0-342-119 119-277-277 275-275 121 121 0-346-342 0 119 119-277 278-275-276 121-121-346 0z" horiz-adv-x="1000" />
+<glyph glyph-name="resize-small" unicode="&#xe847;" d="m0-4l201 202-148 146 441 0 0-441-146 148-201-201z m506 360l0 441 146-148 202 201 146-146-201-202 148-146-441 0z" horiz-adv-x="1000" />
+<glyph glyph-name="resize-vertical" unicode="&#xe848;" d="m0 104l170 0 0 492-170 0 254 254 254-254-170 0 0-492 170 0-254-254z" horiz-adv-x="508" />
+<glyph glyph-name="resize-horizontal" unicode="&#xe849;" d="m0 350l254 254 0-170 492 0 0 170 254-254-254-254 0 170-492 0 0-170z" horiz-adv-x="1000" />
+<glyph glyph-name="move" unicode="&#xe84a;" d="m0 350l172 172 0-119 275 0 0 275-119 0 172 172 172-172-119 0 0-275 275 0 0 119 172-172-172-172 0 119-275 0 0-275 119 0-172-172-172 172 119 0 0 275-275 0 0-119z" horiz-adv-x="1000" />
+<glyph glyph-name="zoom-in" unicode="&#xe84b;" d="m0 403q0 185 131 316t316 131 318-131 131-316q0-141-82-256l186-186-111-111-186 186q-115-82-256-82-185 0-316 131t-131 318z m127 0q0-133 94-227t226-93 227 93 94 227-94 225-227 93-226-93-94-225z m129-65l0 127 129 0 0 129 127 0 0-129 129 0 0-127-129 0 0-129-127 0 0 129-129 0z" horiz-adv-x="1000" />
+<glyph glyph-name="zoom-out" unicode="&#xe84c;" d="m0 403q0 185 131 316t316 131 318-131 131-316q0-141-82-256l186-186-111-111-186 186q-115-82-256-82-185 0-316 131t-131 318z m127 0q0-133 94-227t226-93 227 93 94 227-94 225-227 93-226-93-94-225z m129-65l0 127 385 0 0-127-385 0z" horiz-adv-x="1000" />
+<glyph glyph-name="arrows-cw" unicode="&#xe84d;" d="m0-150l0 402 402 0-160-160q108-107 258-107 125 0 222 75t130 192l138 0q-35-173-173-288t-317-114q-207 0-353 146z m10 598q35 174 173 288t317 114q207 0 354-146l146 146 0-402-402 0 160 160q-108 107-258 107-125 0-222-75t-130-192l-138 0z" horiz-adv-x="1000" />
+<glyph glyph-name="desktop" unicode="&#xe84e;" d="m0 104l0 660 1000 0 0-660-363 0 0-96 88 0 0-72-450 0 0 72 88 0 0 96-363 0z m123 125l754 0 0 410-754 0 0-410z" horiz-adv-x="1000" />
+<glyph glyph-name="inbox" unicode="&#xe84f;" d="m0-150l0 483 328 0q0-73 51-123t121-49 121 49 51 123l328 0 0-483-1000 0z m279 768l119 0 0 232 204 0 0-232 119 0-221-332z" horiz-adv-x="1000" />
+<glyph glyph-name="cloud" unicode="&#xe850;" d="m0 241q4 69 33 125t87 85 124 14q53 85 128 114t145 6 126-81 78-137q49 6 89-22t56-68 9-90-47-82l-791 0q-41 67-37 136z" horiz-adv-x="877" />
+<glyph glyph-name="book" unicode="&#xe851;" d="m0 147l0 543q0 31 14 53 29 45 102 77t116 9l471-242 0-590-86-47 0 590-420 224q-29 10-65-9t-58-47l469-270 0-529-86-47z" horiz-adv-x="703" />
+<glyph glyph-name="certificate" unicode="&#xe852;" d="m0 219l94 139-86 146 154 67 6 168 166-28 96 139 125-113 156 64 43-162 166-29-51-160 123-116-129-107 43-164-168-20-52-160-153 75-131-108-88 145-167-20 3 170z" horiz-adv-x="992" />
+<glyph glyph-name="tasks" unicode="&#xe853;" d="m0-41l0 196 1000 0 0-196-1000 0z m0 293l0 196 1000 0 0-196-1000 0z m0 293l0 196 1000 0 0-196-1000 0z m406-244l543 0 0 100-543 0 0-100z m221 293l322 0 0 100-322 0 0-100z m119-586l203 0 0 100-203 0 0-100z" horiz-adv-x="1000" />
+<glyph glyph-name="thumbs-up" unicode="&#xe854;" d="m0-63l0 552q0 16 10 25t25 11l147 0q33 0 35-36l0-552q0-14-10-24t-25-12l-147 0q-13 0-23 10t-12 26z m277 27l0 500q0 22 14 35t37 16l113 0 114 252q13 31 41 31 37 2 93-61 18-25 25-55t6-48-9-64-10-55l248 0q26 0 38-17t11-44l-70-429q-12-42-53-74t-88-38l-459 0q-21 0-35 14t-16 37z" horiz-adv-x="998" />
+<glyph glyph-name="thumbs-down" unicode="&#xe855;" d="m0 212l0 552q2 34 35 34l147 0q35-2 35-34l0-552q-2-16-12-26t-23-10l-147 0q-13 2-24 12t-11 24z m277 23l0 502q2 21 16 35t33 14l459 0q35-2 70-22 55-33 71-88l70-429q2-26-13-43t-36-18l-248 0q8-58 22-117 6-90-94-158-20-14-43-6-20 6-31 29l-112 252-115 0q-21 2-35 16t-14 33z" horiz-adv-x="996" />
+<glyph glyph-name="help-circled" unicode="&#xe856;" d="m0 350q0 207 147 354t353 146 354-146 146-354-146-354-354-146-353 146-147 354z m316 264q-3-49 12-57l57 0q21 47 70 45 33 0 58-32t10-66q-9-23-29-55t-31-56q-20-41-21-90t21-97l70-2q-8 41 9 79t58 89 45 56q25 39 32 62t7 59q0 71-49 121-53 55-145 55-47 0-109-37t-65-74z m94-553q0-35 25-61t59-25 61 25 25 61-25 60-61 24-59-24-25-60z" horiz-adv-x="1000" />
+<glyph glyph-name="star-circled" unicode="&#xe857;" d="m0 350q0 207 147 354t353 146 354-146 146-354-146-354-354-146-353 146-147 354z m160 82l205-156-80-246 211 148 209-152-74 246 209 152-258 4-78 246-86-242-258 0z" horiz-adv-x="1000" />
+<glyph glyph-name="bell" unicode="&#xe858;" d="m0 10l0 45 197 170 0 266q0 107 68 190t171 105l0 62 130 0 0-62q102-22 170-105t69-190l0-266 195-170 0-45-1000 0z m428-87q0 30 21 52t52 21 52-21 21-52-21-51-52-20-52 20-21 51z" horiz-adv-x="1000" />
+<glyph glyph-name="rss" unicode="&#xe859;" d="m0-150l0 199q82 0 141-58t58-141l-199 0z m0 400l0 200q248 0 424-176t176-424l-200 0q0 166-117 283t-283 117z m0 401l0 199q203 0 389-79t319-213 213-319 79-389l-199 0q0 217-108 401t-292 292-401 108z" horiz-adv-x="1000" />
+<glyph glyph-name="trash-circled" unicode="&#xe85a;" d="m0 350q0 207 147 354t353 146 354-146 146-354-146-354-354-146-353 146-147 354z m242 178l516 0 0 88-180 0 0 46-156 0 0-46-180 0 0-88z m28-490l460 0 0 421-460 0 0-421z" horiz-adv-x="1000" />
+<glyph glyph-name="cogs" unicode="&#xe85b;" d="m0 245l0 97 94 8q8 30 23 55l-60 74 68 69 74-61q26 16 55 23l8 94 97 0 10-94q29-7 55-23l74 61 68-69-60-74q16-25 23-55l94-8 0-97-94-10q-7-29-23-55l60-72-68-70-74 60q-26-15-55-23l-10-94-97 0-8 94q-29 8-55 23l-74-60-68 70 60 72q-15 26-23 55z m221 49q0-37 26-64t64-26 63 26 26 64-26 63-63 26-64-26-26-63z m318 238l8 72 70-2q8 22 20 39l-37 57 54 45 49-49q20 10 41 14l14 66 72-8-2-68q22-8 39-22l57 39 45-54-49-49q10-20 12-43l68-14-8-70-68 0q-8-20-22-37l39-59-56-45-47 49q-22-8-43-12l-14-66-70 6 0 70q-20 8-37 20l-59-37-45 54 49 49q-8 20-12 41z m31-446l6 51 49 0q6 16 14 28l-26 43 37 33 36-37q13 7 29 9l10 49 48-6 0-48q16-6 28-16l41 27 31-41-35-35q6-14 10-29l47-12-6-51-49 0q-4-15-14-27l28-43-40-33-35 37q-13-8-29-10l-10-49-49 6 0 51q-13 4-27 14l-41-28-31 41 35 35q-6 14-8 30z m118 14q-4-21 8-36t32-18 34 10 17 33-10 36-31 18l-6 0q-17 0-31-13t-13-30z m17 451q-4-27 14-49t45-24 48 15 23 45-14 47-44 25l-7 0q-26 0-44-17t-21-42z" horiz-adv-x="1000" />
+<glyph glyph-name="cog-circled" unicode="&#xe85c;" d="m0 350q0 207 147 354t353 146 354-146 146-354-146-354-354-146-353 146-147 354z m195-47l92-10q8-29 22-52l-59-73 68-68 73 59q23-14 52-22l10-92 94 0 10 92q29 8 52 22l73-59 68 68-59 73q14 23 22 52l92 10 0 94-92 10q-8 29-22 52l59 73-68 68-73-59q-23 14-52 22l-10 92-94 0-10-92q-29-8-52-22l-73 59-68-68 59-73q-14-23-22-52l-92-10 0-94z m217 47q0 37 26 63t62 25 63-25 25-63-25-62-63-26-62 26-26 62z" horiz-adv-x="1000" />
+<glyph glyph-name="calendar-circled" unicode="&#xe85d;" d="m0 350q0 207 147 354t353 146 354-146 146-354-146-354-354-146-353 146-147 354z m219-314l562 0 0 408-562 0 0-408z m0 443l562 0 0 139-68 0 0-88-127 0 0 88-172 0 0-88-127 0 0 88-68 0 0-139z m105 88l53 0 0 98-53 0 0-98z m37-391l47 0q2-35 30-35 33 2 33 39 0 24-16 29-12 6-43 6l0 35q53-2 53 30 0 33-27 33-32-2-32-29l-45 0q2 31 25 47t53 17q51 0 67-39 10-27 2-45-10-21-39-31 49-14 49-57-2-31-26-51t-53-19q-78 0-78 70z m178 92l0 39q35 16 59 37l41 0 0-234-45 0 0 189q-24-21-55-31z m84 299l53 0 0 98-53 0 0-98z" horiz-adv-x="1000" />
+<glyph glyph-name="mic-circled" unicode="&#xe85e;" d="m0 350q0 207 147 354t353 146 354-146 146-354-146-354-354-146-353 146-147 354z m283-142q20-18 43-32 53-35 115-47l0 22 118 0 0-22q62 12 115 47 23 14 43 32l0 183-43 0 0-162q-76-63-174-63t-174 63l0 162-43 0 0-183z m71 58q64-53 146-53t146 53l0 358q-19 15-44 27l0-72-36 0 0 87q-23 6-48 8l0-95-36 0 0 95q-25 0-48-8l0-87-36 0 0 74q-25-14-44-29l0-358z m15-240l262 0 0 43-72 0 0 60q-30-5-59-5t-59 5l0-60-72 0 0-43z" horiz-adv-x="1000" />
+<glyph glyph-name="volume-up" unicode="&#xe85f;" d="m0 169l0 360 203 0 307 250 0-858-307 248-203 0z m563 33q62 63 62 151t-62 152l60 65q90-90 92-219 0-125-92-213z m101-105q106 105 106 256t-106 258l66 62q131-133 131-319t-131-321z m100-98q146 147 146 354t-146 353l62 65q82-82 128-190t46-227-46-229-128-190z" horiz-adv-x="1000" />
+<glyph glyph-name="print" unicode="&#xe860;" d="m0 176l0 305 1000 0 0-305-154 0 54-265-800 0 54 265-154 0z m33 362l235 99 39 0 0 153 386 0 0-153 39 0 235-99-934 0z m131-553l672 0-78 381-516 0z" horiz-adv-x="1000" />
+<glyph glyph-name="edit-alt" unicode="&#xe861;" d="m0-150l0 1000 646 0-164-164-318 0 0-672 672 0 0 319 164 164 0-647-1000 0z m363 363l0 118 6 0q39 2 72-30 39-39 39-88l-117 0z m51 176l367 367 125-125-367-367z m397 397l64 64 125-125-64-64z" horiz-adv-x="1000" />
+<glyph glyph-name="edit-2" unicode="&#xe862;" d="m0-150l0 818 188 182 521 0 0-226 31 31 162-160-380-381-239-78 76 238 262 262 0 226-369 0 0-156-164 0 0-668 533 0 0 143 88 87 0-318-709 0z m361 264l119 39-80 82z" horiz-adv-x="902" />
+<glyph glyph-name="block" unicode="&#xe863;" d="m0 349q0 188 134 322t322 134 321-134 133-322-133-321-321-133-322 133-134 321z m115 27q-9-126 63-225l476 476q-99 73-225 63t-215-99-99-215z m143-305q99-73 224-63t215 100 100 215-63 224z" horiz-adv-x="910" />
+</font>
+</defs>
+</svg> \ No newline at end of file
diff --git a/themes/mantra/resources/fonts/elusive.ttf b/themes/mantra/resources/fonts/elusive.ttf
new file mode 100644
index 00000000..b79c6863
--- /dev/null
+++ b/themes/mantra/resources/fonts/elusive.ttf
Binary files differ
diff --git a/themes/mantra/resources/fonts/elusive.woff b/themes/mantra/resources/fonts/elusive.woff
new file mode 100644
index 00000000..8ae2c974
--- /dev/null
+++ b/themes/mantra/resources/fonts/elusive.woff
Binary files differ
diff --git a/themes/mantra/resources/images/back2top.png b/themes/mantra/resources/images/back2top.png
new file mode 100644
index 00000000..64e246f3
--- /dev/null
+++ b/themes/mantra/resources/images/back2top.png
Binary files differ
diff --git a/themes/mantra/resources/images/bullet.png b/themes/mantra/resources/images/bullet.png
new file mode 100644
index 00000000..39c7df90
--- /dev/null
+++ b/themes/mantra/resources/images/bullet.png
Binary files differ
diff --git a/themes/mantra/resources/images/bullets/arrow_black.png b/themes/mantra/resources/images/bullets/arrow_black.png
new file mode 100644
index 00000000..8c06cc05
--- /dev/null
+++ b/themes/mantra/resources/images/bullets/arrow_black.png
Binary files differ
diff --git a/themes/mantra/resources/images/bullets/arrow_white.png b/themes/mantra/resources/images/bullets/arrow_white.png
new file mode 100644
index 00000000..e5ded70b
--- /dev/null
+++ b/themes/mantra/resources/images/bullets/arrow_white.png
Binary files differ
diff --git a/themes/mantra/resources/images/bullets/bullet_dark.png b/themes/mantra/resources/images/bullets/bullet_dark.png
new file mode 100644
index 00000000..53b959d4
--- /dev/null
+++ b/themes/mantra/resources/images/bullets/bullet_dark.png
Binary files differ
diff --git a/themes/mantra/resources/images/bullets/bullet_gray.png b/themes/mantra/resources/images/bullets/bullet_gray.png
new file mode 100644
index 00000000..f71c645d
--- /dev/null
+++ b/themes/mantra/resources/images/bullets/bullet_gray.png
Binary files differ
diff --git a/themes/mantra/resources/images/bullets/bullet_light.png b/themes/mantra/resources/images/bullets/bullet_light.png
new file mode 100644
index 00000000..b41a6023
--- /dev/null
+++ b/themes/mantra/resources/images/bullets/bullet_light.png
Binary files differ
diff --git a/themes/mantra/resources/images/bullets/mantra_dot2.png b/themes/mantra/resources/images/bullets/mantra_dot2.png
new file mode 100644
index 00000000..4d20a004
--- /dev/null
+++ b/themes/mantra/resources/images/bullets/mantra_dot2.png
Binary files differ
diff --git a/themes/mantra/resources/images/bullets/square_dark.png b/themes/mantra/resources/images/bullets/square_dark.png
new file mode 100644
index 00000000..471f894f
--- /dev/null
+++ b/themes/mantra/resources/images/bullets/square_dark.png
Binary files differ
diff --git a/themes/mantra/resources/images/bullets/square_white.png b/themes/mantra/resources/images/bullets/square_white.png
new file mode 100644
index 00000000..c489c514
--- /dev/null
+++ b/themes/mantra/resources/images/bullets/square_white.png
Binary files differ
diff --git a/themes/mantra/resources/images/bullets/triangle_dark.png b/themes/mantra/resources/images/bullets/triangle_dark.png
new file mode 100644
index 00000000..b4eb725c
--- /dev/null
+++ b/themes/mantra/resources/images/bullets/triangle_dark.png
Binary files differ
diff --git a/themes/mantra/resources/images/bullets/triangle_gray.png b/themes/mantra/resources/images/bullets/triangle_gray.png
new file mode 100644
index 00000000..d0c8edd4
--- /dev/null
+++ b/themes/mantra/resources/images/bullets/triangle_gray.png
Binary files differ
diff --git a/themes/mantra/resources/images/bullets/triangle_white.png b/themes/mantra/resources/images/bullets/triangle_white.png
new file mode 100644
index 00000000..2276d387
--- /dev/null
+++ b/themes/mantra/resources/images/bullets/triangle_white.png
Binary files differ
diff --git a/themes/mantra/resources/images/headers/mantra.png b/themes/mantra/resources/images/headers/mantra.png
new file mode 100644
index 00000000..45e9bb0b
--- /dev/null
+++ b/themes/mantra/resources/images/headers/mantra.png
Binary files differ
diff --git a/themes/mantra/resources/images/headers/mantra_thumbnail.png b/themes/mantra/resources/images/headers/mantra_thumbnail.png
new file mode 100644
index 00000000..c2342994
--- /dev/null
+++ b/themes/mantra/resources/images/headers/mantra_thumbnail.png
Binary files differ
diff --git a/themes/mantra/resources/images/icon-back.png b/themes/mantra/resources/images/icon-back.png
new file mode 100644
index 00000000..74621e5c
--- /dev/null
+++ b/themes/mantra/resources/images/icon-back.png
Binary files differ
diff --git a/themes/mantra/resources/images/icon-featured.png b/themes/mantra/resources/images/icon-featured.png
new file mode 100644
index 00000000..2b137b80
--- /dev/null
+++ b/themes/mantra/resources/images/icon-featured.png
Binary files differ
diff --git a/themes/mantra/resources/images/icon-tooltip.png b/themes/mantra/resources/images/icon-tooltip.png
new file mode 100644
index 00000000..f925d33d
--- /dev/null
+++ b/themes/mantra/resources/images/icon-tooltip.png
Binary files differ
diff --git a/themes/mantra/resources/images/nivoslider/arrows.png b/themes/mantra/resources/images/nivoslider/arrows.png
new file mode 100644
index 00000000..8f562bd8
--- /dev/null
+++ b/themes/mantra/resources/images/nivoslider/arrows.png
Binary files differ
diff --git a/themes/mantra/resources/images/nivoslider/bullets.png b/themes/mantra/resources/images/nivoslider/bullets.png
new file mode 100644
index 00000000..a84c9c0b
--- /dev/null
+++ b/themes/mantra/resources/images/nivoslider/bullets.png
Binary files differ
diff --git a/themes/mantra/resources/images/nivoslider/loading.gif b/themes/mantra/resources/images/nivoslider/loading.gif
new file mode 100644
index 00000000..1560b646
--- /dev/null
+++ b/themes/mantra/resources/images/nivoslider/loading.gif
Binary files differ
diff --git a/themes/mantra/resources/images/pins/Pin1.png b/themes/mantra/resources/images/pins/Pin1.png
new file mode 100644
index 00000000..a08ae4c3
--- /dev/null
+++ b/themes/mantra/resources/images/pins/Pin1.png
Binary files differ
diff --git a/themes/mantra/resources/images/pins/Pin2.png b/themes/mantra/resources/images/pins/Pin2.png
new file mode 100644
index 00000000..3de309a5
--- /dev/null
+++ b/themes/mantra/resources/images/pins/Pin2.png
Binary files differ
diff --git a/themes/mantra/resources/images/pins/Pin3.png b/themes/mantra/resources/images/pins/Pin3.png
new file mode 100644
index 00000000..43fc6b66
--- /dev/null
+++ b/themes/mantra/resources/images/pins/Pin3.png
Binary files differ
diff --git a/themes/mantra/resources/images/pins/Pin4.png b/themes/mantra/resources/images/pins/Pin4.png
new file mode 100644
index 00000000..c6d92807
--- /dev/null
+++ b/themes/mantra/resources/images/pins/Pin4.png
Binary files differ
diff --git a/themes/mantra/resources/images/pins/Pin5.png b/themes/mantra/resources/images/pins/Pin5.png
new file mode 100644
index 00000000..8927b6b8
--- /dev/null
+++ b/themes/mantra/resources/images/pins/Pin5.png
Binary files differ
diff --git a/themes/mantra/resources/images/pins/mantra_dot.png b/themes/mantra/resources/images/pins/mantra_dot.png
new file mode 100644
index 00000000..4d20a004
--- /dev/null
+++ b/themes/mantra/resources/images/pins/mantra_dot.png
Binary files differ
diff --git a/themes/mantra/resources/images/post-formats/brackets.png b/themes/mantra/resources/images/post-formats/brackets.png
new file mode 100644
index 00000000..95c8a3a9
--- /dev/null
+++ b/themes/mantra/resources/images/post-formats/brackets.png
Binary files differ
diff --git a/themes/mantra/resources/images/post-formats/brackets2.png b/themes/mantra/resources/images/post-formats/brackets2.png
new file mode 100644
index 00000000..130783c9
--- /dev/null
+++ b/themes/mantra/resources/images/post-formats/brackets2.png
Binary files differ
diff --git a/themes/mantra/resources/images/post-formats/bubble.png b/themes/mantra/resources/images/post-formats/bubble.png
new file mode 100644
index 00000000..0d1a1a56
--- /dev/null
+++ b/themes/mantra/resources/images/post-formats/bubble.png
Binary files differ
diff --git a/themes/mantra/resources/images/post-formats/link.png b/themes/mantra/resources/images/post-formats/link.png
new file mode 100644
index 00000000..189e463d
--- /dev/null
+++ b/themes/mantra/resources/images/post-formats/link.png
Binary files differ
diff --git a/themes/mantra/resources/images/post-formats/picture.png b/themes/mantra/resources/images/post-formats/picture.png
new file mode 100644
index 00000000..ae07e735
--- /dev/null
+++ b/themes/mantra/resources/images/post-formats/picture.png
Binary files differ
diff --git a/themes/mantra/resources/images/post-formats/quotes.png b/themes/mantra/resources/images/post-formats/quotes.png
new file mode 100644
index 00000000..4fa4e7fd
--- /dev/null
+++ b/themes/mantra/resources/images/post-formats/quotes.png
Binary files differ
diff --git a/themes/mantra/resources/images/slider/mantra-column-1.jpg b/themes/mantra/resources/images/slider/mantra-column-1.jpg
new file mode 100644
index 00000000..d7196d60
--- /dev/null
+++ b/themes/mantra/resources/images/slider/mantra-column-1.jpg
Binary files differ
diff --git a/themes/mantra/resources/images/slider/mantra-column-2.jpg b/themes/mantra/resources/images/slider/mantra-column-2.jpg
new file mode 100644
index 00000000..2980d952
--- /dev/null
+++ b/themes/mantra/resources/images/slider/mantra-column-2.jpg
Binary files differ
diff --git a/themes/mantra/resources/images/slider/mantra-column-3.jpg b/themes/mantra/resources/images/slider/mantra-column-3.jpg
new file mode 100644
index 00000000..edcab17b
--- /dev/null
+++ b/themes/mantra/resources/images/slider/mantra-column-3.jpg
Binary files differ
diff --git a/themes/mantra/resources/images/slider/mantra-slider-1.jpg b/themes/mantra/resources/images/slider/mantra-slider-1.jpg
new file mode 100644
index 00000000..1997ff01
--- /dev/null
+++ b/themes/mantra/resources/images/slider/mantra-slider-1.jpg
Binary files differ
diff --git a/themes/mantra/resources/images/slider/mantra-slider-2.jpg b/themes/mantra/resources/images/slider/mantra-slider-2.jpg
new file mode 100644
index 00000000..dda5976c
--- /dev/null
+++ b/themes/mantra/resources/images/slider/mantra-slider-2.jpg
Binary files differ
diff --git a/themes/mantra/resources/images/slider/mantra-slider-3.jpg b/themes/mantra/resources/images/slider/mantra-slider-3.jpg
new file mode 100644
index 00000000..cb831c53
--- /dev/null
+++ b/themes/mantra/resources/images/slider/mantra-slider-3.jpg
Binary files differ
diff --git a/themes/mantra/resources/images/socials/AIM.png b/themes/mantra/resources/images/socials/AIM.png
new file mode 100644
index 00000000..feed4b34
--- /dev/null
+++ b/themes/mantra/resources/images/socials/AIM.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/AboutMe.png b/themes/mantra/resources/images/socials/AboutMe.png
new file mode 100644
index 00000000..67ccb130
--- /dev/null
+++ b/themes/mantra/resources/images/socials/AboutMe.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Amazon.png b/themes/mantra/resources/images/socials/Amazon.png
new file mode 100644
index 00000000..28268779
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Amazon.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Contact.png b/themes/mantra/resources/images/socials/Contact.png
new file mode 100644
index 00000000..77f380df
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Contact.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Delicious.png b/themes/mantra/resources/images/socials/Delicious.png
new file mode 100644
index 00000000..4b68a58f
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Delicious.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/DeviantArt.png b/themes/mantra/resources/images/socials/DeviantArt.png
new file mode 100644
index 00000000..3d87b7ea
--- /dev/null
+++ b/themes/mantra/resources/images/socials/DeviantArt.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Digg.png b/themes/mantra/resources/images/socials/Digg.png
new file mode 100644
index 00000000..3fc6d350
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Digg.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Discord.png b/themes/mantra/resources/images/socials/Discord.png
new file mode 100644
index 00000000..0b121637
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Discord.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Dribbble.png b/themes/mantra/resources/images/socials/Dribbble.png
new file mode 100644
index 00000000..d83f386f
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Dribbble.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Etsy.png b/themes/mantra/resources/images/socials/Etsy.png
new file mode 100644
index 00000000..1cd0e4eb
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Etsy.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Facebook.png b/themes/mantra/resources/images/socials/Facebook.png
new file mode 100644
index 00000000..0d1a45bd
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Facebook.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Flickr.png b/themes/mantra/resources/images/socials/Flickr.png
new file mode 100644
index 00000000..c43ede6d
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Flickr.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/FriendFeed.png b/themes/mantra/resources/images/socials/FriendFeed.png
new file mode 100644
index 00000000..d469fee3
--- /dev/null
+++ b/themes/mantra/resources/images/socials/FriendFeed.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Github.png b/themes/mantra/resources/images/socials/Github.png
new file mode 100644
index 00000000..4f1c793f
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Github.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/GoodReads.png b/themes/mantra/resources/images/socials/GoodReads.png
new file mode 100644
index 00000000..3f54da45
--- /dev/null
+++ b/themes/mantra/resources/images/socials/GoodReads.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/GooglePlus.png b/themes/mantra/resources/images/socials/GooglePlus.png
new file mode 100644
index 00000000..4e93c540
--- /dev/null
+++ b/themes/mantra/resources/images/socials/GooglePlus.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/IMDb.png b/themes/mantra/resources/images/socials/IMDb.png
new file mode 100644
index 00000000..bc072444
--- /dev/null
+++ b/themes/mantra/resources/images/socials/IMDb.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Instagram.png b/themes/mantra/resources/images/socials/Instagram.png
new file mode 100644
index 00000000..2762556e
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Instagram.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/LastFM.png b/themes/mantra/resources/images/socials/LastFM.png
new file mode 100644
index 00000000..0a1bc9a3
--- /dev/null
+++ b/themes/mantra/resources/images/socials/LastFM.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/LinkedIn.png b/themes/mantra/resources/images/socials/LinkedIn.png
new file mode 100644
index 00000000..eec64935
--- /dev/null
+++ b/themes/mantra/resources/images/socials/LinkedIn.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Mail.png b/themes/mantra/resources/images/socials/Mail.png
new file mode 100644
index 00000000..77f380df
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Mail.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/MindVox.png b/themes/mantra/resources/images/socials/MindVox.png
new file mode 100644
index 00000000..eedd746a
--- /dev/null
+++ b/themes/mantra/resources/images/socials/MindVox.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/MySpace.png b/themes/mantra/resources/images/socials/MySpace.png
new file mode 100644
index 00000000..7d4d2757
--- /dev/null
+++ b/themes/mantra/resources/images/socials/MySpace.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Newsvine.png b/themes/mantra/resources/images/socials/Newsvine.png
new file mode 100644
index 00000000..9620801e
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Newsvine.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Patreon.png b/themes/mantra/resources/images/socials/Patreon.png
new file mode 100644
index 00000000..ac000a38
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Patreon.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/PayPal.png b/themes/mantra/resources/images/socials/PayPal.png
new file mode 100644
index 00000000..2ffa3ce6
--- /dev/null
+++ b/themes/mantra/resources/images/socials/PayPal.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Phone.png b/themes/mantra/resources/images/socials/Phone.png
new file mode 100644
index 00000000..d3f4f20d
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Phone.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Picasa.png b/themes/mantra/resources/images/socials/Picasa.png
new file mode 100644
index 00000000..c13e8a43
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Picasa.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Pinterest.png b/themes/mantra/resources/images/socials/Pinterest.png
new file mode 100644
index 00000000..8dd63de3
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Pinterest.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/RSS.png b/themes/mantra/resources/images/socials/RSS.png
new file mode 100644
index 00000000..344cddbf
--- /dev/null
+++ b/themes/mantra/resources/images/socials/RSS.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Reddit.png b/themes/mantra/resources/images/socials/Reddit.png
new file mode 100644
index 00000000..7a541bac
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Reddit.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/ShareThis.png b/themes/mantra/resources/images/socials/ShareThis.png
new file mode 100644
index 00000000..c1cb8d41
--- /dev/null
+++ b/themes/mantra/resources/images/socials/ShareThis.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Skype.png b/themes/mantra/resources/images/socials/Skype.png
new file mode 100644
index 00000000..7ecbf993
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Skype.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/SoundCloud.png b/themes/mantra/resources/images/socials/SoundCloud.png
new file mode 100644
index 00000000..2e46319e
--- /dev/null
+++ b/themes/mantra/resources/images/socials/SoundCloud.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Steam-old.png b/themes/mantra/resources/images/socials/Steam-old.png
new file mode 100644
index 00000000..5b363c73
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Steam-old.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Steam-round.png b/themes/mantra/resources/images/socials/Steam-round.png
new file mode 100644
index 00000000..ce5b71d3
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Steam-round.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Steam.png b/themes/mantra/resources/images/socials/Steam.png
new file mode 100644
index 00000000..ce5b71d3
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Steam.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/StumbleUpon.png b/themes/mantra/resources/images/socials/StumbleUpon.png
new file mode 100644
index 00000000..a454faad
--- /dev/null
+++ b/themes/mantra/resources/images/socials/StumbleUpon.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Technorati.png b/themes/mantra/resources/images/socials/Technorati.png
new file mode 100644
index 00000000..2d40d883
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Technorati.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/TripAdvisor.png b/themes/mantra/resources/images/socials/TripAdvisor.png
new file mode 100644
index 00000000..6b74f9d5
--- /dev/null
+++ b/themes/mantra/resources/images/socials/TripAdvisor.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Tumblr.png b/themes/mantra/resources/images/socials/Tumblr.png
new file mode 100644
index 00000000..4198bcb4
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Tumblr.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Twitch.png b/themes/mantra/resources/images/socials/Twitch.png
new file mode 100644
index 00000000..76022131
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Twitch.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Twitter-old.png b/themes/mantra/resources/images/socials/Twitter-old.png
new file mode 100644
index 00000000..6ad0fdbb
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Twitter-old.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Twitter.png b/themes/mantra/resources/images/socials/Twitter.png
new file mode 100644
index 00000000..8e2d0aa0
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Twitter.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/VK.png b/themes/mantra/resources/images/socials/VK.png
new file mode 100644
index 00000000..8192205d
--- /dev/null
+++ b/themes/mantra/resources/images/socials/VK.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Vimeo.png b/themes/mantra/resources/images/socials/Vimeo.png
new file mode 100644
index 00000000..c17ddf57
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Vimeo.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/WordPress.png b/themes/mantra/resources/images/socials/WordPress.png
new file mode 100644
index 00000000..24617ea5
--- /dev/null
+++ b/themes/mantra/resources/images/socials/WordPress.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Xing.png b/themes/mantra/resources/images/socials/Xing.png
new file mode 100644
index 00000000..3d593587
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Xing.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Yahoo.png b/themes/mantra/resources/images/socials/Yahoo.png
new file mode 100644
index 00000000..295f5fd0
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Yahoo.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/Yelp.png b/themes/mantra/resources/images/socials/Yelp.png
new file mode 100644
index 00000000..025f5f00
--- /dev/null
+++ b/themes/mantra/resources/images/socials/Yelp.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/YouTube-old.png b/themes/mantra/resources/images/socials/YouTube-old.png
new file mode 100644
index 00000000..d61d7c60
--- /dev/null
+++ b/themes/mantra/resources/images/socials/YouTube-old.png
Binary files differ
diff --git a/themes/mantra/resources/images/socials/YouTube.png b/themes/mantra/resources/images/socials/YouTube.png
new file mode 100644
index 00000000..0fd7c628
--- /dev/null
+++ b/themes/mantra/resources/images/socials/YouTube.png
Binary files differ
diff --git a/themes/mantra/resources/js/PIE/PIE.htc b/themes/mantra/resources/js/PIE/PIE.htc
new file mode 100644
index 00000000..ca3b5470
--- /dev/null
+++ b/themes/mantra/resources/js/PIE/PIE.htc
@@ -0,0 +1,96 @@
+<!--
+PIE: CSS3 rendering for IE
+Version 1.0.0
+http://css3pie.com
+Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
+-->
+<PUBLIC:COMPONENT lightWeight="true">
+<!-- saved from url=(0014)about:internet -->
+<PUBLIC:ATTACH EVENT="oncontentready" FOR="element" ONEVENT="init()" />
+<PUBLIC:ATTACH EVENT="ondocumentready" FOR="element" ONEVENT="init()" />
+<PUBLIC:ATTACH EVENT="ondetach" FOR="element" ONEVENT="cleanup()" />
+
+<script type="text/javascript">
+var doc = element.document;var f=window.PIE;
+if(!f){f=window.PIE={F:"-pie-",nb:"Pie",La:"pie_",Ac:{TD:1,TH:1},cc:{TABLE:1,THEAD:1,TBODY:1,TFOOT:1,TR:1,INPUT:1,TEXTAREA:1,SELECT:1,OPTION:1,IMG:1,HR:1},fc:{A:1,INPUT:1,TEXTAREA:1,SELECT:1,BUTTON:1},Gd:{submit:1,button:1,reset:1},aa:function(){}};try{doc.execCommand("BackgroundImageCache",false,true)}catch(aa){}for(var ba=4,Z=doc.createElement("div"),ca=Z.getElementsByTagName("i"),ga;Z.innerHTML="<!--[if gt IE "+ ++ba+"]><i></i><![endif]--\>",ca[0];);f.O=ba;if(ba===6)f.F=f.F.replace(/^-/,"");f.ja=
+doc.documentMode||f.O;Z.innerHTML='<v:shape adj="1"/>';ga=Z.firstChild;ga.style.behavior="url(#default#VML)";f.zc=typeof ga.adj==="object";(function(){var a,b=0,c={};f.p={Za:function(d){if(!a){a=doc.createDocumentFragment();a.namespaces.add("css3vml","urn:schemas-microsoft-com:vml")}return a.createElement("css3vml:"+d)},Ba:function(d){return d&&d._pieId||(d._pieId="_"+ ++b)},Eb:function(d){var e,g,j,i,h=arguments;e=1;for(g=h.length;e<g;e++){i=h[e];for(j in i)if(i.hasOwnProperty(j))d[j]=i[j]}return d},
+Rb:function(d,e,g){var j=c[d],i,h;if(j)Object.prototype.toString.call(j)==="[object Array]"?j.push([e,g]):e.call(g,j);else{h=c[d]=[[e,g]];i=new Image;i.onload=function(){j=c[d]={h:i.width,f:i.height};for(var k=0,n=h.length;k<n;k++)h[k][0].call(h[k][1],j);i.onload=null};i.src=d}}}})();f.Na={gc:function(a,b,c,d){function e(){k=j>=90&&j<270?b:0;n=j<180?c:0;m=b-k;p=c-n}function g(){for(;j<0;)j+=360;j%=360}var j=d.sa;d=d.zb;var i,h,k,n,m,p,r,t;if(d){d=d.coords(a,b,c);i=d.x;h=d.y}if(j){j=j.jd();g();e();
+if(!d){i=k;h=n}d=f.Na.tc(i,h,j,m,p);a=d[0];d=d[1]}else if(d){a=b-i;d=c-h}else{i=h=a=0;d=c}r=a-i;t=d-h;if(j===void 0){j=!r?t<0?90:270:!t?r<0?180:0:-Math.atan2(t,r)/Math.PI*180;g();e()}return{sa:j,xc:i,yc:h,td:a,ud:d,Wd:k,Xd:n,rd:m,sd:p,kd:r,ld:t,rc:f.Na.dc(i,h,a,d)}},tc:function(a,b,c,d,e){if(c===0||c===180)return[d,b];else if(c===90||c===270)return[a,e];else{c=Math.tan(-c*Math.PI/180);a=c*a-b;b=-1/c;d=b*d-e;e=b-c;return[(d-a)/e,(c*d-b*a)/e]}},dc:function(a,b,c,d){a=c-a;b=d-b;return Math.abs(a===0?
+b:b===0?a:Math.sqrt(a*a+b*b))}};f.ea=function(){this.Gb=[];this.oc={}};f.ea.prototype={ba:function(a){var b=f.p.Ba(a),c=this.oc,d=this.Gb;if(!(b in c)){c[b]=d.length;d.push(a)}},Ha:function(a){a=f.p.Ba(a);var b=this.oc;if(a&&a in b){delete this.Gb[b[a]];delete b[a]}},xa:function(){for(var a=this.Gb,b=a.length;b--;)a[b]&&a[b]()}};f.Oa=new f.ea;f.Oa.Rd=function(){var a=this,b;if(!a.Sd){b=doc.documentElement.currentStyle.getAttribute(f.F+"poll-interval")||250;(function c(){a.xa();setTimeout(c,b)})();
+a.Sd=1}};(function(){function a(){f.L.xa();window.detachEvent("onunload",a);window.PIE=null}f.L=new f.ea;window.attachEvent("onunload",a);f.L.ta=function(b,c,d){b.attachEvent(c,d);this.ba(function(){b.detachEvent(c,d)})}})();f.Qa=new f.ea;f.L.ta(window,"onresize",function(){f.Qa.xa()});(function(){function a(){f.mb.xa()}f.mb=new f.ea;f.L.ta(window,"onscroll",a);f.Qa.ba(a)})();(function(){function a(){c=f.kb.md()}function b(){if(c){for(var d=0,e=c.length;d<e;d++)f.attach(c[d]);c=0}}var c;if(f.ja<9){f.L.ta(window,
+"onbeforeprint",a);f.L.ta(window,"onafterprint",b)}})();f.lb=new f.ea;f.L.ta(doc,"onmouseup",function(){f.lb.xa()});f.he=function(){function a(h){this.Y=h}var b=doc.createElement("length-calc"),c=doc.body||doc.documentElement,d=b.style,e={},g=["mm","cm","in","pt","pc"],j=g.length,i={};d.position="absolute";d.top=d.left="-9999px";for(c.appendChild(b);j--;){d.width="100"+g[j];e[g[j]]=b.offsetWidth/100}c.removeChild(b);d.width="1em";a.prototype={Kb:/(px|em|ex|mm|cm|in|pt|pc|%)$/,ic:function(){var h=
+this.Jd;if(h===void 0)h=this.Jd=parseFloat(this.Y);return h},yb:function(){var h=this.ae;if(!h)h=this.ae=(h=this.Y.match(this.Kb))&&h[0]||"px";return h},a:function(h,k){var n=this.ic(),m=this.yb();switch(m){case "px":return n;case "%":return n*(typeof k==="function"?k():k)/100;case "em":return n*this.xb(h);case "ex":return n*this.xb(h)/2;default:return n*e[m]}},xb:function(h){var k=h.currentStyle.fontSize,n,m;if(k.indexOf("px")>0)return parseFloat(k);else if(h.tagName in f.cc){m=this;n=h.parentNode;
+return f.n(k).a(n,function(){return m.xb(n)})}else{h.appendChild(b);k=b.offsetWidth;b.parentNode===h&&h.removeChild(b);return k}}};f.n=function(h){return i[h]||(i[h]=new a(h))};return a}();f.Ja=function(){function a(e){this.X=e}var b=f.n("50%"),c={top:1,center:1,bottom:1},d={left:1,center:1,right:1};a.prototype={zd:function(){if(!this.ac){var e=this.X,g=e.length,j=f.v,i=j.qa,h=f.n("0");i=i.na;h=["left",h,"top",h];if(g===1){e.push(new j.ob(i,"center"));g++}if(g===2){i&(e[0].k|e[1].k)&&e[0].d in c&&
+e[1].d in d&&e.push(e.shift());if(e[0].k&i)if(e[0].d==="center")h[1]=b;else h[0]=e[0].d;else if(e[0].W())h[1]=f.n(e[0].d);if(e[1].k&i)if(e[1].d==="center")h[3]=b;else h[2]=e[1].d;else if(e[1].W())h[3]=f.n(e[1].d)}this.ac=h}return this.ac},coords:function(e,g,j){var i=this.zd(),h=i[1].a(e,g);e=i[3].a(e,j);return{x:i[0]==="right"?g-h:h,y:i[2]==="bottom"?j-e:e}}};return a}();f.Ka=function(){function a(b,c){this.h=b;this.f=c}a.prototype={a:function(b,c,d,e,g){var j=this.h,i=this.f,h=c/d;e=e/g;if(j===
+"contain"){j=e>h?c:d*e;i=e>h?c/e:d}else if(j==="cover"){j=e<h?c:d*e;i=e<h?c/e:d}else if(j==="auto"){i=i==="auto"?g:i.a(b,d);j=i*e}else{j=j.a(b,c);i=i==="auto"?j/e:i.a(b,d)}return{h:j,f:i}}};a.Kc=new a("auto","auto");return a}();f.Ec=function(){function a(b){this.Y=b}a.prototype={Kb:/[a-z]+$/i,yb:function(){return this.ad||(this.ad=this.Y.match(this.Kb)[0].toLowerCase())},jd:function(){var b=this.Vc,c;if(b===undefined){b=this.yb();c=parseFloat(this.Y,10);b=this.Vc=b==="deg"?c:b==="rad"?c/Math.PI*180:
+b==="grad"?c/400*360:b==="turn"?c*360:0}return b}};return a}();f.Jc=function(){function a(c){this.Y=c}var b={};a.Qd=/\s*rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d+|\d*\.\d+)\s*\)\s*/;a.Fb={aliceblue:"F0F8FF",antiquewhite:"FAEBD7",aqua:"0FF",aquamarine:"7FFFD4",azure:"F0FFFF",beige:"F5F5DC",bisque:"FFE4C4",black:"000",blanchedalmond:"FFEBCD",blue:"00F",blueviolet:"8A2BE2",brown:"A52A2A",burlywood:"DEB887",cadetblue:"5F9EA0",chartreuse:"7FFF00",chocolate:"D2691E",coral:"FF7F50",cornflowerblue:"6495ED",
+cornsilk:"FFF8DC",crimson:"DC143C",cyan:"0FF",darkblue:"00008B",darkcyan:"008B8B",darkgoldenrod:"B8860B",darkgray:"A9A9A9",darkgreen:"006400",darkkhaki:"BDB76B",darkmagenta:"8B008B",darkolivegreen:"556B2F",darkorange:"FF8C00",darkorchid:"9932CC",darkred:"8B0000",darksalmon:"E9967A",darkseagreen:"8FBC8F",darkslateblue:"483D8B",darkslategray:"2F4F4F",darkturquoise:"00CED1",darkviolet:"9400D3",deeppink:"FF1493",deepskyblue:"00BFFF",dimgray:"696969",dodgerblue:"1E90FF",firebrick:"B22222",floralwhite:"FFFAF0",
+forestgreen:"228B22",fuchsia:"F0F",gainsboro:"DCDCDC",ghostwhite:"F8F8FF",gold:"FFD700",goldenrod:"DAA520",gray:"808080",green:"008000",greenyellow:"ADFF2F",honeydew:"F0FFF0",hotpink:"FF69B4",indianred:"CD5C5C",indigo:"4B0082",ivory:"FFFFF0",khaki:"F0E68C",lavender:"E6E6FA",lavenderblush:"FFF0F5",lawngreen:"7CFC00",lemonchiffon:"FFFACD",lightblue:"ADD8E6",lightcoral:"F08080",lightcyan:"E0FFFF",lightgoldenrodyellow:"FAFAD2",lightgreen:"90EE90",lightgrey:"D3D3D3",lightpink:"FFB6C1",lightsalmon:"FFA07A",
+lightseagreen:"20B2AA",lightskyblue:"87CEFA",lightslategray:"789",lightsteelblue:"B0C4DE",lightyellow:"FFFFE0",lime:"0F0",limegreen:"32CD32",linen:"FAF0E6",magenta:"F0F",maroon:"800000",mediumauqamarine:"66CDAA",mediumblue:"0000CD",mediumorchid:"BA55D3",mediumpurple:"9370D8",mediumseagreen:"3CB371",mediumslateblue:"7B68EE",mediumspringgreen:"00FA9A",mediumturquoise:"48D1CC",mediumvioletred:"C71585",midnightblue:"191970",mintcream:"F5FFFA",mistyrose:"FFE4E1",moccasin:"FFE4B5",navajowhite:"FFDEAD",
+navy:"000080",oldlace:"FDF5E6",olive:"808000",olivedrab:"688E23",orange:"FFA500",orangered:"FF4500",orchid:"DA70D6",palegoldenrod:"EEE8AA",palegreen:"98FB98",paleturquoise:"AFEEEE",palevioletred:"D87093",papayawhip:"FFEFD5",peachpuff:"FFDAB9",peru:"CD853F",pink:"FFC0CB",plum:"DDA0DD",powderblue:"B0E0E6",purple:"800080",red:"F00",rosybrown:"BC8F8F",royalblue:"4169E1",saddlebrown:"8B4513",salmon:"FA8072",sandybrown:"F4A460",seagreen:"2E8B57",seashell:"FFF5EE",sienna:"A0522D",silver:"C0C0C0",skyblue:"87CEEB",
+slateblue:"6A5ACD",slategray:"708090",snow:"FFFAFA",springgreen:"00FF7F",steelblue:"4682B4",tan:"D2B48C",teal:"008080",thistle:"D8BFD8",tomato:"FF6347",turquoise:"40E0D0",violet:"EE82EE",wheat:"F5DEB3",white:"FFF",whitesmoke:"F5F5F5",yellow:"FF0",yellowgreen:"9ACD32"};a.prototype={parse:function(){if(!this.Ua){var c=this.Y,d;if(d=c.match(a.Qd)){this.Ua="rgb("+d[1]+","+d[2]+","+d[3]+")";this.Yb=parseFloat(d[4])}else{if((d=c.toLowerCase())in a.Fb)c="#"+a.Fb[d];this.Ua=c;this.Yb=c==="transparent"?0:
+1}}},U:function(c){this.parse();return this.Ua==="currentColor"?c.currentStyle.color:this.Ua},fa:function(){this.parse();return this.Yb}};f.ha=function(c){return b[c]||(b[c]=new a(c))};return a}();f.v=function(){function a(c){this.$a=c;this.ch=0;this.X=[];this.Ga=0}var b=a.qa={Ia:1,Wb:2,z:4,Lc:8,Xb:16,na:32,K:64,oa:128,pa:256,Ra:512,Tc:1024,URL:2048};a.ob=function(c,d){this.k=c;this.d=d};a.ob.prototype={Ca:function(){return this.k&b.K||this.k&b.oa&&this.d==="0"},W:function(){return this.Ca()||this.k&
+b.Ra}};a.prototype={de:/\s/,Kd:/^[\+\-]?(\d*\.)?\d+/,url:/^url\(\s*("([^"]*)"|'([^']*)'|([!#$%&*-~]*))\s*\)/i,nc:/^\-?[_a-z][\w-]*/i,Yd:/^("([^"]*)"|'([^']*)')/,Bd:/^#([\da-f]{6}|[\da-f]{3})/i,be:{px:b.K,em:b.K,ex:b.K,mm:b.K,cm:b.K,"in":b.K,pt:b.K,pc:b.K,deg:b.Ia,rad:b.Ia,grad:b.Ia},fd:{rgb:1,rgba:1,hsl:1,hsla:1},next:function(c){function d(p,r){p=new a.ob(p,r);if(!c){k.X.push(p);k.Ga++}return p}function e(){k.Ga++;return null}var g,j,i,h,k=this;if(this.Ga<this.X.length)return this.X[this.Ga++];for(;this.de.test(this.$a.charAt(this.ch));)this.ch++;
+if(this.ch>=this.$a.length)return e();j=this.ch;g=this.$a.substring(this.ch);i=g.charAt(0);switch(i){case "#":if(h=g.match(this.Bd)){this.ch+=h[0].length;return d(b.z,h[0])}break;case '"':case "'":if(h=g.match(this.Yd)){this.ch+=h[0].length;return d(b.Tc,h[2]||h[3]||"")}break;case "/":case ",":this.ch++;return d(b.pa,i);case "u":if(h=g.match(this.url)){this.ch+=h[0].length;return d(b.URL,h[2]||h[3]||h[4]||"")}}if(h=g.match(this.Kd)){i=h[0];this.ch+=i.length;if(g.charAt(i.length)==="%"){this.ch++;
+return d(b.Ra,i+"%")}if(h=g.substring(i.length).match(this.nc)){i+=h[0];this.ch+=h[0].length;return d(this.be[h[0].toLowerCase()]||b.Lc,i)}return d(b.oa,i)}if(h=g.match(this.nc)){i=h[0];this.ch+=i.length;if(i.toLowerCase()in f.Jc.Fb||i==="currentColor"||i==="transparent")return d(b.z,i);if(g.charAt(i.length)==="("){this.ch++;if(i.toLowerCase()in this.fd){g=function(p){return p&&p.k&b.oa};h=function(p){return p&&p.k&(b.oa|b.Ra)};var n=function(p,r){return p&&p.d===r},m=function(){return k.next(1)};
+if((i.charAt(0)==="r"?h(m()):g(m()))&&n(m(),",")&&h(m())&&n(m(),",")&&h(m())&&(i==="rgb"||i==="hsa"||n(m(),",")&&g(m()))&&n(m(),")"))return d(b.z,this.$a.substring(j,this.ch));return e()}return d(b.Xb,i)}return d(b.na,i)}this.ch++;return d(b.Wb,i)},D:function(){return this.X[this.Ga-- -2]},all:function(){for(;this.next(););return this.X},ma:function(c,d){for(var e=[],g,j;g=this.next();){if(c(g)){j=true;this.D();break}e.push(g)}return d&&!j?null:e}};return a}();var ha=function(a){this.e=a};ha.prototype=
+{Z:0,Od:function(){var a=this.qb,b;return!a||(b=this.o())&&(a.x!==b.x||a.y!==b.y)},Td:function(){var a=this.qb,b;return!a||(b=this.o())&&(a.h!==b.h||a.f!==b.f)},hc:function(){var a=this.e,b=a.getBoundingClientRect(),c=f.ja===9,d=f.O===7,e=b.right-b.left;return{x:b.left,y:b.top,h:c||d?a.offsetWidth:e,f:c||d?a.offsetHeight:b.bottom-b.top,Hd:d&&e?a.offsetWidth/e:1}},o:function(){return this.Z?this.Va||(this.Va=this.hc()):this.hc()},Ad:function(){return!!this.qb},cb:function(){++this.Z},hb:function(){if(!--this.Z){if(this.Va)this.qb=
+this.Va;this.Va=null}}};(function(){function a(b){var c=f.p.Ba(b);return function(){if(this.Z){var d=this.$b||(this.$b={});return c in d?d[c]:(d[c]=b.call(this))}else return b.call(this)}}f.B={Z:0,ka:function(b){function c(d){this.e=d;this.Zb=this.ia()}f.p.Eb(c.prototype,f.B,b);c.$c={};return c},j:function(){var b=this.ia(),c=this.constructor.$c;return b?b in c?c[b]:(c[b]=this.la(b)):null},ia:a(function(){var b=this.e,c=this.constructor,d=b.style;b=b.currentStyle;var e=this.wa,g=this.Fa,j=c.Yc||(c.Yc=
+f.F+e);c=c.Zc||(c.Zc=f.nb+g.charAt(0).toUpperCase()+g.substring(1));return d[c]||b.getAttribute(j)||d[g]||b.getAttribute(e)}),i:a(function(){return!!this.j()}),H:a(function(){var b=this.ia(),c=b!==this.Zb;this.Zb=b;return c}),va:a,cb:function(){++this.Z},hb:function(){--this.Z||delete this.$b}}})();f.Sb=f.B.ka({wa:f.F+"background",Fa:f.nb+"Background",cd:{scroll:1,fixed:1,local:1},fb:{"repeat-x":1,"repeat-y":1,repeat:1,"no-repeat":1},sc:{"padding-box":1,"border-box":1,"content-box":1},Pd:{top:1,right:1,
+bottom:1,left:1,center:1},Ud:{contain:1,cover:1},eb:{Ma:"backgroundClip",z:"backgroundColor",da:"backgroundImage",Pa:"backgroundOrigin",S:"backgroundPosition",T:"backgroundRepeat",Sa:"backgroundSize"},la:function(a){function b(s){return s&&s.W()||s.k&k&&s.d in t}function c(s){return s&&(s.W()&&f.n(s.d)||s.d==="auto"&&"auto")}var d=this.e.currentStyle,e,g,j,i=f.v.qa,h=i.pa,k=i.na,n=i.z,m,p,r=0,t=this.Pd,v,l,q={M:[]};if(this.wb()){e=new f.v(a);for(j={};g=e.next();){m=g.k;p=g.d;if(!j.P&&m&i.Xb&&p===
+"linear-gradient"){v={ca:[],P:p};for(l={};g=e.next();){m=g.k;p=g.d;if(m&i.Wb&&p===")"){l.color&&v.ca.push(l);v.ca.length>1&&f.p.Eb(j,v);break}if(m&n){if(v.sa||v.zb){g=e.D();if(g.k!==h)break;e.next()}l={color:f.ha(p)};g=e.next();if(g.W())l.db=f.n(g.d);else e.D()}else if(m&i.Ia&&!v.sa&&!l.color&&!v.ca.length)v.sa=new f.Ec(g.d);else if(b(g)&&!v.zb&&!l.color&&!v.ca.length){e.D();v.zb=new f.Ja(e.ma(function(s){return!b(s)},false))}else if(m&h&&p===","){if(l.color){v.ca.push(l);l={}}}else break}}else if(!j.P&&
+m&i.URL){j.Ab=p;j.P="image"}else if(b(g)&&!j.$){e.D();j.$=new f.Ja(e.ma(function(s){return!b(s)},false))}else if(m&k)if(p in this.fb&&!j.bb)j.bb=p;else if(p in this.sc&&!j.Wa){j.Wa=p;if((g=e.next())&&g.k&k&&g.d in this.sc)j.ub=g.d;else{j.ub=p;e.D()}}else if(p in this.cd&&!j.bc)j.bc=p;else return null;else if(m&n&&!q.color)q.color=f.ha(p);else if(m&h&&p==="/"&&!j.Xa&&j.$){g=e.next();if(g.k&k&&g.d in this.Ud)j.Xa=new f.Ka(g.d);else if(g=c(g)){m=c(e.next());if(!m){m=g;e.D()}j.Xa=new f.Ka(g,m)}else return null}else if(m&
+h&&p===","&&j.P){j.Hb=a.substring(r,e.ch-1);r=e.ch;q.M.push(j);j={}}else return null}if(j.P){j.Hb=a.substring(r);q.M.push(j)}}else this.Bc(f.ja<9?function(){var s=this.eb,o=d[s.S+"X"],u=d[s.S+"Y"],x=d[s.da],y=d[s.z];if(y!=="transparent")q.color=f.ha(y);if(x!=="none")q.M=[{P:"image",Ab:(new f.v(x)).next().d,bb:d[s.T],$:new f.Ja((new f.v(o+" "+u)).all())}]}:function(){var s=this.eb,o=/\s*,\s*/,u=d[s.da].split(o),x=d[s.z],y,z,B,E,D,C;if(x!=="transparent")q.color=f.ha(x);if((E=u.length)&&u[0]!=="none"){x=
+d[s.T].split(o);y=d[s.S].split(o);z=d[s.Pa].split(o);B=d[s.Ma].split(o);s=d[s.Sa].split(o);q.M=[];for(o=0;o<E;o++)if((D=u[o])&&D!=="none"){C=s[o].split(" ");q.M.push({Hb:D+" "+x[o]+" "+y[o]+" / "+s[o]+" "+z[o]+" "+B[o],P:"image",Ab:(new f.v(D)).next().d,bb:x[o],$:new f.Ja((new f.v(y[o])).all()),Wa:z[o],ub:B[o],Xa:new f.Ka(C[0],C[1])})}}});return q.color||q.M[0]?q:null},Bc:function(a){var b=f.ja>8,c=this.eb,d=this.e.runtimeStyle,e=d[c.da],g=d[c.z],j=d[c.T],i,h,k,n;if(e)d[c.da]="";if(g)d[c.z]="";if(j)d[c.T]=
+"";if(b){i=d[c.Ma];h=d[c.Pa];n=d[c.S];k=d[c.Sa];if(i)d[c.Ma]="";if(h)d[c.Pa]="";if(n)d[c.S]="";if(k)d[c.Sa]=""}a=a.call(this);if(e)d[c.da]=e;if(g)d[c.z]=g;if(j)d[c.T]=j;if(b){if(i)d[c.Ma]=i;if(h)d[c.Pa]=h;if(n)d[c.S]=n;if(k)d[c.Sa]=k}return a},ia:f.B.va(function(){return this.wb()||this.Bc(function(){var a=this.e.currentStyle,b=this.eb;return a[b.z]+" "+a[b.da]+" "+a[b.T]+" "+a[b.S+"X"]+" "+a[b.S+"Y"]})}),wb:f.B.va(function(){var a=this.e;return a.style[this.Fa]||a.currentStyle.getAttribute(this.wa)}),
+qc:function(){var a=0;if(f.O<7){a=this.e;a=""+(a.style[f.nb+"PngFix"]||a.currentStyle.getAttribute(f.F+"png-fix"))==="true"}return a},i:f.B.va(function(){return(this.wb()||this.qc())&&!!this.j()})});f.Vb=f.B.ka({wc:["Top","Right","Bottom","Left"],Id:{thin:"1px",medium:"3px",thick:"5px"},la:function(){var a={},b={},c={},d=false,e=true,g=true,j=true;this.Cc(function(){for(var i=this.e.currentStyle,h=0,k,n,m,p,r,t,v;h<4;h++){m=this.wc[h];v=m.charAt(0).toLowerCase();k=b[v]=i["border"+m+"Style"];n=i["border"+
+m+"Color"];m=i["border"+m+"Width"];if(h>0){if(k!==p)g=false;if(n!==r)e=false;if(m!==t)j=false}p=k;r=n;t=m;c[v]=f.ha(n);m=a[v]=f.n(b[v]==="none"?"0":this.Id[m]||m);if(m.a(this.e)>0)d=true}});return d?{J:a,Zd:b,gd:c,ee:j,hd:e,$d:g}:null},ia:f.B.va(function(){var a=this.e,b=a.currentStyle,c;a.tagName in f.Ac&&a.offsetParent.currentStyle.borderCollapse==="collapse"||this.Cc(function(){c=b.borderWidth+"|"+b.borderStyle+"|"+b.borderColor});return c}),Cc:function(a){var b=this.e.runtimeStyle,c=b.borderWidth,
+d=b.borderColor;if(c)b.borderWidth="";if(d)b.borderColor="";a=a.call(this);if(c)b.borderWidth=c;if(d)b.borderColor=d;return a}});(function(){f.jb=f.B.ka({wa:"border-radius",Fa:"borderRadius",la:function(b){var c=null,d,e,g,j,i=false;if(b){e=new f.v(b);var h=function(){for(var k=[],n;(g=e.next())&&g.W();){j=f.n(g.d);n=j.ic();if(n<0)return null;if(n>0)i=true;k.push(j)}return k.length>0&&k.length<5?{tl:k[0],tr:k[1]||k[0],br:k[2]||k[0],bl:k[3]||k[1]||k[0]}:null};if(b=h()){if(g){if(g.k&f.v.qa.pa&&g.d===
+"/")d=h()}else d=b;if(i&&b&&d)c={x:b,y:d}}}return c}});var a=f.n("0");a={tl:a,tr:a,br:a,bl:a};f.jb.Dc={x:a,y:a}})();f.Ub=f.B.ka({wa:"border-image",Fa:"borderImage",fb:{stretch:1,round:1,repeat:1,space:1},la:function(a){var b=null,c,d,e,g,j,i,h=0,k=f.v.qa,n=k.na,m=k.oa,p=k.Ra;if(a){c=new f.v(a);b={};for(var r=function(l){return l&&l.k&k.pa&&l.d==="/"},t=function(l){return l&&l.k&n&&l.d==="fill"},v=function(){g=c.ma(function(l){return!(l.k&(m|p))});if(t(c.next())&&!b.fill)b.fill=true;else c.D();if(r(c.next())){h++;
+j=c.ma(function(l){return!l.W()&&!(l.k&n&&l.d==="auto")});if(r(c.next())){h++;i=c.ma(function(l){return!l.Ca()})}}else c.D()};a=c.next();){d=a.k;e=a.d;if(d&(m|p)&&!g){c.D();v()}else if(t(a)&&!b.fill){b.fill=true;v()}else if(d&n&&this.fb[e]&&!b.repeat){b.repeat={f:e};if(a=c.next())if(a.k&n&&this.fb[a.d])b.repeat.Ob=a.d;else c.D()}else if(d&k.URL&&!b.src)b.src=e;else return null}if(!b.src||!g||g.length<1||g.length>4||j&&j.length>4||h===1&&j.length<1||i&&i.length>4||h===2&&i.length<1)return null;if(!b.repeat)b.repeat=
+{f:"stretch"};if(!b.repeat.Ob)b.repeat.Ob=b.repeat.f;a=function(l,q){return{t:q(l[0]),r:q(l[1]||l[0]),b:q(l[2]||l[0]),l:q(l[3]||l[1]||l[0])}};b.slice=a(g,function(l){return f.n(l.k&m?l.d+"px":l.d)});if(j&&j[0])b.J=a(j,function(l){return l.W()?f.n(l.d):l.d});if(i&&i[0])b.Da=a(i,function(l){return l.Ca()?f.n(l.d):l.d})}return b}});f.Ic=f.B.ka({wa:"box-shadow",Fa:"boxShadow",la:function(a){var b,c=f.n,d=f.v.qa,e;if(a){e=new f.v(a);b={Da:[],Bb:[]};for(a=function(){for(var g,j,i,h,k,n;g=e.next();){i=g.d;
+j=g.k;if(j&d.pa&&i===",")break;else if(g.Ca()&&!k){e.D();k=e.ma(function(m){return!m.Ca()})}else if(j&d.z&&!h)h=i;else if(j&d.na&&i==="inset"&&!n)n=true;else return false}g=k&&k.length;if(g>1&&g<5){(n?b.Bb:b.Da).push({fe:c(k[0].d),ge:c(k[1].d),blur:c(k[2]?k[2].d:"0"),Vd:c(k[3]?k[3].d:"0"),color:f.ha(h||"currentColor")});return true}return false};a(););}return b&&(b.Bb.length||b.Da.length)?b:null}});f.Uc=f.B.ka({ia:f.B.va(function(){var a=this.e.currentStyle;return a.visibility+"|"+a.display}),la:function(){var a=
+this.e,b=a.runtimeStyle;a=a.currentStyle;var c=b.visibility,d;b.visibility="";d=a.visibility;b.visibility=c;return{ce:d!=="hidden",nd:a.display!=="none"}},i:function(){return false}});f.u={R:function(a){function b(c,d,e,g){this.e=c;this.s=d;this.g=e;this.parent=g}f.p.Eb(b.prototype,f.u,a);return b},Cb:false,Q:function(){return false},Ea:f.aa,Lb:function(){this.m();this.i()&&this.V()},ib:function(){this.Cb=true},Mb:function(){this.i()?this.V():this.m()},sb:function(a,b){this.vc(a);for(var c=this.ra||
+(this.ra=[]),d=a+1,e=c.length,g;d<e;d++)if(g=c[d])break;c[a]=b;this.I().insertBefore(b,g||null)},za:function(a){var b=this.ra;return b&&b[a]||null},vc:function(a){var b=this.za(a),c=this.Ta;if(b&&c){c.removeChild(b);this.ra[a]=null}},Aa:function(a,b,c,d){var e=this.rb||(this.rb={}),g=e[a];if(!g){g=e[a]=f.p.Za("shape");if(b)g.appendChild(g[b]=f.p.Za(b));if(d){c=this.za(d);if(!c){this.sb(d,doc.createElement("group"+d));c=this.za(d)}}c.appendChild(g);a=g.style;a.position="absolute";a.left=a.top=0;a.behavior=
+"url(#default#VML)"}return g},vb:function(a){var b=this.rb,c=b&&b[a];if(c){c.parentNode.removeChild(c);delete b[a]}return!!c},kc:function(a){var b=this.e,c=this.s.o(),d=c.h,e=c.f,g,j,i,h,k,n;c=a.x.tl.a(b,d);g=a.y.tl.a(b,e);j=a.x.tr.a(b,d);i=a.y.tr.a(b,e);h=a.x.br.a(b,d);k=a.y.br.a(b,e);n=a.x.bl.a(b,d);a=a.y.bl.a(b,e);d=Math.min(d/(c+j),e/(i+k),d/(n+h),e/(g+a));if(d<1){c*=d;g*=d;j*=d;i*=d;h*=d;k*=d;n*=d;a*=d}return{x:{tl:c,tr:j,br:h,bl:n},y:{tl:g,tr:i,br:k,bl:a}}},ya:function(a,b,c){b=b||1;var d,e,
+g=this.s.o();e=g.h*b;g=g.f*b;var j=this.g.G,i=Math.floor,h=Math.ceil,k=a?a.Jb*b:0,n=a?a.Ib*b:0,m=a?a.tb*b:0;a=a?a.Db*b:0;var p,r,t,v,l;if(c||j.i()){d=this.kc(c||j.j());c=d.x.tl*b;j=d.y.tl*b;p=d.x.tr*b;r=d.y.tr*b;t=d.x.br*b;v=d.y.br*b;l=d.x.bl*b;b=d.y.bl*b;e="m"+i(a)+","+i(j)+"qy"+i(c)+","+i(k)+"l"+h(e-p)+","+i(k)+"qx"+h(e-n)+","+i(r)+"l"+h(e-n)+","+h(g-v)+"qy"+h(e-t)+","+h(g-m)+"l"+i(l)+","+h(g-m)+"qx"+i(a)+","+h(g-b)+" x e"}else e="m"+i(a)+","+i(k)+"l"+h(e-n)+","+i(k)+"l"+h(e-n)+","+h(g-m)+"l"+i(a)+
+","+h(g-m)+"xe";return e},I:function(){var a=this.parent.za(this.N),b;if(!a){a=doc.createElement(this.Ya);b=a.style;b.position="absolute";b.top=b.left=0;this.parent.sb(this.N,a)}return a},mc:function(){var a=this.e,b=a.currentStyle,c=a.runtimeStyle,d=a.tagName,e=f.O===6,g;if(e&&(d in f.cc||d==="FIELDSET")||d==="BUTTON"||d==="INPUT"&&a.type in f.Gd){c.borderWidth="";d=this.g.w.wc;for(g=d.length;g--;){e=d[g];c["padding"+e]="";c["padding"+e]=f.n(b["padding"+e]).a(a)+f.n(b["border"+e+"Width"]).a(a)+(f.O!==
+8&&g%2?1:0)}c.borderWidth=0}else if(e){if(a.childNodes.length!==1||a.firstChild.tagName!=="ie6-mask"){b=doc.createElement("ie6-mask");d=b.style;d.visibility="visible";for(d.zoom=1;d=a.firstChild;)b.appendChild(d);a.appendChild(b);c.visibility="hidden"}}else c.borderColor="transparent"},ie:function(){},m:function(){this.parent.vc(this.N);delete this.rb;delete this.ra}};f.Rc=f.u.R({i:function(){var a=this.ed;for(var b in a)if(a.hasOwnProperty(b)&&a[b].i())return true;return false},Q:function(){return this.g.Pb.H()},
+ib:function(){if(this.i()){var a=this.jc(),b=a,c;a=a.currentStyle;var d=a.position,e=this.I().style,g=0,j=0;j=this.s.o();var i=j.Hd;if(d==="fixed"&&f.O>6){g=j.x*i;j=j.y*i;b=d}else{do b=b.offsetParent;while(b&&b.currentStyle.position==="static");if(b){c=b.getBoundingClientRect();b=b.currentStyle;g=(j.x-c.left)*i-(parseFloat(b.borderLeftWidth)||0);j=(j.y-c.top)*i-(parseFloat(b.borderTopWidth)||0)}else{b=doc.documentElement;g=(j.x+b.scrollLeft-b.clientLeft)*i;j=(j.y+b.scrollTop-b.clientTop)*i}b="absolute"}e.position=
+b;e.left=g;e.top=j;e.zIndex=d==="static"?-1:a.zIndex;this.Cb=true}},Mb:f.aa,Nb:function(){var a=this.g.Pb.j();this.I().style.display=a.ce&&a.nd?"":"none"},Lb:function(){this.i()?this.Nb():this.m()},jc:function(){var a=this.e;return a.tagName in f.Ac?a.offsetParent:a},I:function(){var a=this.Ta,b;if(!a){b=this.jc();a=this.Ta=doc.createElement("css3-container");a.style.direction="ltr";this.Nb();b.parentNode.insertBefore(a,b)}return a},ab:f.aa,m:function(){var a=this.Ta,b;if(a&&(b=a.parentNode))b.removeChild(a);
+delete this.Ta;delete this.ra}});f.Fc=f.u.R({N:2,Ya:"background",Q:function(){var a=this.g;return a.C.H()||a.G.H()},i:function(){var a=this.g;return a.q.i()||a.G.i()||a.C.i()||a.ga.i()&&a.ga.j().Bb},V:function(){var a=this.s.o();if(a.h&&a.f){this.od();this.pd()}},od:function(){var a=this.g.C.j(),b=this.s.o(),c=this.e,d=a&&a.color,e,g;if(d&&d.fa()>0){this.lc();a=this.Aa("bgColor","fill",this.I(),1);e=b.h;b=b.f;a.stroked=false;a.coordsize=e*2+","+b*2;a.coordorigin="1,1";a.path=this.ya(null,2);g=a.style;
+g.width=e;g.height=b;a.fill.color=d.U(c);c=d.fa();if(c<1)a.fill.opacity=c}else this.vb("bgColor")},pd:function(){var a=this.g.C.j(),b=this.s.o();a=a&&a.M;var c,d,e,g,j;if(a){this.lc();d=b.h;e=b.f;for(j=a.length;j--;){b=a[j];c=this.Aa("bgImage"+j,"fill",this.I(),2);c.stroked=false;c.fill.type="tile";c.fillcolor="none";c.coordsize=d*2+","+e*2;c.coordorigin="1,1";c.path=this.ya(0,2);g=c.style;g.width=d;g.height=e;if(b.P==="linear-gradient")this.bd(c,b);else{c.fill.src=b.Ab;this.Nd(c,j)}}}for(j=a?a.length:
+0;this.vb("bgImage"+j++););},Nd:function(a,b){var c=this;f.p.Rb(a.fill.src,function(d){var e=c.e,g=c.s.o(),j=g.h;g=g.f;if(j&&g){var i=a.fill,h=c.g,k=h.w.j(),n=k&&k.J;k=n?n.t.a(e):0;var m=n?n.r.a(e):0,p=n?n.b.a(e):0;n=n?n.l.a(e):0;h=h.C.j().M[b];e=h.$?h.$.coords(e,j-d.h-n-m,g-d.f-k-p):{x:0,y:0};h=h.bb;p=m=0;var r=j+1,t=g+1,v=f.O===8?0:1;n=Math.round(e.x)+n+0.5;k=Math.round(e.y)+k+0.5;i.position=n/j+","+k/g;i.size.x=1;i.size=d.h+"px,"+d.f+"px";if(h&&h!=="repeat"){if(h==="repeat-x"||h==="no-repeat"){m=
+k+1;t=k+d.f+v}if(h==="repeat-y"||h==="no-repeat"){p=n+1;r=n+d.h+v}a.style.clip="rect("+m+"px,"+r+"px,"+t+"px,"+p+"px)"}}})},bd:function(a,b){var c=this.e,d=this.s.o(),e=d.h,g=d.f;a=a.fill;d=b.ca;var j=d.length,i=Math.PI,h=f.Na,k=h.tc,n=h.dc;b=h.gc(c,e,g,b);h=b.sa;var m=b.xc,p=b.yc,r=b.Wd,t=b.Xd,v=b.rd,l=b.sd,q=b.kd,s=b.ld;b=b.rc;e=h%90?Math.atan2(q*e/g,s)/i*180:h+90;e+=180;e%=360;v=k(r,t,h,v,l);g=n(r,t,v[0],v[1]);i=[];v=k(m,p,h,r,t);n=n(m,p,v[0],v[1])/g*100;k=[];for(h=0;h<j;h++)k.push(d[h].db?d[h].db.a(c,
+b):h===0?0:h===j-1?b:null);for(h=1;h<j;h++){if(k[h]===null){m=k[h-1];b=h;do p=k[++b];while(p===null);k[h]=m+(p-m)/(b-h+1)}k[h]=Math.max(k[h],k[h-1])}for(h=0;h<j;h++)i.push(n+k[h]/g*100+"% "+d[h].color.U(c));a.angle=e;a.type="gradient";a.method="sigma";a.color=d[0].color.U(c);a.color2=d[j-1].color.U(c);if(a.colors)a.colors.value=i.join(",");else a.colors=i.join(",")},lc:function(){var a=this.e.runtimeStyle;a.backgroundImage="url(about:blank)";a.backgroundColor="transparent"},m:function(){f.u.m.call(this);
+var a=this.e.runtimeStyle;a.backgroundImage=a.backgroundColor=""}});f.Gc=f.u.R({N:4,Ya:"border",Q:function(){var a=this.g;return a.w.H()||a.G.H()},i:function(){var a=this.g;return a.G.i()&&!a.q.i()&&a.w.i()},V:function(){var a=this.e,b=this.g.w.j(),c=this.s.o(),d=c.h;c=c.f;var e,g,j,i,h;if(b){this.mc();b=this.wd(2);i=0;for(h=b.length;i<h;i++){j=b[i];e=this.Aa("borderPiece"+i,j.stroke?"stroke":"fill",this.I());e.coordsize=d*2+","+c*2;e.coordorigin="1,1";e.path=j.path;g=e.style;g.width=d;g.height=c;
+e.filled=!!j.fill;e.stroked=!!j.stroke;if(j.stroke){e=e.stroke;e.weight=j.Qb+"px";e.color=j.color.U(a);e.dashstyle=j.stroke==="dashed"?"2 2":j.stroke==="dotted"?"1 1":"solid";e.linestyle=j.stroke==="double"&&j.Qb>2?"ThinThin":"Single"}else e.fill.color=j.fill.U(a)}for(;this.vb("borderPiece"+i++););}},wd:function(a){var b=this.e,c,d,e,g=this.g.w,j=[],i,h,k,n,m=Math.round,p,r,t;if(g.i()){c=g.j();g=c.J;r=c.Zd;t=c.gd;if(c.ee&&c.$d&&c.hd){if(t.t.fa()>0){c=g.t.a(b);k=c/2;j.push({path:this.ya({Jb:k,Ib:k,
+tb:k,Db:k},a),stroke:r.t,color:t.t,Qb:c})}}else{a=a||1;c=this.s.o();d=c.h;e=c.f;c=m(g.t.a(b));k=m(g.r.a(b));n=m(g.b.a(b));b=m(g.l.a(b));var v={t:c,r:k,b:n,l:b};b=this.g.G;if(b.i())p=this.kc(b.j());i=Math.floor;h=Math.ceil;var l=function(o,u){return p?p[o][u]:0},q=function(o,u,x,y,z,B){var E=l("x",o),D=l("y",o),C=o.charAt(1)==="r";o=o.charAt(0)==="b";return E>0&&D>0?(B?"al":"ae")+(C?h(d-E):i(E))*a+","+(o?h(e-D):i(D))*a+","+(i(E)-u)*a+","+(i(D)-x)*a+","+y*65535+","+2949075*(z?1:-1):(B?"m":"l")+(C?d-
+u:u)*a+","+(o?e-x:x)*a},s=function(o,u,x,y){var z=o==="t"?i(l("x","tl"))*a+","+h(u)*a:o==="r"?h(d-u)*a+","+i(l("y","tr"))*a:o==="b"?h(d-l("x","br"))*a+","+i(e-u)*a:i(u)*a+","+h(e-l("y","bl"))*a;o=o==="t"?h(d-l("x","tr"))*a+","+h(u)*a:o==="r"?h(d-u)*a+","+h(e-l("y","br"))*a:o==="b"?i(l("x","bl"))*a+","+i(e-u)*a:i(u)*a+","+i(l("y","tl"))*a;return x?(y?"m"+o:"")+"l"+z:(y?"m"+z:"")+"l"+o};b=function(o,u,x,y,z,B){var E=o==="l"||o==="r",D=v[o],C,F;if(D>0&&r[o]!=="none"&&t[o].fa()>0){C=v[E?o:u];u=v[E?u:
+o];F=v[E?o:x];x=v[E?x:o];if(r[o]==="dashed"||r[o]==="dotted"){j.push({path:q(y,C,u,B+45,0,1)+q(y,0,0,B,1,0),fill:t[o]});j.push({path:s(o,D/2,0,1),stroke:r[o],Qb:D,color:t[o]});j.push({path:q(z,F,x,B,0,1)+q(z,0,0,B-45,1,0),fill:t[o]})}else j.push({path:q(y,C,u,B+45,0,1)+s(o,D,0,0)+q(z,F,x,B,0,0)+(r[o]==="double"&&D>2?q(z,F-i(F/3),x-i(x/3),B-45,1,0)+s(o,h(D/3*2),1,0)+q(y,C-i(C/3),u-i(u/3),B,1,0)+"x "+q(y,i(C/3),i(u/3),B+45,0,1)+s(o,i(D/3),1,0)+q(z,i(F/3),i(x/3),B,0,0):"")+q(z,0,0,B-45,1,0)+s(o,0,1,
+0)+q(y,0,0,B,1,0),fill:t[o]})}};b("t","l","r","tl","tr",90);b("r","t","b","tr","br",0);b("b","r","l","br","bl",-90);b("l","b","t","bl","tl",-180)}}return j},m:function(){if(this.ec||!this.g.q.i())this.e.runtimeStyle.borderColor="";f.u.m.call(this)}});f.Tb=f.u.R({N:5,Md:["t","tr","r","br","b","bl","l","tl","c"],Q:function(){return this.g.q.H()},i:function(){return this.g.q.i()},V:function(){this.I();var a=this.g.q.j(),b=this.g.w.j(),c=this.s.o(),d=this.e,e=this.uc;f.p.Rb(a.src,function(g){function j(s,
+o,u,x,y){s=e[s].style;var z=Math.max;s.width=z(o,0);s.height=z(u,0);s.left=x;s.top=y}function i(s,o,u){for(var x=0,y=s.length;x<y;x++)e[s[x]].imagedata[o]=u}var h=c.h,k=c.f,n=f.n("0"),m=a.J||(b?b.J:{t:n,r:n,b:n,l:n});n=m.t.a(d);var p=m.r.a(d),r=m.b.a(d);m=m.l.a(d);var t=a.slice,v=t.t.a(d),l=t.r.a(d),q=t.b.a(d);t=t.l.a(d);j("tl",m,n,0,0);j("t",h-m-p,n,m,0);j("tr",p,n,h-p,0);j("r",p,k-n-r,h-p,n);j("br",p,r,h-p,k-r);j("b",h-m-p,r,m,k-r);j("bl",m,r,0,k-r);j("l",m,k-n-r,0,n);j("c",h-m-p,k-n-r,m,n);i(["tl",
+"t","tr"],"cropBottom",(g.f-v)/g.f);i(["tl","l","bl"],"cropRight",(g.h-t)/g.h);i(["bl","b","br"],"cropTop",(g.f-q)/g.f);i(["tr","r","br"],"cropLeft",(g.h-l)/g.h);i(["l","r","c"],"cropTop",v/g.f);i(["l","r","c"],"cropBottom",q/g.f);i(["t","b","c"],"cropLeft",t/g.h);i(["t","b","c"],"cropRight",l/g.h);e.c.style.display=a.fill?"":"none"},this)},I:function(){var a=this.parent.za(this.N),b,c,d,e=this.Md,g=e.length;if(!a){a=doc.createElement("border-image");b=a.style;b.position="absolute";this.uc={};for(d=
+0;d<g;d++){c=this.uc[e[d]]=f.p.Za("rect");c.appendChild(f.p.Za("imagedata"));b=c.style;b.behavior="url(#default#VML)";b.position="absolute";b.top=b.left=0;c.imagedata.src=this.g.q.j().src;c.stroked=false;c.filled=false;a.appendChild(c)}this.parent.sb(this.N,a)}return a},Ea:function(){if(this.i()){var a=this.e,b=a.runtimeStyle,c=this.g.q.j().J;b.borderStyle="solid";if(c){b.borderTopWidth=c.t.a(a)+"px";b.borderRightWidth=c.r.a(a)+"px";b.borderBottomWidth=c.b.a(a)+"px";b.borderLeftWidth=c.l.a(a)+"px"}this.mc()}},
+m:function(){var a=this.e.runtimeStyle;a.borderStyle="";if(this.ec||!this.g.w.i())a.borderColor=a.borderWidth="";f.u.m.call(this)}});f.Hc=f.u.R({N:1,Ya:"outset-box-shadow",Q:function(){var a=this.g;return a.ga.H()||a.G.H()},i:function(){var a=this.g.ga;return a.i()&&a.j().Da[0]},V:function(){function a(C,F,O,H,M,P,I){C=b.Aa("shadow"+C+F,"fill",d,j-C);F=C.fill;C.coordsize=n*2+","+m*2;C.coordorigin="1,1";C.stroked=false;C.filled=true;F.color=M.U(c);if(P){F.type="gradienttitle";F.color2=F.color;F.opacity=
+0}C.path=I;l=C.style;l.left=O;l.top=H;l.width=n;l.height=m;return C}var b=this,c=this.e,d=this.I(),e=this.g,g=e.ga.j().Da;e=e.G.j();var j=g.length,i=j,h,k=this.s.o(),n=k.h,m=k.f;k=f.O===8?1:0;for(var p=["tl","tr","br","bl"],r,t,v,l,q,s,o,u,x,y,z,B,E,D;i--;){t=g[i];q=t.fe.a(c);s=t.ge.a(c);h=t.Vd.a(c);o=t.blur.a(c);t=t.color;u=-h-o;if(!e&&o)e=f.jb.Dc;u=this.ya({Jb:u,Ib:u,tb:u,Db:u},2,e);if(o){x=(h+o)*2+n;y=(h+o)*2+m;z=x?o*2/x:0;B=y?o*2/y:0;if(o-h>n/2||o-h>m/2)for(h=4;h--;){r=p[h];E=r.charAt(0)==="b";
+D=r.charAt(1)==="r";r=a(i,r,q,s,t,o,u);v=r.fill;v.focusposition=(D?1-z:z)+","+(E?1-B:B);v.focussize="0,0";r.style.clip="rect("+((E?y/2:0)+k)+"px,"+(D?x:x/2)+"px,"+(E?y:y/2)+"px,"+((D?x/2:0)+k)+"px)"}else{r=a(i,"",q,s,t,o,u);v=r.fill;v.focusposition=z+","+B;v.focussize=1-z*2+","+(1-B*2)}}else{r=a(i,"",q,s,t,o,u);q=t.fa();if(q<1)r.fill.opacity=q}}}});f.Pc=f.u.R({N:6,Ya:"imgEl",Q:function(){var a=this.g;return this.e.src!==this.Xc||a.G.H()},i:function(){var a=this.g;return a.G.i()||a.C.qc()},V:function(){this.Xc=
+j;this.Cd();var a=this.Aa("img","fill",this.I()),b=a.fill,c=this.s.o(),d=c.h;c=c.f;var e=this.g.w.j(),g=e&&e.J;e=this.e;var j=e.src,i=Math.round,h=e.currentStyle,k=f.n;if(!g||f.O<7){g=f.n("0");g={t:g,r:g,b:g,l:g}}a.stroked=false;b.type="frame";b.src=j;b.position=(d?0.5/d:0)+","+(c?0.5/c:0);a.coordsize=d*2+","+c*2;a.coordorigin="1,1";a.path=this.ya({Jb:i(g.t.a(e)+k(h.paddingTop).a(e)),Ib:i(g.r.a(e)+k(h.paddingRight).a(e)),tb:i(g.b.a(e)+k(h.paddingBottom).a(e)),Db:i(g.l.a(e)+k(h.paddingLeft).a(e))},
+2);a=a.style;a.width=d;a.height=c},Cd:function(){this.e.runtimeStyle.filter="alpha(opacity=0)"},m:function(){f.u.m.call(this);this.e.runtimeStyle.filter=""}});f.Oc=f.u.R({ib:f.aa,Mb:f.aa,Nb:f.aa,Lb:f.aa,Ld:/^,+|,+$/g,Fd:/,+/g,gb:function(a,b){(this.pb||(this.pb=[]))[a]=b||void 0},ab:function(){var a=this.pb,b;if(a&&(b=a.join(",").replace(this.Ld,"").replace(this.Fd,","))!==this.Wc)this.Wc=this.e.runtimeStyle.background=b},m:function(){this.e.runtimeStyle.background="";delete this.pb}});f.Mc=f.u.R({ua:1,
+Q:function(){return this.g.C.H()},i:function(){var a=this.g;return a.C.i()||a.q.i()},V:function(){var a=this.g.C.j(),b,c,d=0,e,g;if(a){b=[];if(c=a.M)for(;e=c[d++];)if(e.P==="linear-gradient"){g=this.vd(e.Wa);g=(e.Xa||f.Ka.Kc).a(this.e,g.h,g.f,g.h,g.f);b.push("url(data:image/svg+xml,"+escape(this.xd(e,g.h,g.f))+") "+this.dd(e.$)+" / "+g.h+"px "+g.f+"px "+(e.bc||"")+" "+(e.Wa||"")+" "+(e.ub||""))}else b.push(e.Hb);a.color&&b.push(a.color.Y);this.parent.gb(this.ua,b.join(","))}},dd:function(a){return a?
+a.X.map(function(b){return b.d}).join(" "):"0 0"},vd:function(a){var b=this.e,c=this.s.o(),d=c.h;c=c.f;var e;if(a!=="border-box")if((e=this.g.w.j())&&(e=e.J)){d-=e.l.a(b)+e.l.a(b);c-=e.t.a(b)+e.b.a(b)}if(a==="content-box"){a=f.n;e=b.currentStyle;d-=a(e.paddingLeft).a(b)+a(e.paddingRight).a(b);c-=a(e.paddingTop).a(b)+a(e.paddingBottom).a(b)}return{h:d,f:c}},xd:function(a,b,c){var d=this.e,e=a.ca,g=e.length,j=f.Na.gc(d,b,c,a);a=j.xc;var i=j.yc,h=j.td,k=j.ud;j=j.rc;var n,m,p,r,t;n=[];for(m=0;m<g;m++)n.push(e[m].db?
+e[m].db.a(d,j):m===0?0:m===g-1?j:null);for(m=1;m<g;m++)if(n[m]===null){r=n[m-1];p=m;do t=n[++p];while(t===null);n[m]=r+(t-r)/(p-m+1)}b=['<svg width="'+b+'" height="'+c+'" xmlns="http://www.w3.org/2000/svg"><defs><linearGradient id="g" gradientUnits="userSpaceOnUse" x1="'+a/b*100+'%" y1="'+i/c*100+'%" x2="'+h/b*100+'%" y2="'+k/c*100+'%">'];for(m=0;m<g;m++)b.push('<stop offset="'+n[m]/j+'" stop-color="'+e[m].color.U(d)+'" stop-opacity="'+e[m].color.fa()+'"/>');b.push('</linearGradient></defs><rect width="100%" height="100%" fill="url(#g)"/></svg>');
+return b.join("")},m:function(){this.parent.gb(this.ua)}});f.Nc=f.u.R({T:"repeat",Sc:"stretch",Qc:"round",ua:0,Q:function(){return this.g.q.H()},i:function(){return this.g.q.i()},V:function(){var a=this,b=a.g.q.j(),c=a.g.w.j(),d=a.s.o(),e=b.repeat,g=e.f,j=e.Ob,i=a.e,h=0;f.p.Rb(b.src,function(k){function n(Q,R,U,V,W,Y,X,S,w,A){K.push('<pattern patternUnits="userSpaceOnUse" id="pattern'+G+'" x="'+(g===l?Q+U/2-w/2:Q)+'" y="'+(j===l?R+V/2-A/2:R)+'" width="'+w+'" height="'+A+'"><svg width="'+w+'" height="'+
+A+'" viewBox="'+W+" "+Y+" "+X+" "+S+'" preserveAspectRatio="none"><image xlink:href="'+v+'" x="0" y="0" width="'+r+'" height="'+t+'" /></svg></pattern>');J.push('<rect x="'+Q+'" y="'+R+'" width="'+U+'" height="'+V+'" fill="url(#pattern'+G+')" />');G++}var m=d.h,p=d.f,r=k.h,t=k.f,v=a.Dd(b.src,r,t),l=a.T,q=a.Sc;k=a.Qc;var s=Math.ceil,o=f.n("0"),u=b.J||(c?c.J:{t:o,r:o,b:o,l:o});o=u.t.a(i);var x=u.r.a(i),y=u.b.a(i);u=u.l.a(i);var z=b.slice,B=z.t.a(i),E=z.r.a(i),D=z.b.a(i);z=z.l.a(i);var C=m-u-x,F=p-o-
+y,O=r-z-E,H=t-B-D,M=g===q?C:O*o/B,P=j===q?F:H*x/E,I=g===q?C:O*y/D;q=j===q?F:H*u/z;var K=[],J=[],G=0;if(g===k){M-=(M-(C%M||M))/s(C/M);I-=(I-(C%I||I))/s(C/I)}if(j===k){P-=(P-(F%P||P))/s(F/P);q-=(q-(F%q||q))/s(F/q)}k=['<svg width="'+m+'" height="'+p+'" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink">'];n(0,0,u,o,0,0,z,B,u,o);n(u,0,C,o,z,0,O,B,M,o);n(m-x,0,x,o,r-E,0,E,B,x,o);n(0,o,u,F,0,B,z,H,u,q);if(b.fill)n(u,o,C,F,z,B,O,H,M||I||O,q||P||H);n(m-x,o,x,F,r-E,B,E,H,x,P);n(0,
+p-y,u,y,0,t-D,z,D,u,y);n(u,p-y,C,y,z,t-D,O,D,I,y);n(m-x,p-y,x,y,r-E,t-D,E,D,x,y);k.push("<defs>"+K.join("\n")+"</defs>"+J.join("\n")+"</svg>");a.parent.gb(a.ua,"url(data:image/svg+xml,"+escape(k.join(""))+") no-repeat border-box border-box");h&&a.parent.ab()},a);h=1},Dd:function(){var a={};return function(b,c,d){var e=a[b],g;if(!e){e=new Image;g=doc.createElement("canvas");e.src=b;g.width=c;g.height=d;g.getContext("2d").drawImage(e,0,0);e=a[b]=g.toDataURL()}return e}}(),Ea:f.Tb.prototype.Ea,m:function(){var a=
+this.e.runtimeStyle;this.parent.gb(this.ua);a.borderColor=a.borderStyle=a.borderWidth=""}});f.kb=function(){function a(l,q){l.className+=" "+q}function b(l){var q=v.slice.call(arguments,1),s=q.length;setTimeout(function(){if(l)for(;s--;)a(l,q[s])},0)}function c(l){var q=v.slice.call(arguments,1),s=q.length;setTimeout(function(){if(l)for(;s--;){var o=q[s];o=t[o]||(t[o]=new RegExp("\\b"+o+"\\b","g"));l.className=l.className.replace(o,"")}},0)}function d(l){function q(){if(!U){var w,A,L=f.ja,T=l.currentStyle,
+N=T.getAttribute(g)==="true",da=T.getAttribute(i)!=="false",ea=T.getAttribute(h)!=="false";S=T.getAttribute(j);S=L>7?S!=="false":S==="true";if(!R){R=1;l.runtimeStyle.zoom=1;T=l;for(var fa=1;T=T.previousSibling;)if(T.nodeType===1){fa=0;break}fa&&a(l,p)}J.cb();if(N&&(A=J.o())&&(w=doc.documentElement||doc.body)&&(A.y>w.clientHeight||A.x>w.clientWidth||A.y+A.f<0||A.x+A.h<0)){if(!Y){Y=1;f.mb.ba(q)}}else{U=1;Y=R=0;f.mb.Ha(q);if(L===9){G={C:new f.Sb(l),q:new f.Ub(l),w:new f.Vb(l)};Q=[G.C,G.q];K=new f.Oc(l,
+J,G);w=[new f.Mc(l,J,G,K),new f.Nc(l,J,G,K)]}else{G={C:new f.Sb(l),w:new f.Vb(l),q:new f.Ub(l),G:new f.jb(l),ga:new f.Ic(l),Pb:new f.Uc(l)};Q=[G.C,G.w,G.q,G.G,G.ga,G.Pb];K=new f.Rc(l,J,G);w=[new f.Hc(l,J,G,K),new f.Fc(l,J,G,K),new f.Gc(l,J,G,K),new f.Tb(l,J,G,K)];l.tagName==="IMG"&&w.push(new f.Pc(l,J,G,K));K.ed=w}I=[K].concat(w);if(w=l.currentStyle.getAttribute(f.F+"watch-ancestors")){w=parseInt(w,10);A=0;for(N=l.parentNode;N&&(w==="NaN"||A++<w);){H(N,"onpropertychange",C);H(N,"onmouseenter",x);
+H(N,"onmouseleave",y);H(N,"onmousedown",z);if(N.tagName in f.fc){H(N,"onfocus",E);H(N,"onblur",D)}N=N.parentNode}}if(S){f.Oa.ba(o);f.Oa.Rd()}o(1)}if(!V){V=1;L<9&&H(l,"onmove",s);H(l,"onresize",s);H(l,"onpropertychange",u);ea&&H(l,"onmouseenter",x);if(ea||da)H(l,"onmouseleave",y);da&&H(l,"onmousedown",z);if(l.tagName in f.fc){H(l,"onfocus",E);H(l,"onblur",D)}f.Qa.ba(s);f.L.ba(M)}J.hb()}}function s(){J&&J.Ad()&&o()}function o(w){if(!X)if(U){var A,L=I.length;F();for(A=0;A<L;A++)I[A].Ea();if(w||J.Od())for(A=
+0;A<L;A++)I[A].ib();if(w||J.Td())for(A=0;A<L;A++)I[A].Mb();K.ab();O()}else R||q()}function u(){var w,A=I.length,L;w=event;if(!X&&!(w&&w.propertyName in r))if(U){F();for(w=0;w<A;w++)I[w].Ea();for(w=0;w<A;w++){L=I[w];L.Cb||L.ib();L.Q()&&L.Lb()}K.ab();O()}else R||q()}function x(){b(l,k)}function y(){c(l,k,n)}function z(){b(l,n);f.lb.ba(B)}function B(){c(l,n);f.lb.Ha(B)}function E(){b(l,m)}function D(){c(l,m)}function C(){var w=event.propertyName;if(w==="className"||w==="id")u()}function F(){J.cb();for(var w=
+Q.length;w--;)Q[w].cb()}function O(){for(var w=Q.length;w--;)Q[w].hb();J.hb()}function H(w,A,L){w.attachEvent(A,L);W.push([w,A,L])}function M(){if(V){for(var w=W.length,A;w--;){A=W[w];A[0].detachEvent(A[1],A[2])}f.L.Ha(M);V=0;W=[]}}function P(){if(!X){var w,A;M();X=1;if(I){w=0;for(A=I.length;w<A;w++){I[w].ec=1;I[w].m()}}S&&f.Oa.Ha(o);f.Qa.Ha(o);I=J=G=Q=l=null}}var I,K,J=new ha(l),G,Q,R,U,V,W=[],Y,X,S;this.Ed=q;this.update=o;this.m=P;this.qd=l}var e={},g=f.F+"lazy-init",j=f.F+"poll",i=f.F+"track-active",
+h=f.F+"track-hover",k=f.La+"hover",n=f.La+"active",m=f.La+"focus",p=f.La+"first-child",r={background:1,bgColor:1,display:1},t={},v=[];d.yd=function(l){var q=f.p.Ba(l);return e[q]||(e[q]=new d(l))};d.m=function(l){l=f.p.Ba(l);var q=e[l];if(q){q.m();delete e[l]}};d.md=function(){var l=[],q;if(e){for(var s in e)if(e.hasOwnProperty(s)){q=e[s];l.push(q.qd);q.m()}e={}}return l};return d}();f.supportsVML=f.zc;f.attach=function(a){f.ja<10&&f.zc&&f.kb.yd(a).Ed()};f.detach=function(a){f.kb.m(a)}};
+var $=element;function init(){if(doc.media!=="print"){var a=window.PIE;a&&a.attach($)}}function cleanup(){if(doc.media!=="print"){var a=window.PIE;if(a){a.detach($);$=0}}}$.readyState==="complete"&&init();
+</script>
+</PUBLIC:COMPONENT>
diff --git a/themes/mantra/resources/js/PIE/PIE.js b/themes/mantra/resources/js/PIE/PIE.js
new file mode 100644
index 00000000..d36448a9
--- /dev/null
+++ b/themes/mantra/resources/js/PIE/PIE.js
@@ -0,0 +1,88 @@
+/*
+PIE: CSS3 rendering for IE
+Version 1.0.0
+http://css3pie.com
+Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
+*/
+(function(){
+var doc = document;var f=window.PIE;
+if(!f){f=window.PIE={F:"-pie-",nb:"Pie",La:"pie_",Ac:{TD:1,TH:1},cc:{TABLE:1,THEAD:1,TBODY:1,TFOOT:1,TR:1,INPUT:1,TEXTAREA:1,SELECT:1,OPTION:1,IMG:1,HR:1},fc:{A:1,INPUT:1,TEXTAREA:1,SELECT:1,BUTTON:1},Gd:{submit:1,button:1,reset:1},aa:function(){}};try{doc.execCommand("BackgroundImageCache",false,true)}catch(aa){}for(var ba=4,Z=doc.createElement("div"),ca=Z.getElementsByTagName("i"),ga;Z.innerHTML="<!--[if gt IE "+ ++ba+"]><i></i><![endif]--\>",ca[0];);f.O=ba;if(ba===6)f.F=f.F.replace(/^-/,"");f.ja=
+doc.documentMode||f.O;Z.innerHTML='<v:shape adj="1"/>';ga=Z.firstChild;ga.style.behavior="url(#default#VML)";f.zc=typeof ga.adj==="object";(function(){var a,b=0,c={};f.p={Za:function(d){if(!a){a=doc.createDocumentFragment();a.namespaces.add("css3vml","urn:schemas-microsoft-com:vml")}return a.createElement("css3vml:"+d)},Ba:function(d){return d&&d._pieId||(d._pieId="_"+ ++b)},Eb:function(d){var e,g,j,i,h=arguments;e=1;for(g=h.length;e<g;e++){i=h[e];for(j in i)if(i.hasOwnProperty(j))d[j]=i[j]}return d},
+Rb:function(d,e,g){var j=c[d],i,h;if(j)Object.prototype.toString.call(j)==="[object Array]"?j.push([e,g]):e.call(g,j);else{h=c[d]=[[e,g]];i=new Image;i.onload=function(){j=c[d]={h:i.width,f:i.height};for(var k=0,n=h.length;k<n;k++)h[k][0].call(h[k][1],j);i.onload=null};i.src=d}}}})();f.Na={gc:function(a,b,c,d){function e(){k=j>=90&&j<270?b:0;n=j<180?c:0;m=b-k;p=c-n}function g(){for(;j<0;)j+=360;j%=360}var j=d.sa;d=d.zb;var i,h,k,n,m,p,r,t;if(d){d=d.coords(a,b,c);i=d.x;h=d.y}if(j){j=j.jd();g();e();
+if(!d){i=k;h=n}d=f.Na.tc(i,h,j,m,p);a=d[0];d=d[1]}else if(d){a=b-i;d=c-h}else{i=h=a=0;d=c}r=a-i;t=d-h;if(j===void 0){j=!r?t<0?90:270:!t?r<0?180:0:-Math.atan2(t,r)/Math.PI*180;g();e()}return{sa:j,xc:i,yc:h,td:a,ud:d,Wd:k,Xd:n,rd:m,sd:p,kd:r,ld:t,rc:f.Na.dc(i,h,a,d)}},tc:function(a,b,c,d,e){if(c===0||c===180)return[d,b];else if(c===90||c===270)return[a,e];else{c=Math.tan(-c*Math.PI/180);a=c*a-b;b=-1/c;d=b*d-e;e=b-c;return[(d-a)/e,(c*d-b*a)/e]}},dc:function(a,b,c,d){a=c-a;b=d-b;return Math.abs(a===0?
+b:b===0?a:Math.sqrt(a*a+b*b))}};f.ea=function(){this.Gb=[];this.oc={}};f.ea.prototype={ba:function(a){var b=f.p.Ba(a),c=this.oc,d=this.Gb;if(!(b in c)){c[b]=d.length;d.push(a)}},Ha:function(a){a=f.p.Ba(a);var b=this.oc;if(a&&a in b){delete this.Gb[b[a]];delete b[a]}},xa:function(){for(var a=this.Gb,b=a.length;b--;)a[b]&&a[b]()}};f.Oa=new f.ea;f.Oa.Rd=function(){var a=this,b;if(!a.Sd){b=doc.documentElement.currentStyle.getAttribute(f.F+"poll-interval")||250;(function c(){a.xa();setTimeout(c,b)})();
+a.Sd=1}};(function(){function a(){f.L.xa();window.detachEvent("onunload",a);window.PIE=null}f.L=new f.ea;window.attachEvent("onunload",a);f.L.ta=function(b,c,d){b.attachEvent(c,d);this.ba(function(){b.detachEvent(c,d)})}})();f.Qa=new f.ea;f.L.ta(window,"onresize",function(){f.Qa.xa()});(function(){function a(){f.mb.xa()}f.mb=new f.ea;f.L.ta(window,"onscroll",a);f.Qa.ba(a)})();(function(){function a(){c=f.kb.md()}function b(){if(c){for(var d=0,e=c.length;d<e;d++)f.attach(c[d]);c=0}}var c;if(f.ja<9){f.L.ta(window,
+"onbeforeprint",a);f.L.ta(window,"onafterprint",b)}})();f.lb=new f.ea;f.L.ta(doc,"onmouseup",function(){f.lb.xa()});f.he=function(){function a(h){this.Y=h}var b=doc.createElement("length-calc"),c=doc.body||doc.documentElement,d=b.style,e={},g=["mm","cm","in","pt","pc"],j=g.length,i={};d.position="absolute";d.top=d.left="-9999px";for(c.appendChild(b);j--;){d.width="100"+g[j];e[g[j]]=b.offsetWidth/100}c.removeChild(b);d.width="1em";a.prototype={Kb:/(px|em|ex|mm|cm|in|pt|pc|%)$/,ic:function(){var h=
+this.Jd;if(h===void 0)h=this.Jd=parseFloat(this.Y);return h},yb:function(){var h=this.ae;if(!h)h=this.ae=(h=this.Y.match(this.Kb))&&h[0]||"px";return h},a:function(h,k){var n=this.ic(),m=this.yb();switch(m){case "px":return n;case "%":return n*(typeof k==="function"?k():k)/100;case "em":return n*this.xb(h);case "ex":return n*this.xb(h)/2;default:return n*e[m]}},xb:function(h){var k=h.currentStyle.fontSize,n,m;if(k.indexOf("px")>0)return parseFloat(k);else if(h.tagName in f.cc){m=this;n=h.parentNode;
+return f.n(k).a(n,function(){return m.xb(n)})}else{h.appendChild(b);k=b.offsetWidth;b.parentNode===h&&h.removeChild(b);return k}}};f.n=function(h){return i[h]||(i[h]=new a(h))};return a}();f.Ja=function(){function a(e){this.X=e}var b=f.n("50%"),c={top:1,center:1,bottom:1},d={left:1,center:1,right:1};a.prototype={zd:function(){if(!this.ac){var e=this.X,g=e.length,j=f.v,i=j.qa,h=f.n("0");i=i.na;h=["left",h,"top",h];if(g===1){e.push(new j.ob(i,"center"));g++}if(g===2){i&(e[0].k|e[1].k)&&e[0].d in c&&
+e[1].d in d&&e.push(e.shift());if(e[0].k&i)if(e[0].d==="center")h[1]=b;else h[0]=e[0].d;else if(e[0].W())h[1]=f.n(e[0].d);if(e[1].k&i)if(e[1].d==="center")h[3]=b;else h[2]=e[1].d;else if(e[1].W())h[3]=f.n(e[1].d)}this.ac=h}return this.ac},coords:function(e,g,j){var i=this.zd(),h=i[1].a(e,g);e=i[3].a(e,j);return{x:i[0]==="right"?g-h:h,y:i[2]==="bottom"?j-e:e}}};return a}();f.Ka=function(){function a(b,c){this.h=b;this.f=c}a.prototype={a:function(b,c,d,e,g){var j=this.h,i=this.f,h=c/d;e=e/g;if(j===
+"contain"){j=e>h?c:d*e;i=e>h?c/e:d}else if(j==="cover"){j=e<h?c:d*e;i=e<h?c/e:d}else if(j==="auto"){i=i==="auto"?g:i.a(b,d);j=i*e}else{j=j.a(b,c);i=i==="auto"?j/e:i.a(b,d)}return{h:j,f:i}}};a.Kc=new a("auto","auto");return a}();f.Ec=function(){function a(b){this.Y=b}a.prototype={Kb:/[a-z]+$/i,yb:function(){return this.ad||(this.ad=this.Y.match(this.Kb)[0].toLowerCase())},jd:function(){var b=this.Vc,c;if(b===undefined){b=this.yb();c=parseFloat(this.Y,10);b=this.Vc=b==="deg"?c:b==="rad"?c/Math.PI*180:
+b==="grad"?c/400*360:b==="turn"?c*360:0}return b}};return a}();f.Jc=function(){function a(c){this.Y=c}var b={};a.Qd=/\s*rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d+|\d*\.\d+)\s*\)\s*/;a.Fb={aliceblue:"F0F8FF",antiquewhite:"FAEBD7",aqua:"0FF",aquamarine:"7FFFD4",azure:"F0FFFF",beige:"F5F5DC",bisque:"FFE4C4",black:"000",blanchedalmond:"FFEBCD",blue:"00F",blueviolet:"8A2BE2",brown:"A52A2A",burlywood:"DEB887",cadetblue:"5F9EA0",chartreuse:"7FFF00",chocolate:"D2691E",coral:"FF7F50",cornflowerblue:"6495ED",
+cornsilk:"FFF8DC",crimson:"DC143C",cyan:"0FF",darkblue:"00008B",darkcyan:"008B8B",darkgoldenrod:"B8860B",darkgray:"A9A9A9",darkgreen:"006400",darkkhaki:"BDB76B",darkmagenta:"8B008B",darkolivegreen:"556B2F",darkorange:"FF8C00",darkorchid:"9932CC",darkred:"8B0000",darksalmon:"E9967A",darkseagreen:"8FBC8F",darkslateblue:"483D8B",darkslategray:"2F4F4F",darkturquoise:"00CED1",darkviolet:"9400D3",deeppink:"FF1493",deepskyblue:"00BFFF",dimgray:"696969",dodgerblue:"1E90FF",firebrick:"B22222",floralwhite:"FFFAF0",
+forestgreen:"228B22",fuchsia:"F0F",gainsboro:"DCDCDC",ghostwhite:"F8F8FF",gold:"FFD700",goldenrod:"DAA520",gray:"808080",green:"008000",greenyellow:"ADFF2F",honeydew:"F0FFF0",hotpink:"FF69B4",indianred:"CD5C5C",indigo:"4B0082",ivory:"FFFFF0",khaki:"F0E68C",lavender:"E6E6FA",lavenderblush:"FFF0F5",lawngreen:"7CFC00",lemonchiffon:"FFFACD",lightblue:"ADD8E6",lightcoral:"F08080",lightcyan:"E0FFFF",lightgoldenrodyellow:"FAFAD2",lightgreen:"90EE90",lightgrey:"D3D3D3",lightpink:"FFB6C1",lightsalmon:"FFA07A",
+lightseagreen:"20B2AA",lightskyblue:"87CEFA",lightslategray:"789",lightsteelblue:"B0C4DE",lightyellow:"FFFFE0",lime:"0F0",limegreen:"32CD32",linen:"FAF0E6",magenta:"F0F",maroon:"800000",mediumauqamarine:"66CDAA",mediumblue:"0000CD",mediumorchid:"BA55D3",mediumpurple:"9370D8",mediumseagreen:"3CB371",mediumslateblue:"7B68EE",mediumspringgreen:"00FA9A",mediumturquoise:"48D1CC",mediumvioletred:"C71585",midnightblue:"191970",mintcream:"F5FFFA",mistyrose:"FFE4E1",moccasin:"FFE4B5",navajowhite:"FFDEAD",
+navy:"000080",oldlace:"FDF5E6",olive:"808000",olivedrab:"688E23",orange:"FFA500",orangered:"FF4500",orchid:"DA70D6",palegoldenrod:"EEE8AA",palegreen:"98FB98",paleturquoise:"AFEEEE",palevioletred:"D87093",papayawhip:"FFEFD5",peachpuff:"FFDAB9",peru:"CD853F",pink:"FFC0CB",plum:"DDA0DD",powderblue:"B0E0E6",purple:"800080",red:"F00",rosybrown:"BC8F8F",royalblue:"4169E1",saddlebrown:"8B4513",salmon:"FA8072",sandybrown:"F4A460",seagreen:"2E8B57",seashell:"FFF5EE",sienna:"A0522D",silver:"C0C0C0",skyblue:"87CEEB",
+slateblue:"6A5ACD",slategray:"708090",snow:"FFFAFA",springgreen:"00FF7F",steelblue:"4682B4",tan:"D2B48C",teal:"008080",thistle:"D8BFD8",tomato:"FF6347",turquoise:"40E0D0",violet:"EE82EE",wheat:"F5DEB3",white:"FFF",whitesmoke:"F5F5F5",yellow:"FF0",yellowgreen:"9ACD32"};a.prototype={parse:function(){if(!this.Ua){var c=this.Y,d;if(d=c.match(a.Qd)){this.Ua="rgb("+d[1]+","+d[2]+","+d[3]+")";this.Yb=parseFloat(d[4])}else{if((d=c.toLowerCase())in a.Fb)c="#"+a.Fb[d];this.Ua=c;this.Yb=c==="transparent"?0:
+1}}},U:function(c){this.parse();return this.Ua==="currentColor"?c.currentStyle.color:this.Ua},fa:function(){this.parse();return this.Yb}};f.ha=function(c){return b[c]||(b[c]=new a(c))};return a}();f.v=function(){function a(c){this.$a=c;this.ch=0;this.X=[];this.Ga=0}var b=a.qa={Ia:1,Wb:2,z:4,Lc:8,Xb:16,na:32,K:64,oa:128,pa:256,Ra:512,Tc:1024,URL:2048};a.ob=function(c,d){this.k=c;this.d=d};a.ob.prototype={Ca:function(){return this.k&b.K||this.k&b.oa&&this.d==="0"},W:function(){return this.Ca()||this.k&
+b.Ra}};a.prototype={de:/\s/,Kd:/^[\+\-]?(\d*\.)?\d+/,url:/^url\(\s*("([^"]*)"|'([^']*)'|([!#$%&*-~]*))\s*\)/i,nc:/^\-?[_a-z][\w-]*/i,Yd:/^("([^"]*)"|'([^']*)')/,Bd:/^#([\da-f]{6}|[\da-f]{3})/i,be:{px:b.K,em:b.K,ex:b.K,mm:b.K,cm:b.K,"in":b.K,pt:b.K,pc:b.K,deg:b.Ia,rad:b.Ia,grad:b.Ia},fd:{rgb:1,rgba:1,hsl:1,hsla:1},next:function(c){function d(p,r){p=new a.ob(p,r);if(!c){k.X.push(p);k.Ga++}return p}function e(){k.Ga++;return null}var g,j,i,h,k=this;if(this.Ga<this.X.length)return this.X[this.Ga++];for(;this.de.test(this.$a.charAt(this.ch));)this.ch++;
+if(this.ch>=this.$a.length)return e();j=this.ch;g=this.$a.substring(this.ch);i=g.charAt(0);switch(i){case "#":if(h=g.match(this.Bd)){this.ch+=h[0].length;return d(b.z,h[0])}break;case '"':case "'":if(h=g.match(this.Yd)){this.ch+=h[0].length;return d(b.Tc,h[2]||h[3]||"")}break;case "/":case ",":this.ch++;return d(b.pa,i);case "u":if(h=g.match(this.url)){this.ch+=h[0].length;return d(b.URL,h[2]||h[3]||h[4]||"")}}if(h=g.match(this.Kd)){i=h[0];this.ch+=i.length;if(g.charAt(i.length)==="%"){this.ch++;
+return d(b.Ra,i+"%")}if(h=g.substring(i.length).match(this.nc)){i+=h[0];this.ch+=h[0].length;return d(this.be[h[0].toLowerCase()]||b.Lc,i)}return d(b.oa,i)}if(h=g.match(this.nc)){i=h[0];this.ch+=i.length;if(i.toLowerCase()in f.Jc.Fb||i==="currentColor"||i==="transparent")return d(b.z,i);if(g.charAt(i.length)==="("){this.ch++;if(i.toLowerCase()in this.fd){g=function(p){return p&&p.k&b.oa};h=function(p){return p&&p.k&(b.oa|b.Ra)};var n=function(p,r){return p&&p.d===r},m=function(){return k.next(1)};
+if((i.charAt(0)==="r"?h(m()):g(m()))&&n(m(),",")&&h(m())&&n(m(),",")&&h(m())&&(i==="rgb"||i==="hsa"||n(m(),",")&&g(m()))&&n(m(),")"))return d(b.z,this.$a.substring(j,this.ch));return e()}return d(b.Xb,i)}return d(b.na,i)}this.ch++;return d(b.Wb,i)},D:function(){return this.X[this.Ga-- -2]},all:function(){for(;this.next(););return this.X},ma:function(c,d){for(var e=[],g,j;g=this.next();){if(c(g)){j=true;this.D();break}e.push(g)}return d&&!j?null:e}};return a}();var ha=function(a){this.e=a};ha.prototype=
+{Z:0,Od:function(){var a=this.qb,b;return!a||(b=this.o())&&(a.x!==b.x||a.y!==b.y)},Td:function(){var a=this.qb,b;return!a||(b=this.o())&&(a.h!==b.h||a.f!==b.f)},hc:function(){var a=this.e,b=a.getBoundingClientRect(),c=f.ja===9,d=f.O===7,e=b.right-b.left;return{x:b.left,y:b.top,h:c||d?a.offsetWidth:e,f:c||d?a.offsetHeight:b.bottom-b.top,Hd:d&&e?a.offsetWidth/e:1}},o:function(){return this.Z?this.Va||(this.Va=this.hc()):this.hc()},Ad:function(){return!!this.qb},cb:function(){++this.Z},hb:function(){if(!--this.Z){if(this.Va)this.qb=
+this.Va;this.Va=null}}};(function(){function a(b){var c=f.p.Ba(b);return function(){if(this.Z){var d=this.$b||(this.$b={});return c in d?d[c]:(d[c]=b.call(this))}else return b.call(this)}}f.B={Z:0,ka:function(b){function c(d){this.e=d;this.Zb=this.ia()}f.p.Eb(c.prototype,f.B,b);c.$c={};return c},j:function(){var b=this.ia(),c=this.constructor.$c;return b?b in c?c[b]:(c[b]=this.la(b)):null},ia:a(function(){var b=this.e,c=this.constructor,d=b.style;b=b.currentStyle;var e=this.wa,g=this.Fa,j=c.Yc||(c.Yc=
+f.F+e);c=c.Zc||(c.Zc=f.nb+g.charAt(0).toUpperCase()+g.substring(1));return d[c]||b.getAttribute(j)||d[g]||b.getAttribute(e)}),i:a(function(){return!!this.j()}),H:a(function(){var b=this.ia(),c=b!==this.Zb;this.Zb=b;return c}),va:a,cb:function(){++this.Z},hb:function(){--this.Z||delete this.$b}}})();f.Sb=f.B.ka({wa:f.F+"background",Fa:f.nb+"Background",cd:{scroll:1,fixed:1,local:1},fb:{"repeat-x":1,"repeat-y":1,repeat:1,"no-repeat":1},sc:{"padding-box":1,"border-box":1,"content-box":1},Pd:{top:1,right:1,
+bottom:1,left:1,center:1},Ud:{contain:1,cover:1},eb:{Ma:"backgroundClip",z:"backgroundColor",da:"backgroundImage",Pa:"backgroundOrigin",S:"backgroundPosition",T:"backgroundRepeat",Sa:"backgroundSize"},la:function(a){function b(s){return s&&s.W()||s.k&k&&s.d in t}function c(s){return s&&(s.W()&&f.n(s.d)||s.d==="auto"&&"auto")}var d=this.e.currentStyle,e,g,j,i=f.v.qa,h=i.pa,k=i.na,n=i.z,m,p,r=0,t=this.Pd,v,l,q={M:[]};if(this.wb()){e=new f.v(a);for(j={};g=e.next();){m=g.k;p=g.d;if(!j.P&&m&i.Xb&&p===
+"linear-gradient"){v={ca:[],P:p};for(l={};g=e.next();){m=g.k;p=g.d;if(m&i.Wb&&p===")"){l.color&&v.ca.push(l);v.ca.length>1&&f.p.Eb(j,v);break}if(m&n){if(v.sa||v.zb){g=e.D();if(g.k!==h)break;e.next()}l={color:f.ha(p)};g=e.next();if(g.W())l.db=f.n(g.d);else e.D()}else if(m&i.Ia&&!v.sa&&!l.color&&!v.ca.length)v.sa=new f.Ec(g.d);else if(b(g)&&!v.zb&&!l.color&&!v.ca.length){e.D();v.zb=new f.Ja(e.ma(function(s){return!b(s)},false))}else if(m&h&&p===","){if(l.color){v.ca.push(l);l={}}}else break}}else if(!j.P&&
+m&i.URL){j.Ab=p;j.P="image"}else if(b(g)&&!j.$){e.D();j.$=new f.Ja(e.ma(function(s){return!b(s)},false))}else if(m&k)if(p in this.fb&&!j.bb)j.bb=p;else if(p in this.sc&&!j.Wa){j.Wa=p;if((g=e.next())&&g.k&k&&g.d in this.sc)j.ub=g.d;else{j.ub=p;e.D()}}else if(p in this.cd&&!j.bc)j.bc=p;else return null;else if(m&n&&!q.color)q.color=f.ha(p);else if(m&h&&p==="/"&&!j.Xa&&j.$){g=e.next();if(g.k&k&&g.d in this.Ud)j.Xa=new f.Ka(g.d);else if(g=c(g)){m=c(e.next());if(!m){m=g;e.D()}j.Xa=new f.Ka(g,m)}else return null}else if(m&
+h&&p===","&&j.P){j.Hb=a.substring(r,e.ch-1);r=e.ch;q.M.push(j);j={}}else return null}if(j.P){j.Hb=a.substring(r);q.M.push(j)}}else this.Bc(f.ja<9?function(){var s=this.eb,o=d[s.S+"X"],u=d[s.S+"Y"],x=d[s.da],y=d[s.z];if(y!=="transparent")q.color=f.ha(y);if(x!=="none")q.M=[{P:"image",Ab:(new f.v(x)).next().d,bb:d[s.T],$:new f.Ja((new f.v(o+" "+u)).all())}]}:function(){var s=this.eb,o=/\s*,\s*/,u=d[s.da].split(o),x=d[s.z],y,z,B,E,D,C;if(x!=="transparent")q.color=f.ha(x);if((E=u.length)&&u[0]!=="none"){x=
+d[s.T].split(o);y=d[s.S].split(o);z=d[s.Pa].split(o);B=d[s.Ma].split(o);s=d[s.Sa].split(o);q.M=[];for(o=0;o<E;o++)if((D=u[o])&&D!=="none"){C=s[o].split(" ");q.M.push({Hb:D+" "+x[o]+" "+y[o]+" / "+s[o]+" "+z[o]+" "+B[o],P:"image",Ab:(new f.v(D)).next().d,bb:x[o],$:new f.Ja((new f.v(y[o])).all()),Wa:z[o],ub:B[o],Xa:new f.Ka(C[0],C[1])})}}});return q.color||q.M[0]?q:null},Bc:function(a){var b=f.ja>8,c=this.eb,d=this.e.runtimeStyle,e=d[c.da],g=d[c.z],j=d[c.T],i,h,k,n;if(e)d[c.da]="";if(g)d[c.z]="";if(j)d[c.T]=
+"";if(b){i=d[c.Ma];h=d[c.Pa];n=d[c.S];k=d[c.Sa];if(i)d[c.Ma]="";if(h)d[c.Pa]="";if(n)d[c.S]="";if(k)d[c.Sa]=""}a=a.call(this);if(e)d[c.da]=e;if(g)d[c.z]=g;if(j)d[c.T]=j;if(b){if(i)d[c.Ma]=i;if(h)d[c.Pa]=h;if(n)d[c.S]=n;if(k)d[c.Sa]=k}return a},ia:f.B.va(function(){return this.wb()||this.Bc(function(){var a=this.e.currentStyle,b=this.eb;return a[b.z]+" "+a[b.da]+" "+a[b.T]+" "+a[b.S+"X"]+" "+a[b.S+"Y"]})}),wb:f.B.va(function(){var a=this.e;return a.style[this.Fa]||a.currentStyle.getAttribute(this.wa)}),
+qc:function(){var a=0;if(f.O<7){a=this.e;a=""+(a.style[f.nb+"PngFix"]||a.currentStyle.getAttribute(f.F+"png-fix"))==="true"}return a},i:f.B.va(function(){return(this.wb()||this.qc())&&!!this.j()})});f.Vb=f.B.ka({wc:["Top","Right","Bottom","Left"],Id:{thin:"1px",medium:"3px",thick:"5px"},la:function(){var a={},b={},c={},d=false,e=true,g=true,j=true;this.Cc(function(){for(var i=this.e.currentStyle,h=0,k,n,m,p,r,t,v;h<4;h++){m=this.wc[h];v=m.charAt(0).toLowerCase();k=b[v]=i["border"+m+"Style"];n=i["border"+
+m+"Color"];m=i["border"+m+"Width"];if(h>0){if(k!==p)g=false;if(n!==r)e=false;if(m!==t)j=false}p=k;r=n;t=m;c[v]=f.ha(n);m=a[v]=f.n(b[v]==="none"?"0":this.Id[m]||m);if(m.a(this.e)>0)d=true}});return d?{J:a,Zd:b,gd:c,ee:j,hd:e,$d:g}:null},ia:f.B.va(function(){var a=this.e,b=a.currentStyle,c;a.tagName in f.Ac&&a.offsetParent.currentStyle.borderCollapse==="collapse"||this.Cc(function(){c=b.borderWidth+"|"+b.borderStyle+"|"+b.borderColor});return c}),Cc:function(a){var b=this.e.runtimeStyle,c=b.borderWidth,
+d=b.borderColor;if(c)b.borderWidth="";if(d)b.borderColor="";a=a.call(this);if(c)b.borderWidth=c;if(d)b.borderColor=d;return a}});(function(){f.jb=f.B.ka({wa:"border-radius",Fa:"borderRadius",la:function(b){var c=null,d,e,g,j,i=false;if(b){e=new f.v(b);var h=function(){for(var k=[],n;(g=e.next())&&g.W();){j=f.n(g.d);n=j.ic();if(n<0)return null;if(n>0)i=true;k.push(j)}return k.length>0&&k.length<5?{tl:k[0],tr:k[1]||k[0],br:k[2]||k[0],bl:k[3]||k[1]||k[0]}:null};if(b=h()){if(g){if(g.k&f.v.qa.pa&&g.d===
+"/")d=h()}else d=b;if(i&&b&&d)c={x:b,y:d}}}return c}});var a=f.n("0");a={tl:a,tr:a,br:a,bl:a};f.jb.Dc={x:a,y:a}})();f.Ub=f.B.ka({wa:"border-image",Fa:"borderImage",fb:{stretch:1,round:1,repeat:1,space:1},la:function(a){var b=null,c,d,e,g,j,i,h=0,k=f.v.qa,n=k.na,m=k.oa,p=k.Ra;if(a){c=new f.v(a);b={};for(var r=function(l){return l&&l.k&k.pa&&l.d==="/"},t=function(l){return l&&l.k&n&&l.d==="fill"},v=function(){g=c.ma(function(l){return!(l.k&(m|p))});if(t(c.next())&&!b.fill)b.fill=true;else c.D();if(r(c.next())){h++;
+j=c.ma(function(l){return!l.W()&&!(l.k&n&&l.d==="auto")});if(r(c.next())){h++;i=c.ma(function(l){return!l.Ca()})}}else c.D()};a=c.next();){d=a.k;e=a.d;if(d&(m|p)&&!g){c.D();v()}else if(t(a)&&!b.fill){b.fill=true;v()}else if(d&n&&this.fb[e]&&!b.repeat){b.repeat={f:e};if(a=c.next())if(a.k&n&&this.fb[a.d])b.repeat.Ob=a.d;else c.D()}else if(d&k.URL&&!b.src)b.src=e;else return null}if(!b.src||!g||g.length<1||g.length>4||j&&j.length>4||h===1&&j.length<1||i&&i.length>4||h===2&&i.length<1)return null;if(!b.repeat)b.repeat=
+{f:"stretch"};if(!b.repeat.Ob)b.repeat.Ob=b.repeat.f;a=function(l,q){return{t:q(l[0]),r:q(l[1]||l[0]),b:q(l[2]||l[0]),l:q(l[3]||l[1]||l[0])}};b.slice=a(g,function(l){return f.n(l.k&m?l.d+"px":l.d)});if(j&&j[0])b.J=a(j,function(l){return l.W()?f.n(l.d):l.d});if(i&&i[0])b.Da=a(i,function(l){return l.Ca()?f.n(l.d):l.d})}return b}});f.Ic=f.B.ka({wa:"box-shadow",Fa:"boxShadow",la:function(a){var b,c=f.n,d=f.v.qa,e;if(a){e=new f.v(a);b={Da:[],Bb:[]};for(a=function(){for(var g,j,i,h,k,n;g=e.next();){i=g.d;
+j=g.k;if(j&d.pa&&i===",")break;else if(g.Ca()&&!k){e.D();k=e.ma(function(m){return!m.Ca()})}else if(j&d.z&&!h)h=i;else if(j&d.na&&i==="inset"&&!n)n=true;else return false}g=k&&k.length;if(g>1&&g<5){(n?b.Bb:b.Da).push({fe:c(k[0].d),ge:c(k[1].d),blur:c(k[2]?k[2].d:"0"),Vd:c(k[3]?k[3].d:"0"),color:f.ha(h||"currentColor")});return true}return false};a(););}return b&&(b.Bb.length||b.Da.length)?b:null}});f.Uc=f.B.ka({ia:f.B.va(function(){var a=this.e.currentStyle;return a.visibility+"|"+a.display}),la:function(){var a=
+this.e,b=a.runtimeStyle;a=a.currentStyle;var c=b.visibility,d;b.visibility="";d=a.visibility;b.visibility=c;return{ce:d!=="hidden",nd:a.display!=="none"}},i:function(){return false}});f.u={R:function(a){function b(c,d,e,g){this.e=c;this.s=d;this.g=e;this.parent=g}f.p.Eb(b.prototype,f.u,a);return b},Cb:false,Q:function(){return false},Ea:f.aa,Lb:function(){this.m();this.i()&&this.V()},ib:function(){this.Cb=true},Mb:function(){this.i()?this.V():this.m()},sb:function(a,b){this.vc(a);for(var c=this.ra||
+(this.ra=[]),d=a+1,e=c.length,g;d<e;d++)if(g=c[d])break;c[a]=b;this.I().insertBefore(b,g||null)},za:function(a){var b=this.ra;return b&&b[a]||null},vc:function(a){var b=this.za(a),c=this.Ta;if(b&&c){c.removeChild(b);this.ra[a]=null}},Aa:function(a,b,c,d){var e=this.rb||(this.rb={}),g=e[a];if(!g){g=e[a]=f.p.Za("shape");if(b)g.appendChild(g[b]=f.p.Za(b));if(d){c=this.za(d);if(!c){this.sb(d,doc.createElement("group"+d));c=this.za(d)}}c.appendChild(g);a=g.style;a.position="absolute";a.left=a.top=0;a.behavior=
+"url(#default#VML)"}return g},vb:function(a){var b=this.rb,c=b&&b[a];if(c){c.parentNode.removeChild(c);delete b[a]}return!!c},kc:function(a){var b=this.e,c=this.s.o(),d=c.h,e=c.f,g,j,i,h,k,n;c=a.x.tl.a(b,d);g=a.y.tl.a(b,e);j=a.x.tr.a(b,d);i=a.y.tr.a(b,e);h=a.x.br.a(b,d);k=a.y.br.a(b,e);n=a.x.bl.a(b,d);a=a.y.bl.a(b,e);d=Math.min(d/(c+j),e/(i+k),d/(n+h),e/(g+a));if(d<1){c*=d;g*=d;j*=d;i*=d;h*=d;k*=d;n*=d;a*=d}return{x:{tl:c,tr:j,br:h,bl:n},y:{tl:g,tr:i,br:k,bl:a}}},ya:function(a,b,c){b=b||1;var d,e,
+g=this.s.o();e=g.h*b;g=g.f*b;var j=this.g.G,i=Math.floor,h=Math.ceil,k=a?a.Jb*b:0,n=a?a.Ib*b:0,m=a?a.tb*b:0;a=a?a.Db*b:0;var p,r,t,v,l;if(c||j.i()){d=this.kc(c||j.j());c=d.x.tl*b;j=d.y.tl*b;p=d.x.tr*b;r=d.y.tr*b;t=d.x.br*b;v=d.y.br*b;l=d.x.bl*b;b=d.y.bl*b;e="m"+i(a)+","+i(j)+"qy"+i(c)+","+i(k)+"l"+h(e-p)+","+i(k)+"qx"+h(e-n)+","+i(r)+"l"+h(e-n)+","+h(g-v)+"qy"+h(e-t)+","+h(g-m)+"l"+i(l)+","+h(g-m)+"qx"+i(a)+","+h(g-b)+" x e"}else e="m"+i(a)+","+i(k)+"l"+h(e-n)+","+i(k)+"l"+h(e-n)+","+h(g-m)+"l"+i(a)+
+","+h(g-m)+"xe";return e},I:function(){var a=this.parent.za(this.N),b;if(!a){a=doc.createElement(this.Ya);b=a.style;b.position="absolute";b.top=b.left=0;this.parent.sb(this.N,a)}return a},mc:function(){var a=this.e,b=a.currentStyle,c=a.runtimeStyle,d=a.tagName,e=f.O===6,g;if(e&&(d in f.cc||d==="FIELDSET")||d==="BUTTON"||d==="INPUT"&&a.type in f.Gd){c.borderWidth="";d=this.g.w.wc;for(g=d.length;g--;){e=d[g];c["padding"+e]="";c["padding"+e]=f.n(b["padding"+e]).a(a)+f.n(b["border"+e+"Width"]).a(a)+(f.O!==
+8&&g%2?1:0)}c.borderWidth=0}else if(e){if(a.childNodes.length!==1||a.firstChild.tagName!=="ie6-mask"){b=doc.createElement("ie6-mask");d=b.style;d.visibility="visible";for(d.zoom=1;d=a.firstChild;)b.appendChild(d);a.appendChild(b);c.visibility="hidden"}}else c.borderColor="transparent"},ie:function(){},m:function(){this.parent.vc(this.N);delete this.rb;delete this.ra}};f.Rc=f.u.R({i:function(){var a=this.ed;for(var b in a)if(a.hasOwnProperty(b)&&a[b].i())return true;return false},Q:function(){return this.g.Pb.H()},
+ib:function(){if(this.i()){var a=this.jc(),b=a,c;a=a.currentStyle;var d=a.position,e=this.I().style,g=0,j=0;j=this.s.o();var i=j.Hd;if(d==="fixed"&&f.O>6){g=j.x*i;j=j.y*i;b=d}else{do b=b.offsetParent;while(b&&b.currentStyle.position==="static");if(b){c=b.getBoundingClientRect();b=b.currentStyle;g=(j.x-c.left)*i-(parseFloat(b.borderLeftWidth)||0);j=(j.y-c.top)*i-(parseFloat(b.borderTopWidth)||0)}else{b=doc.documentElement;g=(j.x+b.scrollLeft-b.clientLeft)*i;j=(j.y+b.scrollTop-b.clientTop)*i}b="absolute"}e.position=
+b;e.left=g;e.top=j;e.zIndex=d==="static"?-1:a.zIndex;this.Cb=true}},Mb:f.aa,Nb:function(){var a=this.g.Pb.j();this.I().style.display=a.ce&&a.nd?"":"none"},Lb:function(){this.i()?this.Nb():this.m()},jc:function(){var a=this.e;return a.tagName in f.Ac?a.offsetParent:a},I:function(){var a=this.Ta,b;if(!a){b=this.jc();a=this.Ta=doc.createElement("css3-container");a.style.direction="ltr";this.Nb();b.parentNode.insertBefore(a,b)}return a},ab:f.aa,m:function(){var a=this.Ta,b;if(a&&(b=a.parentNode))b.removeChild(a);
+delete this.Ta;delete this.ra}});f.Fc=f.u.R({N:2,Ya:"background",Q:function(){var a=this.g;return a.C.H()||a.G.H()},i:function(){var a=this.g;return a.q.i()||a.G.i()||a.C.i()||a.ga.i()&&a.ga.j().Bb},V:function(){var a=this.s.o();if(a.h&&a.f){this.od();this.pd()}},od:function(){var a=this.g.C.j(),b=this.s.o(),c=this.e,d=a&&a.color,e,g;if(d&&d.fa()>0){this.lc();a=this.Aa("bgColor","fill",this.I(),1);e=b.h;b=b.f;a.stroked=false;a.coordsize=e*2+","+b*2;a.coordorigin="1,1";a.path=this.ya(null,2);g=a.style;
+g.width=e;g.height=b;a.fill.color=d.U(c);c=d.fa();if(c<1)a.fill.opacity=c}else this.vb("bgColor")},pd:function(){var a=this.g.C.j(),b=this.s.o();a=a&&a.M;var c,d,e,g,j;if(a){this.lc();d=b.h;e=b.f;for(j=a.length;j--;){b=a[j];c=this.Aa("bgImage"+j,"fill",this.I(),2);c.stroked=false;c.fill.type="tile";c.fillcolor="none";c.coordsize=d*2+","+e*2;c.coordorigin="1,1";c.path=this.ya(0,2);g=c.style;g.width=d;g.height=e;if(b.P==="linear-gradient")this.bd(c,b);else{c.fill.src=b.Ab;this.Nd(c,j)}}}for(j=a?a.length:
+0;this.vb("bgImage"+j++););},Nd:function(a,b){var c=this;f.p.Rb(a.fill.src,function(d){var e=c.e,g=c.s.o(),j=g.h;g=g.f;if(j&&g){var i=a.fill,h=c.g,k=h.w.j(),n=k&&k.J;k=n?n.t.a(e):0;var m=n?n.r.a(e):0,p=n?n.b.a(e):0;n=n?n.l.a(e):0;h=h.C.j().M[b];e=h.$?h.$.coords(e,j-d.h-n-m,g-d.f-k-p):{x:0,y:0};h=h.bb;p=m=0;var r=j+1,t=g+1,v=f.O===8?0:1;n=Math.round(e.x)+n+0.5;k=Math.round(e.y)+k+0.5;i.position=n/j+","+k/g;i.size.x=1;i.size=d.h+"px,"+d.f+"px";if(h&&h!=="repeat"){if(h==="repeat-x"||h==="no-repeat"){m=
+k+1;t=k+d.f+v}if(h==="repeat-y"||h==="no-repeat"){p=n+1;r=n+d.h+v}a.style.clip="rect("+m+"px,"+r+"px,"+t+"px,"+p+"px)"}}})},bd:function(a,b){var c=this.e,d=this.s.o(),e=d.h,g=d.f;a=a.fill;d=b.ca;var j=d.length,i=Math.PI,h=f.Na,k=h.tc,n=h.dc;b=h.gc(c,e,g,b);h=b.sa;var m=b.xc,p=b.yc,r=b.Wd,t=b.Xd,v=b.rd,l=b.sd,q=b.kd,s=b.ld;b=b.rc;e=h%90?Math.atan2(q*e/g,s)/i*180:h+90;e+=180;e%=360;v=k(r,t,h,v,l);g=n(r,t,v[0],v[1]);i=[];v=k(m,p,h,r,t);n=n(m,p,v[0],v[1])/g*100;k=[];for(h=0;h<j;h++)k.push(d[h].db?d[h].db.a(c,
+b):h===0?0:h===j-1?b:null);for(h=1;h<j;h++){if(k[h]===null){m=k[h-1];b=h;do p=k[++b];while(p===null);k[h]=m+(p-m)/(b-h+1)}k[h]=Math.max(k[h],k[h-1])}for(h=0;h<j;h++)i.push(n+k[h]/g*100+"% "+d[h].color.U(c));a.angle=e;a.type="gradient";a.method="sigma";a.color=d[0].color.U(c);a.color2=d[j-1].color.U(c);if(a.colors)a.colors.value=i.join(",");else a.colors=i.join(",")},lc:function(){var a=this.e.runtimeStyle;a.backgroundImage="url(about:blank)";a.backgroundColor="transparent"},m:function(){f.u.m.call(this);
+var a=this.e.runtimeStyle;a.backgroundImage=a.backgroundColor=""}});f.Gc=f.u.R({N:4,Ya:"border",Q:function(){var a=this.g;return a.w.H()||a.G.H()},i:function(){var a=this.g;return a.G.i()&&!a.q.i()&&a.w.i()},V:function(){var a=this.e,b=this.g.w.j(),c=this.s.o(),d=c.h;c=c.f;var e,g,j,i,h;if(b){this.mc();b=this.wd(2);i=0;for(h=b.length;i<h;i++){j=b[i];e=this.Aa("borderPiece"+i,j.stroke?"stroke":"fill",this.I());e.coordsize=d*2+","+c*2;e.coordorigin="1,1";e.path=j.path;g=e.style;g.width=d;g.height=c;
+e.filled=!!j.fill;e.stroked=!!j.stroke;if(j.stroke){e=e.stroke;e.weight=j.Qb+"px";e.color=j.color.U(a);e.dashstyle=j.stroke==="dashed"?"2 2":j.stroke==="dotted"?"1 1":"solid";e.linestyle=j.stroke==="double"&&j.Qb>2?"ThinThin":"Single"}else e.fill.color=j.fill.U(a)}for(;this.vb("borderPiece"+i++););}},wd:function(a){var b=this.e,c,d,e,g=this.g.w,j=[],i,h,k,n,m=Math.round,p,r,t;if(g.i()){c=g.j();g=c.J;r=c.Zd;t=c.gd;if(c.ee&&c.$d&&c.hd){if(t.t.fa()>0){c=g.t.a(b);k=c/2;j.push({path:this.ya({Jb:k,Ib:k,
+tb:k,Db:k},a),stroke:r.t,color:t.t,Qb:c})}}else{a=a||1;c=this.s.o();d=c.h;e=c.f;c=m(g.t.a(b));k=m(g.r.a(b));n=m(g.b.a(b));b=m(g.l.a(b));var v={t:c,r:k,b:n,l:b};b=this.g.G;if(b.i())p=this.kc(b.j());i=Math.floor;h=Math.ceil;var l=function(o,u){return p?p[o][u]:0},q=function(o,u,x,y,z,B){var E=l("x",o),D=l("y",o),C=o.charAt(1)==="r";o=o.charAt(0)==="b";return E>0&&D>0?(B?"al":"ae")+(C?h(d-E):i(E))*a+","+(o?h(e-D):i(D))*a+","+(i(E)-u)*a+","+(i(D)-x)*a+","+y*65535+","+2949075*(z?1:-1):(B?"m":"l")+(C?d-
+u:u)*a+","+(o?e-x:x)*a},s=function(o,u,x,y){var z=o==="t"?i(l("x","tl"))*a+","+h(u)*a:o==="r"?h(d-u)*a+","+i(l("y","tr"))*a:o==="b"?h(d-l("x","br"))*a+","+i(e-u)*a:i(u)*a+","+h(e-l("y","bl"))*a;o=o==="t"?h(d-l("x","tr"))*a+","+h(u)*a:o==="r"?h(d-u)*a+","+h(e-l("y","br"))*a:o==="b"?i(l("x","bl"))*a+","+i(e-u)*a:i(u)*a+","+i(l("y","tl"))*a;return x?(y?"m"+o:"")+"l"+z:(y?"m"+z:"")+"l"+o};b=function(o,u,x,y,z,B){var E=o==="l"||o==="r",D=v[o],C,F;if(D>0&&r[o]!=="none"&&t[o].fa()>0){C=v[E?o:u];u=v[E?u:
+o];F=v[E?o:x];x=v[E?x:o];if(r[o]==="dashed"||r[o]==="dotted"){j.push({path:q(y,C,u,B+45,0,1)+q(y,0,0,B,1,0),fill:t[o]});j.push({path:s(o,D/2,0,1),stroke:r[o],Qb:D,color:t[o]});j.push({path:q(z,F,x,B,0,1)+q(z,0,0,B-45,1,0),fill:t[o]})}else j.push({path:q(y,C,u,B+45,0,1)+s(o,D,0,0)+q(z,F,x,B,0,0)+(r[o]==="double"&&D>2?q(z,F-i(F/3),x-i(x/3),B-45,1,0)+s(o,h(D/3*2),1,0)+q(y,C-i(C/3),u-i(u/3),B,1,0)+"x "+q(y,i(C/3),i(u/3),B+45,0,1)+s(o,i(D/3),1,0)+q(z,i(F/3),i(x/3),B,0,0):"")+q(z,0,0,B-45,1,0)+s(o,0,1,
+0)+q(y,0,0,B,1,0),fill:t[o]})}};b("t","l","r","tl","tr",90);b("r","t","b","tr","br",0);b("b","r","l","br","bl",-90);b("l","b","t","bl","tl",-180)}}return j},m:function(){if(this.ec||!this.g.q.i())this.e.runtimeStyle.borderColor="";f.u.m.call(this)}});f.Tb=f.u.R({N:5,Md:["t","tr","r","br","b","bl","l","tl","c"],Q:function(){return this.g.q.H()},i:function(){return this.g.q.i()},V:function(){this.I();var a=this.g.q.j(),b=this.g.w.j(),c=this.s.o(),d=this.e,e=this.uc;f.p.Rb(a.src,function(g){function j(s,
+o,u,x,y){s=e[s].style;var z=Math.max;s.width=z(o,0);s.height=z(u,0);s.left=x;s.top=y}function i(s,o,u){for(var x=0,y=s.length;x<y;x++)e[s[x]].imagedata[o]=u}var h=c.h,k=c.f,n=f.n("0"),m=a.J||(b?b.J:{t:n,r:n,b:n,l:n});n=m.t.a(d);var p=m.r.a(d),r=m.b.a(d);m=m.l.a(d);var t=a.slice,v=t.t.a(d),l=t.r.a(d),q=t.b.a(d);t=t.l.a(d);j("tl",m,n,0,0);j("t",h-m-p,n,m,0);j("tr",p,n,h-p,0);j("r",p,k-n-r,h-p,n);j("br",p,r,h-p,k-r);j("b",h-m-p,r,m,k-r);j("bl",m,r,0,k-r);j("l",m,k-n-r,0,n);j("c",h-m-p,k-n-r,m,n);i(["tl",
+"t","tr"],"cropBottom",(g.f-v)/g.f);i(["tl","l","bl"],"cropRight",(g.h-t)/g.h);i(["bl","b","br"],"cropTop",(g.f-q)/g.f);i(["tr","r","br"],"cropLeft",(g.h-l)/g.h);i(["l","r","c"],"cropTop",v/g.f);i(["l","r","c"],"cropBottom",q/g.f);i(["t","b","c"],"cropLeft",t/g.h);i(["t","b","c"],"cropRight",l/g.h);e.c.style.display=a.fill?"":"none"},this)},I:function(){var a=this.parent.za(this.N),b,c,d,e=this.Md,g=e.length;if(!a){a=doc.createElement("border-image");b=a.style;b.position="absolute";this.uc={};for(d=
+0;d<g;d++){c=this.uc[e[d]]=f.p.Za("rect");c.appendChild(f.p.Za("imagedata"));b=c.style;b.behavior="url(#default#VML)";b.position="absolute";b.top=b.left=0;c.imagedata.src=this.g.q.j().src;c.stroked=false;c.filled=false;a.appendChild(c)}this.parent.sb(this.N,a)}return a},Ea:function(){if(this.i()){var a=this.e,b=a.runtimeStyle,c=this.g.q.j().J;b.borderStyle="solid";if(c){b.borderTopWidth=c.t.a(a)+"px";b.borderRightWidth=c.r.a(a)+"px";b.borderBottomWidth=c.b.a(a)+"px";b.borderLeftWidth=c.l.a(a)+"px"}this.mc()}},
+m:function(){var a=this.e.runtimeStyle;a.borderStyle="";if(this.ec||!this.g.w.i())a.borderColor=a.borderWidth="";f.u.m.call(this)}});f.Hc=f.u.R({N:1,Ya:"outset-box-shadow",Q:function(){var a=this.g;return a.ga.H()||a.G.H()},i:function(){var a=this.g.ga;return a.i()&&a.j().Da[0]},V:function(){function a(C,F,O,H,M,P,I){C=b.Aa("shadow"+C+F,"fill",d,j-C);F=C.fill;C.coordsize=n*2+","+m*2;C.coordorigin="1,1";C.stroked=false;C.filled=true;F.color=M.U(c);if(P){F.type="gradienttitle";F.color2=F.color;F.opacity=
+0}C.path=I;l=C.style;l.left=O;l.top=H;l.width=n;l.height=m;return C}var b=this,c=this.e,d=this.I(),e=this.g,g=e.ga.j().Da;e=e.G.j();var j=g.length,i=j,h,k=this.s.o(),n=k.h,m=k.f;k=f.O===8?1:0;for(var p=["tl","tr","br","bl"],r,t,v,l,q,s,o,u,x,y,z,B,E,D;i--;){t=g[i];q=t.fe.a(c);s=t.ge.a(c);h=t.Vd.a(c);o=t.blur.a(c);t=t.color;u=-h-o;if(!e&&o)e=f.jb.Dc;u=this.ya({Jb:u,Ib:u,tb:u,Db:u},2,e);if(o){x=(h+o)*2+n;y=(h+o)*2+m;z=x?o*2/x:0;B=y?o*2/y:0;if(o-h>n/2||o-h>m/2)for(h=4;h--;){r=p[h];E=r.charAt(0)==="b";
+D=r.charAt(1)==="r";r=a(i,r,q,s,t,o,u);v=r.fill;v.focusposition=(D?1-z:z)+","+(E?1-B:B);v.focussize="0,0";r.style.clip="rect("+((E?y/2:0)+k)+"px,"+(D?x:x/2)+"px,"+(E?y:y/2)+"px,"+((D?x/2:0)+k)+"px)"}else{r=a(i,"",q,s,t,o,u);v=r.fill;v.focusposition=z+","+B;v.focussize=1-z*2+","+(1-B*2)}}else{r=a(i,"",q,s,t,o,u);q=t.fa();if(q<1)r.fill.opacity=q}}}});f.Pc=f.u.R({N:6,Ya:"imgEl",Q:function(){var a=this.g;return this.e.src!==this.Xc||a.G.H()},i:function(){var a=this.g;return a.G.i()||a.C.qc()},V:function(){this.Xc=
+j;this.Cd();var a=this.Aa("img","fill",this.I()),b=a.fill,c=this.s.o(),d=c.h;c=c.f;var e=this.g.w.j(),g=e&&e.J;e=this.e;var j=e.src,i=Math.round,h=e.currentStyle,k=f.n;if(!g||f.O<7){g=f.n("0");g={t:g,r:g,b:g,l:g}}a.stroked=false;b.type="frame";b.src=j;b.position=(d?0.5/d:0)+","+(c?0.5/c:0);a.coordsize=d*2+","+c*2;a.coordorigin="1,1";a.path=this.ya({Jb:i(g.t.a(e)+k(h.paddingTop).a(e)),Ib:i(g.r.a(e)+k(h.paddingRight).a(e)),tb:i(g.b.a(e)+k(h.paddingBottom).a(e)),Db:i(g.l.a(e)+k(h.paddingLeft).a(e))},
+2);a=a.style;a.width=d;a.height=c},Cd:function(){this.e.runtimeStyle.filter="alpha(opacity=0)"},m:function(){f.u.m.call(this);this.e.runtimeStyle.filter=""}});f.Oc=f.u.R({ib:f.aa,Mb:f.aa,Nb:f.aa,Lb:f.aa,Ld:/^,+|,+$/g,Fd:/,+/g,gb:function(a,b){(this.pb||(this.pb=[]))[a]=b||void 0},ab:function(){var a=this.pb,b;if(a&&(b=a.join(",").replace(this.Ld,"").replace(this.Fd,","))!==this.Wc)this.Wc=this.e.runtimeStyle.background=b},m:function(){this.e.runtimeStyle.background="";delete this.pb}});f.Mc=f.u.R({ua:1,
+Q:function(){return this.g.C.H()},i:function(){var a=this.g;return a.C.i()||a.q.i()},V:function(){var a=this.g.C.j(),b,c,d=0,e,g;if(a){b=[];if(c=a.M)for(;e=c[d++];)if(e.P==="linear-gradient"){g=this.vd(e.Wa);g=(e.Xa||f.Ka.Kc).a(this.e,g.h,g.f,g.h,g.f);b.push("url(data:image/svg+xml,"+escape(this.xd(e,g.h,g.f))+") "+this.dd(e.$)+" / "+g.h+"px "+g.f+"px "+(e.bc||"")+" "+(e.Wa||"")+" "+(e.ub||""))}else b.push(e.Hb);a.color&&b.push(a.color.Y);this.parent.gb(this.ua,b.join(","))}},dd:function(a){return a?
+a.X.map(function(b){return b.d}).join(" "):"0 0"},vd:function(a){var b=this.e,c=this.s.o(),d=c.h;c=c.f;var e;if(a!=="border-box")if((e=this.g.w.j())&&(e=e.J)){d-=e.l.a(b)+e.l.a(b);c-=e.t.a(b)+e.b.a(b)}if(a==="content-box"){a=f.n;e=b.currentStyle;d-=a(e.paddingLeft).a(b)+a(e.paddingRight).a(b);c-=a(e.paddingTop).a(b)+a(e.paddingBottom).a(b)}return{h:d,f:c}},xd:function(a,b,c){var d=this.e,e=a.ca,g=e.length,j=f.Na.gc(d,b,c,a);a=j.xc;var i=j.yc,h=j.td,k=j.ud;j=j.rc;var n,m,p,r,t;n=[];for(m=0;m<g;m++)n.push(e[m].db?
+e[m].db.a(d,j):m===0?0:m===g-1?j:null);for(m=1;m<g;m++)if(n[m]===null){r=n[m-1];p=m;do t=n[++p];while(t===null);n[m]=r+(t-r)/(p-m+1)}b=['<svg width="'+b+'" height="'+c+'" xmlns="http://www.w3.org/2000/svg"><defs><linearGradient id="g" gradientUnits="userSpaceOnUse" x1="'+a/b*100+'%" y1="'+i/c*100+'%" x2="'+h/b*100+'%" y2="'+k/c*100+'%">'];for(m=0;m<g;m++)b.push('<stop offset="'+n[m]/j+'" stop-color="'+e[m].color.U(d)+'" stop-opacity="'+e[m].color.fa()+'"/>');b.push('</linearGradient></defs><rect width="100%" height="100%" fill="url(#g)"/></svg>');
+return b.join("")},m:function(){this.parent.gb(this.ua)}});f.Nc=f.u.R({T:"repeat",Sc:"stretch",Qc:"round",ua:0,Q:function(){return this.g.q.H()},i:function(){return this.g.q.i()},V:function(){var a=this,b=a.g.q.j(),c=a.g.w.j(),d=a.s.o(),e=b.repeat,g=e.f,j=e.Ob,i=a.e,h=0;f.p.Rb(b.src,function(k){function n(Q,R,U,V,W,Y,X,S,w,A){K.push('<pattern patternUnits="userSpaceOnUse" id="pattern'+G+'" x="'+(g===l?Q+U/2-w/2:Q)+'" y="'+(j===l?R+V/2-A/2:R)+'" width="'+w+'" height="'+A+'"><svg width="'+w+'" height="'+
+A+'" viewBox="'+W+" "+Y+" "+X+" "+S+'" preserveAspectRatio="none"><image xlink:href="'+v+'" x="0" y="0" width="'+r+'" height="'+t+'" /></svg></pattern>');J.push('<rect x="'+Q+'" y="'+R+'" width="'+U+'" height="'+V+'" fill="url(#pattern'+G+')" />');G++}var m=d.h,p=d.f,r=k.h,t=k.f,v=a.Dd(b.src,r,t),l=a.T,q=a.Sc;k=a.Qc;var s=Math.ceil,o=f.n("0"),u=b.J||(c?c.J:{t:o,r:o,b:o,l:o});o=u.t.a(i);var x=u.r.a(i),y=u.b.a(i);u=u.l.a(i);var z=b.slice,B=z.t.a(i),E=z.r.a(i),D=z.b.a(i);z=z.l.a(i);var C=m-u-x,F=p-o-
+y,O=r-z-E,H=t-B-D,M=g===q?C:O*o/B,P=j===q?F:H*x/E,I=g===q?C:O*y/D;q=j===q?F:H*u/z;var K=[],J=[],G=0;if(g===k){M-=(M-(C%M||M))/s(C/M);I-=(I-(C%I||I))/s(C/I)}if(j===k){P-=(P-(F%P||P))/s(F/P);q-=(q-(F%q||q))/s(F/q)}k=['<svg width="'+m+'" height="'+p+'" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink">'];n(0,0,u,o,0,0,z,B,u,o);n(u,0,C,o,z,0,O,B,M,o);n(m-x,0,x,o,r-E,0,E,B,x,o);n(0,o,u,F,0,B,z,H,u,q);if(b.fill)n(u,o,C,F,z,B,O,H,M||I||O,q||P||H);n(m-x,o,x,F,r-E,B,E,H,x,P);n(0,
+p-y,u,y,0,t-D,z,D,u,y);n(u,p-y,C,y,z,t-D,O,D,I,y);n(m-x,p-y,x,y,r-E,t-D,E,D,x,y);k.push("<defs>"+K.join("\n")+"</defs>"+J.join("\n")+"</svg>");a.parent.gb(a.ua,"url(data:image/svg+xml,"+escape(k.join(""))+") no-repeat border-box border-box");h&&a.parent.ab()},a);h=1},Dd:function(){var a={};return function(b,c,d){var e=a[b],g;if(!e){e=new Image;g=doc.createElement("canvas");e.src=b;g.width=c;g.height=d;g.getContext("2d").drawImage(e,0,0);e=a[b]=g.toDataURL()}return e}}(),Ea:f.Tb.prototype.Ea,m:function(){var a=
+this.e.runtimeStyle;this.parent.gb(this.ua);a.borderColor=a.borderStyle=a.borderWidth=""}});f.kb=function(){function a(l,q){l.className+=" "+q}function b(l){var q=v.slice.call(arguments,1),s=q.length;setTimeout(function(){if(l)for(;s--;)a(l,q[s])},0)}function c(l){var q=v.slice.call(arguments,1),s=q.length;setTimeout(function(){if(l)for(;s--;){var o=q[s];o=t[o]||(t[o]=new RegExp("\\b"+o+"\\b","g"));l.className=l.className.replace(o,"")}},0)}function d(l){function q(){if(!U){var w,A,L=f.ja,T=l.currentStyle,
+N=T.getAttribute(g)==="true",da=T.getAttribute(i)!=="false",ea=T.getAttribute(h)!=="false";S=T.getAttribute(j);S=L>7?S!=="false":S==="true";if(!R){R=1;l.runtimeStyle.zoom=1;T=l;for(var fa=1;T=T.previousSibling;)if(T.nodeType===1){fa=0;break}fa&&a(l,p)}J.cb();if(N&&(A=J.o())&&(w=doc.documentElement||doc.body)&&(A.y>w.clientHeight||A.x>w.clientWidth||A.y+A.f<0||A.x+A.h<0)){if(!Y){Y=1;f.mb.ba(q)}}else{U=1;Y=R=0;f.mb.Ha(q);if(L===9){G={C:new f.Sb(l),q:new f.Ub(l),w:new f.Vb(l)};Q=[G.C,G.q];K=new f.Oc(l,
+J,G);w=[new f.Mc(l,J,G,K),new f.Nc(l,J,G,K)]}else{G={C:new f.Sb(l),w:new f.Vb(l),q:new f.Ub(l),G:new f.jb(l),ga:new f.Ic(l),Pb:new f.Uc(l)};Q=[G.C,G.w,G.q,G.G,G.ga,G.Pb];K=new f.Rc(l,J,G);w=[new f.Hc(l,J,G,K),new f.Fc(l,J,G,K),new f.Gc(l,J,G,K),new f.Tb(l,J,G,K)];l.tagName==="IMG"&&w.push(new f.Pc(l,J,G,K));K.ed=w}I=[K].concat(w);if(w=l.currentStyle.getAttribute(f.F+"watch-ancestors")){w=parseInt(w,10);A=0;for(N=l.parentNode;N&&(w==="NaN"||A++<w);){H(N,"onpropertychange",C);H(N,"onmouseenter",x);
+H(N,"onmouseleave",y);H(N,"onmousedown",z);if(N.tagName in f.fc){H(N,"onfocus",E);H(N,"onblur",D)}N=N.parentNode}}if(S){f.Oa.ba(o);f.Oa.Rd()}o(1)}if(!V){V=1;L<9&&H(l,"onmove",s);H(l,"onresize",s);H(l,"onpropertychange",u);ea&&H(l,"onmouseenter",x);if(ea||da)H(l,"onmouseleave",y);da&&H(l,"onmousedown",z);if(l.tagName in f.fc){H(l,"onfocus",E);H(l,"onblur",D)}f.Qa.ba(s);f.L.ba(M)}J.hb()}}function s(){J&&J.Ad()&&o()}function o(w){if(!X)if(U){var A,L=I.length;F();for(A=0;A<L;A++)I[A].Ea();if(w||J.Od())for(A=
+0;A<L;A++)I[A].ib();if(w||J.Td())for(A=0;A<L;A++)I[A].Mb();K.ab();O()}else R||q()}function u(){var w,A=I.length,L;w=event;if(!X&&!(w&&w.propertyName in r))if(U){F();for(w=0;w<A;w++)I[w].Ea();for(w=0;w<A;w++){L=I[w];L.Cb||L.ib();L.Q()&&L.Lb()}K.ab();O()}else R||q()}function x(){b(l,k)}function y(){c(l,k,n)}function z(){b(l,n);f.lb.ba(B)}function B(){c(l,n);f.lb.Ha(B)}function E(){b(l,m)}function D(){c(l,m)}function C(){var w=event.propertyName;if(w==="className"||w==="id")u()}function F(){J.cb();for(var w=
+Q.length;w--;)Q[w].cb()}function O(){for(var w=Q.length;w--;)Q[w].hb();J.hb()}function H(w,A,L){w.attachEvent(A,L);W.push([w,A,L])}function M(){if(V){for(var w=W.length,A;w--;){A=W[w];A[0].detachEvent(A[1],A[2])}f.L.Ha(M);V=0;W=[]}}function P(){if(!X){var w,A;M();X=1;if(I){w=0;for(A=I.length;w<A;w++){I[w].ec=1;I[w].m()}}S&&f.Oa.Ha(o);f.Qa.Ha(o);I=J=G=Q=l=null}}var I,K,J=new ha(l),G,Q,R,U,V,W=[],Y,X,S;this.Ed=q;this.update=o;this.m=P;this.qd=l}var e={},g=f.F+"lazy-init",j=f.F+"poll",i=f.F+"track-active",
+h=f.F+"track-hover",k=f.La+"hover",n=f.La+"active",m=f.La+"focus",p=f.La+"first-child",r={background:1,bgColor:1,display:1},t={},v=[];d.yd=function(l){var q=f.p.Ba(l);return e[q]||(e[q]=new d(l))};d.m=function(l){l=f.p.Ba(l);var q=e[l];if(q){q.m();delete e[l]}};d.md=function(){var l=[],q;if(e){for(var s in e)if(e.hasOwnProperty(s)){q=e[s];l.push(q.qd);q.m()}e={}}return l};return d}();f.supportsVML=f.zc;f.attach=function(a){f.ja<10&&f.zc&&f.kb.yd(a).Ed()};f.detach=function(a){f.kb.m(a)}};
+})(); \ No newline at end of file
diff --git a/themes/mantra/resources/js/PIE/PIE.php b/themes/mantra/resources/js/PIE/PIE.php
new file mode 100644
index 00000000..58a6f0a6
--- /dev/null
+++ b/themes/mantra/resources/js/PIE/PIE.php
@@ -0,0 +1,19 @@
+<?php
+/*
+This file is a wrapper, for use in PHP environments, which serves PIE.htc using the
+correct content-type, so that IE will recognize it as a behavior. Simply specify the
+behavior property to fetch this .php file instead of the .htc directly:
+
+.myElement {
+ [ ...css3 properties... ]
+ behavior: url(PIE.php);
+}
+
+This is only necessary when the web server is not configured to serve .htc files with
+the text/x-component content-type, and cannot easily be configured to do so (as is the
+case with some shared hosting providers).
+*/
+
+header( 'Content-type: text/x-component' );
+include( 'PIE.htc' );
+?> \ No newline at end of file
diff --git a/themes/mantra/resources/js/PIE/PIE_uncompressed.htc b/themes/mantra/resources/js/PIE/PIE_uncompressed.htc
new file mode 100644
index 00000000..bf1a010b
--- /dev/null
+++ b/themes/mantra/resources/js/PIE/PIE_uncompressed.htc
@@ -0,0 +1,4505 @@
+<!--
+PIE: CSS3 rendering for IE
+Version 1.0.0
+http://css3pie.com
+Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
+-->
+<PUBLIC:COMPONENT lightWeight="true">
+<!-- saved from url=(0014)about:internet -->
+<PUBLIC:ATTACH EVENT="oncontentready" FOR="element" ONEVENT="init()" />
+<PUBLIC:ATTACH EVENT="ondocumentready" FOR="element" ONEVENT="init()" />
+<PUBLIC:ATTACH EVENT="ondetach" FOR="element" ONEVENT="cleanup()" />
+
+<script type="text/javascript">
+var doc = element.document;var PIE = window['PIE'];
+
+if( !PIE ) {
+ PIE = window['PIE'] = {
+ CSS_PREFIX: '-pie-',
+ STYLE_PREFIX: 'Pie',
+ CLASS_PREFIX: 'pie_',
+ tableCellTags: {
+ 'TD': 1,
+ 'TH': 1
+ },
+
+ /**
+ * Lookup table of elements which cannot take custom children.
+ */
+ childlessElements: {
+ 'TABLE':1,
+ 'THEAD':1,
+ 'TBODY':1,
+ 'TFOOT':1,
+ 'TR':1,
+ 'INPUT':1,
+ 'TEXTAREA':1,
+ 'SELECT':1,
+ 'OPTION':1,
+ 'IMG':1,
+ 'HR':1
+ },
+
+ /**
+ * Elements that can receive user focus
+ */
+ focusableElements: {
+ 'A':1,
+ 'INPUT':1,
+ 'TEXTAREA':1,
+ 'SELECT':1,
+ 'BUTTON':1
+ },
+
+ /**
+ * Values of the type attribute for input elements displayed as buttons
+ */
+ inputButtonTypes: {
+ 'submit':1,
+ 'button':1,
+ 'reset':1
+ },
+
+ emptyFn: function() {}
+ };
+
+ // Force the background cache to be used. No reason it shouldn't be.
+ try {
+ doc.execCommand( 'BackgroundImageCache', false, true );
+ } catch(e) {}
+
+ (function() {
+ /*
+ * IE version detection approach by James Padolsey, with modifications -- from
+ * http://james.padolsey.com/javascript/detect-ie-in-js-using-conditional-comments/
+ */
+ var ieVersion = 4,
+ div = doc.createElement('div'),
+ all = div.getElementsByTagName('i'),
+ shape;
+ while (
+ div.innerHTML = '<!--[if gt IE ' + (++ieVersion) + ']><i></i><![endif]-->',
+ all[0]
+ ) {}
+ PIE.ieVersion = ieVersion;
+
+ // Detect IE6
+ if( ieVersion === 6 ) {
+ // IE6 can't access properties with leading dash, but can without it.
+ PIE.CSS_PREFIX = PIE.CSS_PREFIX.replace( /^-/, '' );
+ }
+
+ PIE.ieDocMode = doc.documentMode || PIE.ieVersion;
+
+ // Detect VML support (a small number of IE installs don't have a working VML engine)
+ div.innerHTML = '<v:shape adj="1"/>';
+ shape = div.firstChild;
+ shape.style['behavior'] = 'url(#default#VML)';
+ PIE.supportsVML = (typeof shape['adj'] === "object");
+ }());
+/**
+ * Utility functions
+ */
+(function() {
+ var vmlCreatorDoc,
+ idNum = 0,
+ imageSizes = {};
+
+
+ PIE.Util = {
+
+ /**
+ * To create a VML element, it must be created by a Document which has the VML
+ * namespace set. Unfortunately, if you try to add the namespace programatically
+ * into the main document, you will get an "Unspecified error" when trying to
+ * access document.namespaces before the document is finished loading. To get
+ * around this, we create a DocumentFragment, which in IE land is apparently a
+ * full-fledged Document. It allows adding namespaces immediately, so we add the
+ * namespace there and then have it create the VML element.
+ * @param {string} tag The tag name for the VML element
+ * @return {Element} The new VML element
+ */
+ createVmlElement: function( tag ) {
+ var vmlPrefix = 'css3vml';
+ if( !vmlCreatorDoc ) {
+ vmlCreatorDoc = doc.createDocumentFragment();
+ vmlCreatorDoc.namespaces.add( vmlPrefix, 'urn:schemas-microsoft-com:vml' );
+ }
+ return vmlCreatorDoc.createElement( vmlPrefix + ':' + tag );
+ },
+
+
+ /**
+ * Generate and return a unique ID for a given object. The generated ID is stored
+ * as a property of the object for future reuse.
+ * @param {Object} obj
+ */
+ getUID: function( obj ) {
+ return obj && obj[ '_pieId' ] || ( obj[ '_pieId' ] = '_' + ++idNum );
+ },
+
+
+ /**
+ * Simple utility for merging objects
+ * @param {Object} obj1 The main object into which all others will be merged
+ * @param {...Object} var_args Other objects which will be merged into the first, in order
+ */
+ merge: function( obj1 ) {
+ var i, len, p, objN, args = arguments;
+ for( i = 1, len = args.length; i < len; i++ ) {
+ objN = args[i];
+ for( p in objN ) {
+ if( objN.hasOwnProperty( p ) ) {
+ obj1[ p ] = objN[ p ];
+ }
+ }
+ }
+ return obj1;
+ },
+
+
+ /**
+ * Execute a callback function, passing it the dimensions of a given image once
+ * they are known.
+ * @param {string} src The source URL of the image
+ * @param {function({w:number, h:number})} func The callback function to be called once the image dimensions are known
+ * @param {Object} ctx A context object which will be used as the 'this' value within the executed callback function
+ */
+ withImageSize: function( src, func, ctx ) {
+ var size = imageSizes[ src ], img, queue;
+ if( size ) {
+ // If we have a queue, add to it
+ if( Object.prototype.toString.call( size ) === '[object Array]' ) {
+ size.push( [ func, ctx ] );
+ }
+ // Already have the size cached, call func right away
+ else {
+ func.call( ctx, size );
+ }
+ } else {
+ queue = imageSizes[ src ] = [ [ func, ctx ] ]; //create queue
+ img = new Image();
+ img.onload = function() {
+ size = imageSizes[ src ] = { w: img.width, h: img.height };
+ for( var i = 0, len = queue.length; i < len; i++ ) {
+ queue[ i ][ 0 ].call( queue[ i ][ 1 ], size );
+ }
+ img.onload = null;
+ };
+ img.src = src;
+ }
+ }
+ };
+})();/**
+ * Utility functions for handling gradients
+ */
+PIE.GradientUtil = {
+
+ getGradientMetrics: function( el, width, height, gradientInfo ) {
+ var angle = gradientInfo.angle,
+ startPos = gradientInfo.gradientStart,
+ startX, startY,
+ endX, endY,
+ startCornerX, startCornerY,
+ endCornerX, endCornerY,
+ deltaX, deltaY,
+ p, UNDEF;
+
+ // Find the "start" and "end" corners; these are the corners furthest along the gradient line.
+ // This is used below to find the start/end positions of the CSS3 gradient-line, and also in finding
+ // the total length of the VML rendered gradient-line corner to corner.
+ function findCorners() {
+ startCornerX = ( angle >= 90 && angle < 270 ) ? width : 0;
+ startCornerY = angle < 180 ? height : 0;
+ endCornerX = width - startCornerX;
+ endCornerY = height - startCornerY;
+ }
+
+ // Normalize the angle to a value between [0, 360)
+ function normalizeAngle() {
+ while( angle < 0 ) {
+ angle += 360;
+ }
+ angle = angle % 360;
+ }
+
+ // Find the start and end points of the gradient
+ if( startPos ) {
+ startPos = startPos.coords( el, width, height );
+ startX = startPos.x;
+ startY = startPos.y;
+ }
+ if( angle ) {
+ angle = angle.degrees();
+
+ normalizeAngle();
+ findCorners();
+
+ // If no start position was specified, then choose a corner as the starting point.
+ if( !startPos ) {
+ startX = startCornerX;
+ startY = startCornerY;
+ }
+
+ // Find the end position by extending a perpendicular line from the gradient-line which
+ // intersects the corner opposite from the starting corner.
+ p = PIE.GradientUtil.perpendicularIntersect( startX, startY, angle, endCornerX, endCornerY );
+ endX = p[0];
+ endY = p[1];
+ }
+ else if( startPos ) {
+ // Start position but no angle specified: find the end point by rotating 180deg around the center
+ endX = width - startX;
+ endY = height - startY;
+ }
+ else {
+ // Neither position nor angle specified; create vertical gradient from top to bottom
+ startX = startY = endX = 0;
+ endY = height;
+ }
+ deltaX = endX - startX;
+ deltaY = endY - startY;
+
+ if( angle === UNDEF ) {
+ // Get the angle based on the change in x/y from start to end point. Checks first for horizontal
+ // or vertical angles so they get exact whole numbers rather than what atan2 gives.
+ angle = ( !deltaX ? ( deltaY < 0 ? 90 : 270 ) :
+ ( !deltaY ? ( deltaX < 0 ? 180 : 0 ) :
+ -Math.atan2( deltaY, deltaX ) / Math.PI * 180
+ )
+ );
+ normalizeAngle();
+ findCorners();
+ }
+
+ return {
+ angle: angle,
+ startX: startX,
+ startY: startY,
+ endX: endX,
+ endY: endY,
+ startCornerX: startCornerX,
+ startCornerY: startCornerY,
+ endCornerX: endCornerX,
+ endCornerY: endCornerY,
+ deltaX: deltaX,
+ deltaY: deltaY,
+ lineLength: PIE.GradientUtil.distance( startX, startY, endX, endY )
+ }
+ },
+
+ /**
+ * Find the point along a given line (defined by a starting point and an angle), at which
+ * that line is intersected by a perpendicular line extending through another point.
+ * @param x1 - x coord of the starting point
+ * @param y1 - y coord of the starting point
+ * @param angle - angle of the line extending from the starting point (in degrees)
+ * @param x2 - x coord of point along the perpendicular line
+ * @param y2 - y coord of point along the perpendicular line
+ * @return [ x, y ]
+ */
+ perpendicularIntersect: function( x1, y1, angle, x2, y2 ) {
+ // Handle straight vertical and horizontal angles, for performance and to avoid
+ // divide-by-zero errors.
+ if( angle === 0 || angle === 180 ) {
+ return [ x2, y1 ];
+ }
+ else if( angle === 90 || angle === 270 ) {
+ return [ x1, y2 ];
+ }
+ else {
+ // General approach: determine the Ax+By=C formula for each line (the slope of the second
+ // line is the negative inverse of the first) and then solve for where both formulas have
+ // the same x/y values.
+ var a1 = Math.tan( -angle * Math.PI / 180 ),
+ c1 = a1 * x1 - y1,
+ a2 = -1 / a1,
+ c2 = a2 * x2 - y2,
+ d = a2 - a1,
+ endX = ( c2 - c1 ) / d,
+ endY = ( a1 * c2 - a2 * c1 ) / d;
+ return [ endX, endY ];
+ }
+ },
+
+ /**
+ * Find the distance between two points
+ * @param {Number} p1x
+ * @param {Number} p1y
+ * @param {Number} p2x
+ * @param {Number} p2y
+ * @return {Number} the distance
+ */
+ distance: function( p1x, p1y, p2x, p2y ) {
+ var dx = p2x - p1x,
+ dy = p2y - p1y;
+ return Math.abs(
+ dx === 0 ? dy :
+ dy === 0 ? dx :
+ Math.sqrt( dx * dx + dy * dy )
+ );
+ }
+
+};/**
+ *
+ */
+PIE.Observable = function() {
+ /**
+ * List of registered observer functions
+ */
+ this.observers = [];
+
+ /**
+ * Hash of function ids to their position in the observers list, for fast lookup
+ */
+ this.indexes = {};
+};
+PIE.Observable.prototype = {
+
+ observe: function( fn ) {
+ var id = PIE.Util.getUID( fn ),
+ indexes = this.indexes,
+ observers = this.observers;
+ if( !( id in indexes ) ) {
+ indexes[ id ] = observers.length;
+ observers.push( fn );
+ }
+ },
+
+ unobserve: function( fn ) {
+ var id = PIE.Util.getUID( fn ),
+ indexes = this.indexes;
+ if( id && id in indexes ) {
+ delete this.observers[ indexes[ id ] ];
+ delete indexes[ id ];
+ }
+ },
+
+ fire: function() {
+ var o = this.observers,
+ i = o.length;
+ while( i-- ) {
+ o[ i ] && o[ i ]();
+ }
+ }
+
+};/*
+ * Simple heartbeat timer - this is a brute-force workaround for syncing issues caused by IE not
+ * always firing the onmove and onresize events when elements are moved or resized. We check a few
+ * times every second to make sure the elements have the correct position and size. See Element.js
+ * which adds heartbeat listeners based on the custom -pie-poll flag, which defaults to true in IE8-9
+ * and false elsewhere.
+ */
+
+PIE.Heartbeat = new PIE.Observable();
+PIE.Heartbeat.run = function() {
+ var me = this,
+ interval;
+ if( !me.running ) {
+ interval = doc.documentElement.currentStyle.getAttribute( PIE.CSS_PREFIX + 'poll-interval' ) || 250;
+ (function beat() {
+ me.fire();
+ setTimeout(beat, interval);
+ })();
+ me.running = 1;
+ }
+};
+/**
+ * Create an observable listener for the onunload event
+ */
+(function() {
+ PIE.OnUnload = new PIE.Observable();
+
+ function handleUnload() {
+ PIE.OnUnload.fire();
+ window.detachEvent( 'onunload', handleUnload );
+ window[ 'PIE' ] = null;
+ }
+
+ window.attachEvent( 'onunload', handleUnload );
+
+ /**
+ * Attach an event which automatically gets detached onunload
+ */
+ PIE.OnUnload.attachManagedEvent = function( target, name, handler ) {
+ target.attachEvent( name, handler );
+ this.observe( function() {
+ target.detachEvent( name, handler );
+ } );
+ };
+})()/**
+ * Create a single observable listener for window resize events.
+ */
+PIE.OnResize = new PIE.Observable();
+
+PIE.OnUnload.attachManagedEvent( window, 'onresize', function() { PIE.OnResize.fire(); } );
+/**
+ * Create a single observable listener for scroll events. Used for lazy loading based
+ * on the viewport, and for fixed position backgrounds.
+ */
+(function() {
+ PIE.OnScroll = new PIE.Observable();
+
+ function scrolled() {
+ PIE.OnScroll.fire();
+ }
+
+ PIE.OnUnload.attachManagedEvent( window, 'onscroll', scrolled );
+
+ PIE.OnResize.observe( scrolled );
+})();
+/**
+ * Listen for printing events, destroy all active PIE instances when printing, and
+ * restore them afterward.
+ */
+(function() {
+
+ var elements;
+
+ function beforePrint() {
+ elements = PIE.Element.destroyAll();
+ }
+
+ function afterPrint() {
+ if( elements ) {
+ for( var i = 0, len = elements.length; i < len; i++ ) {
+ PIE[ 'attach' ]( elements[i] );
+ }
+ elements = 0;
+ }
+ }
+
+ if( PIE.ieDocMode < 9 ) {
+ PIE.OnUnload.attachManagedEvent( window, 'onbeforeprint', beforePrint );
+ PIE.OnUnload.attachManagedEvent( window, 'onafterprint', afterPrint );
+ }
+
+})();/**
+ * Create a single observable listener for document mouseup events.
+ */
+PIE.OnMouseup = new PIE.Observable();
+
+PIE.OnUnload.attachManagedEvent( doc, 'onmouseup', function() { PIE.OnMouseup.fire(); } );
+/**
+ * Wrapper for length and percentage style values. The value is immutable. A singleton instance per unique
+ * value is returned from PIE.getLength() - always use that instead of instantiating directly.
+ * @constructor
+ * @param {string} val The CSS string representing the length. It is assumed that this will already have
+ * been validated as a valid length or percentage syntax.
+ */
+PIE.Length = (function() {
+ var lengthCalcEl = doc.createElement( 'length-calc' ),
+ parent = doc.body || doc.documentElement,
+ s = lengthCalcEl.style,
+ conversions = {},
+ units = [ 'mm', 'cm', 'in', 'pt', 'pc' ],
+ i = units.length,
+ instances = {};
+
+ s.position = 'absolute';
+ s.top = s.left = '-9999px';
+
+ parent.appendChild( lengthCalcEl );
+ while( i-- ) {
+ s.width = '100' + units[i];
+ conversions[ units[i] ] = lengthCalcEl.offsetWidth / 100;
+ }
+ parent.removeChild( lengthCalcEl );
+
+ // All calcs from here on will use 1em
+ s.width = '1em';
+
+
+ function Length( val ) {
+ this.val = val;
+ }
+ Length.prototype = {
+ /**
+ * Regular expression for matching the length unit
+ * @private
+ */
+ unitRE: /(px|em|ex|mm|cm|in|pt|pc|%)$/,
+
+ /**
+ * Get the numeric value of the length
+ * @return {number} The value
+ */
+ getNumber: function() {
+ var num = this.num,
+ UNDEF;
+ if( num === UNDEF ) {
+ num = this.num = parseFloat( this.val );
+ }
+ return num;
+ },
+
+ /**
+ * Get the unit of the length
+ * @return {string} The unit
+ */
+ getUnit: function() {
+ var unit = this.unit,
+ m;
+ if( !unit ) {
+ m = this.val.match( this.unitRE );
+ unit = this.unit = ( m && m[0] ) || 'px';
+ }
+ return unit;
+ },
+
+ /**
+ * Determine whether this is a percentage length value
+ * @return {boolean}
+ */
+ isPercentage: function() {
+ return this.getUnit() === '%';
+ },
+
+ /**
+ * Resolve this length into a number of pixels.
+ * @param {Element} el - the context element, used to resolve font-relative values
+ * @param {(function():number|number)=} pct100 - the number of pixels that equal a 100% percentage. This can be either a number or a
+ * function which will be called to return the number.
+ */
+ pixels: function( el, pct100 ) {
+ var num = this.getNumber(),
+ unit = this.getUnit();
+ switch( unit ) {
+ case "px":
+ return num;
+ case "%":
+ return num * ( typeof pct100 === 'function' ? pct100() : pct100 ) / 100;
+ case "em":
+ return num * this.getEmPixels( el );
+ case "ex":
+ return num * this.getEmPixels( el ) / 2;
+ default:
+ return num * conversions[ unit ];
+ }
+ },
+
+ /**
+ * The em and ex units are relative to the font-size of the current element,
+ * however if the font-size is set using non-pixel units then we get that value
+ * rather than a pixel conversion. To get around this, we keep a floating element
+ * with width:1em which we insert into the target element and then read its offsetWidth.
+ * For elements that won't accept a child we insert into the parent node and perform
+ * additional calculation. If the font-size *is* specified in pixels, then we use that
+ * directly to avoid the expensive DOM manipulation.
+ * @param {Element} el
+ * @return {number}
+ */
+ getEmPixels: function( el ) {
+ var fs = el.currentStyle.fontSize,
+ px, parent, me;
+
+ if( fs.indexOf( 'px' ) > 0 ) {
+ return parseFloat( fs );
+ }
+ else if( el.tagName in PIE.childlessElements ) {
+ me = this;
+ parent = el.parentNode;
+ return PIE.getLength( fs ).pixels( parent, function() {
+ return me.getEmPixels( parent );
+ } );
+ }
+ else {
+ el.appendChild( lengthCalcEl );
+ px = lengthCalcEl.offsetWidth;
+ if( lengthCalcEl.parentNode === el ) { //not sure how this could be false but it sometimes is
+ el.removeChild( lengthCalcEl );
+ }
+ return px;
+ }
+ }
+ };
+
+
+ /**
+ * Retrieve a PIE.Length instance for the given value. A shared singleton instance is returned for each unique value.
+ * @param {string} val The CSS string representing the length. It is assumed that this will already have
+ * been validated as a valid length or percentage syntax.
+ */
+ PIE.getLength = function( val ) {
+ return instances[ val ] || ( instances[ val ] = new Length( val ) );
+ };
+
+ return Length;
+})();
+/**
+ * Wrapper for a CSS3 bg-position value. Takes up to 2 position keywords and 2 lengths/percentages.
+ * @constructor
+ * @param {Array.<PIE.Tokenizer.Token>} tokens The tokens making up the background position value.
+ */
+PIE.BgPosition = (function() {
+
+ var length_fifty = PIE.getLength( '50%' ),
+ vert_idents = { 'top': 1, 'center': 1, 'bottom': 1 },
+ horiz_idents = { 'left': 1, 'center': 1, 'right': 1 };
+
+
+ function BgPosition( tokens ) {
+ this.tokens = tokens;
+ }
+ BgPosition.prototype = {
+ /**
+ * Normalize the values into the form:
+ * [ xOffsetSide, xOffsetLength, yOffsetSide, yOffsetLength ]
+ * where: xOffsetSide is either 'left' or 'right',
+ * yOffsetSide is either 'top' or 'bottom',
+ * and x/yOffsetLength are both PIE.Length objects.
+ * @return {Array}
+ */
+ getValues: function() {
+ if( !this._values ) {
+ var tokens = this.tokens,
+ len = tokens.length,
+ Tokenizer = PIE.Tokenizer,
+ identType = Tokenizer.Type,
+ length_zero = PIE.getLength( '0' ),
+ type_ident = identType.IDENT,
+ type_length = identType.LENGTH,
+ type_percent = identType.PERCENT,
+ type, value,
+ vals = [ 'left', length_zero, 'top', length_zero ];
+
+ // If only one value, the second is assumed to be 'center'
+ if( len === 1 ) {
+ tokens.push( new Tokenizer.Token( type_ident, 'center' ) );
+ len++;
+ }
+
+ // Two values - CSS2
+ if( len === 2 ) {
+ // If both idents, they can appear in either order, so switch them if needed
+ if( type_ident & ( tokens[0].tokenType | tokens[1].tokenType ) &&
+ tokens[0].tokenValue in vert_idents && tokens[1].tokenValue in horiz_idents ) {
+ tokens.push( tokens.shift() );
+ }
+ if( tokens[0].tokenType & type_ident ) {
+ if( tokens[0].tokenValue === 'center' ) {
+ vals[1] = length_fifty;
+ } else {
+ vals[0] = tokens[0].tokenValue;
+ }
+ }
+ else if( tokens[0].isLengthOrPercent() ) {
+ vals[1] = PIE.getLength( tokens[0].tokenValue );
+ }
+ if( tokens[1].tokenType & type_ident ) {
+ if( tokens[1].tokenValue === 'center' ) {
+ vals[3] = length_fifty;
+ } else {
+ vals[2] = tokens[1].tokenValue;
+ }
+ }
+ else if( tokens[1].isLengthOrPercent() ) {
+ vals[3] = PIE.getLength( tokens[1].tokenValue );
+ }
+ }
+
+ // Three or four values - CSS3
+ else {
+ // TODO
+ }
+
+ this._values = vals;
+ }
+ return this._values;
+ },
+
+ /**
+ * Find the coordinates of the background image from the upper-left corner of the background area.
+ * Note that these coordinate values are not rounded.
+ * @param {Element} el
+ * @param {number} width - the width for percentages (background area width minus image width)
+ * @param {number} height - the height for percentages (background area height minus image height)
+ * @return {Object} { x: Number, y: Number }
+ */
+ coords: function( el, width, height ) {
+ var vals = this.getValues(),
+ pxX = vals[1].pixels( el, width ),
+ pxY = vals[3].pixels( el, height );
+
+ return {
+ x: vals[0] === 'right' ? width - pxX : pxX,
+ y: vals[2] === 'bottom' ? height - pxY : pxY
+ };
+ }
+ };
+
+ return BgPosition;
+})();
+/**
+ * Wrapper for a CSS3 background-size value.
+ * @constructor
+ * @param {String|PIE.Length} w The width parameter
+ * @param {String|PIE.Length} h The height parameter, if any
+ */
+PIE.BgSize = (function() {
+
+ var CONTAIN = 'contain',
+ COVER = 'cover',
+ AUTO = 'auto';
+
+
+ function BgSize( w, h ) {
+ this.w = w;
+ this.h = h;
+ }
+ BgSize.prototype = {
+
+ pixels: function( el, areaW, areaH, imgW, imgH ) {
+ var me = this,
+ w = me.w,
+ h = me.h,
+ areaRatio = areaW / areaH,
+ imgRatio = imgW / imgH;
+
+ if ( w === CONTAIN ) {
+ w = imgRatio > areaRatio ? areaW : areaH * imgRatio;
+ h = imgRatio > areaRatio ? areaW / imgRatio : areaH;
+ }
+ else if ( w === COVER ) {
+ w = imgRatio < areaRatio ? areaW : areaH * imgRatio;
+ h = imgRatio < areaRatio ? areaW / imgRatio : areaH;
+ }
+ else if ( w === AUTO ) {
+ h = ( h === AUTO ? imgH : h.pixels( el, areaH ) );
+ w = h * imgRatio;
+ }
+ else {
+ w = w.pixels( el, areaW );
+ h = ( h === AUTO ? w / imgRatio : h.pixels( el, areaH ) );
+ }
+
+ return { w: w, h: h };
+ }
+
+ };
+
+ BgSize.DEFAULT = new BgSize( AUTO, AUTO );
+
+ return BgSize;
+})();
+/**
+ * Wrapper for angle values; handles conversion to degrees from all allowed angle units
+ * @constructor
+ * @param {string} val The raw CSS value for the angle. It is assumed it has been pre-validated.
+ */
+PIE.Angle = (function() {
+ function Angle( val ) {
+ this.val = val;
+ }
+ Angle.prototype = {
+ unitRE: /[a-z]+$/i,
+
+ /**
+ * @return {string} The unit of the angle value
+ */
+ getUnit: function() {
+ return this._unit || ( this._unit = this.val.match( this.unitRE )[0].toLowerCase() );
+ },
+
+ /**
+ * Get the numeric value of the angle in degrees.
+ * @return {number} The degrees value
+ */
+ degrees: function() {
+ var deg = this._deg, u, n;
+ if( deg === undefined ) {
+ u = this.getUnit();
+ n = parseFloat( this.val, 10 );
+ deg = this._deg = ( u === 'deg' ? n : u === 'rad' ? n / Math.PI * 180 : u === 'grad' ? n / 400 * 360 : u === 'turn' ? n * 360 : 0 );
+ }
+ return deg;
+ }
+ };
+
+ return Angle;
+})();/**
+ * Abstraction for colors values. Allows detection of rgba values. A singleton instance per unique
+ * value is returned from PIE.getColor() - always use that instead of instantiating directly.
+ * @constructor
+ * @param {string} val The raw CSS string value for the color
+ */
+PIE.Color = (function() {
+ var instances = {};
+
+ function Color( val ) {
+ this.val = val;
+ }
+
+ /**
+ * Regular expression for matching rgba colors and extracting their components
+ * @type {RegExp}
+ */
+ Color.rgbaRE = /\s*rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d+|\d*\.\d+)\s*\)\s*/;
+
+ Color.names = {
+ "aliceblue":"F0F8FF", "antiquewhite":"FAEBD7", "aqua":"0FF",
+ "aquamarine":"7FFFD4", "azure":"F0FFFF", "beige":"F5F5DC",
+ "bisque":"FFE4C4", "black":"000", "blanchedalmond":"FFEBCD",
+ "blue":"00F", "blueviolet":"8A2BE2", "brown":"A52A2A",
+ "burlywood":"DEB887", "cadetblue":"5F9EA0", "chartreuse":"7FFF00",
+ "chocolate":"D2691E", "coral":"FF7F50", "cornflowerblue":"6495ED",
+ "cornsilk":"FFF8DC", "crimson":"DC143C", "cyan":"0FF",
+ "darkblue":"00008B", "darkcyan":"008B8B", "darkgoldenrod":"B8860B",
+ "darkgray":"A9A9A9", "darkgreen":"006400", "darkkhaki":"BDB76B",
+ "darkmagenta":"8B008B", "darkolivegreen":"556B2F", "darkorange":"FF8C00",
+ "darkorchid":"9932CC", "darkred":"8B0000", "darksalmon":"E9967A",
+ "darkseagreen":"8FBC8F", "darkslateblue":"483D8B", "darkslategray":"2F4F4F",
+ "darkturquoise":"00CED1", "darkviolet":"9400D3", "deeppink":"FF1493",
+ "deepskyblue":"00BFFF", "dimgray":"696969", "dodgerblue":"1E90FF",
+ "firebrick":"B22222", "floralwhite":"FFFAF0", "forestgreen":"228B22",
+ "fuchsia":"F0F", "gainsboro":"DCDCDC", "ghostwhite":"F8F8FF",
+ "gold":"FFD700", "goldenrod":"DAA520", "gray":"808080",
+ "green":"008000", "greenyellow":"ADFF2F", "honeydew":"F0FFF0",
+ "hotpink":"FF69B4", "indianred":"CD5C5C", "indigo":"4B0082",
+ "ivory":"FFFFF0", "khaki":"F0E68C", "lavender":"E6E6FA",
+ "lavenderblush":"FFF0F5", "lawngreen":"7CFC00", "lemonchiffon":"FFFACD",
+ "lightblue":"ADD8E6", "lightcoral":"F08080", "lightcyan":"E0FFFF",
+ "lightgoldenrodyellow":"FAFAD2", "lightgreen":"90EE90", "lightgrey":"D3D3D3",
+ "lightpink":"FFB6C1", "lightsalmon":"FFA07A", "lightseagreen":"20B2AA",
+ "lightskyblue":"87CEFA", "lightslategray":"789", "lightsteelblue":"B0C4DE",
+ "lightyellow":"FFFFE0", "lime":"0F0", "limegreen":"32CD32",
+ "linen":"FAF0E6", "magenta":"F0F", "maroon":"800000",
+ "mediumauqamarine":"66CDAA", "mediumblue":"0000CD", "mediumorchid":"BA55D3",
+ "mediumpurple":"9370D8", "mediumseagreen":"3CB371", "mediumslateblue":"7B68EE",
+ "mediumspringgreen":"00FA9A", "mediumturquoise":"48D1CC", "mediumvioletred":"C71585",
+ "midnightblue":"191970", "mintcream":"F5FFFA", "mistyrose":"FFE4E1",
+ "moccasin":"FFE4B5", "navajowhite":"FFDEAD", "navy":"000080",
+ "oldlace":"FDF5E6", "olive":"808000", "olivedrab":"688E23",
+ "orange":"FFA500", "orangered":"FF4500", "orchid":"DA70D6",
+ "palegoldenrod":"EEE8AA", "palegreen":"98FB98", "paleturquoise":"AFEEEE",
+ "palevioletred":"D87093", "papayawhip":"FFEFD5", "peachpuff":"FFDAB9",
+ "peru":"CD853F", "pink":"FFC0CB", "plum":"DDA0DD",
+ "powderblue":"B0E0E6", "purple":"800080", "red":"F00",
+ "rosybrown":"BC8F8F", "royalblue":"4169E1", "saddlebrown":"8B4513",
+ "salmon":"FA8072", "sandybrown":"F4A460", "seagreen":"2E8B57",
+ "seashell":"FFF5EE", "sienna":"A0522D", "silver":"C0C0C0",
+ "skyblue":"87CEEB", "slateblue":"6A5ACD", "slategray":"708090",
+ "snow":"FFFAFA", "springgreen":"00FF7F", "steelblue":"4682B4",
+ "tan":"D2B48C", "teal":"008080", "thistle":"D8BFD8",
+ "tomato":"FF6347", "turquoise":"40E0D0", "violet":"EE82EE",
+ "wheat":"F5DEB3", "white":"FFF", "whitesmoke":"F5F5F5",
+ "yellow":"FF0", "yellowgreen":"9ACD32"
+ };
+
+ Color.prototype = {
+ /**
+ * @private
+ */
+ parse: function() {
+ if( !this._color ) {
+ var me = this,
+ v = me.val,
+ vLower,
+ m = v.match( Color.rgbaRE );
+ if( m ) {
+ me._color = 'rgb(' + m[1] + ',' + m[2] + ',' + m[3] + ')';
+ me._alpha = parseFloat( m[4] );
+ }
+ else {
+ if( ( vLower = v.toLowerCase() ) in Color.names ) {
+ v = '#' + Color.names[vLower];
+ }
+ me._color = v;
+ me._alpha = ( v === 'transparent' ? 0 : 1 );
+ }
+ }
+ },
+
+ /**
+ * Retrieve the value of the color in a format usable by IE natively. This will be the same as
+ * the raw input value, except for rgba values which will be converted to an rgb value.
+ * @param {Element} el The context element, used to get 'currentColor' keyword value.
+ * @return {string} Color value
+ */
+ colorValue: function( el ) {
+ this.parse();
+ return this._color === 'currentColor' ? el.currentStyle.color : this._color;
+ },
+
+ /**
+ * Retrieve the alpha value of the color. Will be 1 for all values except for rgba values
+ * with an alpha component.
+ * @return {number} The alpha value, from 0 to 1.
+ */
+ alpha: function() {
+ this.parse();
+ return this._alpha;
+ }
+ };
+
+
+ /**
+ * Retrieve a PIE.Color instance for the given value. A shared singleton instance is returned for each unique value.
+ * @param {string} val The CSS string representing the color. It is assumed that this will already have
+ * been validated as a valid color syntax.
+ */
+ PIE.getColor = function(val) {
+ return instances[ val ] || ( instances[ val ] = new Color( val ) );
+ };
+
+ return Color;
+})();/**
+ * A tokenizer for CSS value strings.
+ * @constructor
+ * @param {string} css The CSS value string
+ */
+PIE.Tokenizer = (function() {
+ function Tokenizer( css ) {
+ this.css = css;
+ this.ch = 0;
+ this.tokens = [];
+ this.tokenIndex = 0;
+ }
+
+ /**
+ * Enumeration of token type constants.
+ * @enum {number}
+ */
+ var Type = Tokenizer.Type = {
+ ANGLE: 1,
+ CHARACTER: 2,
+ COLOR: 4,
+ DIMEN: 8,
+ FUNCTION: 16,
+ IDENT: 32,
+ LENGTH: 64,
+ NUMBER: 128,
+ OPERATOR: 256,
+ PERCENT: 512,
+ STRING: 1024,
+ URL: 2048
+ };
+
+ /**
+ * A single token
+ * @constructor
+ * @param {number} type The type of the token - see PIE.Tokenizer.Type
+ * @param {string} value The value of the token
+ */
+ Tokenizer.Token = function( type, value ) {
+ this.tokenType = type;
+ this.tokenValue = value;
+ };
+ Tokenizer.Token.prototype = {
+ isLength: function() {
+ return this.tokenType & Type.LENGTH || ( this.tokenType & Type.NUMBER && this.tokenValue === '0' );
+ },
+ isLengthOrPercent: function() {
+ return this.isLength() || this.tokenType & Type.PERCENT;
+ }
+ };
+
+ Tokenizer.prototype = {
+ whitespace: /\s/,
+ number: /^[\+\-]?(\d*\.)?\d+/,
+ url: /^url\(\s*("([^"]*)"|'([^']*)'|([!#$%&*-~]*))\s*\)/i,
+ ident: /^\-?[_a-z][\w-]*/i,
+ string: /^("([^"]*)"|'([^']*)')/,
+ operator: /^[\/,]/,
+ hash: /^#[\w]+/,
+ hashColor: /^#([\da-f]{6}|[\da-f]{3})/i,
+
+ unitTypes: {
+ 'px': Type.LENGTH, 'em': Type.LENGTH, 'ex': Type.LENGTH,
+ 'mm': Type.LENGTH, 'cm': Type.LENGTH, 'in': Type.LENGTH,
+ 'pt': Type.LENGTH, 'pc': Type.LENGTH,
+ 'deg': Type.ANGLE, 'rad': Type.ANGLE, 'grad': Type.ANGLE
+ },
+
+ colorFunctions: {
+ 'rgb': 1, 'rgba': 1, 'hsl': 1, 'hsla': 1
+ },
+
+
+ /**
+ * Advance to and return the next token in the CSS string. If the end of the CSS string has
+ * been reached, null will be returned.
+ * @param {boolean} forget - if true, the token will not be stored for the purposes of backtracking with prev().
+ * @return {PIE.Tokenizer.Token}
+ */
+ next: function( forget ) {
+ var css, ch, firstChar, match, val,
+ me = this;
+
+ function newToken( type, value ) {
+ var tok = new Tokenizer.Token( type, value );
+ if( !forget ) {
+ me.tokens.push( tok );
+ me.tokenIndex++;
+ }
+ return tok;
+ }
+ function failure() {
+ me.tokenIndex++;
+ return null;
+ }
+
+ // In case we previously backed up, return the stored token in the next slot
+ if( this.tokenIndex < this.tokens.length ) {
+ return this.tokens[ this.tokenIndex++ ];
+ }
+
+ // Move past leading whitespace characters
+ while( this.whitespace.test( this.css.charAt( this.ch ) ) ) {
+ this.ch++;
+ }
+ if( this.ch >= this.css.length ) {
+ return failure();
+ }
+
+ ch = this.ch;
+ css = this.css.substring( this.ch );
+ firstChar = css.charAt( 0 );
+ switch( firstChar ) {
+ case '#':
+ if( match = css.match( this.hashColor ) ) {
+ this.ch += match[0].length;
+ return newToken( Type.COLOR, match[0] );
+ }
+ break;
+
+ case '"':
+ case "'":
+ if( match = css.match( this.string ) ) {
+ this.ch += match[0].length;
+ return newToken( Type.STRING, match[2] || match[3] || '' );
+ }
+ break;
+
+ case "/":
+ case ",":
+ this.ch++;
+ return newToken( Type.OPERATOR, firstChar );
+
+ case 'u':
+ if( match = css.match( this.url ) ) {
+ this.ch += match[0].length;
+ return newToken( Type.URL, match[2] || match[3] || match[4] || '' );
+ }
+ }
+
+ // Numbers and values starting with numbers
+ if( match = css.match( this.number ) ) {
+ val = match[0];
+ this.ch += val.length;
+
+ // Check if it is followed by a unit
+ if( css.charAt( val.length ) === '%' ) {
+ this.ch++;
+ return newToken( Type.PERCENT, val + '%' );
+ }
+ if( match = css.substring( val.length ).match( this.ident ) ) {
+ val += match[0];
+ this.ch += match[0].length;
+ return newToken( this.unitTypes[ match[0].toLowerCase() ] || Type.DIMEN, val );
+ }
+
+ // Plain ol' number
+ return newToken( Type.NUMBER, val );
+ }
+
+ // Identifiers
+ if( match = css.match( this.ident ) ) {
+ val = match[0];
+ this.ch += val.length;
+
+ // Named colors
+ if( val.toLowerCase() in PIE.Color.names || val === 'currentColor' || val === 'transparent' ) {
+ return newToken( Type.COLOR, val );
+ }
+
+ // Functions
+ if( css.charAt( val.length ) === '(' ) {
+ this.ch++;
+
+ // Color values in function format: rgb, rgba, hsl, hsla
+ if( val.toLowerCase() in this.colorFunctions ) {
+ function isNum( tok ) {
+ return tok && tok.tokenType & Type.NUMBER;
+ }
+ function isNumOrPct( tok ) {
+ return tok && ( tok.tokenType & ( Type.NUMBER | Type.PERCENT ) );
+ }
+ function isValue( tok, val ) {
+ return tok && tok.tokenValue === val;
+ }
+ function next() {
+ return me.next( 1 );
+ }
+
+ if( ( val.charAt(0) === 'r' ? isNumOrPct( next() ) : isNum( next() ) ) &&
+ isValue( next(), ',' ) &&
+ isNumOrPct( next() ) &&
+ isValue( next(), ',' ) &&
+ isNumOrPct( next() ) &&
+ ( val === 'rgb' || val === 'hsa' || (
+ isValue( next(), ',' ) &&
+ isNum( next() )
+ ) ) &&
+ isValue( next(), ')' ) ) {
+ return newToken( Type.COLOR, this.css.substring( ch, this.ch ) );
+ }
+ return failure();
+ }
+
+ return newToken( Type.FUNCTION, val );
+ }
+
+ // Other identifier
+ return newToken( Type.IDENT, val );
+ }
+
+ // Standalone character
+ this.ch++;
+ return newToken( Type.CHARACTER, firstChar );
+ },
+
+ /**
+ * Determine whether there is another token
+ * @return {boolean}
+ */
+ hasNext: function() {
+ var next = this.next();
+ this.prev();
+ return !!next;
+ },
+
+ /**
+ * Back up and return the previous token
+ * @return {PIE.Tokenizer.Token}
+ */
+ prev: function() {
+ return this.tokens[ this.tokenIndex-- - 2 ];
+ },
+
+ /**
+ * Retrieve all the tokens in the CSS string
+ * @return {Array.<PIE.Tokenizer.Token>}
+ */
+ all: function() {
+ while( this.next() ) {}
+ return this.tokens;
+ },
+
+ /**
+ * Return a list of tokens from the current position until the given function returns
+ * true. The final token will not be included in the list.
+ * @param {function():boolean} func - test function
+ * @param {boolean} require - if true, then if the end of the CSS string is reached
+ * before the test function returns true, null will be returned instead of the
+ * tokens that have been found so far.
+ * @return {Array.<PIE.Tokenizer.Token>}
+ */
+ until: function( func, require ) {
+ var list = [], t, hit;
+ while( t = this.next() ) {
+ if( func( t ) ) {
+ hit = true;
+ this.prev();
+ break;
+ }
+ list.push( t );
+ }
+ return require && !hit ? null : list;
+ }
+ };
+
+ return Tokenizer;
+})();/**
+ * Handles calculating, caching, and detecting changes to size and position of the element.
+ * @constructor
+ * @param {Element} el the target element
+ */
+PIE.BoundsInfo = function( el ) {
+ this.targetElement = el;
+};
+PIE.BoundsInfo.prototype = {
+
+ _locked: 0,
+
+ positionChanged: function() {
+ var last = this._lastBounds,
+ bounds;
+ return !last || ( ( bounds = this.getBounds() ) && ( last.x !== bounds.x || last.y !== bounds.y ) );
+ },
+
+ sizeChanged: function() {
+ var last = this._lastBounds,
+ bounds;
+ return !last || ( ( bounds = this.getBounds() ) && ( last.w !== bounds.w || last.h !== bounds.h ) );
+ },
+
+ getLiveBounds: function() {
+ var el = this.targetElement,
+ rect = el.getBoundingClientRect(),
+ isIE9 = PIE.ieDocMode === 9,
+ isIE7 = PIE.ieVersion === 7,
+ width = rect.right - rect.left;
+ return {
+ x: rect.left,
+ y: rect.top,
+ // In some cases scrolling the page will cause IE9 to report incorrect dimensions
+ // in the rect returned by getBoundingClientRect, so we must query offsetWidth/Height
+ // instead. Also IE7 is inconsistent in using logical vs. device pixels in measurements
+ // so we must calculate the ratio and use it in certain places as a position adjustment.
+ w: isIE9 || isIE7 ? el.offsetWidth : width,
+ h: isIE9 || isIE7 ? el.offsetHeight : rect.bottom - rect.top,
+ logicalZoomRatio: ( isIE7 && width ) ? el.offsetWidth / width : 1
+ };
+ },
+
+ getBounds: function() {
+ return this._locked ?
+ ( this._lockedBounds || ( this._lockedBounds = this.getLiveBounds() ) ) :
+ this.getLiveBounds();
+ },
+
+ hasBeenQueried: function() {
+ return !!this._lastBounds;
+ },
+
+ lock: function() {
+ ++this._locked;
+ },
+
+ unlock: function() {
+ if( !--this._locked ) {
+ if( this._lockedBounds ) this._lastBounds = this._lockedBounds;
+ this._lockedBounds = null;
+ }
+ }
+
+};
+(function() {
+
+function cacheWhenLocked( fn ) {
+ var uid = PIE.Util.getUID( fn );
+ return function() {
+ if( this._locked ) {
+ var cache = this._lockedValues || ( this._lockedValues = {} );
+ return ( uid in cache ) ? cache[ uid ] : ( cache[ uid ] = fn.call( this ) );
+ } else {
+ return fn.call( this );
+ }
+ }
+}
+
+
+PIE.StyleInfoBase = {
+
+ _locked: 0,
+
+ /**
+ * Create a new StyleInfo class, with the standard constructor, and augmented by
+ * the StyleInfoBase's members.
+ * @param proto
+ */
+ newStyleInfo: function( proto ) {
+ function StyleInfo( el ) {
+ this.targetElement = el;
+ this._lastCss = this.getCss();
+ }
+ PIE.Util.merge( StyleInfo.prototype, PIE.StyleInfoBase, proto );
+ StyleInfo._propsCache = {};
+ return StyleInfo;
+ },
+
+ /**
+ * Get an object representation of the target CSS style, caching it for each unique
+ * CSS value string.
+ * @return {Object}
+ */
+ getProps: function() {
+ var css = this.getCss(),
+ cache = this.constructor._propsCache;
+ return css ? ( css in cache ? cache[ css ] : ( cache[ css ] = this.parseCss( css ) ) ) : null;
+ },
+
+ /**
+ * Get the raw CSS value for the target style
+ * @return {string}
+ */
+ getCss: cacheWhenLocked( function() {
+ var el = this.targetElement,
+ ctor = this.constructor,
+ s = el.style,
+ cs = el.currentStyle,
+ cssProp = this.cssProperty,
+ styleProp = this.styleProperty,
+ prefixedCssProp = ctor._prefixedCssProp || ( ctor._prefixedCssProp = PIE.CSS_PREFIX + cssProp ),
+ prefixedStyleProp = ctor._prefixedStyleProp || ( ctor._prefixedStyleProp = PIE.STYLE_PREFIX + styleProp.charAt(0).toUpperCase() + styleProp.substring(1) );
+ return s[ prefixedStyleProp ] || cs.getAttribute( prefixedCssProp ) || s[ styleProp ] || cs.getAttribute( cssProp );
+ } ),
+
+ /**
+ * Determine whether the target CSS style is active.
+ * @return {boolean}
+ */
+ isActive: cacheWhenLocked( function() {
+ return !!this.getProps();
+ } ),
+
+ /**
+ * Determine whether the target CSS style has changed since the last time it was used.
+ * @return {boolean}
+ */
+ changed: cacheWhenLocked( function() {
+ var currentCss = this.getCss(),
+ changed = currentCss !== this._lastCss;
+ this._lastCss = currentCss;
+ return changed;
+ } ),
+
+ cacheWhenLocked: cacheWhenLocked,
+
+ lock: function() {
+ ++this._locked;
+ },
+
+ unlock: function() {
+ if( !--this._locked ) {
+ delete this._lockedValues;
+ }
+ }
+};
+
+})();/**
+ * Handles parsing, caching, and detecting changes to background (and -pie-background) CSS
+ * @constructor
+ * @param {Element} el the target element
+ */
+PIE.BackgroundStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
+
+ cssProperty: PIE.CSS_PREFIX + 'background',
+ styleProperty: PIE.STYLE_PREFIX + 'Background',
+
+ attachIdents: { 'scroll':1, 'fixed':1, 'local':1 },
+ repeatIdents: { 'repeat-x':1, 'repeat-y':1, 'repeat':1, 'no-repeat':1 },
+ originAndClipIdents: { 'padding-box':1, 'border-box':1, 'content-box':1 },
+ positionIdents: { 'top':1, 'right':1, 'bottom':1, 'left':1, 'center':1 },
+ sizeIdents: { 'contain':1, 'cover':1 },
+ propertyNames: {
+ CLIP: 'backgroundClip',
+ COLOR: 'backgroundColor',
+ IMAGE: 'backgroundImage',
+ ORIGIN: 'backgroundOrigin',
+ POSITION: 'backgroundPosition',
+ REPEAT: 'backgroundRepeat',
+ SIZE: 'backgroundSize'
+ },
+
+ /**
+ * For background styles, we support the -pie-background property but fall back to the standard
+ * backround* properties. The reason we have to use the prefixed version is that IE natively
+ * parses the standard properties and if it sees something it doesn't know how to parse, for example
+ * multiple values or gradient definitions, it will throw that away and not make it available through
+ * currentStyle.
+ *
+ * Format of return object:
+ * {
+ * color: <PIE.Color>,
+ * bgImages: [
+ * {
+ * imgType: 'image',
+ * imgUrl: 'image.png',
+ * imgRepeat: <'no-repeat' | 'repeat-x' | 'repeat-y' | 'repeat'>,
+ * bgPosition: <PIE.BgPosition>,
+ * bgAttachment: <'scroll' | 'fixed' | 'local'>,
+ * bgOrigin: <'border-box' | 'padding-box' | 'content-box'>,
+ * bgClip: <'border-box' | 'padding-box'>,
+ * bgSize: <PIE.BgSize>,
+ * origString: 'url(img.png) no-repeat top left'
+ * },
+ * {
+ * imgType: 'linear-gradient',
+ * gradientStart: <PIE.BgPosition>,
+ * angle: <PIE.Angle>,
+ * stops: [
+ * { color: <PIE.Color>, offset: <PIE.Length> },
+ * { color: <PIE.Color>, offset: <PIE.Length> }, ...
+ * ]
+ * }
+ * ]
+ * }
+ * @param {String} css
+ * @override
+ */
+ parseCss: function( css ) {
+ var el = this.targetElement,
+ cs = el.currentStyle,
+ tokenizer, token, image,
+ tok_type = PIE.Tokenizer.Type,
+ type_operator = tok_type.OPERATOR,
+ type_ident = tok_type.IDENT,
+ type_color = tok_type.COLOR,
+ tokType, tokVal,
+ beginCharIndex = 0,
+ positionIdents = this.positionIdents,
+ gradient, stop, width, height,
+ props = { bgImages: [] };
+
+ function isBgPosToken( token ) {
+ return token && token.isLengthOrPercent() || ( token.tokenType & type_ident && token.tokenValue in positionIdents );
+ }
+
+ function sizeToken( token ) {
+ return token && ( ( token.isLengthOrPercent() && PIE.getLength( token.tokenValue ) ) || ( token.tokenValue === 'auto' && 'auto' ) );
+ }
+
+ // If the CSS3-specific -pie-background property is present, parse it
+ if( this.getCss3() ) {
+ tokenizer = new PIE.Tokenizer( css );
+ image = {};
+
+ while( token = tokenizer.next() ) {
+ tokType = token.tokenType;
+ tokVal = token.tokenValue;
+
+ if( !image.imgType && tokType & tok_type.FUNCTION && tokVal === 'linear-gradient' ) {
+ gradient = { stops: [], imgType: tokVal };
+ stop = {};
+ while( token = tokenizer.next() ) {
+ tokType = token.tokenType;
+ tokVal = token.tokenValue;
+
+ // If we reached the end of the function and had at least 2 stops, flush the info
+ if( tokType & tok_type.CHARACTER && tokVal === ')' ) {
+ if( stop.color ) {
+ gradient.stops.push( stop );
+ }
+ if( gradient.stops.length > 1 ) {
+ PIE.Util.merge( image, gradient );
+ }
+ break;
+ }
+
+ // Color stop - must start with color
+ if( tokType & type_color ) {
+ // if we already have an angle/position, make sure that the previous token was a comma
+ if( gradient.angle || gradient.gradientStart ) {
+ token = tokenizer.prev();
+ if( token.tokenType !== type_operator ) {
+ break; //fail
+ }
+ tokenizer.next();
+ }
+
+ stop = {
+ color: PIE.getColor( tokVal )
+ };
+ // check for offset following color
+ token = tokenizer.next();
+ if( token.isLengthOrPercent() ) {
+ stop.offset = PIE.getLength( token.tokenValue );
+ } else {
+ tokenizer.prev();
+ }
+ }
+ // Angle - can only appear in first spot
+ else if( tokType & tok_type.ANGLE && !gradient.angle && !stop.color && !gradient.stops.length ) {
+ gradient.angle = new PIE.Angle( token.tokenValue );
+ }
+ else if( isBgPosToken( token ) && !gradient.gradientStart && !stop.color && !gradient.stops.length ) {
+ tokenizer.prev();
+ gradient.gradientStart = new PIE.BgPosition(
+ tokenizer.until( function( t ) {
+ return !isBgPosToken( t );
+ }, false )
+ );
+ }
+ else if( tokType & type_operator && tokVal === ',' ) {
+ if( stop.color ) {
+ gradient.stops.push( stop );
+ stop = {};
+ }
+ }
+ else {
+ // Found something we didn't recognize; fail without adding image
+ break;
+ }
+ }
+ }
+ else if( !image.imgType && tokType & tok_type.URL ) {
+ image.imgUrl = tokVal;
+ image.imgType = 'image';
+ }
+ else if( isBgPosToken( token ) && !image.bgPosition ) {
+ tokenizer.prev();
+ image.bgPosition = new PIE.BgPosition(
+ tokenizer.until( function( t ) {
+ return !isBgPosToken( t );
+ }, false )
+ );
+ }
+ else if( tokType & type_ident ) {
+ if( tokVal in this.repeatIdents && !image.imgRepeat ) {
+ image.imgRepeat = tokVal;
+ }
+ else if( tokVal in this.originAndClipIdents && !image.bgOrigin ) {
+ image.bgOrigin = tokVal;
+ if( ( token = tokenizer.next() ) && ( token.tokenType & type_ident ) &&
+ token.tokenValue in this.originAndClipIdents ) {
+ image.bgClip = token.tokenValue;
+ } else {
+ image.bgClip = tokVal;
+ tokenizer.prev();
+ }
+ }
+ else if( tokVal in this.attachIdents && !image.bgAttachment ) {
+ image.bgAttachment = tokVal;
+ }
+ else {
+ return null;
+ }
+ }
+ else if( tokType & type_color && !props.color ) {
+ props.color = PIE.getColor( tokVal );
+ }
+ else if( tokType & type_operator && tokVal === '/' && !image.bgSize && image.bgPosition ) {
+ // background size
+ token = tokenizer.next();
+ if( token.tokenType & type_ident && token.tokenValue in this.sizeIdents ) {
+ image.bgSize = new PIE.BgSize( token.tokenValue );
+ }
+ else if( width = sizeToken( token ) ) {
+ height = sizeToken( tokenizer.next() );
+ if ( !height ) {
+ height = width;
+ tokenizer.prev();
+ }
+ image.bgSize = new PIE.BgSize( width, height );
+ }
+ else {
+ return null;
+ }
+ }
+ // new layer
+ else if( tokType & type_operator && tokVal === ',' && image.imgType ) {
+ image.origString = css.substring( beginCharIndex, tokenizer.ch - 1 );
+ beginCharIndex = tokenizer.ch;
+ props.bgImages.push( image );
+ image = {};
+ }
+ else {
+ // Found something unrecognized; chuck everything
+ return null;
+ }
+ }
+
+ // leftovers
+ if( image.imgType ) {
+ image.origString = css.substring( beginCharIndex );
+ props.bgImages.push( image );
+ }
+ }
+
+ // Otherwise, use the standard background properties; let IE give us the values rather than parsing them
+ else {
+ this.withActualBg( PIE.ieDocMode < 9 ?
+ function() {
+ var propNames = this.propertyNames,
+ posX = cs[propNames.POSITION + 'X'],
+ posY = cs[propNames.POSITION + 'Y'],
+ img = cs[propNames.IMAGE],
+ color = cs[propNames.COLOR];
+
+ if( color !== 'transparent' ) {
+ props.color = PIE.getColor( color )
+ }
+ if( img !== 'none' ) {
+ props.bgImages = [ {
+ imgType: 'image',
+ imgUrl: new PIE.Tokenizer( img ).next().tokenValue,
+ imgRepeat: cs[propNames.REPEAT],
+ bgPosition: new PIE.BgPosition( new PIE.Tokenizer( posX + ' ' + posY ).all() )
+ } ];
+ }
+ } :
+ function() {
+ var propNames = this.propertyNames,
+ splitter = /\s*,\s*/,
+ images = cs[propNames.IMAGE].split( splitter ),
+ color = cs[propNames.COLOR],
+ repeats, positions, origins, clips, sizes, i, len, image, sizeParts;
+
+ if( color !== 'transparent' ) {
+ props.color = PIE.getColor( color )
+ }
+
+ len = images.length;
+ if( len && images[0] !== 'none' ) {
+ repeats = cs[propNames.REPEAT].split( splitter );
+ positions = cs[propNames.POSITION].split( splitter );
+ origins = cs[propNames.ORIGIN].split( splitter );
+ clips = cs[propNames.CLIP].split( splitter );
+ sizes = cs[propNames.SIZE].split( splitter );
+
+ props.bgImages = [];
+ for( i = 0; i < len; i++ ) {
+ image = images[ i ];
+ if( image && image !== 'none' ) {
+ sizeParts = sizes[i].split( ' ' );
+ props.bgImages.push( {
+ origString: image + ' ' + repeats[ i ] + ' ' + positions[ i ] + ' / ' + sizes[ i ] + ' ' +
+ origins[ i ] + ' ' + clips[ i ],
+ imgType: 'image',
+ imgUrl: new PIE.Tokenizer( image ).next().tokenValue,
+ imgRepeat: repeats[ i ],
+ bgPosition: new PIE.BgPosition( new PIE.Tokenizer( positions[ i ] ).all() ),
+ bgOrigin: origins[ i ],
+ bgClip: clips[ i ],
+ bgSize: new PIE.BgSize( sizeParts[ 0 ], sizeParts[ 1 ] )
+ } );
+ }
+ }
+ }
+ }
+ );
+ }
+
+ return ( props.color || props.bgImages[0] ) ? props : null;
+ },
+
+ /**
+ * Execute a function with the actual background styles (not overridden with runtimeStyle
+ * properties set by the renderers) available via currentStyle.
+ * @param fn
+ */
+ withActualBg: function( fn ) {
+ var isIE9 = PIE.ieDocMode > 8,
+ propNames = this.propertyNames,
+ rs = this.targetElement.runtimeStyle,
+ rsImage = rs[propNames.IMAGE],
+ rsColor = rs[propNames.COLOR],
+ rsRepeat = rs[propNames.REPEAT],
+ rsClip, rsOrigin, rsSize, rsPosition, ret;
+
+ if( rsImage ) rs[propNames.IMAGE] = '';
+ if( rsColor ) rs[propNames.COLOR] = '';
+ if( rsRepeat ) rs[propNames.REPEAT] = '';
+ if( isIE9 ) {
+ rsClip = rs[propNames.CLIP];
+ rsOrigin = rs[propNames.ORIGIN];
+ rsPosition = rs[propNames.POSITION];
+ rsSize = rs[propNames.SIZE];
+ if( rsClip ) rs[propNames.CLIP] = '';
+ if( rsOrigin ) rs[propNames.ORIGIN] = '';
+ if( rsPosition ) rs[propNames.POSITION] = '';
+ if( rsSize ) rs[propNames.SIZE] = '';
+ }
+
+ ret = fn.call( this );
+
+ if( rsImage ) rs[propNames.IMAGE] = rsImage;
+ if( rsColor ) rs[propNames.COLOR] = rsColor;
+ if( rsRepeat ) rs[propNames.REPEAT] = rsRepeat;
+ if( isIE9 ) {
+ if( rsClip ) rs[propNames.CLIP] = rsClip;
+ if( rsOrigin ) rs[propNames.ORIGIN] = rsOrigin;
+ if( rsPosition ) rs[propNames.POSITION] = rsPosition;
+ if( rsSize ) rs[propNames.SIZE] = rsSize;
+ }
+
+ return ret;
+ },
+
+ getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
+ return this.getCss3() ||
+ this.withActualBg( function() {
+ var cs = this.targetElement.currentStyle,
+ propNames = this.propertyNames;
+ return cs[propNames.COLOR] + ' ' + cs[propNames.IMAGE] + ' ' + cs[propNames.REPEAT] + ' ' +
+ cs[propNames.POSITION + 'X'] + ' ' + cs[propNames.POSITION + 'Y'];
+ } );
+ } ),
+
+ getCss3: PIE.StyleInfoBase.cacheWhenLocked( function() {
+ var el = this.targetElement;
+ return el.style[ this.styleProperty ] || el.currentStyle.getAttribute( this.cssProperty );
+ } ),
+
+ /**
+ * Tests if style.PiePngFix or the -pie-png-fix property is set to true in IE6.
+ */
+ isPngFix: function() {
+ var val = 0, el;
+ if( PIE.ieVersion < 7 ) {
+ el = this.targetElement;
+ val = ( '' + ( el.style[ PIE.STYLE_PREFIX + 'PngFix' ] || el.currentStyle.getAttribute( PIE.CSS_PREFIX + 'png-fix' ) ) === 'true' );
+ }
+ return val;
+ },
+
+ /**
+ * The isActive logic is slightly different, because getProps() always returns an object
+ * even if it is just falling back to the native background properties. But we only want
+ * to report is as being "active" if either the -pie-background override property is present
+ * and parses successfully or '-pie-png-fix' is set to true in IE6.
+ */
+ isActive: PIE.StyleInfoBase.cacheWhenLocked( function() {
+ return (this.getCss3() || this.isPngFix()) && !!this.getProps();
+ } )
+
+} );/**
+ * Handles parsing, caching, and detecting changes to border CSS
+ * @constructor
+ * @param {Element} el the target element
+ */
+PIE.BorderStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
+
+ sides: [ 'Top', 'Right', 'Bottom', 'Left' ],
+ namedWidths: {
+ 'thin': '1px',
+ 'medium': '3px',
+ 'thick': '5px'
+ },
+
+ parseCss: function( css ) {
+ var w = {},
+ s = {},
+ c = {},
+ active = false,
+ colorsSame = true,
+ stylesSame = true,
+ widthsSame = true;
+
+ this.withActualBorder( function() {
+ var el = this.targetElement,
+ cs = el.currentStyle,
+ i = 0,
+ style, color, width, lastStyle, lastColor, lastWidth, side, ltr;
+ for( ; i < 4; i++ ) {
+ side = this.sides[ i ];
+
+ ltr = side.charAt(0).toLowerCase();
+ style = s[ ltr ] = cs[ 'border' + side + 'Style' ];
+ color = cs[ 'border' + side + 'Color' ];
+ width = cs[ 'border' + side + 'Width' ];
+
+ if( i > 0 ) {
+ if( style !== lastStyle ) { stylesSame = false; }
+ if( color !== lastColor ) { colorsSame = false; }
+ if( width !== lastWidth ) { widthsSame = false; }
+ }
+ lastStyle = style;
+ lastColor = color;
+ lastWidth = width;
+
+ c[ ltr ] = PIE.getColor( color );
+
+ width = w[ ltr ] = PIE.getLength( s[ ltr ] === 'none' ? '0' : ( this.namedWidths[ width ] || width ) );
+ if( width.pixels( this.targetElement ) > 0 ) {
+ active = true;
+ }
+ }
+ } );
+
+ return active ? {
+ widths: w,
+ styles: s,
+ colors: c,
+ widthsSame: widthsSame,
+ colorsSame: colorsSame,
+ stylesSame: stylesSame
+ } : null;
+ },
+
+ getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
+ var el = this.targetElement,
+ cs = el.currentStyle,
+ css;
+
+ // Don't redraw or hide borders for cells in border-collapse:collapse tables
+ if( !( el.tagName in PIE.tableCellTags && el.offsetParent.currentStyle.borderCollapse === 'collapse' ) ) {
+ this.withActualBorder( function() {
+ css = cs.borderWidth + '|' + cs.borderStyle + '|' + cs.borderColor;
+ } );
+ }
+ return css;
+ } ),
+
+ /**
+ * Execute a function with the actual border styles (not overridden with runtimeStyle
+ * properties set by the renderers) available via currentStyle.
+ * @param fn
+ */
+ withActualBorder: function( fn ) {
+ var rs = this.targetElement.runtimeStyle,
+ rsWidth = rs.borderWidth,
+ rsColor = rs.borderColor,
+ ret;
+
+ if( rsWidth ) rs.borderWidth = '';
+ if( rsColor ) rs.borderColor = '';
+
+ ret = fn.call( this );
+
+ if( rsWidth ) rs.borderWidth = rsWidth;
+ if( rsColor ) rs.borderColor = rsColor;
+
+ return ret;
+ }
+
+} );
+/**
+ * Handles parsing, caching, and detecting changes to border-radius CSS
+ * @constructor
+ * @param {Element} el the target element
+ */
+(function() {
+
+PIE.BorderRadiusStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
+
+ cssProperty: 'border-radius',
+ styleProperty: 'borderRadius',
+
+ parseCss: function( css ) {
+ var p = null, x, y,
+ tokenizer, token, length,
+ hasNonZero = false;
+
+ if( css ) {
+ tokenizer = new PIE.Tokenizer( css );
+
+ function collectLengths() {
+ var arr = [], num;
+ while( ( token = tokenizer.next() ) && token.isLengthOrPercent() ) {
+ length = PIE.getLength( token.tokenValue );
+ num = length.getNumber();
+ if( num < 0 ) {
+ return null;
+ }
+ if( num > 0 ) {
+ hasNonZero = true;
+ }
+ arr.push( length );
+ }
+ return arr.length > 0 && arr.length < 5 ? {
+ 'tl': arr[0],
+ 'tr': arr[1] || arr[0],
+ 'br': arr[2] || arr[0],
+ 'bl': arr[3] || arr[1] || arr[0]
+ } : null;
+ }
+
+ // Grab the initial sequence of lengths
+ if( x = collectLengths() ) {
+ // See if there is a slash followed by more lengths, for the y-axis radii
+ if( token ) {
+ if( token.tokenType & PIE.Tokenizer.Type.OPERATOR && token.tokenValue === '/' ) {
+ y = collectLengths();
+ }
+ } else {
+ y = x;
+ }
+
+ // Treat all-zero values the same as no value
+ if( hasNonZero && x && y ) {
+ p = { x: x, y : y };
+ }
+ }
+ }
+
+ return p;
+ }
+} );
+
+var zero = PIE.getLength( '0' ),
+ zeros = { 'tl': zero, 'tr': zero, 'br': zero, 'bl': zero };
+PIE.BorderRadiusStyleInfo.ALL_ZERO = { x: zeros, y: zeros };
+
+})();/**
+ * Handles parsing, caching, and detecting changes to border-image CSS
+ * @constructor
+ * @param {Element} el the target element
+ */
+PIE.BorderImageStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
+
+ cssProperty: 'border-image',
+ styleProperty: 'borderImage',
+
+ repeatIdents: { 'stretch':1, 'round':1, 'repeat':1, 'space':1 },
+
+ parseCss: function( css ) {
+ var p = null, tokenizer, token, type, value,
+ slices, widths, outsets,
+ slashCount = 0,
+ Type = PIE.Tokenizer.Type,
+ IDENT = Type.IDENT,
+ NUMBER = Type.NUMBER,
+ PERCENT = Type.PERCENT;
+
+ if( css ) {
+ tokenizer = new PIE.Tokenizer( css );
+ p = {};
+
+ function isSlash( token ) {
+ return token && ( token.tokenType & Type.OPERATOR ) && ( token.tokenValue === '/' );
+ }
+
+ function isFillIdent( token ) {
+ return token && ( token.tokenType & IDENT ) && ( token.tokenValue === 'fill' );
+ }
+
+ function collectSlicesEtc() {
+ slices = tokenizer.until( function( tok ) {
+ return !( tok.tokenType & ( NUMBER | PERCENT ) );
+ } );
+
+ if( isFillIdent( tokenizer.next() ) && !p.fill ) {
+ p.fill = true;
+ } else {
+ tokenizer.prev();
+ }
+
+ if( isSlash( tokenizer.next() ) ) {
+ slashCount++;
+ widths = tokenizer.until( function( token ) {
+ return !token.isLengthOrPercent() && !( ( token.tokenType & IDENT ) && token.tokenValue === 'auto' );
+ } );
+
+ if( isSlash( tokenizer.next() ) ) {
+ slashCount++;
+ outsets = tokenizer.until( function( token ) {
+ return !token.isLength();
+ } );
+ }
+ } else {
+ tokenizer.prev();
+ }
+ }
+
+ while( token = tokenizer.next() ) {
+ type = token.tokenType;
+ value = token.tokenValue;
+
+ // Numbers and/or 'fill' keyword: slice values. May be followed optionally by width values, followed optionally by outset values
+ if( type & ( NUMBER | PERCENT ) && !slices ) {
+ tokenizer.prev();
+ collectSlicesEtc();
+ }
+ else if( isFillIdent( token ) && !p.fill ) {
+ p.fill = true;
+ collectSlicesEtc();
+ }
+
+ // Idents: one or values for 'repeat'
+ else if( ( type & IDENT ) && this.repeatIdents[value] && !p.repeat ) {
+ p.repeat = { h: value };
+ if( token = tokenizer.next() ) {
+ if( ( token.tokenType & IDENT ) && this.repeatIdents[token.tokenValue] ) {
+ p.repeat.v = token.tokenValue;
+ } else {
+ tokenizer.prev();
+ }
+ }
+ }
+
+ // URL of the image
+ else if( ( type & Type.URL ) && !p.src ) {
+ p.src = value;
+ }
+
+ // Found something unrecognized; exit.
+ else {
+ return null;
+ }
+ }
+
+ // Validate what we collected
+ if( !p.src || !slices || slices.length < 1 || slices.length > 4 ||
+ ( widths && widths.length > 4 ) || ( slashCount === 1 && widths.length < 1 ) ||
+ ( outsets && outsets.length > 4 ) || ( slashCount === 2 && outsets.length < 1 ) ) {
+ return null;
+ }
+
+ // Fill in missing values
+ if( !p.repeat ) {
+ p.repeat = { h: 'stretch' };
+ }
+ if( !p.repeat.v ) {
+ p.repeat.v = p.repeat.h;
+ }
+
+ function distributeSides( tokens, convertFn ) {
+ return {
+ 't': convertFn( tokens[0] ),
+ 'r': convertFn( tokens[1] || tokens[0] ),
+ 'b': convertFn( tokens[2] || tokens[0] ),
+ 'l': convertFn( tokens[3] || tokens[1] || tokens[0] )
+ };
+ }
+
+ p.slice = distributeSides( slices, function( tok ) {
+ return PIE.getLength( ( tok.tokenType & NUMBER ) ? tok.tokenValue + 'px' : tok.tokenValue );
+ } );
+
+ if( widths && widths[0] ) {
+ p.widths = distributeSides( widths, function( tok ) {
+ return tok.isLengthOrPercent() ? PIE.getLength( tok.tokenValue ) : tok.tokenValue;
+ } );
+ }
+
+ if( outsets && outsets[0] ) {
+ p.outset = distributeSides( outsets, function( tok ) {
+ return tok.isLength() ? PIE.getLength( tok.tokenValue ) : tok.tokenValue;
+ } );
+ }
+ }
+
+ return p;
+ }
+
+} );/**
+ * Handles parsing, caching, and detecting changes to box-shadow CSS
+ * @constructor
+ * @param {Element} el the target element
+ */
+PIE.BoxShadowStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
+
+ cssProperty: 'box-shadow',
+ styleProperty: 'boxShadow',
+
+ parseCss: function( css ) {
+ var props,
+ getLength = PIE.getLength,
+ Type = PIE.Tokenizer.Type,
+ tokenizer;
+
+ if( css ) {
+ tokenizer = new PIE.Tokenizer( css );
+ props = { outset: [], inset: [] };
+
+ function parseItem() {
+ var token, type, value, color, lengths, inset, len;
+
+ while( token = tokenizer.next() ) {
+ value = token.tokenValue;
+ type = token.tokenType;
+
+ if( type & Type.OPERATOR && value === ',' ) {
+ break;
+ }
+ else if( token.isLength() && !lengths ) {
+ tokenizer.prev();
+ lengths = tokenizer.until( function( token ) {
+ return !token.isLength();
+ } );
+ }
+ else if( type & Type.COLOR && !color ) {
+ color = value;
+ }
+ else if( type & Type.IDENT && value === 'inset' && !inset ) {
+ inset = true;
+ }
+ else { //encountered an unrecognized token; fail.
+ return false;
+ }
+ }
+
+ len = lengths && lengths.length;
+ if( len > 1 && len < 5 ) {
+ ( inset ? props.inset : props.outset ).push( {
+ xOffset: getLength( lengths[0].tokenValue ),
+ yOffset: getLength( lengths[1].tokenValue ),
+ blur: getLength( lengths[2] ? lengths[2].tokenValue : '0' ),
+ spread: getLength( lengths[3] ? lengths[3].tokenValue : '0' ),
+ color: PIE.getColor( color || 'currentColor' )
+ } );
+ return true;
+ }
+ return false;
+ }
+
+ while( parseItem() ) {}
+ }
+
+ return props && ( props.inset.length || props.outset.length ) ? props : null;
+ }
+} );
+/**
+ * Retrieves the state of the element's visibility and display
+ * @constructor
+ * @param {Element} el the target element
+ */
+PIE.VisibilityStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
+
+ getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
+ var cs = this.targetElement.currentStyle;
+ return cs.visibility + '|' + cs.display;
+ } ),
+
+ parseCss: function() {
+ var el = this.targetElement,
+ rs = el.runtimeStyle,
+ cs = el.currentStyle,
+ rsVis = rs.visibility,
+ csVis;
+
+ rs.visibility = '';
+ csVis = cs.visibility;
+ rs.visibility = rsVis;
+
+ return {
+ visible: csVis !== 'hidden',
+ displayed: cs.display !== 'none'
+ }
+ },
+
+ /**
+ * Always return false for isActive, since this property alone will not trigger
+ * a renderer to do anything.
+ */
+ isActive: function() {
+ return false;
+ }
+
+} );
+PIE.RendererBase = {
+
+ /**
+ * Create a new Renderer class, with the standard constructor, and augmented by
+ * the RendererBase's members.
+ * @param proto
+ */
+ newRenderer: function( proto ) {
+ function Renderer( el, boundsInfo, styleInfos, parent ) {
+ this.targetElement = el;
+ this.boundsInfo = boundsInfo;
+ this.styleInfos = styleInfos;
+ this.parent = parent;
+ }
+ PIE.Util.merge( Renderer.prototype, PIE.RendererBase, proto );
+ return Renderer;
+ },
+
+ /**
+ * Flag indicating the element has already been positioned at least once.
+ * @type {boolean}
+ */
+ isPositioned: false,
+
+ /**
+ * Determine if the renderer needs to be updated
+ * @return {boolean}
+ */
+ needsUpdate: function() {
+ return false;
+ },
+
+ /**
+ * Run any preparation logic that would affect the main update logic of this
+ * renderer or any of the other renderers, e.g. things that might affect the
+ * element's size or style properties.
+ */
+ prepareUpdate: PIE.emptyFn,
+
+ /**
+ * Tell the renderer to update based on modified properties
+ */
+ updateProps: function() {
+ this.destroy();
+ if( this.isActive() ) {
+ this.draw();
+ }
+ },
+
+ /**
+ * Tell the renderer to update based on modified element position
+ */
+ updatePos: function() {
+ this.isPositioned = true;
+ },
+
+ /**
+ * Tell the renderer to update based on modified element dimensions
+ */
+ updateSize: function() {
+ if( this.isActive() ) {
+ this.draw();
+ } else {
+ this.destroy();
+ }
+ },
+
+
+ /**
+ * Add a layer element, with the given z-order index, to the renderer's main box element. We can't use
+ * z-index because that breaks when the root rendering box's z-index is 'auto' in IE8+ standards mode.
+ * So instead we make sure they are inserted into the DOM in the correct order.
+ * @param {number} index
+ * @param {Element} el
+ */
+ addLayer: function( index, el ) {
+ this.removeLayer( index );
+ for( var layers = this._layers || ( this._layers = [] ), i = index + 1, len = layers.length, layer; i < len; i++ ) {
+ layer = layers[i];
+ if( layer ) {
+ break;
+ }
+ }
+ layers[index] = el;
+ this.getBox().insertBefore( el, layer || null );
+ },
+
+ /**
+ * Retrieve a layer element by its index, or null if not present
+ * @param {number} index
+ * @return {Element}
+ */
+ getLayer: function( index ) {
+ var layers = this._layers;
+ return layers && layers[index] || null;
+ },
+
+ /**
+ * Remove a layer element by its index
+ * @param {number} index
+ */
+ removeLayer: function( index ) {
+ var layer = this.getLayer( index ),
+ box = this._box;
+ if( layer && box ) {
+ box.removeChild( layer );
+ this._layers[index] = null;
+ }
+ },
+
+
+ /**
+ * Get a VML shape by name, creating it if necessary.
+ * @param {string} name A name identifying the element
+ * @param {string=} subElName If specified a subelement of the shape will be created with this tag name
+ * @param {Element} parent The parent element for the shape; will be ignored if 'group' is specified
+ * @param {number=} group If specified, an ordinal group for the shape. 1 or greater. Groups are rendered
+ * using container elements in the correct order, to get correct z stacking without z-index.
+ */
+ getShape: function( name, subElName, parent, group ) {
+ var shapes = this._shapes || ( this._shapes = {} ),
+ shape = shapes[ name ],
+ s;
+
+ if( !shape ) {
+ shape = shapes[ name ] = PIE.Util.createVmlElement( 'shape' );
+ if( subElName ) {
+ shape.appendChild( shape[ subElName ] = PIE.Util.createVmlElement( subElName ) );
+ }
+
+ if( group ) {
+ parent = this.getLayer( group );
+ if( !parent ) {
+ this.addLayer( group, doc.createElement( 'group' + group ) );
+ parent = this.getLayer( group );
+ }
+ }
+
+ parent.appendChild( shape );
+
+ s = shape.style;
+ s.position = 'absolute';
+ s.left = s.top = 0;
+ s['behavior'] = 'url(#default#VML)';
+ }
+ return shape;
+ },
+
+ /**
+ * Delete a named shape which was created by getShape(). Returns true if a shape with the
+ * given name was found and deleted, or false if there was no shape of that name.
+ * @param {string} name
+ * @return {boolean}
+ */
+ deleteShape: function( name ) {
+ var shapes = this._shapes,
+ shape = shapes && shapes[ name ];
+ if( shape ) {
+ shape.parentNode.removeChild( shape );
+ delete shapes[ name ];
+ }
+ return !!shape;
+ },
+
+
+ /**
+ * For a given set of border radius length/percentage values, convert them to concrete pixel
+ * values based on the current size of the target element.
+ * @param {Object} radii
+ * @return {Object}
+ */
+ getRadiiPixels: function( radii ) {
+ var el = this.targetElement,
+ bounds = this.boundsInfo.getBounds(),
+ w = bounds.w,
+ h = bounds.h,
+ tlX, tlY, trX, trY, brX, brY, blX, blY, f;
+
+ tlX = radii.x['tl'].pixels( el, w );
+ tlY = radii.y['tl'].pixels( el, h );
+ trX = radii.x['tr'].pixels( el, w );
+ trY = radii.y['tr'].pixels( el, h );
+ brX = radii.x['br'].pixels( el, w );
+ brY = radii.y['br'].pixels( el, h );
+ blX = radii.x['bl'].pixels( el, w );
+ blY = radii.y['bl'].pixels( el, h );
+
+ // If any corner ellipses overlap, reduce them all by the appropriate factor. This formula
+ // is taken straight from the CSS3 Backgrounds and Borders spec.
+ f = Math.min(
+ w / ( tlX + trX ),
+ h / ( trY + brY ),
+ w / ( blX + brX ),
+ h / ( tlY + blY )
+ );
+ if( f < 1 ) {
+ tlX *= f;
+ tlY *= f;
+ trX *= f;
+ trY *= f;
+ brX *= f;
+ brY *= f;
+ blX *= f;
+ blY *= f;
+ }
+
+ return {
+ x: {
+ 'tl': tlX,
+ 'tr': trX,
+ 'br': brX,
+ 'bl': blX
+ },
+ y: {
+ 'tl': tlY,
+ 'tr': trY,
+ 'br': brY,
+ 'bl': blY
+ }
+ }
+ },
+
+ /**
+ * Return the VML path string for the element's background box, with corners rounded.
+ * @param {Object.<{t:number, r:number, b:number, l:number}>} shrink - if present, specifies number of
+ * pixels to shrink the box path inward from the element's four sides.
+ * @param {number=} mult If specified, all coordinates will be multiplied by this number
+ * @param {Object=} radii If specified, this will be used for the corner radii instead of the properties
+ * from this renderer's borderRadiusInfo object.
+ * @return {string} the VML path
+ */
+ getBoxPath: function( shrink, mult, radii ) {
+ mult = mult || 1;
+
+ var r, str,
+ bounds = this.boundsInfo.getBounds(),
+ w = bounds.w * mult,
+ h = bounds.h * mult,
+ radInfo = this.styleInfos.borderRadiusInfo,
+ floor = Math.floor, ceil = Math.ceil,
+ shrinkT = shrink ? shrink.t * mult : 0,
+ shrinkR = shrink ? shrink.r * mult : 0,
+ shrinkB = shrink ? shrink.b * mult : 0,
+ shrinkL = shrink ? shrink.l * mult : 0,
+ tlX, tlY, trX, trY, brX, brY, blX, blY;
+
+ if( radii || radInfo.isActive() ) {
+ r = this.getRadiiPixels( radii || radInfo.getProps() );
+
+ tlX = r.x['tl'] * mult;
+ tlY = r.y['tl'] * mult;
+ trX = r.x['tr'] * mult;
+ trY = r.y['tr'] * mult;
+ brX = r.x['br'] * mult;
+ brY = r.y['br'] * mult;
+ blX = r.x['bl'] * mult;
+ blY = r.y['bl'] * mult;
+
+ str = 'm' + floor( shrinkL ) + ',' + floor( tlY ) +
+ 'qy' + floor( tlX ) + ',' + floor( shrinkT ) +
+ 'l' + ceil( w - trX ) + ',' + floor( shrinkT ) +
+ 'qx' + ceil( w - shrinkR ) + ',' + floor( trY ) +
+ 'l' + ceil( w - shrinkR ) + ',' + ceil( h - brY ) +
+ 'qy' + ceil( w - brX ) + ',' + ceil( h - shrinkB ) +
+ 'l' + floor( blX ) + ',' + ceil( h - shrinkB ) +
+ 'qx' + floor( shrinkL ) + ',' + ceil( h - blY ) + ' x e';
+ } else {
+ // simplified path for non-rounded box
+ str = 'm' + floor( shrinkL ) + ',' + floor( shrinkT ) +
+ 'l' + ceil( w - shrinkR ) + ',' + floor( shrinkT ) +
+ 'l' + ceil( w - shrinkR ) + ',' + ceil( h - shrinkB ) +
+ 'l' + floor( shrinkL ) + ',' + ceil( h - shrinkB ) +
+ 'xe';
+ }
+ return str;
+ },
+
+
+ /**
+ * Get the container element for the shapes, creating it if necessary.
+ */
+ getBox: function() {
+ var box = this.parent.getLayer( this.boxZIndex ), s;
+
+ if( !box ) {
+ box = doc.createElement( this.boxName );
+ s = box.style;
+ s.position = 'absolute';
+ s.top = s.left = 0;
+ this.parent.addLayer( this.boxZIndex, box );
+ }
+
+ return box;
+ },
+
+
+ /**
+ * Hide the actual border of the element. In IE7 and up we can just set its color to transparent;
+ * however IE6 does not support transparent borders so we have to get tricky with it. Also, some elements
+ * like form buttons require removing the border width altogether, so for those we increase the padding
+ * by the border size.
+ */
+ hideBorder: function() {
+ var el = this.targetElement,
+ cs = el.currentStyle,
+ rs = el.runtimeStyle,
+ tag = el.tagName,
+ isIE6 = PIE.ieVersion === 6,
+ sides, side, i;
+
+ if( ( isIE6 && ( tag in PIE.childlessElements || tag === 'FIELDSET' ) ) ||
+ tag === 'BUTTON' || ( tag === 'INPUT' && el.type in PIE.inputButtonTypes ) ) {
+ rs.borderWidth = '';
+ sides = this.styleInfos.borderInfo.sides;
+ for( i = sides.length; i--; ) {
+ side = sides[ i ];
+ rs[ 'padding' + side ] = '';
+ rs[ 'padding' + side ] = ( PIE.getLength( cs[ 'padding' + side ] ) ).pixels( el ) +
+ ( PIE.getLength( cs[ 'border' + side + 'Width' ] ) ).pixels( el ) +
+ ( PIE.ieVersion !== 8 && i % 2 ? 1 : 0 ); //needs an extra horizontal pixel to counteract the extra "inner border" going away
+ }
+ rs.borderWidth = 0;
+ }
+ else if( isIE6 ) {
+ // Wrap all the element's children in a custom element, set the element to visiblity:hidden,
+ // and set the wrapper element to visiblity:visible. This hides the outer element's decorations
+ // (background and border) but displays all the contents.
+ // TODO find a better way to do this that doesn't mess up the DOM parent-child relationship,
+ // as this can interfere with other author scripts which add/modify/delete children. Also, this
+ // won't work for elements which cannot take children, e.g. input/button/textarea/img/etc. Look into
+ // using a compositor filter or some other filter which masks the border.
+ if( el.childNodes.length !== 1 || el.firstChild.tagName !== 'ie6-mask' ) {
+ var cont = doc.createElement( 'ie6-mask' ),
+ s = cont.style, child;
+ s.visibility = 'visible';
+ s.zoom = 1;
+ while( child = el.firstChild ) {
+ cont.appendChild( child );
+ }
+ el.appendChild( cont );
+ rs.visibility = 'hidden';
+ }
+ }
+ else {
+ rs.borderColor = 'transparent';
+ }
+ },
+
+ unhideBorder: function() {
+
+ },
+
+
+ /**
+ * Destroy the rendered objects. This is a base implementation which handles common renderer
+ * structures, but individual renderers may override as necessary.
+ */
+ destroy: function() {
+ this.parent.removeLayer( this.boxZIndex );
+ delete this._shapes;
+ delete this._layers;
+ }
+};
+/**
+ * Root renderer; creates the outermost container element and handles keeping it aligned
+ * with the target element's size and position.
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ */
+PIE.RootRenderer = PIE.RendererBase.newRenderer( {
+
+ isActive: function() {
+ var children = this.childRenderers;
+ for( var i in children ) {
+ if( children.hasOwnProperty( i ) && children[ i ].isActive() ) {
+ return true;
+ }
+ }
+ return false;
+ },
+
+ needsUpdate: function() {
+ return this.styleInfos.visibilityInfo.changed();
+ },
+
+ updatePos: function() {
+ if( this.isActive() ) {
+ var el = this.getPositioningElement(),
+ par = el,
+ docEl,
+ parRect,
+ tgtCS = el.currentStyle,
+ tgtPos = tgtCS.position,
+ boxPos,
+ s = this.getBox().style, cs,
+ x = 0, y = 0,
+ elBounds = this.boundsInfo.getBounds(),
+ logicalZoomRatio = elBounds.logicalZoomRatio;
+
+ if( tgtPos === 'fixed' && PIE.ieVersion > 6 ) {
+ x = elBounds.x * logicalZoomRatio;
+ y = elBounds.y * logicalZoomRatio;
+ boxPos = tgtPos;
+ } else {
+ // Get the element's offsets from its nearest positioned ancestor. Uses
+ // getBoundingClientRect for accuracy and speed.
+ do {
+ par = par.offsetParent;
+ } while( par && ( par.currentStyle.position === 'static' ) );
+ if( par ) {
+ parRect = par.getBoundingClientRect();
+ cs = par.currentStyle;
+ x = ( elBounds.x - parRect.left ) * logicalZoomRatio - ( parseFloat(cs.borderLeftWidth) || 0 );
+ y = ( elBounds.y - parRect.top ) * logicalZoomRatio - ( parseFloat(cs.borderTopWidth) || 0 );
+ } else {
+ docEl = doc.documentElement;
+ x = ( elBounds.x + docEl.scrollLeft - docEl.clientLeft ) * logicalZoomRatio;
+ y = ( elBounds.y + docEl.scrollTop - docEl.clientTop ) * logicalZoomRatio;
+ }
+ boxPos = 'absolute';
+ }
+
+ s.position = boxPos;
+ s.left = x;
+ s.top = y;
+ s.zIndex = tgtPos === 'static' ? -1 : tgtCS.zIndex;
+ this.isPositioned = true;
+ }
+ },
+
+ updateSize: PIE.emptyFn,
+
+ updateVisibility: function() {
+ var vis = this.styleInfos.visibilityInfo.getProps();
+ this.getBox().style.display = ( vis.visible && vis.displayed ) ? '' : 'none';
+ },
+
+ updateProps: function() {
+ if( this.isActive() ) {
+ this.updateVisibility();
+ } else {
+ this.destroy();
+ }
+ },
+
+ getPositioningElement: function() {
+ var el = this.targetElement;
+ return el.tagName in PIE.tableCellTags ? el.offsetParent : el;
+ },
+
+ getBox: function() {
+ var box = this._box, el;
+ if( !box ) {
+ el = this.getPositioningElement();
+ box = this._box = doc.createElement( 'css3-container' );
+ box.style['direction'] = 'ltr'; //fix positioning bug in rtl environments
+
+ this.updateVisibility();
+
+ el.parentNode.insertBefore( box, el );
+ }
+ return box;
+ },
+
+ finishUpdate: PIE.emptyFn,
+
+ destroy: function() {
+ var box = this._box, par;
+ if( box && ( par = box.parentNode ) ) {
+ par.removeChild( box );
+ }
+ delete this._box;
+ delete this._layers;
+ }
+
+} );
+/**
+ * Renderer for element backgrounds.
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ * @param {PIE.RootRenderer} parent
+ */
+PIE.BackgroundRenderer = PIE.RendererBase.newRenderer( {
+
+ boxZIndex: 2,
+ boxName: 'background',
+
+ needsUpdate: function() {
+ var si = this.styleInfos;
+ return si.backgroundInfo.changed() || si.borderRadiusInfo.changed();
+ },
+
+ isActive: function() {
+ var si = this.styleInfos;
+ return si.borderImageInfo.isActive() ||
+ si.borderRadiusInfo.isActive() ||
+ si.backgroundInfo.isActive() ||
+ ( si.boxShadowInfo.isActive() && si.boxShadowInfo.getProps().inset );
+ },
+
+ /**
+ * Draw the shapes
+ */
+ draw: function() {
+ var bounds = this.boundsInfo.getBounds();
+ if( bounds.w && bounds.h ) {
+ this.drawBgColor();
+ this.drawBgImages();
+ }
+ },
+
+ /**
+ * Draw the background color shape
+ */
+ drawBgColor: function() {
+ var props = this.styleInfos.backgroundInfo.getProps(),
+ bounds = this.boundsInfo.getBounds(),
+ el = this.targetElement,
+ color = props && props.color,
+ shape, w, h, s, alpha;
+
+ if( color && color.alpha() > 0 ) {
+ this.hideBackground();
+
+ shape = this.getShape( 'bgColor', 'fill', this.getBox(), 1 );
+ w = bounds.w;
+ h = bounds.h;
+ shape.stroked = false;
+ shape.coordsize = w * 2 + ',' + h * 2;
+ shape.coordorigin = '1,1';
+ shape.path = this.getBoxPath( null, 2 );
+ s = shape.style;
+ s.width = w;
+ s.height = h;
+ shape.fill.color = color.colorValue( el );
+
+ alpha = color.alpha();
+ if( alpha < 1 ) {
+ shape.fill.opacity = alpha;
+ }
+ } else {
+ this.deleteShape( 'bgColor' );
+ }
+ },
+
+ /**
+ * Draw all the background image layers
+ */
+ drawBgImages: function() {
+ var props = this.styleInfos.backgroundInfo.getProps(),
+ bounds = this.boundsInfo.getBounds(),
+ images = props && props.bgImages,
+ img, shape, w, h, s, i;
+
+ if( images ) {
+ this.hideBackground();
+
+ w = bounds.w;
+ h = bounds.h;
+
+ i = images.length;
+ while( i-- ) {
+ img = images[i];
+ shape = this.getShape( 'bgImage' + i, 'fill', this.getBox(), 2 );
+
+ shape.stroked = false;
+ shape.fill.type = 'tile';
+ shape.fillcolor = 'none';
+ shape.coordsize = w * 2 + ',' + h * 2;
+ shape.coordorigin = '1,1';
+ shape.path = this.getBoxPath( 0, 2 );
+ s = shape.style;
+ s.width = w;
+ s.height = h;
+
+ if( img.imgType === 'linear-gradient' ) {
+ this.addLinearGradient( shape, img );
+ }
+ else {
+ shape.fill.src = img.imgUrl;
+ this.positionBgImage( shape, i );
+ }
+ }
+ }
+
+ // Delete any bgImage shapes previously created which weren't used above
+ i = images ? images.length : 0;
+ while( this.deleteShape( 'bgImage' + i++ ) ) {}
+ },
+
+
+ /**
+ * Set the position and clipping of the background image for a layer
+ * @param {Element} shape
+ * @param {number} index
+ */
+ positionBgImage: function( shape, index ) {
+ var me = this;
+ PIE.Util.withImageSize( shape.fill.src, function( size ) {
+ var el = me.targetElement,
+ bounds = me.boundsInfo.getBounds(),
+ elW = bounds.w,
+ elH = bounds.h;
+
+ // It's possible that the element dimensions are zero now but weren't when the original
+ // update executed, make sure that's not the case to avoid divide-by-zero error
+ if( elW && elH ) {
+ var fill = shape.fill,
+ si = me.styleInfos,
+ border = si.borderInfo.getProps(),
+ bw = border && border.widths,
+ bwT = bw ? bw['t'].pixels( el ) : 0,
+ bwR = bw ? bw['r'].pixels( el ) : 0,
+ bwB = bw ? bw['b'].pixels( el ) : 0,
+ bwL = bw ? bw['l'].pixels( el ) : 0,
+ bg = si.backgroundInfo.getProps().bgImages[ index ],
+ bgPos = bg.bgPosition ? bg.bgPosition.coords( el, elW - size.w - bwL - bwR, elH - size.h - bwT - bwB ) : { x:0, y:0 },
+ repeat = bg.imgRepeat,
+ pxX, pxY,
+ clipT = 0, clipL = 0,
+ clipR = elW + 1, clipB = elH + 1, //make sure the default clip region is not inside the box (by a subpixel)
+ clipAdjust = PIE.ieVersion === 8 ? 0 : 1; //prior to IE8 requires 1 extra pixel in the image clip region
+
+ // Positioning - find the pixel offset from the top/left and convert to a ratio
+ // The position is shifted by half a pixel, to adjust for the half-pixel coordorigin shift which is
+ // needed to fix antialiasing but makes the bg image fuzzy.
+ pxX = Math.round( bgPos.x ) + bwL + 0.5;
+ pxY = Math.round( bgPos.y ) + bwT + 0.5;
+ fill.position = ( pxX / elW ) + ',' + ( pxY / elH );
+
+ // Set the size of the image. We have to actually set it to px values otherwise it will not honor
+ // the user's browser zoom level and always display at its natural screen size.
+ fill['size']['x'] = 1; //Can be any value, just has to be set to "prime" it so the next line works. Weird!
+ fill['size'] = size.w + 'px,' + size.h + 'px';
+
+ // Repeating - clip the image shape
+ if( repeat && repeat !== 'repeat' ) {
+ if( repeat === 'repeat-x' || repeat === 'no-repeat' ) {
+ clipT = pxY + 1;
+ clipB = pxY + size.h + clipAdjust;
+ }
+ if( repeat === 'repeat-y' || repeat === 'no-repeat' ) {
+ clipL = pxX + 1;
+ clipR = pxX + size.w + clipAdjust;
+ }
+ shape.style.clip = 'rect(' + clipT + 'px,' + clipR + 'px,' + clipB + 'px,' + clipL + 'px)';
+ }
+ }
+ } );
+ },
+
+
+ /**
+ * Draw the linear gradient for a gradient layer
+ * @param {Element} shape
+ * @param {Object} info The object holding the information about the gradient
+ */
+ addLinearGradient: function( shape, info ) {
+ var el = this.targetElement,
+ bounds = this.boundsInfo.getBounds(),
+ w = bounds.w,
+ h = bounds.h,
+ fill = shape.fill,
+ stops = info.stops,
+ stopCount = stops.length,
+ PI = Math.PI,
+ GradientUtil = PIE.GradientUtil,
+ perpendicularIntersect = GradientUtil.perpendicularIntersect,
+ distance = GradientUtil.distance,
+ metrics = GradientUtil.getGradientMetrics( el, w, h, info ),
+ angle = metrics.angle,
+ startX = metrics.startX,
+ startY = metrics.startY,
+ startCornerX = metrics.startCornerX,
+ startCornerY = metrics.startCornerY,
+ endCornerX = metrics.endCornerX,
+ endCornerY = metrics.endCornerY,
+ deltaX = metrics.deltaX,
+ deltaY = metrics.deltaY,
+ lineLength = metrics.lineLength,
+ vmlAngle, vmlGradientLength, vmlColors,
+ stopPx, vmlOffsetPct,
+ p, i, j, before, after;
+
+ // In VML land, the angle of the rendered gradient depends on the aspect ratio of the shape's
+ // bounding box; for example specifying a 45 deg angle actually results in a gradient
+ // drawn diagonally from one corner to its opposite corner, which will only appear to the
+ // viewer as 45 degrees if the shape is equilateral. We adjust for this by taking the x/y deltas
+ // between the start and end points, multiply one of them by the shape's aspect ratio,
+ // and get their arctangent, resulting in an appropriate VML angle. If the angle is perfectly
+ // horizontal or vertical then we don't need to do this conversion.
+ vmlAngle = ( angle % 90 ) ? Math.atan2( deltaX * w / h, deltaY ) / PI * 180 : ( angle + 90 );
+
+ // VML angles are 180 degrees offset from CSS angles
+ vmlAngle += 180;
+ vmlAngle = vmlAngle % 360;
+
+ // Add all the stops to the VML 'colors' list, including the first and last stops.
+ // For each, we find its pixel offset along the gradient-line; if the offset of a stop is less
+ // than that of its predecessor we increase it to be equal. We then map that pixel offset to a
+ // percentage along the VML gradient-line, which runs from shape corner to corner.
+ p = perpendicularIntersect( startCornerX, startCornerY, angle, endCornerX, endCornerY );
+ vmlGradientLength = distance( startCornerX, startCornerY, p[0], p[1] );
+ vmlColors = [];
+ p = perpendicularIntersect( startX, startY, angle, startCornerX, startCornerY );
+ vmlOffsetPct = distance( startX, startY, p[0], p[1] ) / vmlGradientLength * 100;
+
+ // Find the pixel offsets along the CSS3 gradient-line for each stop.
+ stopPx = [];
+ for( i = 0; i < stopCount; i++ ) {
+ stopPx.push( stops[i].offset ? stops[i].offset.pixels( el, lineLength ) :
+ i === 0 ? 0 : i === stopCount - 1 ? lineLength : null );
+ }
+ // Fill in gaps with evenly-spaced offsets
+ for( i = 1; i < stopCount; i++ ) {
+ if( stopPx[ i ] === null ) {
+ before = stopPx[ i - 1 ];
+ j = i;
+ do {
+ after = stopPx[ ++j ];
+ } while( after === null );
+ stopPx[ i ] = before + ( after - before ) / ( j - i + 1 );
+ }
+ // Make sure each stop's offset is no less than the one before it
+ stopPx[ i ] = Math.max( stopPx[ i ], stopPx[ i - 1 ] );
+ }
+
+ // Convert to percentage along the VML gradient line and add to the VML 'colors' value
+ for( i = 0; i < stopCount; i++ ) {
+ vmlColors.push(
+ ( vmlOffsetPct + ( stopPx[ i ] / vmlGradientLength * 100 ) ) + '% ' + stops[i].color.colorValue( el )
+ );
+ }
+
+ // Now, finally, we're ready to render the gradient fill. Set the start and end colors to
+ // the first and last stop colors; this just sets outer bounds for the gradient.
+ fill['angle'] = vmlAngle;
+ fill['type'] = 'gradient';
+ fill['method'] = 'sigma';
+ fill['color'] = stops[0].color.colorValue( el );
+ fill['color2'] = stops[stopCount - 1].color.colorValue( el );
+ if( fill['colors'] ) { //sometimes the colors object isn't initialized so we have to assign it directly (?)
+ fill['colors'].value = vmlColors.join( ',' );
+ } else {
+ fill['colors'] = vmlColors.join( ',' );
+ }
+ },
+
+
+ /**
+ * Hide the actual background image and color of the element.
+ */
+ hideBackground: function() {
+ var rs = this.targetElement.runtimeStyle;
+ rs.backgroundImage = 'url(about:blank)'; //ensures the background area reacts to mouse events
+ rs.backgroundColor = 'transparent';
+ },
+
+ destroy: function() {
+ PIE.RendererBase.destroy.call( this );
+ var rs = this.targetElement.runtimeStyle;
+ rs.backgroundImage = rs.backgroundColor = '';
+ }
+
+} );
+/**
+ * Renderer for element borders.
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ * @param {PIE.RootRenderer} parent
+ */
+PIE.BorderRenderer = PIE.RendererBase.newRenderer( {
+
+ boxZIndex: 4,
+ boxName: 'border',
+
+ needsUpdate: function() {
+ var si = this.styleInfos;
+ return si.borderInfo.changed() || si.borderRadiusInfo.changed();
+ },
+
+ isActive: function() {
+ var si = this.styleInfos;
+ return si.borderRadiusInfo.isActive() &&
+ !si.borderImageInfo.isActive() &&
+ si.borderInfo.isActive(); //check BorderStyleInfo last because it's the most expensive
+ },
+
+ /**
+ * Draw the border shape(s)
+ */
+ draw: function() {
+ var el = this.targetElement,
+ props = this.styleInfos.borderInfo.getProps(),
+ bounds = this.boundsInfo.getBounds(),
+ w = bounds.w,
+ h = bounds.h,
+ shape, stroke, s,
+ segments, seg, i, len;
+
+ if( props ) {
+ this.hideBorder();
+
+ segments = this.getBorderSegments( 2 );
+ for( i = 0, len = segments.length; i < len; i++) {
+ seg = segments[i];
+ shape = this.getShape( 'borderPiece' + i, seg.stroke ? 'stroke' : 'fill', this.getBox() );
+ shape.coordsize = w * 2 + ',' + h * 2;
+ shape.coordorigin = '1,1';
+ shape.path = seg.path;
+ s = shape.style;
+ s.width = w;
+ s.height = h;
+
+ shape.filled = !!seg.fill;
+ shape.stroked = !!seg.stroke;
+ if( seg.stroke ) {
+ stroke = shape.stroke;
+ stroke['weight'] = seg.weight + 'px';
+ stroke.color = seg.color.colorValue( el );
+ stroke['dashstyle'] = seg.stroke === 'dashed' ? '2 2' : seg.stroke === 'dotted' ? '1 1' : 'solid';
+ stroke['linestyle'] = seg.stroke === 'double' && seg.weight > 2 ? 'ThinThin' : 'Single';
+ } else {
+ shape.fill.color = seg.fill.colorValue( el );
+ }
+ }
+
+ // remove any previously-created border shapes which didn't get used above
+ while( this.deleteShape( 'borderPiece' + i++ ) ) {}
+ }
+ },
+
+
+ /**
+ * Get the VML path definitions for the border segment(s).
+ * @param {number=} mult If specified, all coordinates will be multiplied by this number
+ * @return {Array.<string>}
+ */
+ getBorderSegments: function( mult ) {
+ var el = this.targetElement,
+ bounds, elW, elH,
+ borderInfo = this.styleInfos.borderInfo,
+ segments = [],
+ floor, ceil, wT, wR, wB, wL,
+ round = Math.round,
+ borderProps, radiusInfo, radii, widths, styles, colors;
+
+ if( borderInfo.isActive() ) {
+ borderProps = borderInfo.getProps();
+
+ widths = borderProps.widths;
+ styles = borderProps.styles;
+ colors = borderProps.colors;
+
+ if( borderProps.widthsSame && borderProps.stylesSame && borderProps.colorsSame ) {
+ if( colors['t'].alpha() > 0 ) {
+ // shortcut for identical border on all sides - only need 1 stroked shape
+ wT = widths['t'].pixels( el ); //thickness
+ wR = wT / 2; //shrink
+ segments.push( {
+ path: this.getBoxPath( { t: wR, r: wR, b: wR, l: wR }, mult ),
+ stroke: styles['t'],
+ color: colors['t'],
+ weight: wT
+ } );
+ }
+ }
+ else {
+ mult = mult || 1;
+ bounds = this.boundsInfo.getBounds();
+ elW = bounds.w;
+ elH = bounds.h;
+
+ wT = round( widths['t'].pixels( el ) );
+ wR = round( widths['r'].pixels( el ) );
+ wB = round( widths['b'].pixels( el ) );
+ wL = round( widths['l'].pixels( el ) );
+ var pxWidths = {
+ 't': wT,
+ 'r': wR,
+ 'b': wB,
+ 'l': wL
+ };
+
+ radiusInfo = this.styleInfos.borderRadiusInfo;
+ if( radiusInfo.isActive() ) {
+ radii = this.getRadiiPixels( radiusInfo.getProps() );
+ }
+
+ floor = Math.floor;
+ ceil = Math.ceil;
+
+ function radius( xy, corner ) {
+ return radii ? radii[ xy ][ corner ] : 0;
+ }
+
+ function curve( corner, shrinkX, shrinkY, startAngle, ccw, doMove ) {
+ var rx = radius( 'x', corner),
+ ry = radius( 'y', corner),
+ deg = 65535,
+ isRight = corner.charAt( 1 ) === 'r',
+ isBottom = corner.charAt( 0 ) === 'b';
+ return ( rx > 0 && ry > 0 ) ?
+ ( doMove ? 'al' : 'ae' ) +
+ ( isRight ? ceil( elW - rx ) : floor( rx ) ) * mult + ',' + // center x
+ ( isBottom ? ceil( elH - ry ) : floor( ry ) ) * mult + ',' + // center y
+ ( floor( rx ) - shrinkX ) * mult + ',' + // width
+ ( floor( ry ) - shrinkY ) * mult + ',' + // height
+ ( startAngle * deg ) + ',' + // start angle
+ ( 45 * deg * ( ccw ? 1 : -1 ) // angle change
+ ) : (
+ ( doMove ? 'm' : 'l' ) +
+ ( isRight ? elW - shrinkX : shrinkX ) * mult + ',' +
+ ( isBottom ? elH - shrinkY : shrinkY ) * mult
+ );
+ }
+
+ function line( side, shrink, ccw, doMove ) {
+ var
+ start = (
+ side === 't' ?
+ floor( radius( 'x', 'tl') ) * mult + ',' + ceil( shrink ) * mult :
+ side === 'r' ?
+ ceil( elW - shrink ) * mult + ',' + floor( radius( 'y', 'tr') ) * mult :
+ side === 'b' ?
+ ceil( elW - radius( 'x', 'br') ) * mult + ',' + floor( elH - shrink ) * mult :
+ // side === 'l' ?
+ floor( shrink ) * mult + ',' + ceil( elH - radius( 'y', 'bl') ) * mult
+ ),
+ end = (
+ side === 't' ?
+ ceil( elW - radius( 'x', 'tr') ) * mult + ',' + ceil( shrink ) * mult :
+ side === 'r' ?
+ ceil( elW - shrink ) * mult + ',' + ceil( elH - radius( 'y', 'br') ) * mult :
+ side === 'b' ?
+ floor( radius( 'x', 'bl') ) * mult + ',' + floor( elH - shrink ) * mult :
+ // side === 'l' ?
+ floor( shrink ) * mult + ',' + floor( radius( 'y', 'tl') ) * mult
+ );
+ return ccw ? ( doMove ? 'm' + end : '' ) + 'l' + start :
+ ( doMove ? 'm' + start : '' ) + 'l' + end;
+ }
+
+
+ function addSide( side, sideBefore, sideAfter, cornerBefore, cornerAfter, baseAngle ) {
+ var vert = side === 'l' || side === 'r',
+ sideW = pxWidths[ side ],
+ beforeX, beforeY, afterX, afterY;
+
+ if( sideW > 0 && styles[ side ] !== 'none' && colors[ side ].alpha() > 0 ) {
+ beforeX = pxWidths[ vert ? side : sideBefore ];
+ beforeY = pxWidths[ vert ? sideBefore : side ];
+ afterX = pxWidths[ vert ? side : sideAfter ];
+ afterY = pxWidths[ vert ? sideAfter : side ];
+
+ if( styles[ side ] === 'dashed' || styles[ side ] === 'dotted' ) {
+ segments.push( {
+ path: curve( cornerBefore, beforeX, beforeY, baseAngle + 45, 0, 1 ) +
+ curve( cornerBefore, 0, 0, baseAngle, 1, 0 ),
+ fill: colors[ side ]
+ } );
+ segments.push( {
+ path: line( side, sideW / 2, 0, 1 ),
+ stroke: styles[ side ],
+ weight: sideW,
+ color: colors[ side ]
+ } );
+ segments.push( {
+ path: curve( cornerAfter, afterX, afterY, baseAngle, 0, 1 ) +
+ curve( cornerAfter, 0, 0, baseAngle - 45, 1, 0 ),
+ fill: colors[ side ]
+ } );
+ }
+ else {
+ segments.push( {
+ path: curve( cornerBefore, beforeX, beforeY, baseAngle + 45, 0, 1 ) +
+ line( side, sideW, 0, 0 ) +
+ curve( cornerAfter, afterX, afterY, baseAngle, 0, 0 ) +
+
+ ( styles[ side ] === 'double' && sideW > 2 ?
+ curve( cornerAfter, afterX - floor( afterX / 3 ), afterY - floor( afterY / 3 ), baseAngle - 45, 1, 0 ) +
+ line( side, ceil( sideW / 3 * 2 ), 1, 0 ) +
+ curve( cornerBefore, beforeX - floor( beforeX / 3 ), beforeY - floor( beforeY / 3 ), baseAngle, 1, 0 ) +
+ 'x ' +
+ curve( cornerBefore, floor( beforeX / 3 ), floor( beforeY / 3 ), baseAngle + 45, 0, 1 ) +
+ line( side, floor( sideW / 3 ), 1, 0 ) +
+ curve( cornerAfter, floor( afterX / 3 ), floor( afterY / 3 ), baseAngle, 0, 0 )
+ : '' ) +
+
+ curve( cornerAfter, 0, 0, baseAngle - 45, 1, 0 ) +
+ line( side, 0, 1, 0 ) +
+ curve( cornerBefore, 0, 0, baseAngle, 1, 0 ),
+ fill: colors[ side ]
+ } );
+ }
+ }
+ }
+
+ addSide( 't', 'l', 'r', 'tl', 'tr', 90 );
+ addSide( 'r', 't', 'b', 'tr', 'br', 0 );
+ addSide( 'b', 'r', 'l', 'br', 'bl', -90 );
+ addSide( 'l', 'b', 't', 'bl', 'tl', -180 );
+ }
+ }
+
+ return segments;
+ },
+
+ destroy: function() {
+ var me = this;
+ if (me.finalized || !me.styleInfos.borderImageInfo.isActive()) {
+ me.targetElement.runtimeStyle.borderColor = '';
+ }
+ PIE.RendererBase.destroy.call( me );
+ }
+
+
+} );
+/**
+ * Renderer for border-image
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ * @param {PIE.RootRenderer} parent
+ */
+PIE.BorderImageRenderer = PIE.RendererBase.newRenderer( {
+
+ boxZIndex: 5,
+ pieceNames: [ 't', 'tr', 'r', 'br', 'b', 'bl', 'l', 'tl', 'c' ],
+
+ needsUpdate: function() {
+ return this.styleInfos.borderImageInfo.changed();
+ },
+
+ isActive: function() {
+ return this.styleInfos.borderImageInfo.isActive();
+ },
+
+ draw: function() {
+ this.getBox(); //make sure pieces are created
+
+ var props = this.styleInfos.borderImageInfo.getProps(),
+ borderProps = this.styleInfos.borderInfo.getProps(),
+ bounds = this.boundsInfo.getBounds(),
+ el = this.targetElement,
+ pieces = this.pieces;
+
+ PIE.Util.withImageSize( props.src, function( imgSize ) {
+ var elW = bounds.w,
+ elH = bounds.h,
+ zero = PIE.getLength( '0' ),
+ widths = props.widths || ( borderProps ? borderProps.widths : { 't': zero, 'r': zero, 'b': zero, 'l': zero } ),
+ widthT = widths['t'].pixels( el ),
+ widthR = widths['r'].pixels( el ),
+ widthB = widths['b'].pixels( el ),
+ widthL = widths['l'].pixels( el ),
+ slices = props.slice,
+ sliceT = slices['t'].pixels( el ),
+ sliceR = slices['r'].pixels( el ),
+ sliceB = slices['b'].pixels( el ),
+ sliceL = slices['l'].pixels( el );
+
+ // Piece positions and sizes
+ function setSizeAndPos( piece, w, h, x, y ) {
+ var s = pieces[piece].style,
+ max = Math.max;
+ s.width = max(w, 0);
+ s.height = max(h, 0);
+ s.left = x;
+ s.top = y;
+ }
+ setSizeAndPos( 'tl', widthL, widthT, 0, 0 );
+ setSizeAndPos( 't', elW - widthL - widthR, widthT, widthL, 0 );
+ setSizeAndPos( 'tr', widthR, widthT, elW - widthR, 0 );
+ setSizeAndPos( 'r', widthR, elH - widthT - widthB, elW - widthR, widthT );
+ setSizeAndPos( 'br', widthR, widthB, elW - widthR, elH - widthB );
+ setSizeAndPos( 'b', elW - widthL - widthR, widthB, widthL, elH - widthB );
+ setSizeAndPos( 'bl', widthL, widthB, 0, elH - widthB );
+ setSizeAndPos( 'l', widthL, elH - widthT - widthB, 0, widthT );
+ setSizeAndPos( 'c', elW - widthL - widthR, elH - widthT - widthB, widthL, widthT );
+
+
+ // image croppings
+ function setCrops( sides, crop, val ) {
+ for( var i=0, len=sides.length; i < len; i++ ) {
+ pieces[ sides[i] ]['imagedata'][ crop ] = val;
+ }
+ }
+
+ // corners
+ setCrops( [ 'tl', 't', 'tr' ], 'cropBottom', ( imgSize.h - sliceT ) / imgSize.h );
+ setCrops( [ 'tl', 'l', 'bl' ], 'cropRight', ( imgSize.w - sliceL ) / imgSize.w );
+ setCrops( [ 'bl', 'b', 'br' ], 'cropTop', ( imgSize.h - sliceB ) / imgSize.h );
+ setCrops( [ 'tr', 'r', 'br' ], 'cropLeft', ( imgSize.w - sliceR ) / imgSize.w );
+
+ // edges and center
+ // TODO right now this treats everything like 'stretch', need to support other schemes
+ //if( props.repeat.v === 'stretch' ) {
+ setCrops( [ 'l', 'r', 'c' ], 'cropTop', sliceT / imgSize.h );
+ setCrops( [ 'l', 'r', 'c' ], 'cropBottom', sliceB / imgSize.h );
+ //}
+ //if( props.repeat.h === 'stretch' ) {
+ setCrops( [ 't', 'b', 'c' ], 'cropLeft', sliceL / imgSize.w );
+ setCrops( [ 't', 'b', 'c' ], 'cropRight', sliceR / imgSize.w );
+ //}
+
+ // center fill
+ pieces['c'].style.display = props.fill ? '' : 'none';
+ }, this );
+ },
+
+ getBox: function() {
+ var box = this.parent.getLayer( this.boxZIndex ),
+ s, piece, i,
+ pieceNames = this.pieceNames,
+ len = pieceNames.length;
+
+ if( !box ) {
+ box = doc.createElement( 'border-image' );
+ s = box.style;
+ s.position = 'absolute';
+
+ this.pieces = {};
+
+ for( i = 0; i < len; i++ ) {
+ piece = this.pieces[ pieceNames[i] ] = PIE.Util.createVmlElement( 'rect' );
+ piece.appendChild( PIE.Util.createVmlElement( 'imagedata' ) );
+ s = piece.style;
+ s['behavior'] = 'url(#default#VML)';
+ s.position = "absolute";
+ s.top = s.left = 0;
+ piece['imagedata'].src = this.styleInfos.borderImageInfo.getProps().src;
+ piece.stroked = false;
+ piece.filled = false;
+ box.appendChild( piece );
+ }
+
+ this.parent.addLayer( this.boxZIndex, box );
+ }
+
+ return box;
+ },
+
+ prepareUpdate: function() {
+ if (this.isActive()) {
+ var me = this,
+ el = me.targetElement,
+ rs = el.runtimeStyle,
+ widths = me.styleInfos.borderImageInfo.getProps().widths;
+
+ // Force border-style to solid so it doesn't collapse
+ rs.borderStyle = 'solid';
+
+ // If widths specified in border-image shorthand, override border-width
+ // NOTE px units needed here as this gets used by the IE9 renderer too
+ if ( widths ) {
+ rs.borderTopWidth = widths['t'].pixels( el ) + 'px';
+ rs.borderRightWidth = widths['r'].pixels( el ) + 'px';
+ rs.borderBottomWidth = widths['b'].pixels( el ) + 'px';
+ rs.borderLeftWidth = widths['l'].pixels( el ) + 'px';
+ }
+
+ // Make the border transparent
+ me.hideBorder();
+ }
+ },
+
+ destroy: function() {
+ var me = this,
+ rs = me.targetElement.runtimeStyle;
+ rs.borderStyle = '';
+ if (me.finalized || !me.styleInfos.borderInfo.isActive()) {
+ rs.borderColor = rs.borderWidth = '';
+ }
+ PIE.RendererBase.destroy.call( this );
+ }
+
+} );
+/**
+ * Renderer for outset box-shadows
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ * @param {PIE.RootRenderer} parent
+ */
+PIE.BoxShadowOutsetRenderer = PIE.RendererBase.newRenderer( {
+
+ boxZIndex: 1,
+ boxName: 'outset-box-shadow',
+
+ needsUpdate: function() {
+ var si = this.styleInfos;
+ return si.boxShadowInfo.changed() || si.borderRadiusInfo.changed();
+ },
+
+ isActive: function() {
+ var boxShadowInfo = this.styleInfos.boxShadowInfo;
+ return boxShadowInfo.isActive() && boxShadowInfo.getProps().outset[0];
+ },
+
+ draw: function() {
+ var me = this,
+ el = this.targetElement,
+ box = this.getBox(),
+ styleInfos = this.styleInfos,
+ shadowInfos = styleInfos.boxShadowInfo.getProps().outset,
+ radii = styleInfos.borderRadiusInfo.getProps(),
+ len = shadowInfos.length,
+ i = len, j,
+ bounds = this.boundsInfo.getBounds(),
+ w = bounds.w,
+ h = bounds.h,
+ clipAdjust = PIE.ieVersion === 8 ? 1 : 0, //workaround for IE8 bug where VML leaks out top/left of clip region by 1px
+ corners = [ 'tl', 'tr', 'br', 'bl' ], corner,
+ shadowInfo, shape, fill, ss, xOff, yOff, spread, blur, shrink, color, alpha, path,
+ totalW, totalH, focusX, focusY, isBottom, isRight;
+
+
+ function getShadowShape( index, corner, xOff, yOff, color, blur, path ) {
+ var shape = me.getShape( 'shadow' + index + corner, 'fill', box, len - index ),
+ fill = shape.fill;
+
+ // Position and size
+ shape['coordsize'] = w * 2 + ',' + h * 2;
+ shape['coordorigin'] = '1,1';
+
+ // Color and opacity
+ shape['stroked'] = false;
+ shape['filled'] = true;
+ fill.color = color.colorValue( el );
+ if( blur ) {
+ fill['type'] = 'gradienttitle'; //makes the VML gradient follow the shape's outline - hooray for undocumented features?!?!
+ fill['color2'] = fill.color;
+ fill['opacity'] = 0;
+ }
+
+ // Path
+ shape.path = path;
+
+ // This needs to go last for some reason, to prevent rendering at incorrect size
+ ss = shape.style;
+ ss.left = xOff;
+ ss.top = yOff;
+ ss.width = w;
+ ss.height = h;
+
+ return shape;
+ }
+
+
+ while( i-- ) {
+ shadowInfo = shadowInfos[ i ];
+ xOff = shadowInfo.xOffset.pixels( el );
+ yOff = shadowInfo.yOffset.pixels( el );
+ spread = shadowInfo.spread.pixels( el );
+ blur = shadowInfo.blur.pixels( el );
+ color = shadowInfo.color;
+ // Shape path
+ shrink = -spread - blur;
+ if( !radii && blur ) {
+ // If blurring, use a non-null border radius info object so that getBoxPath will
+ // round the corners of the expanded shadow shape rather than squaring them off.
+ radii = PIE.BorderRadiusStyleInfo.ALL_ZERO;
+ }
+ path = this.getBoxPath( { t: shrink, r: shrink, b: shrink, l: shrink }, 2, radii );
+
+ if( blur ) {
+ totalW = ( spread + blur ) * 2 + w;
+ totalH = ( spread + blur ) * 2 + h;
+ focusX = totalW ? blur * 2 / totalW : 0;
+ focusY = totalH ? blur * 2 / totalH : 0;
+ if( blur - spread > w / 2 || blur - spread > h / 2 ) {
+ // If the blur is larger than half the element's narrowest dimension, we cannot do
+ // this with a single shape gradient, because its focussize would have to be less than
+ // zero which results in ugly artifacts. Instead we create four shapes, each with its
+ // gradient focus past center, and then clip them so each only shows the quadrant
+ // opposite the focus.
+ for( j = 4; j--; ) {
+ corner = corners[j];
+ isBottom = corner.charAt( 0 ) === 'b';
+ isRight = corner.charAt( 1 ) === 'r';
+ shape = getShadowShape( i, corner, xOff, yOff, color, blur, path );
+ fill = shape.fill;
+ fill['focusposition'] = ( isRight ? 1 - focusX : focusX ) + ',' +
+ ( isBottom ? 1 - focusY : focusY );
+ fill['focussize'] = '0,0';
+
+ // Clip to show only the appropriate quadrant. Add 1px to the top/left clip values
+ // in IE8 to prevent a bug where IE8 displays one pixel outside the clip region.
+ shape.style.clip = 'rect(' + ( ( isBottom ? totalH / 2 : 0 ) + clipAdjust ) + 'px,' +
+ ( isRight ? totalW : totalW / 2 ) + 'px,' +
+ ( isBottom ? totalH : totalH / 2 ) + 'px,' +
+ ( ( isRight ? totalW / 2 : 0 ) + clipAdjust ) + 'px)';
+ }
+ } else {
+ // TODO delete old quadrant shapes if resizing expands past the barrier
+ shape = getShadowShape( i, '', xOff, yOff, color, blur, path );
+ fill = shape.fill;
+ fill['focusposition'] = focusX + ',' + focusY;
+ fill['focussize'] = ( 1 - focusX * 2 ) + ',' + ( 1 - focusY * 2 );
+ }
+ } else {
+ shape = getShadowShape( i, '', xOff, yOff, color, blur, path );
+ alpha = color.alpha();
+ if( alpha < 1 ) {
+ // shape.style.filter = 'alpha(opacity=' + ( alpha * 100 ) + ')';
+ // ss.filter = 'progid:DXImageTransform.Microsoft.BasicImage(opacity=' + ( alpha ) + ')';
+ shape.fill.opacity = alpha;
+ }
+ }
+ }
+ }
+
+} );
+/**
+ * Renderer for re-rendering img elements using VML. Kicks in if the img has
+ * a border-radius applied, or if the -pie-png-fix flag is set.
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ * @param {PIE.RootRenderer} parent
+ */
+PIE.ImgRenderer = PIE.RendererBase.newRenderer( {
+
+ boxZIndex: 6,
+ boxName: 'imgEl',
+
+ needsUpdate: function() {
+ var si = this.styleInfos;
+ return this.targetElement.src !== this._lastSrc || si.borderRadiusInfo.changed();
+ },
+
+ isActive: function() {
+ var si = this.styleInfos;
+ return si.borderRadiusInfo.isActive() || si.backgroundInfo.isPngFix();
+ },
+
+ draw: function() {
+ this._lastSrc = src;
+ this.hideActualImg();
+
+ var shape = this.getShape( 'img', 'fill', this.getBox() ),
+ fill = shape.fill,
+ bounds = this.boundsInfo.getBounds(),
+ w = bounds.w,
+ h = bounds.h,
+ borderProps = this.styleInfos.borderInfo.getProps(),
+ borderWidths = borderProps && borderProps.widths,
+ el = this.targetElement,
+ src = el.src,
+ round = Math.round,
+ cs = el.currentStyle,
+ getLength = PIE.getLength,
+ s, zero;
+
+ // In IE6, the BorderRenderer will have hidden the border by moving the border-width to
+ // the padding; therefore we want to pretend the borders have no width so they aren't doubled
+ // when adding in the current padding value below.
+ if( !borderWidths || PIE.ieVersion < 7 ) {
+ zero = PIE.getLength( '0' );
+ borderWidths = { 't': zero, 'r': zero, 'b': zero, 'l': zero };
+ }
+
+ shape.stroked = false;
+ fill.type = 'frame';
+ fill.src = src;
+ fill.position = (w ? 0.5 / w : 0) + ',' + (h ? 0.5 / h : 0);
+ shape.coordsize = w * 2 + ',' + h * 2;
+ shape.coordorigin = '1,1';
+ shape.path = this.getBoxPath( {
+ t: round( borderWidths['t'].pixels( el ) + getLength( cs.paddingTop ).pixels( el ) ),
+ r: round( borderWidths['r'].pixels( el ) + getLength( cs.paddingRight ).pixels( el ) ),
+ b: round( borderWidths['b'].pixels( el ) + getLength( cs.paddingBottom ).pixels( el ) ),
+ l: round( borderWidths['l'].pixels( el ) + getLength( cs.paddingLeft ).pixels( el ) )
+ }, 2 );
+ s = shape.style;
+ s.width = w;
+ s.height = h;
+ },
+
+ hideActualImg: function() {
+ this.targetElement.runtimeStyle.filter = 'alpha(opacity=0)';
+ },
+
+ destroy: function() {
+ PIE.RendererBase.destroy.call( this );
+ this.targetElement.runtimeStyle.filter = '';
+ }
+
+} );
+/**
+ * Root renderer for IE9; manages the rendering layers in the element's background
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ */
+PIE.IE9RootRenderer = PIE.RendererBase.newRenderer( {
+
+ updatePos: PIE.emptyFn,
+ updateSize: PIE.emptyFn,
+ updateVisibility: PIE.emptyFn,
+ updateProps: PIE.emptyFn,
+
+ outerCommasRE: /^,+|,+$/g,
+ innerCommasRE: /,+/g,
+
+ setBackgroundLayer: function(zIndex, bg) {
+ var me = this,
+ bgLayers = me._bgLayers || ( me._bgLayers = [] ),
+ undef;
+ bgLayers[zIndex] = bg || undef;
+ },
+
+ finishUpdate: function() {
+ var me = this,
+ bgLayers = me._bgLayers,
+ bg;
+ if( bgLayers && ( bg = bgLayers.join( ',' ).replace( me.outerCommasRE, '' ).replace( me.innerCommasRE, ',' ) ) !== me._lastBg ) {
+ me._lastBg = me.targetElement.runtimeStyle.background = bg;
+ }
+ },
+
+ destroy: function() {
+ this.targetElement.runtimeStyle.background = '';
+ delete this._bgLayers;
+ }
+
+} );
+/**
+ * Renderer for element backgrounds, specific for IE9. Only handles translating CSS3 gradients
+ * to an equivalent SVG data URI.
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ */
+PIE.IE9BackgroundRenderer = PIE.RendererBase.newRenderer( {
+
+ bgLayerZIndex: 1,
+
+ needsUpdate: function() {
+ var si = this.styleInfos;
+ return si.backgroundInfo.changed();
+ },
+
+ isActive: function() {
+ var si = this.styleInfos;
+ return si.backgroundInfo.isActive() || si.borderImageInfo.isActive();
+ },
+
+ draw: function() {
+ var me = this,
+ props = me.styleInfos.backgroundInfo.getProps(),
+ bg, images, i = 0, img, bgAreaSize, bgSize;
+
+ if ( props ) {
+ bg = [];
+
+ images = props.bgImages;
+ if ( images ) {
+ while( img = images[ i++ ] ) {
+ if (img.imgType === 'linear-gradient' ) {
+ bgAreaSize = me.getBgAreaSize( img.bgOrigin );
+ bgSize = ( img.bgSize || PIE.BgSize.DEFAULT ).pixels(
+ me.targetElement, bgAreaSize.w, bgAreaSize.h, bgAreaSize.w, bgAreaSize.h
+ ),
+ bg.push(
+ 'url(data:image/svg+xml,' + escape( me.getGradientSvg( img, bgSize.w, bgSize.h ) ) + ') ' +
+ me.bgPositionToString( img.bgPosition ) + ' / ' + bgSize.w + 'px ' + bgSize.h + 'px ' +
+ ( img.bgAttachment || '' ) + ' ' + ( img.bgOrigin || '' ) + ' ' + ( img.bgClip || '' )
+ );
+ } else {
+ bg.push( img.origString );
+ }
+ }
+ }
+
+ if ( props.color ) {
+ bg.push( props.color.val );
+ }
+
+ me.parent.setBackgroundLayer(me.bgLayerZIndex, bg.join(','));
+ }
+ },
+
+ bgPositionToString: function( bgPosition ) {
+ return bgPosition ? bgPosition.tokens.map(function(token) {
+ return token.tokenValue;
+ }).join(' ') : '0 0';
+ },
+
+ getBgAreaSize: function( bgOrigin ) {
+ var me = this,
+ el = me.targetElement,
+ bounds = me.boundsInfo.getBounds(),
+ elW = bounds.w,
+ elH = bounds.h,
+ w = elW,
+ h = elH,
+ borders, getLength, cs;
+
+ if( bgOrigin !== 'border-box' ) {
+ borders = me.styleInfos.borderInfo.getProps();
+ if( borders && ( borders = borders.widths ) ) {
+ w -= borders[ 'l' ].pixels( el ) + borders[ 'l' ].pixels( el );
+ h -= borders[ 't' ].pixels( el ) + borders[ 'b' ].pixels( el );
+ }
+ }
+
+ if ( bgOrigin === 'content-box' ) {
+ getLength = PIE.getLength;
+ cs = el.currentStyle;
+ w -= getLength( cs.paddingLeft ).pixels( el ) + getLength( cs.paddingRight ).pixels( el );
+ h -= getLength( cs.paddingTop ).pixels( el ) + getLength( cs.paddingBottom ).pixels( el );
+ }
+
+ return { w: w, h: h };
+ },
+
+ getGradientSvg: function( info, bgWidth, bgHeight ) {
+ var el = this.targetElement,
+ stopsInfo = info.stops,
+ stopCount = stopsInfo.length,
+ metrics = PIE.GradientUtil.getGradientMetrics( el, bgWidth, bgHeight, info ),
+ startX = metrics.startX,
+ startY = metrics.startY,
+ endX = metrics.endX,
+ endY = metrics.endY,
+ lineLength = metrics.lineLength,
+ stopPx,
+ i, j, before, after,
+ svg;
+
+ // Find the pixel offsets along the CSS3 gradient-line for each stop.
+ stopPx = [];
+ for( i = 0; i < stopCount; i++ ) {
+ stopPx.push( stopsInfo[i].offset ? stopsInfo[i].offset.pixels( el, lineLength ) :
+ i === 0 ? 0 : i === stopCount - 1 ? lineLength : null );
+ }
+ // Fill in gaps with evenly-spaced offsets
+ for( i = 1; i < stopCount; i++ ) {
+ if( stopPx[ i ] === null ) {
+ before = stopPx[ i - 1 ];
+ j = i;
+ do {
+ after = stopPx[ ++j ];
+ } while( after === null );
+ stopPx[ i ] = before + ( after - before ) / ( j - i + 1 );
+ }
+ }
+
+ svg = [
+ '<svg width="' + bgWidth + '" height="' + bgHeight + '" xmlns="http://www.w3.org/2000/svg">' +
+ '<defs>' +
+ '<linearGradient id="g" gradientUnits="userSpaceOnUse"' +
+ ' x1="' + ( startX / bgWidth * 100 ) + '%" y1="' + ( startY / bgHeight * 100 ) + '%" x2="' + ( endX / bgWidth * 100 ) + '%" y2="' + ( endY / bgHeight * 100 ) + '%">'
+ ];
+
+ // Convert to percentage along the SVG gradient line and add to the stops list
+ for( i = 0; i < stopCount; i++ ) {
+ svg.push(
+ '<stop offset="' + ( stopPx[ i ] / lineLength ) +
+ '" stop-color="' + stopsInfo[i].color.colorValue( el ) +
+ '" stop-opacity="' + stopsInfo[i].color.alpha() + '"/>'
+ );
+ }
+
+ svg.push(
+ '</linearGradient>' +
+ '</defs>' +
+ '<rect width="100%" height="100%" fill="url(#g)"/>' +
+ '</svg>'
+ );
+
+ return svg.join( '' );
+ },
+
+ destroy: function() {
+ this.parent.setBackgroundLayer( this.bgLayerZIndex );
+ }
+
+} );
+/**
+ * Renderer for border-image
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ * @param {PIE.RootRenderer} parent
+ */
+PIE.IE9BorderImageRenderer = PIE.RendererBase.newRenderer( {
+
+ REPEAT: 'repeat',
+ STRETCH: 'stretch',
+ ROUND: 'round',
+
+ bgLayerZIndex: 0,
+
+ needsUpdate: function() {
+ return this.styleInfos.borderImageInfo.changed();
+ },
+
+ isActive: function() {
+ return this.styleInfos.borderImageInfo.isActive();
+ },
+
+ draw: function() {
+ var me = this,
+ props = me.styleInfos.borderImageInfo.getProps(),
+ borderProps = me.styleInfos.borderInfo.getProps(),
+ bounds = me.boundsInfo.getBounds(),
+ repeat = props.repeat,
+ repeatH = repeat.h,
+ repeatV = repeat.v,
+ el = me.targetElement,
+ isAsync = 0;
+
+ PIE.Util.withImageSize( props.src, function( imgSize ) {
+ var elW = bounds.w,
+ elH = bounds.h,
+ imgW = imgSize.w,
+ imgH = imgSize.h,
+
+ // The image cannot be referenced as a URL directly in the SVG because IE9 throws a strange
+ // security exception (perhaps due to cross-origin policy within data URIs?) Therefore we
+ // work around this by converting the image data into a data URI itself using a transient
+ // canvas. This unfortunately requires the border-image src to be within the same domain,
+ // which isn't a limitation in true border-image, so we need to try and find a better fix.
+ imgSrc = me.imageToDataURI( props.src, imgW, imgH ),
+
+ REPEAT = me.REPEAT,
+ STRETCH = me.STRETCH,
+ ROUND = me.ROUND,
+ ceil = Math.ceil,
+
+ zero = PIE.getLength( '0' ),
+ widths = props.widths || ( borderProps ? borderProps.widths : { 't': zero, 'r': zero, 'b': zero, 'l': zero } ),
+ widthT = widths['t'].pixels( el ),
+ widthR = widths['r'].pixels( el ),
+ widthB = widths['b'].pixels( el ),
+ widthL = widths['l'].pixels( el ),
+ slices = props.slice,
+ sliceT = slices['t'].pixels( el ),
+ sliceR = slices['r'].pixels( el ),
+ sliceB = slices['b'].pixels( el ),
+ sliceL = slices['l'].pixels( el ),
+ centerW = elW - widthL - widthR,
+ middleH = elH - widthT - widthB,
+ imgCenterW = imgW - sliceL - sliceR,
+ imgMiddleH = imgH - sliceT - sliceB,
+
+ // Determine the size of each tile - 'round' is handled below
+ tileSizeT = repeatH === STRETCH ? centerW : imgCenterW * widthT / sliceT,
+ tileSizeR = repeatV === STRETCH ? middleH : imgMiddleH * widthR / sliceR,
+ tileSizeB = repeatH === STRETCH ? centerW : imgCenterW * widthB / sliceB,
+ tileSizeL = repeatV === STRETCH ? middleH : imgMiddleH * widthL / sliceL,
+
+ svg,
+ patterns = [],
+ rects = [],
+ i = 0;
+
+ // For 'round', subtract from each tile's size enough so that they fill the space a whole number of times
+ if (repeatH === ROUND) {
+ tileSizeT -= (tileSizeT - (centerW % tileSizeT || tileSizeT)) / ceil(centerW / tileSizeT);
+ tileSizeB -= (tileSizeB - (centerW % tileSizeB || tileSizeB)) / ceil(centerW / tileSizeB);
+ }
+ if (repeatV === ROUND) {
+ tileSizeR -= (tileSizeR - (middleH % tileSizeR || tileSizeR)) / ceil(middleH / tileSizeR);
+ tileSizeL -= (tileSizeL - (middleH % tileSizeL || tileSizeL)) / ceil(middleH / tileSizeL);
+ }
+
+
+ // Build the SVG for the border-image rendering. Add each piece as a pattern, which is then stretched
+ // or repeated as the fill of a rect of appropriate size.
+ svg = [
+ '<svg width="' + elW + '" height="' + elH + '" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink">'
+ ];
+
+ function addImage( x, y, w, h, cropX, cropY, cropW, cropH, tileW, tileH ) {
+ patterns.push(
+ '<pattern patternUnits="userSpaceOnUse" id="pattern' + i + '" ' +
+ 'x="' + (repeatH === REPEAT ? x + w / 2 - tileW / 2 : x) + '" ' +
+ 'y="' + (repeatV === REPEAT ? y + h / 2 - tileH / 2 : y) + '" ' +
+ 'width="' + tileW + '" height="' + tileH + '">' +
+ '<svg width="' + tileW + '" height="' + tileH + '" viewBox="' + cropX + ' ' + cropY + ' ' + cropW + ' ' + cropH + '" preserveAspectRatio="none">' +
+ '<image xlink:href="' + imgSrc + '" x="0" y="0" width="' + imgW + '" height="' + imgH + '" />' +
+ '</svg>' +
+ '</pattern>'
+ );
+ rects.push(
+ '<rect x="' + x + '" y="' + y + '" width="' + w + '" height="' + h + '" fill="url(#pattern' + i + ')" />'
+ );
+ i++;
+ }
+ addImage( 0, 0, widthL, widthT, 0, 0, sliceL, sliceT, widthL, widthT ); // top left
+ addImage( widthL, 0, centerW, widthT, sliceL, 0, imgCenterW, sliceT, tileSizeT, widthT ); // top center
+ addImage( elW - widthR, 0, widthR, widthT, imgW - sliceR, 0, sliceR, sliceT, widthR, widthT ); // top right
+ addImage( 0, widthT, widthL, middleH, 0, sliceT, sliceL, imgMiddleH, widthL, tileSizeL ); // middle left
+ if ( props.fill ) { // center fill
+ addImage( widthL, widthT, centerW, middleH, sliceL, sliceT, imgCenterW, imgMiddleH,
+ tileSizeT || tileSizeB || imgCenterW, tileSizeL || tileSizeR || imgMiddleH );
+ }
+ addImage( elW - widthR, widthT, widthR, middleH, imgW - sliceR, sliceT, sliceR, imgMiddleH, widthR, tileSizeR ); // middle right
+ addImage( 0, elH - widthB, widthL, widthB, 0, imgH - sliceB, sliceL, sliceB, widthL, widthB ); // bottom left
+ addImage( widthL, elH - widthB, centerW, widthB, sliceL, imgH - sliceB, imgCenterW, sliceB, tileSizeB, widthB ); // bottom center
+ addImage( elW - widthR, elH - widthB, widthR, widthB, imgW - sliceR, imgH - sliceB, sliceR, sliceB, widthR, widthB ); // bottom right
+
+ svg.push(
+ '<defs>' +
+ patterns.join('\n') +
+ '</defs>' +
+ rects.join('\n') +
+ '</svg>'
+ );
+
+ me.parent.setBackgroundLayer( me.bgLayerZIndex, 'url(data:image/svg+xml,' + escape( svg.join( '' ) ) + ') no-repeat border-box border-box' );
+
+ // If the border-image's src wasn't immediately available, the SVG for its background layer
+ // will have been created asynchronously after the main element's update has finished; we'll
+ // therefore need to force the root renderer to sync to the final background once finished.
+ if( isAsync ) {
+ me.parent.finishUpdate();
+ }
+ }, me );
+
+ isAsync = 1;
+ },
+
+ /**
+ * Convert a given image to a data URI
+ */
+ imageToDataURI: (function() {
+ var uris = {};
+ return function( src, width, height ) {
+ var uri = uris[ src ],
+ image, canvas;
+ if ( !uri ) {
+ image = new Image();
+ canvas = doc.createElement( 'canvas' );
+ image.src = src;
+ canvas.width = width;
+ canvas.height = height;
+ canvas.getContext( '2d' ).drawImage( image, 0, 0 );
+ uri = uris[ src ] = canvas.toDataURL();
+ }
+ return uri;
+ }
+ })(),
+
+ prepareUpdate: PIE.BorderImageRenderer.prototype.prepareUpdate,
+
+ destroy: function() {
+ var me = this,
+ rs = me.targetElement.runtimeStyle;
+ me.parent.setBackgroundLayer( me.bgLayerZIndex );
+ rs.borderColor = rs.borderStyle = rs.borderWidth = '';
+ }
+
+} );
+
+PIE.Element = (function() {
+
+ var wrappers = {},
+ lazyInitCssProp = PIE.CSS_PREFIX + 'lazy-init',
+ pollCssProp = PIE.CSS_PREFIX + 'poll',
+ trackActiveCssProp = PIE.CSS_PREFIX + 'track-active',
+ trackHoverCssProp = PIE.CSS_PREFIX + 'track-hover',
+ hoverClass = PIE.CLASS_PREFIX + 'hover',
+ activeClass = PIE.CLASS_PREFIX + 'active',
+ focusClass = PIE.CLASS_PREFIX + 'focus',
+ firstChildClass = PIE.CLASS_PREFIX + 'first-child',
+ ignorePropertyNames = { 'background':1, 'bgColor':1, 'display': 1 },
+ classNameRegExes = {},
+ dummyArray = [];
+
+
+ function addClass( el, className ) {
+ el.className += ' ' + className;
+ }
+
+ function removeClass( el, className ) {
+ var re = classNameRegExes[ className ] ||
+ ( classNameRegExes[ className ] = new RegExp( '\\b' + className + '\\b', 'g' ) );
+ el.className = el.className.replace( re, '' );
+ }
+
+ function delayAddClass( el, className /*, className2*/ ) {
+ var classes = dummyArray.slice.call( arguments, 1 ),
+ i = classes.length;
+ setTimeout( function() {
+ if( el ) {
+ while( i-- ) {
+ addClass( el, classes[ i ] );
+ }
+ }
+ }, 0 );
+ }
+
+ function delayRemoveClass( el, className /*, className2*/ ) {
+ var classes = dummyArray.slice.call( arguments, 1 ),
+ i = classes.length;
+ setTimeout( function() {
+ if( el ) {
+ while( i-- ) {
+ removeClass( el, classes[ i ] );
+ }
+ }
+ }, 0 );
+ }
+
+
+
+ function Element( el ) {
+ var renderers,
+ rootRenderer,
+ boundsInfo = new PIE.BoundsInfo( el ),
+ styleInfos,
+ styleInfosArr,
+ initializing,
+ initialized,
+ eventsAttached,
+ eventListeners = [],
+ delayed,
+ destroyed,
+ poll;
+
+ /**
+ * Initialize PIE for this element.
+ */
+ function init() {
+ if( !initialized ) {
+ var docEl,
+ bounds,
+ ieDocMode = PIE.ieDocMode,
+ cs = el.currentStyle,
+ lazy = cs.getAttribute( lazyInitCssProp ) === 'true',
+ trackActive = cs.getAttribute( trackActiveCssProp ) !== 'false',
+ trackHover = cs.getAttribute( trackHoverCssProp ) !== 'false',
+ childRenderers;
+
+ // Polling for size/position changes: default to on in IE8, off otherwise, overridable by -pie-poll
+ poll = cs.getAttribute( pollCssProp );
+ poll = ieDocMode > 7 ? poll !== 'false' : poll === 'true';
+
+ // Force layout so move/resize events will fire. Set this as soon as possible to avoid layout changes
+ // after load, but make sure it only gets called the first time through to avoid recursive calls to init().
+ if( !initializing ) {
+ initializing = 1;
+ el.runtimeStyle.zoom = 1;
+ initFirstChildPseudoClass();
+ }
+
+ boundsInfo.lock();
+
+ // If the -pie-lazy-init:true flag is set, check if the element is outside the viewport and if so, delay initialization
+ if( lazy && ( bounds = boundsInfo.getBounds() ) && ( docEl = doc.documentElement || doc.body ) &&
+ ( bounds.y > docEl.clientHeight || bounds.x > docEl.clientWidth || bounds.y + bounds.h < 0 || bounds.x + bounds.w < 0 ) ) {
+ if( !delayed ) {
+ delayed = 1;
+ PIE.OnScroll.observe( init );
+ }
+ } else {
+ initialized = 1;
+ delayed = initializing = 0;
+ PIE.OnScroll.unobserve( init );
+
+ // Create the style infos and renderers
+ if ( ieDocMode === 9 ) {
+ styleInfos = {
+ backgroundInfo: new PIE.BackgroundStyleInfo( el ),
+ borderImageInfo: new PIE.BorderImageStyleInfo( el ),
+ borderInfo: new PIE.BorderStyleInfo( el )
+ };
+ styleInfosArr = [
+ styleInfos.backgroundInfo,
+ styleInfos.borderImageInfo
+ ];
+ rootRenderer = new PIE.IE9RootRenderer( el, boundsInfo, styleInfos );
+ childRenderers = [
+ new PIE.IE9BackgroundRenderer( el, boundsInfo, styleInfos, rootRenderer ),
+ new PIE.IE9BorderImageRenderer( el, boundsInfo, styleInfos, rootRenderer )
+ ];
+ } else {
+
+ styleInfos = {
+ backgroundInfo: new PIE.BackgroundStyleInfo( el ),
+ borderInfo: new PIE.BorderStyleInfo( el ),
+ borderImageInfo: new PIE.BorderImageStyleInfo( el ),
+ borderRadiusInfo: new PIE.BorderRadiusStyleInfo( el ),
+ boxShadowInfo: new PIE.BoxShadowStyleInfo( el ),
+ visibilityInfo: new PIE.VisibilityStyleInfo( el )
+ };
+ styleInfosArr = [
+ styleInfos.backgroundInfo,
+ styleInfos.borderInfo,
+ styleInfos.borderImageInfo,
+ styleInfos.borderRadiusInfo,
+ styleInfos.boxShadowInfo,
+ styleInfos.visibilityInfo
+ ];
+ rootRenderer = new PIE.RootRenderer( el, boundsInfo, styleInfos );
+ childRenderers = [
+ new PIE.BoxShadowOutsetRenderer( el, boundsInfo, styleInfos, rootRenderer ),
+ new PIE.BackgroundRenderer( el, boundsInfo, styleInfos, rootRenderer ),
+ //new PIE.BoxShadowInsetRenderer( el, boundsInfo, styleInfos, rootRenderer ),
+ new PIE.BorderRenderer( el, boundsInfo, styleInfos, rootRenderer ),
+ new PIE.BorderImageRenderer( el, boundsInfo, styleInfos, rootRenderer )
+ ];
+ if( el.tagName === 'IMG' ) {
+ childRenderers.push( new PIE.ImgRenderer( el, boundsInfo, styleInfos, rootRenderer ) );
+ }
+ rootRenderer.childRenderers = childRenderers; // circular reference, can't pass in constructor; TODO is there a cleaner way?
+ }
+ renderers = [ rootRenderer ].concat( childRenderers );
+
+ // Add property change listeners to ancestors if requested
+ initAncestorEventListeners();
+
+ // Add to list of polled elements in IE8
+ if( poll ) {
+ PIE.Heartbeat.observe( update );
+ PIE.Heartbeat.run();
+ }
+
+ // Trigger rendering
+ update( 1 );
+ }
+
+ if( !eventsAttached ) {
+ eventsAttached = 1;
+ if( ieDocMode < 9 ) {
+ addListener( el, 'onmove', handleMoveOrResize );
+ }
+ addListener( el, 'onresize', handleMoveOrResize );
+ addListener( el, 'onpropertychange', propChanged );
+ if( trackHover ) {
+ addListener( el, 'onmouseenter', mouseEntered );
+ }
+ if( trackHover || trackActive ) {
+ addListener( el, 'onmouseleave', mouseLeft );
+ }
+ if( trackActive ) {
+ addListener( el, 'onmousedown', mousePressed );
+ }
+ if( el.tagName in PIE.focusableElements ) {
+ addListener( el, 'onfocus', focused );
+ addListener( el, 'onblur', blurred );
+ }
+ PIE.OnResize.observe( handleMoveOrResize );
+
+ PIE.OnUnload.observe( removeEventListeners );
+ }
+
+ boundsInfo.unlock();
+ }
+ }
+
+
+
+
+ /**
+ * Event handler for onmove and onresize events. Invokes update() only if the element's
+ * bounds have previously been calculated, to prevent multiple runs during page load when
+ * the element has no initial CSS3 properties.
+ */
+ function handleMoveOrResize() {
+ if( boundsInfo && boundsInfo.hasBeenQueried() ) {
+ update();
+ }
+ }
+
+
+ /**
+ * Update position and/or size as necessary. Both move and resize events call
+ * this rather than the updatePos/Size functions because sometimes, particularly
+ * during page load, one will fire but the other won't.
+ */
+ function update( force ) {
+ if( !destroyed ) {
+ if( initialized ) {
+ var i, len = renderers.length;
+
+ lockAll();
+ for( i = 0; i < len; i++ ) {
+ renderers[i].prepareUpdate();
+ }
+ if( force || boundsInfo.positionChanged() ) {
+ /* TODO just using getBoundingClientRect (used internally by BoundsInfo) for detecting
+ position changes may not always be accurate; it's possible that
+ an element will actually move relative to its positioning parent, but its position
+ relative to the viewport will stay the same. Need to come up with a better way to
+ track movement. The most accurate would be the same logic used in RootRenderer.updatePos()
+ but that is a more expensive operation since it does some DOM walking, and we want this
+ check to be as fast as possible. */
+ for( i = 0; i < len; i++ ) {
+ renderers[i].updatePos();
+ }
+ }
+ if( force || boundsInfo.sizeChanged() ) {
+ for( i = 0; i < len; i++ ) {
+ renderers[i].updateSize();
+ }
+ }
+ rootRenderer.finishUpdate();
+ unlockAll();
+ }
+ else if( !initializing ) {
+ init();
+ }
+ }
+ }
+
+ /**
+ * Handle property changes to trigger update when appropriate.
+ */
+ function propChanged() {
+ var i, len = renderers.length,
+ renderer,
+ e = event;
+
+ // Some elements like <table> fire onpropertychange events for old-school background properties
+ // ('background', 'bgColor') when runtimeStyle background properties are changed, which
+ // results in an infinite loop; therefore we filter out those property names. Also, 'display'
+ // is ignored because size calculations don't work correctly immediately when its onpropertychange
+ // event fires, and because it will trigger an onresize event anyway.
+ if( !destroyed && !( e && e.propertyName in ignorePropertyNames ) ) {
+ if( initialized ) {
+ lockAll();
+ for( i = 0; i < len; i++ ) {
+ renderers[i].prepareUpdate();
+ }
+ for( i = 0; i < len; i++ ) {
+ renderer = renderers[i];
+ // Make sure position is synced if the element hasn't already been rendered.
+ // TODO this feels sloppy - look into merging propChanged and update functions
+ if( !renderer.isPositioned ) {
+ renderer.updatePos();
+ }
+ if( renderer.needsUpdate() ) {
+ renderer.updateProps();
+ }
+ }
+ rootRenderer.finishUpdate();
+ unlockAll();
+ }
+ else if( !initializing ) {
+ init();
+ }
+ }
+ }
+
+
+ /**
+ * Handle mouseenter events. Adds a custom class to the element to allow IE6 to add
+ * hover styles to non-link elements, and to trigger a propertychange update.
+ */
+ function mouseEntered() {
+ //must delay this because the mouseenter event fires before the :hover styles are added.
+ delayAddClass( el, hoverClass );
+ }
+
+ /**
+ * Handle mouseleave events
+ */
+ function mouseLeft() {
+ //must delay this because the mouseleave event fires before the :hover styles are removed.
+ delayRemoveClass( el, hoverClass, activeClass );
+ }
+
+ /**
+ * Handle mousedown events. Adds a custom class to the element to allow IE6 to add
+ * active styles to non-link elements, and to trigger a propertychange update.
+ */
+ function mousePressed() {
+ //must delay this because the mousedown event fires before the :active styles are added.
+ delayAddClass( el, activeClass );
+
+ // listen for mouseups on the document; can't just be on the element because the user might
+ // have dragged out of the element while the mouse button was held down
+ PIE.OnMouseup.observe( mouseReleased );
+ }
+
+ /**
+ * Handle mouseup events
+ */
+ function mouseReleased() {
+ //must delay this because the mouseup event fires before the :active styles are removed.
+ delayRemoveClass( el, activeClass );
+
+ PIE.OnMouseup.unobserve( mouseReleased );
+ }
+
+ /**
+ * Handle focus events. Adds a custom class to the element to trigger a propertychange update.
+ */
+ function focused() {
+ //must delay this because the focus event fires before the :focus styles are added.
+ delayAddClass( el, focusClass );
+ }
+
+ /**
+ * Handle blur events
+ */
+ function blurred() {
+ //must delay this because the blur event fires before the :focus styles are removed.
+ delayRemoveClass( el, focusClass );
+ }
+
+
+ /**
+ * Handle property changes on ancestors of the element; see initAncestorEventListeners()
+ * which adds these listeners as requested with the -pie-watch-ancestors CSS property.
+ */
+ function ancestorPropChanged() {
+ var name = event.propertyName;
+ if( name === 'className' || name === 'id' ) {
+ propChanged();
+ }
+ }
+
+ function lockAll() {
+ boundsInfo.lock();
+ for( var i = styleInfosArr.length; i--; ) {
+ styleInfosArr[i].lock();
+ }
+ }
+
+ function unlockAll() {
+ for( var i = styleInfosArr.length; i--; ) {
+ styleInfosArr[i].unlock();
+ }
+ boundsInfo.unlock();
+ }
+
+
+ function addListener( targetEl, type, handler ) {
+ targetEl.attachEvent( type, handler );
+ eventListeners.push( [ targetEl, type, handler ] );
+ }
+
+ /**
+ * Remove all event listeners from the element and any monitored ancestors.
+ */
+ function removeEventListeners() {
+ if (eventsAttached) {
+ var i = eventListeners.length,
+ listener;
+
+ while( i-- ) {
+ listener = eventListeners[ i ];
+ listener[ 0 ].detachEvent( listener[ 1 ], listener[ 2 ] );
+ }
+
+ PIE.OnUnload.unobserve( removeEventListeners );
+ eventsAttached = 0;
+ eventListeners = [];
+ }
+ }
+
+
+ /**
+ * Clean everything up when the behavior is removed from the element, or the element
+ * is manually destroyed.
+ */
+ function destroy() {
+ if( !destroyed ) {
+ var i, len;
+
+ removeEventListeners();
+
+ destroyed = 1;
+
+ // destroy any active renderers
+ if( renderers ) {
+ for( i = 0, len = renderers.length; i < len; i++ ) {
+ renderers[i].finalized = 1;
+ renderers[i].destroy();
+ }
+ }
+
+ // Remove from list of polled elements in IE8
+ if( poll ) {
+ PIE.Heartbeat.unobserve( update );
+ }
+ // Stop onresize listening
+ PIE.OnResize.unobserve( update );
+
+ // Kill references
+ renderers = boundsInfo = styleInfos = styleInfosArr = el = null;
+ }
+ }
+
+
+ /**
+ * If requested via the custom -pie-watch-ancestors CSS property, add onpropertychange and
+ * other event listeners to ancestor(s) of the element so we can pick up style changes
+ * based on CSS rules using descendant selectors.
+ */
+ function initAncestorEventListeners() {
+ var watch = el.currentStyle.getAttribute( PIE.CSS_PREFIX + 'watch-ancestors' ),
+ i, a;
+ if( watch ) {
+ watch = parseInt( watch, 10 );
+ i = 0;
+ a = el.parentNode;
+ while( a && ( watch === 'NaN' || i++ < watch ) ) {
+ addListener( a, 'onpropertychange', ancestorPropChanged );
+ addListener( a, 'onmouseenter', mouseEntered );
+ addListener( a, 'onmouseleave', mouseLeft );
+ addListener( a, 'onmousedown', mousePressed );
+ if( a.tagName in PIE.focusableElements ) {
+ addListener( a, 'onfocus', focused );
+ addListener( a, 'onblur', blurred );
+ }
+ a = a.parentNode;
+ }
+ }
+ }
+
+
+ /**
+ * If the target element is a first child, add a pie_first-child class to it. This allows using
+ * the added class as a workaround for the fact that PIE's rendering element breaks the :first-child
+ * pseudo-class selector.
+ */
+ function initFirstChildPseudoClass() {
+ var tmpEl = el,
+ isFirst = 1;
+ while( tmpEl = tmpEl.previousSibling ) {
+ if( tmpEl.nodeType === 1 ) {
+ isFirst = 0;
+ break;
+ }
+ }
+ if( isFirst ) {
+ addClass( el, firstChildClass );
+ }
+ }
+
+
+ // These methods are all already bound to this instance so there's no need to wrap them
+ // in a closure to maintain the 'this' scope object when calling them.
+ this.init = init;
+ this.update = update;
+ this.destroy = destroy;
+ this.el = el;
+ }
+
+ Element.getInstance = function( el ) {
+ var id = PIE.Util.getUID( el );
+ return wrappers[ id ] || ( wrappers[ id ] = new Element( el ) );
+ };
+
+ Element.destroy = function( el ) {
+ var id = PIE.Util.getUID( el ),
+ wrapper = wrappers[ id ];
+ if( wrapper ) {
+ wrapper.destroy();
+ delete wrappers[ id ];
+ }
+ };
+
+ Element.destroyAll = function() {
+ var els = [], wrapper;
+ if( wrappers ) {
+ for( var w in wrappers ) {
+ if( wrappers.hasOwnProperty( w ) ) {
+ wrapper = wrappers[ w ];
+ els.push( wrapper.el );
+ wrapper.destroy();
+ }
+ }
+ wrappers = {};
+ }
+ return els;
+ };
+
+ return Element;
+})();
+
+/*
+ * This file exposes the public API for invoking PIE.
+ */
+
+
+/**
+ * @property supportsVML
+ * True if the current IE browser environment has a functioning VML engine. Should be true
+ * in most IEs, but in rare cases may be false. If false, PIE will exit immediately when
+ * attached to an element; this property may be used for debugging or by external scripts
+ * to perform some special action when VML support is absent.
+ * @type {boolean}
+ */
+PIE[ 'supportsVML' ] = PIE.supportsVML;
+
+
+/**
+ * Programatically attach PIE to a single element.
+ * @param {Element} el
+ */
+PIE[ 'attach' ] = function( el ) {
+ if (PIE.ieDocMode < 10 && PIE.supportsVML) {
+ PIE.Element.getInstance( el ).init();
+ }
+};
+
+
+/**
+ * Programatically detach PIE from a single element.
+ * @param {Element} el
+ */
+PIE[ 'detach' ] = function( el ) {
+ PIE.Element.destroy( el );
+};
+
+
+} // if( !PIE )
+var el = element;
+
+function init() {
+ if ( doc.media !== 'print' ) { // IE strangely attaches a second copy of the behavior to elements when printing
+ var PIE = window[ 'PIE' ];
+ if( PIE ) {
+ PIE['attach']( el );
+ }
+ }
+}
+
+function cleanup() {
+ if ( doc.media !== 'print' ) {
+ var PIE = window[ 'PIE' ];
+ if (PIE) {
+ PIE['detach']( el );
+ el = 0;
+ }
+ }
+}
+
+if( el.readyState === 'complete' ) {
+ init();
+}
+</script>
+</PUBLIC:COMPONENT>
diff --git a/themes/mantra/resources/js/PIE/PIE_uncompressed.js b/themes/mantra/resources/js/PIE/PIE_uncompressed.js
new file mode 100644
index 00000000..85f6785e
--- /dev/null
+++ b/themes/mantra/resources/js/PIE/PIE_uncompressed.js
@@ -0,0 +1,4474 @@
+/*
+PIE: CSS3 rendering for IE
+Version 1.0.0
+http://css3pie.com
+Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2.
+*/
+(function(){
+var doc = document;var PIE = window['PIE'];
+
+if( !PIE ) {
+ PIE = window['PIE'] = {
+ CSS_PREFIX: '-pie-',
+ STYLE_PREFIX: 'Pie',
+ CLASS_PREFIX: 'pie_',
+ tableCellTags: {
+ 'TD': 1,
+ 'TH': 1
+ },
+
+ /**
+ * Lookup table of elements which cannot take custom children.
+ */
+ childlessElements: {
+ 'TABLE':1,
+ 'THEAD':1,
+ 'TBODY':1,
+ 'TFOOT':1,
+ 'TR':1,
+ 'INPUT':1,
+ 'TEXTAREA':1,
+ 'SELECT':1,
+ 'OPTION':1,
+ 'IMG':1,
+ 'HR':1
+ },
+
+ /**
+ * Elements that can receive user focus
+ */
+ focusableElements: {
+ 'A':1,
+ 'INPUT':1,
+ 'TEXTAREA':1,
+ 'SELECT':1,
+ 'BUTTON':1
+ },
+
+ /**
+ * Values of the type attribute for input elements displayed as buttons
+ */
+ inputButtonTypes: {
+ 'submit':1,
+ 'button':1,
+ 'reset':1
+ },
+
+ emptyFn: function() {}
+ };
+
+ // Force the background cache to be used. No reason it shouldn't be.
+ try {
+ doc.execCommand( 'BackgroundImageCache', false, true );
+ } catch(e) {}
+
+ (function() {
+ /*
+ * IE version detection approach by James Padolsey, with modifications -- from
+ * http://james.padolsey.com/javascript/detect-ie-in-js-using-conditional-comments/
+ */
+ var ieVersion = 4,
+ div = doc.createElement('div'),
+ all = div.getElementsByTagName('i'),
+ shape;
+ while (
+ div.innerHTML = '<!--[if gt IE ' + (++ieVersion) + ']><i></i><![endif]-->',
+ all[0]
+ ) {}
+ PIE.ieVersion = ieVersion;
+
+ // Detect IE6
+ if( ieVersion === 6 ) {
+ // IE6 can't access properties with leading dash, but can without it.
+ PIE.CSS_PREFIX = PIE.CSS_PREFIX.replace( /^-/, '' );
+ }
+
+ PIE.ieDocMode = doc.documentMode || PIE.ieVersion;
+
+ // Detect VML support (a small number of IE installs don't have a working VML engine)
+ div.innerHTML = '<v:shape adj="1"/>';
+ shape = div.firstChild;
+ shape.style['behavior'] = 'url(#default#VML)';
+ PIE.supportsVML = (typeof shape['adj'] === "object");
+ }());
+/**
+ * Utility functions
+ */
+(function() {
+ var vmlCreatorDoc,
+ idNum = 0,
+ imageSizes = {};
+
+
+ PIE.Util = {
+
+ /**
+ * To create a VML element, it must be created by a Document which has the VML
+ * namespace set. Unfortunately, if you try to add the namespace programatically
+ * into the main document, you will get an "Unspecified error" when trying to
+ * access document.namespaces before the document is finished loading. To get
+ * around this, we create a DocumentFragment, which in IE land is apparently a
+ * full-fledged Document. It allows adding namespaces immediately, so we add the
+ * namespace there and then have it create the VML element.
+ * @param {string} tag The tag name for the VML element
+ * @return {Element} The new VML element
+ */
+ createVmlElement: function( tag ) {
+ var vmlPrefix = 'css3vml';
+ if( !vmlCreatorDoc ) {
+ vmlCreatorDoc = doc.createDocumentFragment();
+ vmlCreatorDoc.namespaces.add( vmlPrefix, 'urn:schemas-microsoft-com:vml' );
+ }
+ return vmlCreatorDoc.createElement( vmlPrefix + ':' + tag );
+ },
+
+
+ /**
+ * Generate and return a unique ID for a given object. The generated ID is stored
+ * as a property of the object for future reuse.
+ * @param {Object} obj
+ */
+ getUID: function( obj ) {
+ return obj && obj[ '_pieId' ] || ( obj[ '_pieId' ] = '_' + ++idNum );
+ },
+
+
+ /**
+ * Simple utility for merging objects
+ * @param {Object} obj1 The main object into which all others will be merged
+ * @param {...Object} var_args Other objects which will be merged into the first, in order
+ */
+ merge: function( obj1 ) {
+ var i, len, p, objN, args = arguments;
+ for( i = 1, len = args.length; i < len; i++ ) {
+ objN = args[i];
+ for( p in objN ) {
+ if( objN.hasOwnProperty( p ) ) {
+ obj1[ p ] = objN[ p ];
+ }
+ }
+ }
+ return obj1;
+ },
+
+
+ /**
+ * Execute a callback function, passing it the dimensions of a given image once
+ * they are known.
+ * @param {string} src The source URL of the image
+ * @param {function({w:number, h:number})} func The callback function to be called once the image dimensions are known
+ * @param {Object} ctx A context object which will be used as the 'this' value within the executed callback function
+ */
+ withImageSize: function( src, func, ctx ) {
+ var size = imageSizes[ src ], img, queue;
+ if( size ) {
+ // If we have a queue, add to it
+ if( Object.prototype.toString.call( size ) === '[object Array]' ) {
+ size.push( [ func, ctx ] );
+ }
+ // Already have the size cached, call func right away
+ else {
+ func.call( ctx, size );
+ }
+ } else {
+ queue = imageSizes[ src ] = [ [ func, ctx ] ]; //create queue
+ img = new Image();
+ img.onload = function() {
+ size = imageSizes[ src ] = { w: img.width, h: img.height };
+ for( var i = 0, len = queue.length; i < len; i++ ) {
+ queue[ i ][ 0 ].call( queue[ i ][ 1 ], size );
+ }
+ img.onload = null;
+ };
+ img.src = src;
+ }
+ }
+ };
+})();/**
+ * Utility functions for handling gradients
+ */
+PIE.GradientUtil = {
+
+ getGradientMetrics: function( el, width, height, gradientInfo ) {
+ var angle = gradientInfo.angle,
+ startPos = gradientInfo.gradientStart,
+ startX, startY,
+ endX, endY,
+ startCornerX, startCornerY,
+ endCornerX, endCornerY,
+ deltaX, deltaY,
+ p, UNDEF;
+
+ // Find the "start" and "end" corners; these are the corners furthest along the gradient line.
+ // This is used below to find the start/end positions of the CSS3 gradient-line, and also in finding
+ // the total length of the VML rendered gradient-line corner to corner.
+ function findCorners() {
+ startCornerX = ( angle >= 90 && angle < 270 ) ? width : 0;
+ startCornerY = angle < 180 ? height : 0;
+ endCornerX = width - startCornerX;
+ endCornerY = height - startCornerY;
+ }
+
+ // Normalize the angle to a value between [0, 360)
+ function normalizeAngle() {
+ while( angle < 0 ) {
+ angle += 360;
+ }
+ angle = angle % 360;
+ }
+
+ // Find the start and end points of the gradient
+ if( startPos ) {
+ startPos = startPos.coords( el, width, height );
+ startX = startPos.x;
+ startY = startPos.y;
+ }
+ if( angle ) {
+ angle = angle.degrees();
+
+ normalizeAngle();
+ findCorners();
+
+ // If no start position was specified, then choose a corner as the starting point.
+ if( !startPos ) {
+ startX = startCornerX;
+ startY = startCornerY;
+ }
+
+ // Find the end position by extending a perpendicular line from the gradient-line which
+ // intersects the corner opposite from the starting corner.
+ p = PIE.GradientUtil.perpendicularIntersect( startX, startY, angle, endCornerX, endCornerY );
+ endX = p[0];
+ endY = p[1];
+ }
+ else if( startPos ) {
+ // Start position but no angle specified: find the end point by rotating 180deg around the center
+ endX = width - startX;
+ endY = height - startY;
+ }
+ else {
+ // Neither position nor angle specified; create vertical gradient from top to bottom
+ startX = startY = endX = 0;
+ endY = height;
+ }
+ deltaX = endX - startX;
+ deltaY = endY - startY;
+
+ if( angle === UNDEF ) {
+ // Get the angle based on the change in x/y from start to end point. Checks first for horizontal
+ // or vertical angles so they get exact whole numbers rather than what atan2 gives.
+ angle = ( !deltaX ? ( deltaY < 0 ? 90 : 270 ) :
+ ( !deltaY ? ( deltaX < 0 ? 180 : 0 ) :
+ -Math.atan2( deltaY, deltaX ) / Math.PI * 180
+ )
+ );
+ normalizeAngle();
+ findCorners();
+ }
+
+ return {
+ angle: angle,
+ startX: startX,
+ startY: startY,
+ endX: endX,
+ endY: endY,
+ startCornerX: startCornerX,
+ startCornerY: startCornerY,
+ endCornerX: endCornerX,
+ endCornerY: endCornerY,
+ deltaX: deltaX,
+ deltaY: deltaY,
+ lineLength: PIE.GradientUtil.distance( startX, startY, endX, endY )
+ }
+ },
+
+ /**
+ * Find the point along a given line (defined by a starting point and an angle), at which
+ * that line is intersected by a perpendicular line extending through another point.
+ * @param x1 - x coord of the starting point
+ * @param y1 - y coord of the starting point
+ * @param angle - angle of the line extending from the starting point (in degrees)
+ * @param x2 - x coord of point along the perpendicular line
+ * @param y2 - y coord of point along the perpendicular line
+ * @return [ x, y ]
+ */
+ perpendicularIntersect: function( x1, y1, angle, x2, y2 ) {
+ // Handle straight vertical and horizontal angles, for performance and to avoid
+ // divide-by-zero errors.
+ if( angle === 0 || angle === 180 ) {
+ return [ x2, y1 ];
+ }
+ else if( angle === 90 || angle === 270 ) {
+ return [ x1, y2 ];
+ }
+ else {
+ // General approach: determine the Ax+By=C formula for each line (the slope of the second
+ // line is the negative inverse of the first) and then solve for where both formulas have
+ // the same x/y values.
+ var a1 = Math.tan( -angle * Math.PI / 180 ),
+ c1 = a1 * x1 - y1,
+ a2 = -1 / a1,
+ c2 = a2 * x2 - y2,
+ d = a2 - a1,
+ endX = ( c2 - c1 ) / d,
+ endY = ( a1 * c2 - a2 * c1 ) / d;
+ return [ endX, endY ];
+ }
+ },
+
+ /**
+ * Find the distance between two points
+ * @param {Number} p1x
+ * @param {Number} p1y
+ * @param {Number} p2x
+ * @param {Number} p2y
+ * @return {Number} the distance
+ */
+ distance: function( p1x, p1y, p2x, p2y ) {
+ var dx = p2x - p1x,
+ dy = p2y - p1y;
+ return Math.abs(
+ dx === 0 ? dy :
+ dy === 0 ? dx :
+ Math.sqrt( dx * dx + dy * dy )
+ );
+ }
+
+};/**
+ *
+ */
+PIE.Observable = function() {
+ /**
+ * List of registered observer functions
+ */
+ this.observers = [];
+
+ /**
+ * Hash of function ids to their position in the observers list, for fast lookup
+ */
+ this.indexes = {};
+};
+PIE.Observable.prototype = {
+
+ observe: function( fn ) {
+ var id = PIE.Util.getUID( fn ),
+ indexes = this.indexes,
+ observers = this.observers;
+ if( !( id in indexes ) ) {
+ indexes[ id ] = observers.length;
+ observers.push( fn );
+ }
+ },
+
+ unobserve: function( fn ) {
+ var id = PIE.Util.getUID( fn ),
+ indexes = this.indexes;
+ if( id && id in indexes ) {
+ delete this.observers[ indexes[ id ] ];
+ delete indexes[ id ];
+ }
+ },
+
+ fire: function() {
+ var o = this.observers,
+ i = o.length;
+ while( i-- ) {
+ o[ i ] && o[ i ]();
+ }
+ }
+
+};/*
+ * Simple heartbeat timer - this is a brute-force workaround for syncing issues caused by IE not
+ * always firing the onmove and onresize events when elements are moved or resized. We check a few
+ * times every second to make sure the elements have the correct position and size. See Element.js
+ * which adds heartbeat listeners based on the custom -pie-poll flag, which defaults to true in IE8-9
+ * and false elsewhere.
+ */
+
+PIE.Heartbeat = new PIE.Observable();
+PIE.Heartbeat.run = function() {
+ var me = this,
+ interval;
+ if( !me.running ) {
+ interval = doc.documentElement.currentStyle.getAttribute( PIE.CSS_PREFIX + 'poll-interval' ) || 250;
+ (function beat() {
+ me.fire();
+ setTimeout(beat, interval);
+ })();
+ me.running = 1;
+ }
+};
+/**
+ * Create an observable listener for the onunload event
+ */
+(function() {
+ PIE.OnUnload = new PIE.Observable();
+
+ function handleUnload() {
+ PIE.OnUnload.fire();
+ window.detachEvent( 'onunload', handleUnload );
+ window[ 'PIE' ] = null;
+ }
+
+ window.attachEvent( 'onunload', handleUnload );
+
+ /**
+ * Attach an event which automatically gets detached onunload
+ */
+ PIE.OnUnload.attachManagedEvent = function( target, name, handler ) {
+ target.attachEvent( name, handler );
+ this.observe( function() {
+ target.detachEvent( name, handler );
+ } );
+ };
+})()/**
+ * Create a single observable listener for window resize events.
+ */
+PIE.OnResize = new PIE.Observable();
+
+PIE.OnUnload.attachManagedEvent( window, 'onresize', function() { PIE.OnResize.fire(); } );
+/**
+ * Create a single observable listener for scroll events. Used for lazy loading based
+ * on the viewport, and for fixed position backgrounds.
+ */
+(function() {
+ PIE.OnScroll = new PIE.Observable();
+
+ function scrolled() {
+ PIE.OnScroll.fire();
+ }
+
+ PIE.OnUnload.attachManagedEvent( window, 'onscroll', scrolled );
+
+ PIE.OnResize.observe( scrolled );
+})();
+/**
+ * Listen for printing events, destroy all active PIE instances when printing, and
+ * restore them afterward.
+ */
+(function() {
+
+ var elements;
+
+ function beforePrint() {
+ elements = PIE.Element.destroyAll();
+ }
+
+ function afterPrint() {
+ if( elements ) {
+ for( var i = 0, len = elements.length; i < len; i++ ) {
+ PIE[ 'attach' ]( elements[i] );
+ }
+ elements = 0;
+ }
+ }
+
+ if( PIE.ieDocMode < 9 ) {
+ PIE.OnUnload.attachManagedEvent( window, 'onbeforeprint', beforePrint );
+ PIE.OnUnload.attachManagedEvent( window, 'onafterprint', afterPrint );
+ }
+
+})();/**
+ * Create a single observable listener for document mouseup events.
+ */
+PIE.OnMouseup = new PIE.Observable();
+
+PIE.OnUnload.attachManagedEvent( doc, 'onmouseup', function() { PIE.OnMouseup.fire(); } );
+/**
+ * Wrapper for length and percentage style values. The value is immutable. A singleton instance per unique
+ * value is returned from PIE.getLength() - always use that instead of instantiating directly.
+ * @constructor
+ * @param {string} val The CSS string representing the length. It is assumed that this will already have
+ * been validated as a valid length or percentage syntax.
+ */
+PIE.Length = (function() {
+ var lengthCalcEl = doc.createElement( 'length-calc' ),
+ parent = doc.body || doc.documentElement,
+ s = lengthCalcEl.style,
+ conversions = {},
+ units = [ 'mm', 'cm', 'in', 'pt', 'pc' ],
+ i = units.length,
+ instances = {};
+
+ s.position = 'absolute';
+ s.top = s.left = '-9999px';
+
+ parent.appendChild( lengthCalcEl );
+ while( i-- ) {
+ s.width = '100' + units[i];
+ conversions[ units[i] ] = lengthCalcEl.offsetWidth / 100;
+ }
+ parent.removeChild( lengthCalcEl );
+
+ // All calcs from here on will use 1em
+ s.width = '1em';
+
+
+ function Length( val ) {
+ this.val = val;
+ }
+ Length.prototype = {
+ /**
+ * Regular expression for matching the length unit
+ * @private
+ */
+ unitRE: /(px|em|ex|mm|cm|in|pt|pc|%)$/,
+
+ /**
+ * Get the numeric value of the length
+ * @return {number} The value
+ */
+ getNumber: function() {
+ var num = this.num,
+ UNDEF;
+ if( num === UNDEF ) {
+ num = this.num = parseFloat( this.val );
+ }
+ return num;
+ },
+
+ /**
+ * Get the unit of the length
+ * @return {string} The unit
+ */
+ getUnit: function() {
+ var unit = this.unit,
+ m;
+ if( !unit ) {
+ m = this.val.match( this.unitRE );
+ unit = this.unit = ( m && m[0] ) || 'px';
+ }
+ return unit;
+ },
+
+ /**
+ * Determine whether this is a percentage length value
+ * @return {boolean}
+ */
+ isPercentage: function() {
+ return this.getUnit() === '%';
+ },
+
+ /**
+ * Resolve this length into a number of pixels.
+ * @param {Element} el - the context element, used to resolve font-relative values
+ * @param {(function():number|number)=} pct100 - the number of pixels that equal a 100% percentage. This can be either a number or a
+ * function which will be called to return the number.
+ */
+ pixels: function( el, pct100 ) {
+ var num = this.getNumber(),
+ unit = this.getUnit();
+ switch( unit ) {
+ case "px":
+ return num;
+ case "%":
+ return num * ( typeof pct100 === 'function' ? pct100() : pct100 ) / 100;
+ case "em":
+ return num * this.getEmPixels( el );
+ case "ex":
+ return num * this.getEmPixels( el ) / 2;
+ default:
+ return num * conversions[ unit ];
+ }
+ },
+
+ /**
+ * The em and ex units are relative to the font-size of the current element,
+ * however if the font-size is set using non-pixel units then we get that value
+ * rather than a pixel conversion. To get around this, we keep a floating element
+ * with width:1em which we insert into the target element and then read its offsetWidth.
+ * For elements that won't accept a child we insert into the parent node and perform
+ * additional calculation. If the font-size *is* specified in pixels, then we use that
+ * directly to avoid the expensive DOM manipulation.
+ * @param {Element} el
+ * @return {number}
+ */
+ getEmPixels: function( el ) {
+ var fs = el.currentStyle.fontSize,
+ px, parent, me;
+
+ if( fs.indexOf( 'px' ) > 0 ) {
+ return parseFloat( fs );
+ }
+ else if( el.tagName in PIE.childlessElements ) {
+ me = this;
+ parent = el.parentNode;
+ return PIE.getLength( fs ).pixels( parent, function() {
+ return me.getEmPixels( parent );
+ } );
+ }
+ else {
+ el.appendChild( lengthCalcEl );
+ px = lengthCalcEl.offsetWidth;
+ if( lengthCalcEl.parentNode === el ) { //not sure how this could be false but it sometimes is
+ el.removeChild( lengthCalcEl );
+ }
+ return px;
+ }
+ }
+ };
+
+
+ /**
+ * Retrieve a PIE.Length instance for the given value. A shared singleton instance is returned for each unique value.
+ * @param {string} val The CSS string representing the length. It is assumed that this will already have
+ * been validated as a valid length or percentage syntax.
+ */
+ PIE.getLength = function( val ) {
+ return instances[ val ] || ( instances[ val ] = new Length( val ) );
+ };
+
+ return Length;
+})();
+/**
+ * Wrapper for a CSS3 bg-position value. Takes up to 2 position keywords and 2 lengths/percentages.
+ * @constructor
+ * @param {Array.<PIE.Tokenizer.Token>} tokens The tokens making up the background position value.
+ */
+PIE.BgPosition = (function() {
+
+ var length_fifty = PIE.getLength( '50%' ),
+ vert_idents = { 'top': 1, 'center': 1, 'bottom': 1 },
+ horiz_idents = { 'left': 1, 'center': 1, 'right': 1 };
+
+
+ function BgPosition( tokens ) {
+ this.tokens = tokens;
+ }
+ BgPosition.prototype = {
+ /**
+ * Normalize the values into the form:
+ * [ xOffsetSide, xOffsetLength, yOffsetSide, yOffsetLength ]
+ * where: xOffsetSide is either 'left' or 'right',
+ * yOffsetSide is either 'top' or 'bottom',
+ * and x/yOffsetLength are both PIE.Length objects.
+ * @return {Array}
+ */
+ getValues: function() {
+ if( !this._values ) {
+ var tokens = this.tokens,
+ len = tokens.length,
+ Tokenizer = PIE.Tokenizer,
+ identType = Tokenizer.Type,
+ length_zero = PIE.getLength( '0' ),
+ type_ident = identType.IDENT,
+ type_length = identType.LENGTH,
+ type_percent = identType.PERCENT,
+ type, value,
+ vals = [ 'left', length_zero, 'top', length_zero ];
+
+ // If only one value, the second is assumed to be 'center'
+ if( len === 1 ) {
+ tokens.push( new Tokenizer.Token( type_ident, 'center' ) );
+ len++;
+ }
+
+ // Two values - CSS2
+ if( len === 2 ) {
+ // If both idents, they can appear in either order, so switch them if needed
+ if( type_ident & ( tokens[0].tokenType | tokens[1].tokenType ) &&
+ tokens[0].tokenValue in vert_idents && tokens[1].tokenValue in horiz_idents ) {
+ tokens.push( tokens.shift() );
+ }
+ if( tokens[0].tokenType & type_ident ) {
+ if( tokens[0].tokenValue === 'center' ) {
+ vals[1] = length_fifty;
+ } else {
+ vals[0] = tokens[0].tokenValue;
+ }
+ }
+ else if( tokens[0].isLengthOrPercent() ) {
+ vals[1] = PIE.getLength( tokens[0].tokenValue );
+ }
+ if( tokens[1].tokenType & type_ident ) {
+ if( tokens[1].tokenValue === 'center' ) {
+ vals[3] = length_fifty;
+ } else {
+ vals[2] = tokens[1].tokenValue;
+ }
+ }
+ else if( tokens[1].isLengthOrPercent() ) {
+ vals[3] = PIE.getLength( tokens[1].tokenValue );
+ }
+ }
+
+ // Three or four values - CSS3
+ else {
+ // TODO
+ }
+
+ this._values = vals;
+ }
+ return this._values;
+ },
+
+ /**
+ * Find the coordinates of the background image from the upper-left corner of the background area.
+ * Note that these coordinate values are not rounded.
+ * @param {Element} el
+ * @param {number} width - the width for percentages (background area width minus image width)
+ * @param {number} height - the height for percentages (background area height minus image height)
+ * @return {Object} { x: Number, y: Number }
+ */
+ coords: function( el, width, height ) {
+ var vals = this.getValues(),
+ pxX = vals[1].pixels( el, width ),
+ pxY = vals[3].pixels( el, height );
+
+ return {
+ x: vals[0] === 'right' ? width - pxX : pxX,
+ y: vals[2] === 'bottom' ? height - pxY : pxY
+ };
+ }
+ };
+
+ return BgPosition;
+})();
+/**
+ * Wrapper for a CSS3 background-size value.
+ * @constructor
+ * @param {String|PIE.Length} w The width parameter
+ * @param {String|PIE.Length} h The height parameter, if any
+ */
+PIE.BgSize = (function() {
+
+ var CONTAIN = 'contain',
+ COVER = 'cover',
+ AUTO = 'auto';
+
+
+ function BgSize( w, h ) {
+ this.w = w;
+ this.h = h;
+ }
+ BgSize.prototype = {
+
+ pixels: function( el, areaW, areaH, imgW, imgH ) {
+ var me = this,
+ w = me.w,
+ h = me.h,
+ areaRatio = areaW / areaH,
+ imgRatio = imgW / imgH;
+
+ if ( w === CONTAIN ) {
+ w = imgRatio > areaRatio ? areaW : areaH * imgRatio;
+ h = imgRatio > areaRatio ? areaW / imgRatio : areaH;
+ }
+ else if ( w === COVER ) {
+ w = imgRatio < areaRatio ? areaW : areaH * imgRatio;
+ h = imgRatio < areaRatio ? areaW / imgRatio : areaH;
+ }
+ else if ( w === AUTO ) {
+ h = ( h === AUTO ? imgH : h.pixels( el, areaH ) );
+ w = h * imgRatio;
+ }
+ else {
+ w = w.pixels( el, areaW );
+ h = ( h === AUTO ? w / imgRatio : h.pixels( el, areaH ) );
+ }
+
+ return { w: w, h: h };
+ }
+
+ };
+
+ BgSize.DEFAULT = new BgSize( AUTO, AUTO );
+
+ return BgSize;
+})();
+/**
+ * Wrapper for angle values; handles conversion to degrees from all allowed angle units
+ * @constructor
+ * @param {string} val The raw CSS value for the angle. It is assumed it has been pre-validated.
+ */
+PIE.Angle = (function() {
+ function Angle( val ) {
+ this.val = val;
+ }
+ Angle.prototype = {
+ unitRE: /[a-z]+$/i,
+
+ /**
+ * @return {string} The unit of the angle value
+ */
+ getUnit: function() {
+ return this._unit || ( this._unit = this.val.match( this.unitRE )[0].toLowerCase() );
+ },
+
+ /**
+ * Get the numeric value of the angle in degrees.
+ * @return {number} The degrees value
+ */
+ degrees: function() {
+ var deg = this._deg, u, n;
+ if( deg === undefined ) {
+ u = this.getUnit();
+ n = parseFloat( this.val, 10 );
+ deg = this._deg = ( u === 'deg' ? n : u === 'rad' ? n / Math.PI * 180 : u === 'grad' ? n / 400 * 360 : u === 'turn' ? n * 360 : 0 );
+ }
+ return deg;
+ }
+ };
+
+ return Angle;
+})();/**
+ * Abstraction for colors values. Allows detection of rgba values. A singleton instance per unique
+ * value is returned from PIE.getColor() - always use that instead of instantiating directly.
+ * @constructor
+ * @param {string} val The raw CSS string value for the color
+ */
+PIE.Color = (function() {
+ var instances = {};
+
+ function Color( val ) {
+ this.val = val;
+ }
+
+ /**
+ * Regular expression for matching rgba colors and extracting their components
+ * @type {RegExp}
+ */
+ Color.rgbaRE = /\s*rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d+|\d*\.\d+)\s*\)\s*/;
+
+ Color.names = {
+ "aliceblue":"F0F8FF", "antiquewhite":"FAEBD7", "aqua":"0FF",
+ "aquamarine":"7FFFD4", "azure":"F0FFFF", "beige":"F5F5DC",
+ "bisque":"FFE4C4", "black":"000", "blanchedalmond":"FFEBCD",
+ "blue":"00F", "blueviolet":"8A2BE2", "brown":"A52A2A",
+ "burlywood":"DEB887", "cadetblue":"5F9EA0", "chartreuse":"7FFF00",
+ "chocolate":"D2691E", "coral":"FF7F50", "cornflowerblue":"6495ED",
+ "cornsilk":"FFF8DC", "crimson":"DC143C", "cyan":"0FF",
+ "darkblue":"00008B", "darkcyan":"008B8B", "darkgoldenrod":"B8860B",
+ "darkgray":"A9A9A9", "darkgreen":"006400", "darkkhaki":"BDB76B",
+ "darkmagenta":"8B008B", "darkolivegreen":"556B2F", "darkorange":"FF8C00",
+ "darkorchid":"9932CC", "darkred":"8B0000", "darksalmon":"E9967A",
+ "darkseagreen":"8FBC8F", "darkslateblue":"483D8B", "darkslategray":"2F4F4F",
+ "darkturquoise":"00CED1", "darkviolet":"9400D3", "deeppink":"FF1493",
+ "deepskyblue":"00BFFF", "dimgray":"696969", "dodgerblue":"1E90FF",
+ "firebrick":"B22222", "floralwhite":"FFFAF0", "forestgreen":"228B22",
+ "fuchsia":"F0F", "gainsboro":"DCDCDC", "ghostwhite":"F8F8FF",
+ "gold":"FFD700", "goldenrod":"DAA520", "gray":"808080",
+ "green":"008000", "greenyellow":"ADFF2F", "honeydew":"F0FFF0",
+ "hotpink":"FF69B4", "indianred":"CD5C5C", "indigo":"4B0082",
+ "ivory":"FFFFF0", "khaki":"F0E68C", "lavender":"E6E6FA",
+ "lavenderblush":"FFF0F5", "lawngreen":"7CFC00", "lemonchiffon":"FFFACD",
+ "lightblue":"ADD8E6", "lightcoral":"F08080", "lightcyan":"E0FFFF",
+ "lightgoldenrodyellow":"FAFAD2", "lightgreen":"90EE90", "lightgrey":"D3D3D3",
+ "lightpink":"FFB6C1", "lightsalmon":"FFA07A", "lightseagreen":"20B2AA",
+ "lightskyblue":"87CEFA", "lightslategray":"789", "lightsteelblue":"B0C4DE",
+ "lightyellow":"FFFFE0", "lime":"0F0", "limegreen":"32CD32",
+ "linen":"FAF0E6", "magenta":"F0F", "maroon":"800000",
+ "mediumauqamarine":"66CDAA", "mediumblue":"0000CD", "mediumorchid":"BA55D3",
+ "mediumpurple":"9370D8", "mediumseagreen":"3CB371", "mediumslateblue":"7B68EE",
+ "mediumspringgreen":"00FA9A", "mediumturquoise":"48D1CC", "mediumvioletred":"C71585",
+ "midnightblue":"191970", "mintcream":"F5FFFA", "mistyrose":"FFE4E1",
+ "moccasin":"FFE4B5", "navajowhite":"FFDEAD", "navy":"000080",
+ "oldlace":"FDF5E6", "olive":"808000", "olivedrab":"688E23",
+ "orange":"FFA500", "orangered":"FF4500", "orchid":"DA70D6",
+ "palegoldenrod":"EEE8AA", "palegreen":"98FB98", "paleturquoise":"AFEEEE",
+ "palevioletred":"D87093", "papayawhip":"FFEFD5", "peachpuff":"FFDAB9",
+ "peru":"CD853F", "pink":"FFC0CB", "plum":"DDA0DD",
+ "powderblue":"B0E0E6", "purple":"800080", "red":"F00",
+ "rosybrown":"BC8F8F", "royalblue":"4169E1", "saddlebrown":"8B4513",
+ "salmon":"FA8072", "sandybrown":"F4A460", "seagreen":"2E8B57",
+ "seashell":"FFF5EE", "sienna":"A0522D", "silver":"C0C0C0",
+ "skyblue":"87CEEB", "slateblue":"6A5ACD", "slategray":"708090",
+ "snow":"FFFAFA", "springgreen":"00FF7F", "steelblue":"4682B4",
+ "tan":"D2B48C", "teal":"008080", "thistle":"D8BFD8",
+ "tomato":"FF6347", "turquoise":"40E0D0", "violet":"EE82EE",
+ "wheat":"F5DEB3", "white":"FFF", "whitesmoke":"F5F5F5",
+ "yellow":"FF0", "yellowgreen":"9ACD32"
+ };
+
+ Color.prototype = {
+ /**
+ * @private
+ */
+ parse: function() {
+ if( !this._color ) {
+ var me = this,
+ v = me.val,
+ vLower,
+ m = v.match( Color.rgbaRE );
+ if( m ) {
+ me._color = 'rgb(' + m[1] + ',' + m[2] + ',' + m[3] + ')';
+ me._alpha = parseFloat( m[4] );
+ }
+ else {
+ if( ( vLower = v.toLowerCase() ) in Color.names ) {
+ v = '#' + Color.names[vLower];
+ }
+ me._color = v;
+ me._alpha = ( v === 'transparent' ? 0 : 1 );
+ }
+ }
+ },
+
+ /**
+ * Retrieve the value of the color in a format usable by IE natively. This will be the same as
+ * the raw input value, except for rgba values which will be converted to an rgb value.
+ * @param {Element} el The context element, used to get 'currentColor' keyword value.
+ * @return {string} Color value
+ */
+ colorValue: function( el ) {
+ this.parse();
+ return this._color === 'currentColor' ? el.currentStyle.color : this._color;
+ },
+
+ /**
+ * Retrieve the alpha value of the color. Will be 1 for all values except for rgba values
+ * with an alpha component.
+ * @return {number} The alpha value, from 0 to 1.
+ */
+ alpha: function() {
+ this.parse();
+ return this._alpha;
+ }
+ };
+
+
+ /**
+ * Retrieve a PIE.Color instance for the given value. A shared singleton instance is returned for each unique value.
+ * @param {string} val The CSS string representing the color. It is assumed that this will already have
+ * been validated as a valid color syntax.
+ */
+ PIE.getColor = function(val) {
+ return instances[ val ] || ( instances[ val ] = new Color( val ) );
+ };
+
+ return Color;
+})();/**
+ * A tokenizer for CSS value strings.
+ * @constructor
+ * @param {string} css The CSS value string
+ */
+PIE.Tokenizer = (function() {
+ function Tokenizer( css ) {
+ this.css = css;
+ this.ch = 0;
+ this.tokens = [];
+ this.tokenIndex = 0;
+ }
+
+ /**
+ * Enumeration of token type constants.
+ * @enum {number}
+ */
+ var Type = Tokenizer.Type = {
+ ANGLE: 1,
+ CHARACTER: 2,
+ COLOR: 4,
+ DIMEN: 8,
+ FUNCTION: 16,
+ IDENT: 32,
+ LENGTH: 64,
+ NUMBER: 128,
+ OPERATOR: 256,
+ PERCENT: 512,
+ STRING: 1024,
+ URL: 2048
+ };
+
+ /**
+ * A single token
+ * @constructor
+ * @param {number} type The type of the token - see PIE.Tokenizer.Type
+ * @param {string} value The value of the token
+ */
+ Tokenizer.Token = function( type, value ) {
+ this.tokenType = type;
+ this.tokenValue = value;
+ };
+ Tokenizer.Token.prototype = {
+ isLength: function() {
+ return this.tokenType & Type.LENGTH || ( this.tokenType & Type.NUMBER && this.tokenValue === '0' );
+ },
+ isLengthOrPercent: function() {
+ return this.isLength() || this.tokenType & Type.PERCENT;
+ }
+ };
+
+ Tokenizer.prototype = {
+ whitespace: /\s/,
+ number: /^[\+\-]?(\d*\.)?\d+/,
+ url: /^url\(\s*("([^"]*)"|'([^']*)'|([!#$%&*-~]*))\s*\)/i,
+ ident: /^\-?[_a-z][\w-]*/i,
+ string: /^("([^"]*)"|'([^']*)')/,
+ operator: /^[\/,]/,
+ hash: /^#[\w]+/,
+ hashColor: /^#([\da-f]{6}|[\da-f]{3})/i,
+
+ unitTypes: {
+ 'px': Type.LENGTH, 'em': Type.LENGTH, 'ex': Type.LENGTH,
+ 'mm': Type.LENGTH, 'cm': Type.LENGTH, 'in': Type.LENGTH,
+ 'pt': Type.LENGTH, 'pc': Type.LENGTH,
+ 'deg': Type.ANGLE, 'rad': Type.ANGLE, 'grad': Type.ANGLE
+ },
+
+ colorFunctions: {
+ 'rgb': 1, 'rgba': 1, 'hsl': 1, 'hsla': 1
+ },
+
+
+ /**
+ * Advance to and return the next token in the CSS string. If the end of the CSS string has
+ * been reached, null will be returned.
+ * @param {boolean} forget - if true, the token will not be stored for the purposes of backtracking with prev().
+ * @return {PIE.Tokenizer.Token}
+ */
+ next: function( forget ) {
+ var css, ch, firstChar, match, val,
+ me = this;
+
+ function newToken( type, value ) {
+ var tok = new Tokenizer.Token( type, value );
+ if( !forget ) {
+ me.tokens.push( tok );
+ me.tokenIndex++;
+ }
+ return tok;
+ }
+ function failure() {
+ me.tokenIndex++;
+ return null;
+ }
+
+ // In case we previously backed up, return the stored token in the next slot
+ if( this.tokenIndex < this.tokens.length ) {
+ return this.tokens[ this.tokenIndex++ ];
+ }
+
+ // Move past leading whitespace characters
+ while( this.whitespace.test( this.css.charAt( this.ch ) ) ) {
+ this.ch++;
+ }
+ if( this.ch >= this.css.length ) {
+ return failure();
+ }
+
+ ch = this.ch;
+ css = this.css.substring( this.ch );
+ firstChar = css.charAt( 0 );
+ switch( firstChar ) {
+ case '#':
+ if( match = css.match( this.hashColor ) ) {
+ this.ch += match[0].length;
+ return newToken( Type.COLOR, match[0] );
+ }
+ break;
+
+ case '"':
+ case "'":
+ if( match = css.match( this.string ) ) {
+ this.ch += match[0].length;
+ return newToken( Type.STRING, match[2] || match[3] || '' );
+ }
+ break;
+
+ case "/":
+ case ",":
+ this.ch++;
+ return newToken( Type.OPERATOR, firstChar );
+
+ case 'u':
+ if( match = css.match( this.url ) ) {
+ this.ch += match[0].length;
+ return newToken( Type.URL, match[2] || match[3] || match[4] || '' );
+ }
+ }
+
+ // Numbers and values starting with numbers
+ if( match = css.match( this.number ) ) {
+ val = match[0];
+ this.ch += val.length;
+
+ // Check if it is followed by a unit
+ if( css.charAt( val.length ) === '%' ) {
+ this.ch++;
+ return newToken( Type.PERCENT, val + '%' );
+ }
+ if( match = css.substring( val.length ).match( this.ident ) ) {
+ val += match[0];
+ this.ch += match[0].length;
+ return newToken( this.unitTypes[ match[0].toLowerCase() ] || Type.DIMEN, val );
+ }
+
+ // Plain ol' number
+ return newToken( Type.NUMBER, val );
+ }
+
+ // Identifiers
+ if( match = css.match( this.ident ) ) {
+ val = match[0];
+ this.ch += val.length;
+
+ // Named colors
+ if( val.toLowerCase() in PIE.Color.names || val === 'currentColor' || val === 'transparent' ) {
+ return newToken( Type.COLOR, val );
+ }
+
+ // Functions
+ if( css.charAt( val.length ) === '(' ) {
+ this.ch++;
+
+ // Color values in function format: rgb, rgba, hsl, hsla
+ if( val.toLowerCase() in this.colorFunctions ) {
+ function isNum( tok ) {
+ return tok && tok.tokenType & Type.NUMBER;
+ }
+ function isNumOrPct( tok ) {
+ return tok && ( tok.tokenType & ( Type.NUMBER | Type.PERCENT ) );
+ }
+ function isValue( tok, val ) {
+ return tok && tok.tokenValue === val;
+ }
+ function next() {
+ return me.next( 1 );
+ }
+
+ if( ( val.charAt(0) === 'r' ? isNumOrPct( next() ) : isNum( next() ) ) &&
+ isValue( next(), ',' ) &&
+ isNumOrPct( next() ) &&
+ isValue( next(), ',' ) &&
+ isNumOrPct( next() ) &&
+ ( val === 'rgb' || val === 'hsa' || (
+ isValue( next(), ',' ) &&
+ isNum( next() )
+ ) ) &&
+ isValue( next(), ')' ) ) {
+ return newToken( Type.COLOR, this.css.substring( ch, this.ch ) );
+ }
+ return failure();
+ }
+
+ return newToken( Type.FUNCTION, val );
+ }
+
+ // Other identifier
+ return newToken( Type.IDENT, val );
+ }
+
+ // Standalone character
+ this.ch++;
+ return newToken( Type.CHARACTER, firstChar );
+ },
+
+ /**
+ * Determine whether there is another token
+ * @return {boolean}
+ */
+ hasNext: function() {
+ var next = this.next();
+ this.prev();
+ return !!next;
+ },
+
+ /**
+ * Back up and return the previous token
+ * @return {PIE.Tokenizer.Token}
+ */
+ prev: function() {
+ return this.tokens[ this.tokenIndex-- - 2 ];
+ },
+
+ /**
+ * Retrieve all the tokens in the CSS string
+ * @return {Array.<PIE.Tokenizer.Token>}
+ */
+ all: function() {
+ while( this.next() ) {}
+ return this.tokens;
+ },
+
+ /**
+ * Return a list of tokens from the current position until the given function returns
+ * true. The final token will not be included in the list.
+ * @param {function():boolean} func - test function
+ * @param {boolean} require - if true, then if the end of the CSS string is reached
+ * before the test function returns true, null will be returned instead of the
+ * tokens that have been found so far.
+ * @return {Array.<PIE.Tokenizer.Token>}
+ */
+ until: function( func, require ) {
+ var list = [], t, hit;
+ while( t = this.next() ) {
+ if( func( t ) ) {
+ hit = true;
+ this.prev();
+ break;
+ }
+ list.push( t );
+ }
+ return require && !hit ? null : list;
+ }
+ };
+
+ return Tokenizer;
+})();/**
+ * Handles calculating, caching, and detecting changes to size and position of the element.
+ * @constructor
+ * @param {Element} el the target element
+ */
+PIE.BoundsInfo = function( el ) {
+ this.targetElement = el;
+};
+PIE.BoundsInfo.prototype = {
+
+ _locked: 0,
+
+ positionChanged: function() {
+ var last = this._lastBounds,
+ bounds;
+ return !last || ( ( bounds = this.getBounds() ) && ( last.x !== bounds.x || last.y !== bounds.y ) );
+ },
+
+ sizeChanged: function() {
+ var last = this._lastBounds,
+ bounds;
+ return !last || ( ( bounds = this.getBounds() ) && ( last.w !== bounds.w || last.h !== bounds.h ) );
+ },
+
+ getLiveBounds: function() {
+ var el = this.targetElement,
+ rect = el.getBoundingClientRect(),
+ isIE9 = PIE.ieDocMode === 9,
+ isIE7 = PIE.ieVersion === 7,
+ width = rect.right - rect.left;
+ return {
+ x: rect.left,
+ y: rect.top,
+ // In some cases scrolling the page will cause IE9 to report incorrect dimensions
+ // in the rect returned by getBoundingClientRect, so we must query offsetWidth/Height
+ // instead. Also IE7 is inconsistent in using logical vs. device pixels in measurements
+ // so we must calculate the ratio and use it in certain places as a position adjustment.
+ w: isIE9 || isIE7 ? el.offsetWidth : width,
+ h: isIE9 || isIE7 ? el.offsetHeight : rect.bottom - rect.top,
+ logicalZoomRatio: ( isIE7 && width ) ? el.offsetWidth / width : 1
+ };
+ },
+
+ getBounds: function() {
+ return this._locked ?
+ ( this._lockedBounds || ( this._lockedBounds = this.getLiveBounds() ) ) :
+ this.getLiveBounds();
+ },
+
+ hasBeenQueried: function() {
+ return !!this._lastBounds;
+ },
+
+ lock: function() {
+ ++this._locked;
+ },
+
+ unlock: function() {
+ if( !--this._locked ) {
+ if( this._lockedBounds ) this._lastBounds = this._lockedBounds;
+ this._lockedBounds = null;
+ }
+ }
+
+};
+(function() {
+
+function cacheWhenLocked( fn ) {
+ var uid = PIE.Util.getUID( fn );
+ return function() {
+ if( this._locked ) {
+ var cache = this._lockedValues || ( this._lockedValues = {} );
+ return ( uid in cache ) ? cache[ uid ] : ( cache[ uid ] = fn.call( this ) );
+ } else {
+ return fn.call( this );
+ }
+ }
+}
+
+
+PIE.StyleInfoBase = {
+
+ _locked: 0,
+
+ /**
+ * Create a new StyleInfo class, with the standard constructor, and augmented by
+ * the StyleInfoBase's members.
+ * @param proto
+ */
+ newStyleInfo: function( proto ) {
+ function StyleInfo( el ) {
+ this.targetElement = el;
+ this._lastCss = this.getCss();
+ }
+ PIE.Util.merge( StyleInfo.prototype, PIE.StyleInfoBase, proto );
+ StyleInfo._propsCache = {};
+ return StyleInfo;
+ },
+
+ /**
+ * Get an object representation of the target CSS style, caching it for each unique
+ * CSS value string.
+ * @return {Object}
+ */
+ getProps: function() {
+ var css = this.getCss(),
+ cache = this.constructor._propsCache;
+ return css ? ( css in cache ? cache[ css ] : ( cache[ css ] = this.parseCss( css ) ) ) : null;
+ },
+
+ /**
+ * Get the raw CSS value for the target style
+ * @return {string}
+ */
+ getCss: cacheWhenLocked( function() {
+ var el = this.targetElement,
+ ctor = this.constructor,
+ s = el.style,
+ cs = el.currentStyle,
+ cssProp = this.cssProperty,
+ styleProp = this.styleProperty,
+ prefixedCssProp = ctor._prefixedCssProp || ( ctor._prefixedCssProp = PIE.CSS_PREFIX + cssProp ),
+ prefixedStyleProp = ctor._prefixedStyleProp || ( ctor._prefixedStyleProp = PIE.STYLE_PREFIX + styleProp.charAt(0).toUpperCase() + styleProp.substring(1) );
+ return s[ prefixedStyleProp ] || cs.getAttribute( prefixedCssProp ) || s[ styleProp ] || cs.getAttribute( cssProp );
+ } ),
+
+ /**
+ * Determine whether the target CSS style is active.
+ * @return {boolean}
+ */
+ isActive: cacheWhenLocked( function() {
+ return !!this.getProps();
+ } ),
+
+ /**
+ * Determine whether the target CSS style has changed since the last time it was used.
+ * @return {boolean}
+ */
+ changed: cacheWhenLocked( function() {
+ var currentCss = this.getCss(),
+ changed = currentCss !== this._lastCss;
+ this._lastCss = currentCss;
+ return changed;
+ } ),
+
+ cacheWhenLocked: cacheWhenLocked,
+
+ lock: function() {
+ ++this._locked;
+ },
+
+ unlock: function() {
+ if( !--this._locked ) {
+ delete this._lockedValues;
+ }
+ }
+};
+
+})();/**
+ * Handles parsing, caching, and detecting changes to background (and -pie-background) CSS
+ * @constructor
+ * @param {Element} el the target element
+ */
+PIE.BackgroundStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
+
+ cssProperty: PIE.CSS_PREFIX + 'background',
+ styleProperty: PIE.STYLE_PREFIX + 'Background',
+
+ attachIdents: { 'scroll':1, 'fixed':1, 'local':1 },
+ repeatIdents: { 'repeat-x':1, 'repeat-y':1, 'repeat':1, 'no-repeat':1 },
+ originAndClipIdents: { 'padding-box':1, 'border-box':1, 'content-box':1 },
+ positionIdents: { 'top':1, 'right':1, 'bottom':1, 'left':1, 'center':1 },
+ sizeIdents: { 'contain':1, 'cover':1 },
+ propertyNames: {
+ CLIP: 'backgroundClip',
+ COLOR: 'backgroundColor',
+ IMAGE: 'backgroundImage',
+ ORIGIN: 'backgroundOrigin',
+ POSITION: 'backgroundPosition',
+ REPEAT: 'backgroundRepeat',
+ SIZE: 'backgroundSize'
+ },
+
+ /**
+ * For background styles, we support the -pie-background property but fall back to the standard
+ * backround* properties. The reason we have to use the prefixed version is that IE natively
+ * parses the standard properties and if it sees something it doesn't know how to parse, for example
+ * multiple values or gradient definitions, it will throw that away and not make it available through
+ * currentStyle.
+ *
+ * Format of return object:
+ * {
+ * color: <PIE.Color>,
+ * bgImages: [
+ * {
+ * imgType: 'image',
+ * imgUrl: 'image.png',
+ * imgRepeat: <'no-repeat' | 'repeat-x' | 'repeat-y' | 'repeat'>,
+ * bgPosition: <PIE.BgPosition>,
+ * bgAttachment: <'scroll' | 'fixed' | 'local'>,
+ * bgOrigin: <'border-box' | 'padding-box' | 'content-box'>,
+ * bgClip: <'border-box' | 'padding-box'>,
+ * bgSize: <PIE.BgSize>,
+ * origString: 'url(img.png) no-repeat top left'
+ * },
+ * {
+ * imgType: 'linear-gradient',
+ * gradientStart: <PIE.BgPosition>,
+ * angle: <PIE.Angle>,
+ * stops: [
+ * { color: <PIE.Color>, offset: <PIE.Length> },
+ * { color: <PIE.Color>, offset: <PIE.Length> }, ...
+ * ]
+ * }
+ * ]
+ * }
+ * @param {String} css
+ * @override
+ */
+ parseCss: function( css ) {
+ var el = this.targetElement,
+ cs = el.currentStyle,
+ tokenizer, token, image,
+ tok_type = PIE.Tokenizer.Type,
+ type_operator = tok_type.OPERATOR,
+ type_ident = tok_type.IDENT,
+ type_color = tok_type.COLOR,
+ tokType, tokVal,
+ beginCharIndex = 0,
+ positionIdents = this.positionIdents,
+ gradient, stop, width, height,
+ props = { bgImages: [] };
+
+ function isBgPosToken( token ) {
+ return token && token.isLengthOrPercent() || ( token.tokenType & type_ident && token.tokenValue in positionIdents );
+ }
+
+ function sizeToken( token ) {
+ return token && ( ( token.isLengthOrPercent() && PIE.getLength( token.tokenValue ) ) || ( token.tokenValue === 'auto' && 'auto' ) );
+ }
+
+ // If the CSS3-specific -pie-background property is present, parse it
+ if( this.getCss3() ) {
+ tokenizer = new PIE.Tokenizer( css );
+ image = {};
+
+ while( token = tokenizer.next() ) {
+ tokType = token.tokenType;
+ tokVal = token.tokenValue;
+
+ if( !image.imgType && tokType & tok_type.FUNCTION && tokVal === 'linear-gradient' ) {
+ gradient = { stops: [], imgType: tokVal };
+ stop = {};
+ while( token = tokenizer.next() ) {
+ tokType = token.tokenType;
+ tokVal = token.tokenValue;
+
+ // If we reached the end of the function and had at least 2 stops, flush the info
+ if( tokType & tok_type.CHARACTER && tokVal === ')' ) {
+ if( stop.color ) {
+ gradient.stops.push( stop );
+ }
+ if( gradient.stops.length > 1 ) {
+ PIE.Util.merge( image, gradient );
+ }
+ break;
+ }
+
+ // Color stop - must start with color
+ if( tokType & type_color ) {
+ // if we already have an angle/position, make sure that the previous token was a comma
+ if( gradient.angle || gradient.gradientStart ) {
+ token = tokenizer.prev();
+ if( token.tokenType !== type_operator ) {
+ break; //fail
+ }
+ tokenizer.next();
+ }
+
+ stop = {
+ color: PIE.getColor( tokVal )
+ };
+ // check for offset following color
+ token = tokenizer.next();
+ if( token.isLengthOrPercent() ) {
+ stop.offset = PIE.getLength( token.tokenValue );
+ } else {
+ tokenizer.prev();
+ }
+ }
+ // Angle - can only appear in first spot
+ else if( tokType & tok_type.ANGLE && !gradient.angle && !stop.color && !gradient.stops.length ) {
+ gradient.angle = new PIE.Angle( token.tokenValue );
+ }
+ else if( isBgPosToken( token ) && !gradient.gradientStart && !stop.color && !gradient.stops.length ) {
+ tokenizer.prev();
+ gradient.gradientStart = new PIE.BgPosition(
+ tokenizer.until( function( t ) {
+ return !isBgPosToken( t );
+ }, false )
+ );
+ }
+ else if( tokType & type_operator && tokVal === ',' ) {
+ if( stop.color ) {
+ gradient.stops.push( stop );
+ stop = {};
+ }
+ }
+ else {
+ // Found something we didn't recognize; fail without adding image
+ break;
+ }
+ }
+ }
+ else if( !image.imgType && tokType & tok_type.URL ) {
+ image.imgUrl = tokVal;
+ image.imgType = 'image';
+ }
+ else if( isBgPosToken( token ) && !image.bgPosition ) {
+ tokenizer.prev();
+ image.bgPosition = new PIE.BgPosition(
+ tokenizer.until( function( t ) {
+ return !isBgPosToken( t );
+ }, false )
+ );
+ }
+ else if( tokType & type_ident ) {
+ if( tokVal in this.repeatIdents && !image.imgRepeat ) {
+ image.imgRepeat = tokVal;
+ }
+ else if( tokVal in this.originAndClipIdents && !image.bgOrigin ) {
+ image.bgOrigin = tokVal;
+ if( ( token = tokenizer.next() ) && ( token.tokenType & type_ident ) &&
+ token.tokenValue in this.originAndClipIdents ) {
+ image.bgClip = token.tokenValue;
+ } else {
+ image.bgClip = tokVal;
+ tokenizer.prev();
+ }
+ }
+ else if( tokVal in this.attachIdents && !image.bgAttachment ) {
+ image.bgAttachment = tokVal;
+ }
+ else {
+ return null;
+ }
+ }
+ else if( tokType & type_color && !props.color ) {
+ props.color = PIE.getColor( tokVal );
+ }
+ else if( tokType & type_operator && tokVal === '/' && !image.bgSize && image.bgPosition ) {
+ // background size
+ token = tokenizer.next();
+ if( token.tokenType & type_ident && token.tokenValue in this.sizeIdents ) {
+ image.bgSize = new PIE.BgSize( token.tokenValue );
+ }
+ else if( width = sizeToken( token ) ) {
+ height = sizeToken( tokenizer.next() );
+ if ( !height ) {
+ height = width;
+ tokenizer.prev();
+ }
+ image.bgSize = new PIE.BgSize( width, height );
+ }
+ else {
+ return null;
+ }
+ }
+ // new layer
+ else if( tokType & type_operator && tokVal === ',' && image.imgType ) {
+ image.origString = css.substring( beginCharIndex, tokenizer.ch - 1 );
+ beginCharIndex = tokenizer.ch;
+ props.bgImages.push( image );
+ image = {};
+ }
+ else {
+ // Found something unrecognized; chuck everything
+ return null;
+ }
+ }
+
+ // leftovers
+ if( image.imgType ) {
+ image.origString = css.substring( beginCharIndex );
+ props.bgImages.push( image );
+ }
+ }
+
+ // Otherwise, use the standard background properties; let IE give us the values rather than parsing them
+ else {
+ this.withActualBg( PIE.ieDocMode < 9 ?
+ function() {
+ var propNames = this.propertyNames,
+ posX = cs[propNames.POSITION + 'X'],
+ posY = cs[propNames.POSITION + 'Y'],
+ img = cs[propNames.IMAGE],
+ color = cs[propNames.COLOR];
+
+ if( color !== 'transparent' ) {
+ props.color = PIE.getColor( color )
+ }
+ if( img !== 'none' ) {
+ props.bgImages = [ {
+ imgType: 'image',
+ imgUrl: new PIE.Tokenizer( img ).next().tokenValue,
+ imgRepeat: cs[propNames.REPEAT],
+ bgPosition: new PIE.BgPosition( new PIE.Tokenizer( posX + ' ' + posY ).all() )
+ } ];
+ }
+ } :
+ function() {
+ var propNames = this.propertyNames,
+ splitter = /\s*,\s*/,
+ images = cs[propNames.IMAGE].split( splitter ),
+ color = cs[propNames.COLOR],
+ repeats, positions, origins, clips, sizes, i, len, image, sizeParts;
+
+ if( color !== 'transparent' ) {
+ props.color = PIE.getColor( color )
+ }
+
+ len = images.length;
+ if( len && images[0] !== 'none' ) {
+ repeats = cs[propNames.REPEAT].split( splitter );
+ positions = cs[propNames.POSITION].split( splitter );
+ origins = cs[propNames.ORIGIN].split( splitter );
+ clips = cs[propNames.CLIP].split( splitter );
+ sizes = cs[propNames.SIZE].split( splitter );
+
+ props.bgImages = [];
+ for( i = 0; i < len; i++ ) {
+ image = images[ i ];
+ if( image && image !== 'none' ) {
+ sizeParts = sizes[i].split( ' ' );
+ props.bgImages.push( {
+ origString: image + ' ' + repeats[ i ] + ' ' + positions[ i ] + ' / ' + sizes[ i ] + ' ' +
+ origins[ i ] + ' ' + clips[ i ],
+ imgType: 'image',
+ imgUrl: new PIE.Tokenizer( image ).next().tokenValue,
+ imgRepeat: repeats[ i ],
+ bgPosition: new PIE.BgPosition( new PIE.Tokenizer( positions[ i ] ).all() ),
+ bgOrigin: origins[ i ],
+ bgClip: clips[ i ],
+ bgSize: new PIE.BgSize( sizeParts[ 0 ], sizeParts[ 1 ] )
+ } );
+ }
+ }
+ }
+ }
+ );
+ }
+
+ return ( props.color || props.bgImages[0] ) ? props : null;
+ },
+
+ /**
+ * Execute a function with the actual background styles (not overridden with runtimeStyle
+ * properties set by the renderers) available via currentStyle.
+ * @param fn
+ */
+ withActualBg: function( fn ) {
+ var isIE9 = PIE.ieDocMode > 8,
+ propNames = this.propertyNames,
+ rs = this.targetElement.runtimeStyle,
+ rsImage = rs[propNames.IMAGE],
+ rsColor = rs[propNames.COLOR],
+ rsRepeat = rs[propNames.REPEAT],
+ rsClip, rsOrigin, rsSize, rsPosition, ret;
+
+ if( rsImage ) rs[propNames.IMAGE] = '';
+ if( rsColor ) rs[propNames.COLOR] = '';
+ if( rsRepeat ) rs[propNames.REPEAT] = '';
+ if( isIE9 ) {
+ rsClip = rs[propNames.CLIP];
+ rsOrigin = rs[propNames.ORIGIN];
+ rsPosition = rs[propNames.POSITION];
+ rsSize = rs[propNames.SIZE];
+ if( rsClip ) rs[propNames.CLIP] = '';
+ if( rsOrigin ) rs[propNames.ORIGIN] = '';
+ if( rsPosition ) rs[propNames.POSITION] = '';
+ if( rsSize ) rs[propNames.SIZE] = '';
+ }
+
+ ret = fn.call( this );
+
+ if( rsImage ) rs[propNames.IMAGE] = rsImage;
+ if( rsColor ) rs[propNames.COLOR] = rsColor;
+ if( rsRepeat ) rs[propNames.REPEAT] = rsRepeat;
+ if( isIE9 ) {
+ if( rsClip ) rs[propNames.CLIP] = rsClip;
+ if( rsOrigin ) rs[propNames.ORIGIN] = rsOrigin;
+ if( rsPosition ) rs[propNames.POSITION] = rsPosition;
+ if( rsSize ) rs[propNames.SIZE] = rsSize;
+ }
+
+ return ret;
+ },
+
+ getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
+ return this.getCss3() ||
+ this.withActualBg( function() {
+ var cs = this.targetElement.currentStyle,
+ propNames = this.propertyNames;
+ return cs[propNames.COLOR] + ' ' + cs[propNames.IMAGE] + ' ' + cs[propNames.REPEAT] + ' ' +
+ cs[propNames.POSITION + 'X'] + ' ' + cs[propNames.POSITION + 'Y'];
+ } );
+ } ),
+
+ getCss3: PIE.StyleInfoBase.cacheWhenLocked( function() {
+ var el = this.targetElement;
+ return el.style[ this.styleProperty ] || el.currentStyle.getAttribute( this.cssProperty );
+ } ),
+
+ /**
+ * Tests if style.PiePngFix or the -pie-png-fix property is set to true in IE6.
+ */
+ isPngFix: function() {
+ var val = 0, el;
+ if( PIE.ieVersion < 7 ) {
+ el = this.targetElement;
+ val = ( '' + ( el.style[ PIE.STYLE_PREFIX + 'PngFix' ] || el.currentStyle.getAttribute( PIE.CSS_PREFIX + 'png-fix' ) ) === 'true' );
+ }
+ return val;
+ },
+
+ /**
+ * The isActive logic is slightly different, because getProps() always returns an object
+ * even if it is just falling back to the native background properties. But we only want
+ * to report is as being "active" if either the -pie-background override property is present
+ * and parses successfully or '-pie-png-fix' is set to true in IE6.
+ */
+ isActive: PIE.StyleInfoBase.cacheWhenLocked( function() {
+ return (this.getCss3() || this.isPngFix()) && !!this.getProps();
+ } )
+
+} );/**
+ * Handles parsing, caching, and detecting changes to border CSS
+ * @constructor
+ * @param {Element} el the target element
+ */
+PIE.BorderStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
+
+ sides: [ 'Top', 'Right', 'Bottom', 'Left' ],
+ namedWidths: {
+ 'thin': '1px',
+ 'medium': '3px',
+ 'thick': '5px'
+ },
+
+ parseCss: function( css ) {
+ var w = {},
+ s = {},
+ c = {},
+ active = false,
+ colorsSame = true,
+ stylesSame = true,
+ widthsSame = true;
+
+ this.withActualBorder( function() {
+ var el = this.targetElement,
+ cs = el.currentStyle,
+ i = 0,
+ style, color, width, lastStyle, lastColor, lastWidth, side, ltr;
+ for( ; i < 4; i++ ) {
+ side = this.sides[ i ];
+
+ ltr = side.charAt(0).toLowerCase();
+ style = s[ ltr ] = cs[ 'border' + side + 'Style' ];
+ color = cs[ 'border' + side + 'Color' ];
+ width = cs[ 'border' + side + 'Width' ];
+
+ if( i > 0 ) {
+ if( style !== lastStyle ) { stylesSame = false; }
+ if( color !== lastColor ) { colorsSame = false; }
+ if( width !== lastWidth ) { widthsSame = false; }
+ }
+ lastStyle = style;
+ lastColor = color;
+ lastWidth = width;
+
+ c[ ltr ] = PIE.getColor( color );
+
+ width = w[ ltr ] = PIE.getLength( s[ ltr ] === 'none' ? '0' : ( this.namedWidths[ width ] || width ) );
+ if( width.pixels( this.targetElement ) > 0 ) {
+ active = true;
+ }
+ }
+ } );
+
+ return active ? {
+ widths: w,
+ styles: s,
+ colors: c,
+ widthsSame: widthsSame,
+ colorsSame: colorsSame,
+ stylesSame: stylesSame
+ } : null;
+ },
+
+ getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
+ var el = this.targetElement,
+ cs = el.currentStyle,
+ css;
+
+ // Don't redraw or hide borders for cells in border-collapse:collapse tables
+ if( !( el.tagName in PIE.tableCellTags && el.offsetParent.currentStyle.borderCollapse === 'collapse' ) ) {
+ this.withActualBorder( function() {
+ css = cs.borderWidth + '|' + cs.borderStyle + '|' + cs.borderColor;
+ } );
+ }
+ return css;
+ } ),
+
+ /**
+ * Execute a function with the actual border styles (not overridden with runtimeStyle
+ * properties set by the renderers) available via currentStyle.
+ * @param fn
+ */
+ withActualBorder: function( fn ) {
+ var rs = this.targetElement.runtimeStyle,
+ rsWidth = rs.borderWidth,
+ rsColor = rs.borderColor,
+ ret;
+
+ if( rsWidth ) rs.borderWidth = '';
+ if( rsColor ) rs.borderColor = '';
+
+ ret = fn.call( this );
+
+ if( rsWidth ) rs.borderWidth = rsWidth;
+ if( rsColor ) rs.borderColor = rsColor;
+
+ return ret;
+ }
+
+} );
+/**
+ * Handles parsing, caching, and detecting changes to border-radius CSS
+ * @constructor
+ * @param {Element} el the target element
+ */
+(function() {
+
+PIE.BorderRadiusStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
+
+ cssProperty: 'border-radius',
+ styleProperty: 'borderRadius',
+
+ parseCss: function( css ) {
+ var p = null, x, y,
+ tokenizer, token, length,
+ hasNonZero = false;
+
+ if( css ) {
+ tokenizer = new PIE.Tokenizer( css );
+
+ function collectLengths() {
+ var arr = [], num;
+ while( ( token = tokenizer.next() ) && token.isLengthOrPercent() ) {
+ length = PIE.getLength( token.tokenValue );
+ num = length.getNumber();
+ if( num < 0 ) {
+ return null;
+ }
+ if( num > 0 ) {
+ hasNonZero = true;
+ }
+ arr.push( length );
+ }
+ return arr.length > 0 && arr.length < 5 ? {
+ 'tl': arr[0],
+ 'tr': arr[1] || arr[0],
+ 'br': arr[2] || arr[0],
+ 'bl': arr[3] || arr[1] || arr[0]
+ } : null;
+ }
+
+ // Grab the initial sequence of lengths
+ if( x = collectLengths() ) {
+ // See if there is a slash followed by more lengths, for the y-axis radii
+ if( token ) {
+ if( token.tokenType & PIE.Tokenizer.Type.OPERATOR && token.tokenValue === '/' ) {
+ y = collectLengths();
+ }
+ } else {
+ y = x;
+ }
+
+ // Treat all-zero values the same as no value
+ if( hasNonZero && x && y ) {
+ p = { x: x, y : y };
+ }
+ }
+ }
+
+ return p;
+ }
+} );
+
+var zero = PIE.getLength( '0' ),
+ zeros = { 'tl': zero, 'tr': zero, 'br': zero, 'bl': zero };
+PIE.BorderRadiusStyleInfo.ALL_ZERO = { x: zeros, y: zeros };
+
+})();/**
+ * Handles parsing, caching, and detecting changes to border-image CSS
+ * @constructor
+ * @param {Element} el the target element
+ */
+PIE.BorderImageStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
+
+ cssProperty: 'border-image',
+ styleProperty: 'borderImage',
+
+ repeatIdents: { 'stretch':1, 'round':1, 'repeat':1, 'space':1 },
+
+ parseCss: function( css ) {
+ var p = null, tokenizer, token, type, value,
+ slices, widths, outsets,
+ slashCount = 0,
+ Type = PIE.Tokenizer.Type,
+ IDENT = Type.IDENT,
+ NUMBER = Type.NUMBER,
+ PERCENT = Type.PERCENT;
+
+ if( css ) {
+ tokenizer = new PIE.Tokenizer( css );
+ p = {};
+
+ function isSlash( token ) {
+ return token && ( token.tokenType & Type.OPERATOR ) && ( token.tokenValue === '/' );
+ }
+
+ function isFillIdent( token ) {
+ return token && ( token.tokenType & IDENT ) && ( token.tokenValue === 'fill' );
+ }
+
+ function collectSlicesEtc() {
+ slices = tokenizer.until( function( tok ) {
+ return !( tok.tokenType & ( NUMBER | PERCENT ) );
+ } );
+
+ if( isFillIdent( tokenizer.next() ) && !p.fill ) {
+ p.fill = true;
+ } else {
+ tokenizer.prev();
+ }
+
+ if( isSlash( tokenizer.next() ) ) {
+ slashCount++;
+ widths = tokenizer.until( function( token ) {
+ return !token.isLengthOrPercent() && !( ( token.tokenType & IDENT ) && token.tokenValue === 'auto' );
+ } );
+
+ if( isSlash( tokenizer.next() ) ) {
+ slashCount++;
+ outsets = tokenizer.until( function( token ) {
+ return !token.isLength();
+ } );
+ }
+ } else {
+ tokenizer.prev();
+ }
+ }
+
+ while( token = tokenizer.next() ) {
+ type = token.tokenType;
+ value = token.tokenValue;
+
+ // Numbers and/or 'fill' keyword: slice values. May be followed optionally by width values, followed optionally by outset values
+ if( type & ( NUMBER | PERCENT ) && !slices ) {
+ tokenizer.prev();
+ collectSlicesEtc();
+ }
+ else if( isFillIdent( token ) && !p.fill ) {
+ p.fill = true;
+ collectSlicesEtc();
+ }
+
+ // Idents: one or values for 'repeat'
+ else if( ( type & IDENT ) && this.repeatIdents[value] && !p.repeat ) {
+ p.repeat = { h: value };
+ if( token = tokenizer.next() ) {
+ if( ( token.tokenType & IDENT ) && this.repeatIdents[token.tokenValue] ) {
+ p.repeat.v = token.tokenValue;
+ } else {
+ tokenizer.prev();
+ }
+ }
+ }
+
+ // URL of the image
+ else if( ( type & Type.URL ) && !p.src ) {
+ p.src = value;
+ }
+
+ // Found something unrecognized; exit.
+ else {
+ return null;
+ }
+ }
+
+ // Validate what we collected
+ if( !p.src || !slices || slices.length < 1 || slices.length > 4 ||
+ ( widths && widths.length > 4 ) || ( slashCount === 1 && widths.length < 1 ) ||
+ ( outsets && outsets.length > 4 ) || ( slashCount === 2 && outsets.length < 1 ) ) {
+ return null;
+ }
+
+ // Fill in missing values
+ if( !p.repeat ) {
+ p.repeat = { h: 'stretch' };
+ }
+ if( !p.repeat.v ) {
+ p.repeat.v = p.repeat.h;
+ }
+
+ function distributeSides( tokens, convertFn ) {
+ return {
+ 't': convertFn( tokens[0] ),
+ 'r': convertFn( tokens[1] || tokens[0] ),
+ 'b': convertFn( tokens[2] || tokens[0] ),
+ 'l': convertFn( tokens[3] || tokens[1] || tokens[0] )
+ };
+ }
+
+ p.slice = distributeSides( slices, function( tok ) {
+ return PIE.getLength( ( tok.tokenType & NUMBER ) ? tok.tokenValue + 'px' : tok.tokenValue );
+ } );
+
+ if( widths && widths[0] ) {
+ p.widths = distributeSides( widths, function( tok ) {
+ return tok.isLengthOrPercent() ? PIE.getLength( tok.tokenValue ) : tok.tokenValue;
+ } );
+ }
+
+ if( outsets && outsets[0] ) {
+ p.outset = distributeSides( outsets, function( tok ) {
+ return tok.isLength() ? PIE.getLength( tok.tokenValue ) : tok.tokenValue;
+ } );
+ }
+ }
+
+ return p;
+ }
+
+} );/**
+ * Handles parsing, caching, and detecting changes to box-shadow CSS
+ * @constructor
+ * @param {Element} el the target element
+ */
+PIE.BoxShadowStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
+
+ cssProperty: 'box-shadow',
+ styleProperty: 'boxShadow',
+
+ parseCss: function( css ) {
+ var props,
+ getLength = PIE.getLength,
+ Type = PIE.Tokenizer.Type,
+ tokenizer;
+
+ if( css ) {
+ tokenizer = new PIE.Tokenizer( css );
+ props = { outset: [], inset: [] };
+
+ function parseItem() {
+ var token, type, value, color, lengths, inset, len;
+
+ while( token = tokenizer.next() ) {
+ value = token.tokenValue;
+ type = token.tokenType;
+
+ if( type & Type.OPERATOR && value === ',' ) {
+ break;
+ }
+ else if( token.isLength() && !lengths ) {
+ tokenizer.prev();
+ lengths = tokenizer.until( function( token ) {
+ return !token.isLength();
+ } );
+ }
+ else if( type & Type.COLOR && !color ) {
+ color = value;
+ }
+ else if( type & Type.IDENT && value === 'inset' && !inset ) {
+ inset = true;
+ }
+ else { //encountered an unrecognized token; fail.
+ return false;
+ }
+ }
+
+ len = lengths && lengths.length;
+ if( len > 1 && len < 5 ) {
+ ( inset ? props.inset : props.outset ).push( {
+ xOffset: getLength( lengths[0].tokenValue ),
+ yOffset: getLength( lengths[1].tokenValue ),
+ blur: getLength( lengths[2] ? lengths[2].tokenValue : '0' ),
+ spread: getLength( lengths[3] ? lengths[3].tokenValue : '0' ),
+ color: PIE.getColor( color || 'currentColor' )
+ } );
+ return true;
+ }
+ return false;
+ }
+
+ while( parseItem() ) {}
+ }
+
+ return props && ( props.inset.length || props.outset.length ) ? props : null;
+ }
+} );
+/**
+ * Retrieves the state of the element's visibility and display
+ * @constructor
+ * @param {Element} el the target element
+ */
+PIE.VisibilityStyleInfo = PIE.StyleInfoBase.newStyleInfo( {
+
+ getCss: PIE.StyleInfoBase.cacheWhenLocked( function() {
+ var cs = this.targetElement.currentStyle;
+ return cs.visibility + '|' + cs.display;
+ } ),
+
+ parseCss: function() {
+ var el = this.targetElement,
+ rs = el.runtimeStyle,
+ cs = el.currentStyle,
+ rsVis = rs.visibility,
+ csVis;
+
+ rs.visibility = '';
+ csVis = cs.visibility;
+ rs.visibility = rsVis;
+
+ return {
+ visible: csVis !== 'hidden',
+ displayed: cs.display !== 'none'
+ }
+ },
+
+ /**
+ * Always return false for isActive, since this property alone will not trigger
+ * a renderer to do anything.
+ */
+ isActive: function() {
+ return false;
+ }
+
+} );
+PIE.RendererBase = {
+
+ /**
+ * Create a new Renderer class, with the standard constructor, and augmented by
+ * the RendererBase's members.
+ * @param proto
+ */
+ newRenderer: function( proto ) {
+ function Renderer( el, boundsInfo, styleInfos, parent ) {
+ this.targetElement = el;
+ this.boundsInfo = boundsInfo;
+ this.styleInfos = styleInfos;
+ this.parent = parent;
+ }
+ PIE.Util.merge( Renderer.prototype, PIE.RendererBase, proto );
+ return Renderer;
+ },
+
+ /**
+ * Flag indicating the element has already been positioned at least once.
+ * @type {boolean}
+ */
+ isPositioned: false,
+
+ /**
+ * Determine if the renderer needs to be updated
+ * @return {boolean}
+ */
+ needsUpdate: function() {
+ return false;
+ },
+
+ /**
+ * Run any preparation logic that would affect the main update logic of this
+ * renderer or any of the other renderers, e.g. things that might affect the
+ * element's size or style properties.
+ */
+ prepareUpdate: PIE.emptyFn,
+
+ /**
+ * Tell the renderer to update based on modified properties
+ */
+ updateProps: function() {
+ this.destroy();
+ if( this.isActive() ) {
+ this.draw();
+ }
+ },
+
+ /**
+ * Tell the renderer to update based on modified element position
+ */
+ updatePos: function() {
+ this.isPositioned = true;
+ },
+
+ /**
+ * Tell the renderer to update based on modified element dimensions
+ */
+ updateSize: function() {
+ if( this.isActive() ) {
+ this.draw();
+ } else {
+ this.destroy();
+ }
+ },
+
+
+ /**
+ * Add a layer element, with the given z-order index, to the renderer's main box element. We can't use
+ * z-index because that breaks when the root rendering box's z-index is 'auto' in IE8+ standards mode.
+ * So instead we make sure they are inserted into the DOM in the correct order.
+ * @param {number} index
+ * @param {Element} el
+ */
+ addLayer: function( index, el ) {
+ this.removeLayer( index );
+ for( var layers = this._layers || ( this._layers = [] ), i = index + 1, len = layers.length, layer; i < len; i++ ) {
+ layer = layers[i];
+ if( layer ) {
+ break;
+ }
+ }
+ layers[index] = el;
+ this.getBox().insertBefore( el, layer || null );
+ },
+
+ /**
+ * Retrieve a layer element by its index, or null if not present
+ * @param {number} index
+ * @return {Element}
+ */
+ getLayer: function( index ) {
+ var layers = this._layers;
+ return layers && layers[index] || null;
+ },
+
+ /**
+ * Remove a layer element by its index
+ * @param {number} index
+ */
+ removeLayer: function( index ) {
+ var layer = this.getLayer( index ),
+ box = this._box;
+ if( layer && box ) {
+ box.removeChild( layer );
+ this._layers[index] = null;
+ }
+ },
+
+
+ /**
+ * Get a VML shape by name, creating it if necessary.
+ * @param {string} name A name identifying the element
+ * @param {string=} subElName If specified a subelement of the shape will be created with this tag name
+ * @param {Element} parent The parent element for the shape; will be ignored if 'group' is specified
+ * @param {number=} group If specified, an ordinal group for the shape. 1 or greater. Groups are rendered
+ * using container elements in the correct order, to get correct z stacking without z-index.
+ */
+ getShape: function( name, subElName, parent, group ) {
+ var shapes = this._shapes || ( this._shapes = {} ),
+ shape = shapes[ name ],
+ s;
+
+ if( !shape ) {
+ shape = shapes[ name ] = PIE.Util.createVmlElement( 'shape' );
+ if( subElName ) {
+ shape.appendChild( shape[ subElName ] = PIE.Util.createVmlElement( subElName ) );
+ }
+
+ if( group ) {
+ parent = this.getLayer( group );
+ if( !parent ) {
+ this.addLayer( group, doc.createElement( 'group' + group ) );
+ parent = this.getLayer( group );
+ }
+ }
+
+ parent.appendChild( shape );
+
+ s = shape.style;
+ s.position = 'absolute';
+ s.left = s.top = 0;
+ s['behavior'] = 'url(#default#VML)';
+ }
+ return shape;
+ },
+
+ /**
+ * Delete a named shape which was created by getShape(). Returns true if a shape with the
+ * given name was found and deleted, or false if there was no shape of that name.
+ * @param {string} name
+ * @return {boolean}
+ */
+ deleteShape: function( name ) {
+ var shapes = this._shapes,
+ shape = shapes && shapes[ name ];
+ if( shape ) {
+ shape.parentNode.removeChild( shape );
+ delete shapes[ name ];
+ }
+ return !!shape;
+ },
+
+
+ /**
+ * For a given set of border radius length/percentage values, convert them to concrete pixel
+ * values based on the current size of the target element.
+ * @param {Object} radii
+ * @return {Object}
+ */
+ getRadiiPixels: function( radii ) {
+ var el = this.targetElement,
+ bounds = this.boundsInfo.getBounds(),
+ w = bounds.w,
+ h = bounds.h,
+ tlX, tlY, trX, trY, brX, brY, blX, blY, f;
+
+ tlX = radii.x['tl'].pixels( el, w );
+ tlY = radii.y['tl'].pixels( el, h );
+ trX = radii.x['tr'].pixels( el, w );
+ trY = radii.y['tr'].pixels( el, h );
+ brX = radii.x['br'].pixels( el, w );
+ brY = radii.y['br'].pixels( el, h );
+ blX = radii.x['bl'].pixels( el, w );
+ blY = radii.y['bl'].pixels( el, h );
+
+ // If any corner ellipses overlap, reduce them all by the appropriate factor. This formula
+ // is taken straight from the CSS3 Backgrounds and Borders spec.
+ f = Math.min(
+ w / ( tlX + trX ),
+ h / ( trY + brY ),
+ w / ( blX + brX ),
+ h / ( tlY + blY )
+ );
+ if( f < 1 ) {
+ tlX *= f;
+ tlY *= f;
+ trX *= f;
+ trY *= f;
+ brX *= f;
+ brY *= f;
+ blX *= f;
+ blY *= f;
+ }
+
+ return {
+ x: {
+ 'tl': tlX,
+ 'tr': trX,
+ 'br': brX,
+ 'bl': blX
+ },
+ y: {
+ 'tl': tlY,
+ 'tr': trY,
+ 'br': brY,
+ 'bl': blY
+ }
+ }
+ },
+
+ /**
+ * Return the VML path string for the element's background box, with corners rounded.
+ * @param {Object.<{t:number, r:number, b:number, l:number}>} shrink - if present, specifies number of
+ * pixels to shrink the box path inward from the element's four sides.
+ * @param {number=} mult If specified, all coordinates will be multiplied by this number
+ * @param {Object=} radii If specified, this will be used for the corner radii instead of the properties
+ * from this renderer's borderRadiusInfo object.
+ * @return {string} the VML path
+ */
+ getBoxPath: function( shrink, mult, radii ) {
+ mult = mult || 1;
+
+ var r, str,
+ bounds = this.boundsInfo.getBounds(),
+ w = bounds.w * mult,
+ h = bounds.h * mult,
+ radInfo = this.styleInfos.borderRadiusInfo,
+ floor = Math.floor, ceil = Math.ceil,
+ shrinkT = shrink ? shrink.t * mult : 0,
+ shrinkR = shrink ? shrink.r * mult : 0,
+ shrinkB = shrink ? shrink.b * mult : 0,
+ shrinkL = shrink ? shrink.l * mult : 0,
+ tlX, tlY, trX, trY, brX, brY, blX, blY;
+
+ if( radii || radInfo.isActive() ) {
+ r = this.getRadiiPixels( radii || radInfo.getProps() );
+
+ tlX = r.x['tl'] * mult;
+ tlY = r.y['tl'] * mult;
+ trX = r.x['tr'] * mult;
+ trY = r.y['tr'] * mult;
+ brX = r.x['br'] * mult;
+ brY = r.y['br'] * mult;
+ blX = r.x['bl'] * mult;
+ blY = r.y['bl'] * mult;
+
+ str = 'm' + floor( shrinkL ) + ',' + floor( tlY ) +
+ 'qy' + floor( tlX ) + ',' + floor( shrinkT ) +
+ 'l' + ceil( w - trX ) + ',' + floor( shrinkT ) +
+ 'qx' + ceil( w - shrinkR ) + ',' + floor( trY ) +
+ 'l' + ceil( w - shrinkR ) + ',' + ceil( h - brY ) +
+ 'qy' + ceil( w - brX ) + ',' + ceil( h - shrinkB ) +
+ 'l' + floor( blX ) + ',' + ceil( h - shrinkB ) +
+ 'qx' + floor( shrinkL ) + ',' + ceil( h - blY ) + ' x e';
+ } else {
+ // simplified path for non-rounded box
+ str = 'm' + floor( shrinkL ) + ',' + floor( shrinkT ) +
+ 'l' + ceil( w - shrinkR ) + ',' + floor( shrinkT ) +
+ 'l' + ceil( w - shrinkR ) + ',' + ceil( h - shrinkB ) +
+ 'l' + floor( shrinkL ) + ',' + ceil( h - shrinkB ) +
+ 'xe';
+ }
+ return str;
+ },
+
+
+ /**
+ * Get the container element for the shapes, creating it if necessary.
+ */
+ getBox: function() {
+ var box = this.parent.getLayer( this.boxZIndex ), s;
+
+ if( !box ) {
+ box = doc.createElement( this.boxName );
+ s = box.style;
+ s.position = 'absolute';
+ s.top = s.left = 0;
+ this.parent.addLayer( this.boxZIndex, box );
+ }
+
+ return box;
+ },
+
+
+ /**
+ * Hide the actual border of the element. In IE7 and up we can just set its color to transparent;
+ * however IE6 does not support transparent borders so we have to get tricky with it. Also, some elements
+ * like form buttons require removing the border width altogether, so for those we increase the padding
+ * by the border size.
+ */
+ hideBorder: function() {
+ var el = this.targetElement,
+ cs = el.currentStyle,
+ rs = el.runtimeStyle,
+ tag = el.tagName,
+ isIE6 = PIE.ieVersion === 6,
+ sides, side, i;
+
+ if( ( isIE6 && ( tag in PIE.childlessElements || tag === 'FIELDSET' ) ) ||
+ tag === 'BUTTON' || ( tag === 'INPUT' && el.type in PIE.inputButtonTypes ) ) {
+ rs.borderWidth = '';
+ sides = this.styleInfos.borderInfo.sides;
+ for( i = sides.length; i--; ) {
+ side = sides[ i ];
+ rs[ 'padding' + side ] = '';
+ rs[ 'padding' + side ] = ( PIE.getLength( cs[ 'padding' + side ] ) ).pixels( el ) +
+ ( PIE.getLength( cs[ 'border' + side + 'Width' ] ) ).pixels( el ) +
+ ( PIE.ieVersion !== 8 && i % 2 ? 1 : 0 ); //needs an extra horizontal pixel to counteract the extra "inner border" going away
+ }
+ rs.borderWidth = 0;
+ }
+ else if( isIE6 ) {
+ // Wrap all the element's children in a custom element, set the element to visiblity:hidden,
+ // and set the wrapper element to visiblity:visible. This hides the outer element's decorations
+ // (background and border) but displays all the contents.
+ // TODO find a better way to do this that doesn't mess up the DOM parent-child relationship,
+ // as this can interfere with other author scripts which add/modify/delete children. Also, this
+ // won't work for elements which cannot take children, e.g. input/button/textarea/img/etc. Look into
+ // using a compositor filter or some other filter which masks the border.
+ if( el.childNodes.length !== 1 || el.firstChild.tagName !== 'ie6-mask' ) {
+ var cont = doc.createElement( 'ie6-mask' ),
+ s = cont.style, child;
+ s.visibility = 'visible';
+ s.zoom = 1;
+ while( child = el.firstChild ) {
+ cont.appendChild( child );
+ }
+ el.appendChild( cont );
+ rs.visibility = 'hidden';
+ }
+ }
+ else {
+ rs.borderColor = 'transparent';
+ }
+ },
+
+ unhideBorder: function() {
+
+ },
+
+
+ /**
+ * Destroy the rendered objects. This is a base implementation which handles common renderer
+ * structures, but individual renderers may override as necessary.
+ */
+ destroy: function() {
+ this.parent.removeLayer( this.boxZIndex );
+ delete this._shapes;
+ delete this._layers;
+ }
+};
+/**
+ * Root renderer; creates the outermost container element and handles keeping it aligned
+ * with the target element's size and position.
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ */
+PIE.RootRenderer = PIE.RendererBase.newRenderer( {
+
+ isActive: function() {
+ var children = this.childRenderers;
+ for( var i in children ) {
+ if( children.hasOwnProperty( i ) && children[ i ].isActive() ) {
+ return true;
+ }
+ }
+ return false;
+ },
+
+ needsUpdate: function() {
+ return this.styleInfos.visibilityInfo.changed();
+ },
+
+ updatePos: function() {
+ if( this.isActive() ) {
+ var el = this.getPositioningElement(),
+ par = el,
+ docEl,
+ parRect,
+ tgtCS = el.currentStyle,
+ tgtPos = tgtCS.position,
+ boxPos,
+ s = this.getBox().style, cs,
+ x = 0, y = 0,
+ elBounds = this.boundsInfo.getBounds(),
+ logicalZoomRatio = elBounds.logicalZoomRatio;
+
+ if( tgtPos === 'fixed' && PIE.ieVersion > 6 ) {
+ x = elBounds.x * logicalZoomRatio;
+ y = elBounds.y * logicalZoomRatio;
+ boxPos = tgtPos;
+ } else {
+ // Get the element's offsets from its nearest positioned ancestor. Uses
+ // getBoundingClientRect for accuracy and speed.
+ do {
+ par = par.offsetParent;
+ } while( par && ( par.currentStyle.position === 'static' ) );
+ if( par ) {
+ parRect = par.getBoundingClientRect();
+ cs = par.currentStyle;
+ x = ( elBounds.x - parRect.left ) * logicalZoomRatio - ( parseFloat(cs.borderLeftWidth) || 0 );
+ y = ( elBounds.y - parRect.top ) * logicalZoomRatio - ( parseFloat(cs.borderTopWidth) || 0 );
+ } else {
+ docEl = doc.documentElement;
+ x = ( elBounds.x + docEl.scrollLeft - docEl.clientLeft ) * logicalZoomRatio;
+ y = ( elBounds.y + docEl.scrollTop - docEl.clientTop ) * logicalZoomRatio;
+ }
+ boxPos = 'absolute';
+ }
+
+ s.position = boxPos;
+ s.left = x;
+ s.top = y;
+ s.zIndex = tgtPos === 'static' ? -1 : tgtCS.zIndex;
+ this.isPositioned = true;
+ }
+ },
+
+ updateSize: PIE.emptyFn,
+
+ updateVisibility: function() {
+ var vis = this.styleInfos.visibilityInfo.getProps();
+ this.getBox().style.display = ( vis.visible && vis.displayed ) ? '' : 'none';
+ },
+
+ updateProps: function() {
+ if( this.isActive() ) {
+ this.updateVisibility();
+ } else {
+ this.destroy();
+ }
+ },
+
+ getPositioningElement: function() {
+ var el = this.targetElement;
+ return el.tagName in PIE.tableCellTags ? el.offsetParent : el;
+ },
+
+ getBox: function() {
+ var box = this._box, el;
+ if( !box ) {
+ el = this.getPositioningElement();
+ box = this._box = doc.createElement( 'css3-container' );
+ box.style['direction'] = 'ltr'; //fix positioning bug in rtl environments
+
+ this.updateVisibility();
+
+ el.parentNode.insertBefore( box, el );
+ }
+ return box;
+ },
+
+ finishUpdate: PIE.emptyFn,
+
+ destroy: function() {
+ var box = this._box, par;
+ if( box && ( par = box.parentNode ) ) {
+ par.removeChild( box );
+ }
+ delete this._box;
+ delete this._layers;
+ }
+
+} );
+/**
+ * Renderer for element backgrounds.
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ * @param {PIE.RootRenderer} parent
+ */
+PIE.BackgroundRenderer = PIE.RendererBase.newRenderer( {
+
+ boxZIndex: 2,
+ boxName: 'background',
+
+ needsUpdate: function() {
+ var si = this.styleInfos;
+ return si.backgroundInfo.changed() || si.borderRadiusInfo.changed();
+ },
+
+ isActive: function() {
+ var si = this.styleInfos;
+ return si.borderImageInfo.isActive() ||
+ si.borderRadiusInfo.isActive() ||
+ si.backgroundInfo.isActive() ||
+ ( si.boxShadowInfo.isActive() && si.boxShadowInfo.getProps().inset );
+ },
+
+ /**
+ * Draw the shapes
+ */
+ draw: function() {
+ var bounds = this.boundsInfo.getBounds();
+ if( bounds.w && bounds.h ) {
+ this.drawBgColor();
+ this.drawBgImages();
+ }
+ },
+
+ /**
+ * Draw the background color shape
+ */
+ drawBgColor: function() {
+ var props = this.styleInfos.backgroundInfo.getProps(),
+ bounds = this.boundsInfo.getBounds(),
+ el = this.targetElement,
+ color = props && props.color,
+ shape, w, h, s, alpha;
+
+ if( color && color.alpha() > 0 ) {
+ this.hideBackground();
+
+ shape = this.getShape( 'bgColor', 'fill', this.getBox(), 1 );
+ w = bounds.w;
+ h = bounds.h;
+ shape.stroked = false;
+ shape.coordsize = w * 2 + ',' + h * 2;
+ shape.coordorigin = '1,1';
+ shape.path = this.getBoxPath( null, 2 );
+ s = shape.style;
+ s.width = w;
+ s.height = h;
+ shape.fill.color = color.colorValue( el );
+
+ alpha = color.alpha();
+ if( alpha < 1 ) {
+ shape.fill.opacity = alpha;
+ }
+ } else {
+ this.deleteShape( 'bgColor' );
+ }
+ },
+
+ /**
+ * Draw all the background image layers
+ */
+ drawBgImages: function() {
+ var props = this.styleInfos.backgroundInfo.getProps(),
+ bounds = this.boundsInfo.getBounds(),
+ images = props && props.bgImages,
+ img, shape, w, h, s, i;
+
+ if( images ) {
+ this.hideBackground();
+
+ w = bounds.w;
+ h = bounds.h;
+
+ i = images.length;
+ while( i-- ) {
+ img = images[i];
+ shape = this.getShape( 'bgImage' + i, 'fill', this.getBox(), 2 );
+
+ shape.stroked = false;
+ shape.fill.type = 'tile';
+ shape.fillcolor = 'none';
+ shape.coordsize = w * 2 + ',' + h * 2;
+ shape.coordorigin = '1,1';
+ shape.path = this.getBoxPath( 0, 2 );
+ s = shape.style;
+ s.width = w;
+ s.height = h;
+
+ if( img.imgType === 'linear-gradient' ) {
+ this.addLinearGradient( shape, img );
+ }
+ else {
+ shape.fill.src = img.imgUrl;
+ this.positionBgImage( shape, i );
+ }
+ }
+ }
+
+ // Delete any bgImage shapes previously created which weren't used above
+ i = images ? images.length : 0;
+ while( this.deleteShape( 'bgImage' + i++ ) ) {}
+ },
+
+
+ /**
+ * Set the position and clipping of the background image for a layer
+ * @param {Element} shape
+ * @param {number} index
+ */
+ positionBgImage: function( shape, index ) {
+ var me = this;
+ PIE.Util.withImageSize( shape.fill.src, function( size ) {
+ var el = me.targetElement,
+ bounds = me.boundsInfo.getBounds(),
+ elW = bounds.w,
+ elH = bounds.h;
+
+ // It's possible that the element dimensions are zero now but weren't when the original
+ // update executed, make sure that's not the case to avoid divide-by-zero error
+ if( elW && elH ) {
+ var fill = shape.fill,
+ si = me.styleInfos,
+ border = si.borderInfo.getProps(),
+ bw = border && border.widths,
+ bwT = bw ? bw['t'].pixels( el ) : 0,
+ bwR = bw ? bw['r'].pixels( el ) : 0,
+ bwB = bw ? bw['b'].pixels( el ) : 0,
+ bwL = bw ? bw['l'].pixels( el ) : 0,
+ bg = si.backgroundInfo.getProps().bgImages[ index ],
+ bgPos = bg.bgPosition ? bg.bgPosition.coords( el, elW - size.w - bwL - bwR, elH - size.h - bwT - bwB ) : { x:0, y:0 },
+ repeat = bg.imgRepeat,
+ pxX, pxY,
+ clipT = 0, clipL = 0,
+ clipR = elW + 1, clipB = elH + 1, //make sure the default clip region is not inside the box (by a subpixel)
+ clipAdjust = PIE.ieVersion === 8 ? 0 : 1; //prior to IE8 requires 1 extra pixel in the image clip region
+
+ // Positioning - find the pixel offset from the top/left and convert to a ratio
+ // The position is shifted by half a pixel, to adjust for the half-pixel coordorigin shift which is
+ // needed to fix antialiasing but makes the bg image fuzzy.
+ pxX = Math.round( bgPos.x ) + bwL + 0.5;
+ pxY = Math.round( bgPos.y ) + bwT + 0.5;
+ fill.position = ( pxX / elW ) + ',' + ( pxY / elH );
+
+ // Set the size of the image. We have to actually set it to px values otherwise it will not honor
+ // the user's browser zoom level and always display at its natural screen size.
+ fill['size']['x'] = 1; //Can be any value, just has to be set to "prime" it so the next line works. Weird!
+ fill['size'] = size.w + 'px,' + size.h + 'px';
+
+ // Repeating - clip the image shape
+ if( repeat && repeat !== 'repeat' ) {
+ if( repeat === 'repeat-x' || repeat === 'no-repeat' ) {
+ clipT = pxY + 1;
+ clipB = pxY + size.h + clipAdjust;
+ }
+ if( repeat === 'repeat-y' || repeat === 'no-repeat' ) {
+ clipL = pxX + 1;
+ clipR = pxX + size.w + clipAdjust;
+ }
+ shape.style.clip = 'rect(' + clipT + 'px,' + clipR + 'px,' + clipB + 'px,' + clipL + 'px)';
+ }
+ }
+ } );
+ },
+
+
+ /**
+ * Draw the linear gradient for a gradient layer
+ * @param {Element} shape
+ * @param {Object} info The object holding the information about the gradient
+ */
+ addLinearGradient: function( shape, info ) {
+ var el = this.targetElement,
+ bounds = this.boundsInfo.getBounds(),
+ w = bounds.w,
+ h = bounds.h,
+ fill = shape.fill,
+ stops = info.stops,
+ stopCount = stops.length,
+ PI = Math.PI,
+ GradientUtil = PIE.GradientUtil,
+ perpendicularIntersect = GradientUtil.perpendicularIntersect,
+ distance = GradientUtil.distance,
+ metrics = GradientUtil.getGradientMetrics( el, w, h, info ),
+ angle = metrics.angle,
+ startX = metrics.startX,
+ startY = metrics.startY,
+ startCornerX = metrics.startCornerX,
+ startCornerY = metrics.startCornerY,
+ endCornerX = metrics.endCornerX,
+ endCornerY = metrics.endCornerY,
+ deltaX = metrics.deltaX,
+ deltaY = metrics.deltaY,
+ lineLength = metrics.lineLength,
+ vmlAngle, vmlGradientLength, vmlColors,
+ stopPx, vmlOffsetPct,
+ p, i, j, before, after;
+
+ // In VML land, the angle of the rendered gradient depends on the aspect ratio of the shape's
+ // bounding box; for example specifying a 45 deg angle actually results in a gradient
+ // drawn diagonally from one corner to its opposite corner, which will only appear to the
+ // viewer as 45 degrees if the shape is equilateral. We adjust for this by taking the x/y deltas
+ // between the start and end points, multiply one of them by the shape's aspect ratio,
+ // and get their arctangent, resulting in an appropriate VML angle. If the angle is perfectly
+ // horizontal or vertical then we don't need to do this conversion.
+ vmlAngle = ( angle % 90 ) ? Math.atan2( deltaX * w / h, deltaY ) / PI * 180 : ( angle + 90 );
+
+ // VML angles are 180 degrees offset from CSS angles
+ vmlAngle += 180;
+ vmlAngle = vmlAngle % 360;
+
+ // Add all the stops to the VML 'colors' list, including the first and last stops.
+ // For each, we find its pixel offset along the gradient-line; if the offset of a stop is less
+ // than that of its predecessor we increase it to be equal. We then map that pixel offset to a
+ // percentage along the VML gradient-line, which runs from shape corner to corner.
+ p = perpendicularIntersect( startCornerX, startCornerY, angle, endCornerX, endCornerY );
+ vmlGradientLength = distance( startCornerX, startCornerY, p[0], p[1] );
+ vmlColors = [];
+ p = perpendicularIntersect( startX, startY, angle, startCornerX, startCornerY );
+ vmlOffsetPct = distance( startX, startY, p[0], p[1] ) / vmlGradientLength * 100;
+
+ // Find the pixel offsets along the CSS3 gradient-line for each stop.
+ stopPx = [];
+ for( i = 0; i < stopCount; i++ ) {
+ stopPx.push( stops[i].offset ? stops[i].offset.pixels( el, lineLength ) :
+ i === 0 ? 0 : i === stopCount - 1 ? lineLength : null );
+ }
+ // Fill in gaps with evenly-spaced offsets
+ for( i = 1; i < stopCount; i++ ) {
+ if( stopPx[ i ] === null ) {
+ before = stopPx[ i - 1 ];
+ j = i;
+ do {
+ after = stopPx[ ++j ];
+ } while( after === null );
+ stopPx[ i ] = before + ( after - before ) / ( j - i + 1 );
+ }
+ // Make sure each stop's offset is no less than the one before it
+ stopPx[ i ] = Math.max( stopPx[ i ], stopPx[ i - 1 ] );
+ }
+
+ // Convert to percentage along the VML gradient line and add to the VML 'colors' value
+ for( i = 0; i < stopCount; i++ ) {
+ vmlColors.push(
+ ( vmlOffsetPct + ( stopPx[ i ] / vmlGradientLength * 100 ) ) + '% ' + stops[i].color.colorValue( el )
+ );
+ }
+
+ // Now, finally, we're ready to render the gradient fill. Set the start and end colors to
+ // the first and last stop colors; this just sets outer bounds for the gradient.
+ fill['angle'] = vmlAngle;
+ fill['type'] = 'gradient';
+ fill['method'] = 'sigma';
+ fill['color'] = stops[0].color.colorValue( el );
+ fill['color2'] = stops[stopCount - 1].color.colorValue( el );
+ if( fill['colors'] ) { //sometimes the colors object isn't initialized so we have to assign it directly (?)
+ fill['colors'].value = vmlColors.join( ',' );
+ } else {
+ fill['colors'] = vmlColors.join( ',' );
+ }
+ },
+
+
+ /**
+ * Hide the actual background image and color of the element.
+ */
+ hideBackground: function() {
+ var rs = this.targetElement.runtimeStyle;
+ rs.backgroundImage = 'url(about:blank)'; //ensures the background area reacts to mouse events
+ rs.backgroundColor = 'transparent';
+ },
+
+ destroy: function() {
+ PIE.RendererBase.destroy.call( this );
+ var rs = this.targetElement.runtimeStyle;
+ rs.backgroundImage = rs.backgroundColor = '';
+ }
+
+} );
+/**
+ * Renderer for element borders.
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ * @param {PIE.RootRenderer} parent
+ */
+PIE.BorderRenderer = PIE.RendererBase.newRenderer( {
+
+ boxZIndex: 4,
+ boxName: 'border',
+
+ needsUpdate: function() {
+ var si = this.styleInfos;
+ return si.borderInfo.changed() || si.borderRadiusInfo.changed();
+ },
+
+ isActive: function() {
+ var si = this.styleInfos;
+ return si.borderRadiusInfo.isActive() &&
+ !si.borderImageInfo.isActive() &&
+ si.borderInfo.isActive(); //check BorderStyleInfo last because it's the most expensive
+ },
+
+ /**
+ * Draw the border shape(s)
+ */
+ draw: function() {
+ var el = this.targetElement,
+ props = this.styleInfos.borderInfo.getProps(),
+ bounds = this.boundsInfo.getBounds(),
+ w = bounds.w,
+ h = bounds.h,
+ shape, stroke, s,
+ segments, seg, i, len;
+
+ if( props ) {
+ this.hideBorder();
+
+ segments = this.getBorderSegments( 2 );
+ for( i = 0, len = segments.length; i < len; i++) {
+ seg = segments[i];
+ shape = this.getShape( 'borderPiece' + i, seg.stroke ? 'stroke' : 'fill', this.getBox() );
+ shape.coordsize = w * 2 + ',' + h * 2;
+ shape.coordorigin = '1,1';
+ shape.path = seg.path;
+ s = shape.style;
+ s.width = w;
+ s.height = h;
+
+ shape.filled = !!seg.fill;
+ shape.stroked = !!seg.stroke;
+ if( seg.stroke ) {
+ stroke = shape.stroke;
+ stroke['weight'] = seg.weight + 'px';
+ stroke.color = seg.color.colorValue( el );
+ stroke['dashstyle'] = seg.stroke === 'dashed' ? '2 2' : seg.stroke === 'dotted' ? '1 1' : 'solid';
+ stroke['linestyle'] = seg.stroke === 'double' && seg.weight > 2 ? 'ThinThin' : 'Single';
+ } else {
+ shape.fill.color = seg.fill.colorValue( el );
+ }
+ }
+
+ // remove any previously-created border shapes which didn't get used above
+ while( this.deleteShape( 'borderPiece' + i++ ) ) {}
+ }
+ },
+
+
+ /**
+ * Get the VML path definitions for the border segment(s).
+ * @param {number=} mult If specified, all coordinates will be multiplied by this number
+ * @return {Array.<string>}
+ */
+ getBorderSegments: function( mult ) {
+ var el = this.targetElement,
+ bounds, elW, elH,
+ borderInfo = this.styleInfos.borderInfo,
+ segments = [],
+ floor, ceil, wT, wR, wB, wL,
+ round = Math.round,
+ borderProps, radiusInfo, radii, widths, styles, colors;
+
+ if( borderInfo.isActive() ) {
+ borderProps = borderInfo.getProps();
+
+ widths = borderProps.widths;
+ styles = borderProps.styles;
+ colors = borderProps.colors;
+
+ if( borderProps.widthsSame && borderProps.stylesSame && borderProps.colorsSame ) {
+ if( colors['t'].alpha() > 0 ) {
+ // shortcut for identical border on all sides - only need 1 stroked shape
+ wT = widths['t'].pixels( el ); //thickness
+ wR = wT / 2; //shrink
+ segments.push( {
+ path: this.getBoxPath( { t: wR, r: wR, b: wR, l: wR }, mult ),
+ stroke: styles['t'],
+ color: colors['t'],
+ weight: wT
+ } );
+ }
+ }
+ else {
+ mult = mult || 1;
+ bounds = this.boundsInfo.getBounds();
+ elW = bounds.w;
+ elH = bounds.h;
+
+ wT = round( widths['t'].pixels( el ) );
+ wR = round( widths['r'].pixels( el ) );
+ wB = round( widths['b'].pixels( el ) );
+ wL = round( widths['l'].pixels( el ) );
+ var pxWidths = {
+ 't': wT,
+ 'r': wR,
+ 'b': wB,
+ 'l': wL
+ };
+
+ radiusInfo = this.styleInfos.borderRadiusInfo;
+ if( radiusInfo.isActive() ) {
+ radii = this.getRadiiPixels( radiusInfo.getProps() );
+ }
+
+ floor = Math.floor;
+ ceil = Math.ceil;
+
+ function radius( xy, corner ) {
+ return radii ? radii[ xy ][ corner ] : 0;
+ }
+
+ function curve( corner, shrinkX, shrinkY, startAngle, ccw, doMove ) {
+ var rx = radius( 'x', corner),
+ ry = radius( 'y', corner),
+ deg = 65535,
+ isRight = corner.charAt( 1 ) === 'r',
+ isBottom = corner.charAt( 0 ) === 'b';
+ return ( rx > 0 && ry > 0 ) ?
+ ( doMove ? 'al' : 'ae' ) +
+ ( isRight ? ceil( elW - rx ) : floor( rx ) ) * mult + ',' + // center x
+ ( isBottom ? ceil( elH - ry ) : floor( ry ) ) * mult + ',' + // center y
+ ( floor( rx ) - shrinkX ) * mult + ',' + // width
+ ( floor( ry ) - shrinkY ) * mult + ',' + // height
+ ( startAngle * deg ) + ',' + // start angle
+ ( 45 * deg * ( ccw ? 1 : -1 ) // angle change
+ ) : (
+ ( doMove ? 'm' : 'l' ) +
+ ( isRight ? elW - shrinkX : shrinkX ) * mult + ',' +
+ ( isBottom ? elH - shrinkY : shrinkY ) * mult
+ );
+ }
+
+ function line( side, shrink, ccw, doMove ) {
+ var
+ start = (
+ side === 't' ?
+ floor( radius( 'x', 'tl') ) * mult + ',' + ceil( shrink ) * mult :
+ side === 'r' ?
+ ceil( elW - shrink ) * mult + ',' + floor( radius( 'y', 'tr') ) * mult :
+ side === 'b' ?
+ ceil( elW - radius( 'x', 'br') ) * mult + ',' + floor( elH - shrink ) * mult :
+ // side === 'l' ?
+ floor( shrink ) * mult + ',' + ceil( elH - radius( 'y', 'bl') ) * mult
+ ),
+ end = (
+ side === 't' ?
+ ceil( elW - radius( 'x', 'tr') ) * mult + ',' + ceil( shrink ) * mult :
+ side === 'r' ?
+ ceil( elW - shrink ) * mult + ',' + ceil( elH - radius( 'y', 'br') ) * mult :
+ side === 'b' ?
+ floor( radius( 'x', 'bl') ) * mult + ',' + floor( elH - shrink ) * mult :
+ // side === 'l' ?
+ floor( shrink ) * mult + ',' + floor( radius( 'y', 'tl') ) * mult
+ );
+ return ccw ? ( doMove ? 'm' + end : '' ) + 'l' + start :
+ ( doMove ? 'm' + start : '' ) + 'l' + end;
+ }
+
+
+ function addSide( side, sideBefore, sideAfter, cornerBefore, cornerAfter, baseAngle ) {
+ var vert = side === 'l' || side === 'r',
+ sideW = pxWidths[ side ],
+ beforeX, beforeY, afterX, afterY;
+
+ if( sideW > 0 && styles[ side ] !== 'none' && colors[ side ].alpha() > 0 ) {
+ beforeX = pxWidths[ vert ? side : sideBefore ];
+ beforeY = pxWidths[ vert ? sideBefore : side ];
+ afterX = pxWidths[ vert ? side : sideAfter ];
+ afterY = pxWidths[ vert ? sideAfter : side ];
+
+ if( styles[ side ] === 'dashed' || styles[ side ] === 'dotted' ) {
+ segments.push( {
+ path: curve( cornerBefore, beforeX, beforeY, baseAngle + 45, 0, 1 ) +
+ curve( cornerBefore, 0, 0, baseAngle, 1, 0 ),
+ fill: colors[ side ]
+ } );
+ segments.push( {
+ path: line( side, sideW / 2, 0, 1 ),
+ stroke: styles[ side ],
+ weight: sideW,
+ color: colors[ side ]
+ } );
+ segments.push( {
+ path: curve( cornerAfter, afterX, afterY, baseAngle, 0, 1 ) +
+ curve( cornerAfter, 0, 0, baseAngle - 45, 1, 0 ),
+ fill: colors[ side ]
+ } );
+ }
+ else {
+ segments.push( {
+ path: curve( cornerBefore, beforeX, beforeY, baseAngle + 45, 0, 1 ) +
+ line( side, sideW, 0, 0 ) +
+ curve( cornerAfter, afterX, afterY, baseAngle, 0, 0 ) +
+
+ ( styles[ side ] === 'double' && sideW > 2 ?
+ curve( cornerAfter, afterX - floor( afterX / 3 ), afterY - floor( afterY / 3 ), baseAngle - 45, 1, 0 ) +
+ line( side, ceil( sideW / 3 * 2 ), 1, 0 ) +
+ curve( cornerBefore, beforeX - floor( beforeX / 3 ), beforeY - floor( beforeY / 3 ), baseAngle, 1, 0 ) +
+ 'x ' +
+ curve( cornerBefore, floor( beforeX / 3 ), floor( beforeY / 3 ), baseAngle + 45, 0, 1 ) +
+ line( side, floor( sideW / 3 ), 1, 0 ) +
+ curve( cornerAfter, floor( afterX / 3 ), floor( afterY / 3 ), baseAngle, 0, 0 )
+ : '' ) +
+
+ curve( cornerAfter, 0, 0, baseAngle - 45, 1, 0 ) +
+ line( side, 0, 1, 0 ) +
+ curve( cornerBefore, 0, 0, baseAngle, 1, 0 ),
+ fill: colors[ side ]
+ } );
+ }
+ }
+ }
+
+ addSide( 't', 'l', 'r', 'tl', 'tr', 90 );
+ addSide( 'r', 't', 'b', 'tr', 'br', 0 );
+ addSide( 'b', 'r', 'l', 'br', 'bl', -90 );
+ addSide( 'l', 'b', 't', 'bl', 'tl', -180 );
+ }
+ }
+
+ return segments;
+ },
+
+ destroy: function() {
+ var me = this;
+ if (me.finalized || !me.styleInfos.borderImageInfo.isActive()) {
+ me.targetElement.runtimeStyle.borderColor = '';
+ }
+ PIE.RendererBase.destroy.call( me );
+ }
+
+
+} );
+/**
+ * Renderer for border-image
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ * @param {PIE.RootRenderer} parent
+ */
+PIE.BorderImageRenderer = PIE.RendererBase.newRenderer( {
+
+ boxZIndex: 5,
+ pieceNames: [ 't', 'tr', 'r', 'br', 'b', 'bl', 'l', 'tl', 'c' ],
+
+ needsUpdate: function() {
+ return this.styleInfos.borderImageInfo.changed();
+ },
+
+ isActive: function() {
+ return this.styleInfos.borderImageInfo.isActive();
+ },
+
+ draw: function() {
+ this.getBox(); //make sure pieces are created
+
+ var props = this.styleInfos.borderImageInfo.getProps(),
+ borderProps = this.styleInfos.borderInfo.getProps(),
+ bounds = this.boundsInfo.getBounds(),
+ el = this.targetElement,
+ pieces = this.pieces;
+
+ PIE.Util.withImageSize( props.src, function( imgSize ) {
+ var elW = bounds.w,
+ elH = bounds.h,
+ zero = PIE.getLength( '0' ),
+ widths = props.widths || ( borderProps ? borderProps.widths : { 't': zero, 'r': zero, 'b': zero, 'l': zero } ),
+ widthT = widths['t'].pixels( el ),
+ widthR = widths['r'].pixels( el ),
+ widthB = widths['b'].pixels( el ),
+ widthL = widths['l'].pixels( el ),
+ slices = props.slice,
+ sliceT = slices['t'].pixels( el ),
+ sliceR = slices['r'].pixels( el ),
+ sliceB = slices['b'].pixels( el ),
+ sliceL = slices['l'].pixels( el );
+
+ // Piece positions and sizes
+ function setSizeAndPos( piece, w, h, x, y ) {
+ var s = pieces[piece].style,
+ max = Math.max;
+ s.width = max(w, 0);
+ s.height = max(h, 0);
+ s.left = x;
+ s.top = y;
+ }
+ setSizeAndPos( 'tl', widthL, widthT, 0, 0 );
+ setSizeAndPos( 't', elW - widthL - widthR, widthT, widthL, 0 );
+ setSizeAndPos( 'tr', widthR, widthT, elW - widthR, 0 );
+ setSizeAndPos( 'r', widthR, elH - widthT - widthB, elW - widthR, widthT );
+ setSizeAndPos( 'br', widthR, widthB, elW - widthR, elH - widthB );
+ setSizeAndPos( 'b', elW - widthL - widthR, widthB, widthL, elH - widthB );
+ setSizeAndPos( 'bl', widthL, widthB, 0, elH - widthB );
+ setSizeAndPos( 'l', widthL, elH - widthT - widthB, 0, widthT );
+ setSizeAndPos( 'c', elW - widthL - widthR, elH - widthT - widthB, widthL, widthT );
+
+
+ // image croppings
+ function setCrops( sides, crop, val ) {
+ for( var i=0, len=sides.length; i < len; i++ ) {
+ pieces[ sides[i] ]['imagedata'][ crop ] = val;
+ }
+ }
+
+ // corners
+ setCrops( [ 'tl', 't', 'tr' ], 'cropBottom', ( imgSize.h - sliceT ) / imgSize.h );
+ setCrops( [ 'tl', 'l', 'bl' ], 'cropRight', ( imgSize.w - sliceL ) / imgSize.w );
+ setCrops( [ 'bl', 'b', 'br' ], 'cropTop', ( imgSize.h - sliceB ) / imgSize.h );
+ setCrops( [ 'tr', 'r', 'br' ], 'cropLeft', ( imgSize.w - sliceR ) / imgSize.w );
+
+ // edges and center
+ // TODO right now this treats everything like 'stretch', need to support other schemes
+ //if( props.repeat.v === 'stretch' ) {
+ setCrops( [ 'l', 'r', 'c' ], 'cropTop', sliceT / imgSize.h );
+ setCrops( [ 'l', 'r', 'c' ], 'cropBottom', sliceB / imgSize.h );
+ //}
+ //if( props.repeat.h === 'stretch' ) {
+ setCrops( [ 't', 'b', 'c' ], 'cropLeft', sliceL / imgSize.w );
+ setCrops( [ 't', 'b', 'c' ], 'cropRight', sliceR / imgSize.w );
+ //}
+
+ // center fill
+ pieces['c'].style.display = props.fill ? '' : 'none';
+ }, this );
+ },
+
+ getBox: function() {
+ var box = this.parent.getLayer( this.boxZIndex ),
+ s, piece, i,
+ pieceNames = this.pieceNames,
+ len = pieceNames.length;
+
+ if( !box ) {
+ box = doc.createElement( 'border-image' );
+ s = box.style;
+ s.position = 'absolute';
+
+ this.pieces = {};
+
+ for( i = 0; i < len; i++ ) {
+ piece = this.pieces[ pieceNames[i] ] = PIE.Util.createVmlElement( 'rect' );
+ piece.appendChild( PIE.Util.createVmlElement( 'imagedata' ) );
+ s = piece.style;
+ s['behavior'] = 'url(#default#VML)';
+ s.position = "absolute";
+ s.top = s.left = 0;
+ piece['imagedata'].src = this.styleInfos.borderImageInfo.getProps().src;
+ piece.stroked = false;
+ piece.filled = false;
+ box.appendChild( piece );
+ }
+
+ this.parent.addLayer( this.boxZIndex, box );
+ }
+
+ return box;
+ },
+
+ prepareUpdate: function() {
+ if (this.isActive()) {
+ var me = this,
+ el = me.targetElement,
+ rs = el.runtimeStyle,
+ widths = me.styleInfos.borderImageInfo.getProps().widths;
+
+ // Force border-style to solid so it doesn't collapse
+ rs.borderStyle = 'solid';
+
+ // If widths specified in border-image shorthand, override border-width
+ // NOTE px units needed here as this gets used by the IE9 renderer too
+ if ( widths ) {
+ rs.borderTopWidth = widths['t'].pixels( el ) + 'px';
+ rs.borderRightWidth = widths['r'].pixels( el ) + 'px';
+ rs.borderBottomWidth = widths['b'].pixels( el ) + 'px';
+ rs.borderLeftWidth = widths['l'].pixels( el ) + 'px';
+ }
+
+ // Make the border transparent
+ me.hideBorder();
+ }
+ },
+
+ destroy: function() {
+ var me = this,
+ rs = me.targetElement.runtimeStyle;
+ rs.borderStyle = '';
+ if (me.finalized || !me.styleInfos.borderInfo.isActive()) {
+ rs.borderColor = rs.borderWidth = '';
+ }
+ PIE.RendererBase.destroy.call( this );
+ }
+
+} );
+/**
+ * Renderer for outset box-shadows
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ * @param {PIE.RootRenderer} parent
+ */
+PIE.BoxShadowOutsetRenderer = PIE.RendererBase.newRenderer( {
+
+ boxZIndex: 1,
+ boxName: 'outset-box-shadow',
+
+ needsUpdate: function() {
+ var si = this.styleInfos;
+ return si.boxShadowInfo.changed() || si.borderRadiusInfo.changed();
+ },
+
+ isActive: function() {
+ var boxShadowInfo = this.styleInfos.boxShadowInfo;
+ return boxShadowInfo.isActive() && boxShadowInfo.getProps().outset[0];
+ },
+
+ draw: function() {
+ var me = this,
+ el = this.targetElement,
+ box = this.getBox(),
+ styleInfos = this.styleInfos,
+ shadowInfos = styleInfos.boxShadowInfo.getProps().outset,
+ radii = styleInfos.borderRadiusInfo.getProps(),
+ len = shadowInfos.length,
+ i = len, j,
+ bounds = this.boundsInfo.getBounds(),
+ w = bounds.w,
+ h = bounds.h,
+ clipAdjust = PIE.ieVersion === 8 ? 1 : 0, //workaround for IE8 bug where VML leaks out top/left of clip region by 1px
+ corners = [ 'tl', 'tr', 'br', 'bl' ], corner,
+ shadowInfo, shape, fill, ss, xOff, yOff, spread, blur, shrink, color, alpha, path,
+ totalW, totalH, focusX, focusY, isBottom, isRight;
+
+
+ function getShadowShape( index, corner, xOff, yOff, color, blur, path ) {
+ var shape = me.getShape( 'shadow' + index + corner, 'fill', box, len - index ),
+ fill = shape.fill;
+
+ // Position and size
+ shape['coordsize'] = w * 2 + ',' + h * 2;
+ shape['coordorigin'] = '1,1';
+
+ // Color and opacity
+ shape['stroked'] = false;
+ shape['filled'] = true;
+ fill.color = color.colorValue( el );
+ if( blur ) {
+ fill['type'] = 'gradienttitle'; //makes the VML gradient follow the shape's outline - hooray for undocumented features?!?!
+ fill['color2'] = fill.color;
+ fill['opacity'] = 0;
+ }
+
+ // Path
+ shape.path = path;
+
+ // This needs to go last for some reason, to prevent rendering at incorrect size
+ ss = shape.style;
+ ss.left = xOff;
+ ss.top = yOff;
+ ss.width = w;
+ ss.height = h;
+
+ return shape;
+ }
+
+
+ while( i-- ) {
+ shadowInfo = shadowInfos[ i ];
+ xOff = shadowInfo.xOffset.pixels( el );
+ yOff = shadowInfo.yOffset.pixels( el );
+ spread = shadowInfo.spread.pixels( el );
+ blur = shadowInfo.blur.pixels( el );
+ color = shadowInfo.color;
+ // Shape path
+ shrink = -spread - blur;
+ if( !radii && blur ) {
+ // If blurring, use a non-null border radius info object so that getBoxPath will
+ // round the corners of the expanded shadow shape rather than squaring them off.
+ radii = PIE.BorderRadiusStyleInfo.ALL_ZERO;
+ }
+ path = this.getBoxPath( { t: shrink, r: shrink, b: shrink, l: shrink }, 2, radii );
+
+ if( blur ) {
+ totalW = ( spread + blur ) * 2 + w;
+ totalH = ( spread + blur ) * 2 + h;
+ focusX = totalW ? blur * 2 / totalW : 0;
+ focusY = totalH ? blur * 2 / totalH : 0;
+ if( blur - spread > w / 2 || blur - spread > h / 2 ) {
+ // If the blur is larger than half the element's narrowest dimension, we cannot do
+ // this with a single shape gradient, because its focussize would have to be less than
+ // zero which results in ugly artifacts. Instead we create four shapes, each with its
+ // gradient focus past center, and then clip them so each only shows the quadrant
+ // opposite the focus.
+ for( j = 4; j--; ) {
+ corner = corners[j];
+ isBottom = corner.charAt( 0 ) === 'b';
+ isRight = corner.charAt( 1 ) === 'r';
+ shape = getShadowShape( i, corner, xOff, yOff, color, blur, path );
+ fill = shape.fill;
+ fill['focusposition'] = ( isRight ? 1 - focusX : focusX ) + ',' +
+ ( isBottom ? 1 - focusY : focusY );
+ fill['focussize'] = '0,0';
+
+ // Clip to show only the appropriate quadrant. Add 1px to the top/left clip values
+ // in IE8 to prevent a bug where IE8 displays one pixel outside the clip region.
+ shape.style.clip = 'rect(' + ( ( isBottom ? totalH / 2 : 0 ) + clipAdjust ) + 'px,' +
+ ( isRight ? totalW : totalW / 2 ) + 'px,' +
+ ( isBottom ? totalH : totalH / 2 ) + 'px,' +
+ ( ( isRight ? totalW / 2 : 0 ) + clipAdjust ) + 'px)';
+ }
+ } else {
+ // TODO delete old quadrant shapes if resizing expands past the barrier
+ shape = getShadowShape( i, '', xOff, yOff, color, blur, path );
+ fill = shape.fill;
+ fill['focusposition'] = focusX + ',' + focusY;
+ fill['focussize'] = ( 1 - focusX * 2 ) + ',' + ( 1 - focusY * 2 );
+ }
+ } else {
+ shape = getShadowShape( i, '', xOff, yOff, color, blur, path );
+ alpha = color.alpha();
+ if( alpha < 1 ) {
+ // shape.style.filter = 'alpha(opacity=' + ( alpha * 100 ) + ')';
+ // ss.filter = 'progid:DXImageTransform.Microsoft.BasicImage(opacity=' + ( alpha ) + ')';
+ shape.fill.opacity = alpha;
+ }
+ }
+ }
+ }
+
+} );
+/**
+ * Renderer for re-rendering img elements using VML. Kicks in if the img has
+ * a border-radius applied, or if the -pie-png-fix flag is set.
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ * @param {PIE.RootRenderer} parent
+ */
+PIE.ImgRenderer = PIE.RendererBase.newRenderer( {
+
+ boxZIndex: 6,
+ boxName: 'imgEl',
+
+ needsUpdate: function() {
+ var si = this.styleInfos;
+ return this.targetElement.src !== this._lastSrc || si.borderRadiusInfo.changed();
+ },
+
+ isActive: function() {
+ var si = this.styleInfos;
+ return si.borderRadiusInfo.isActive() || si.backgroundInfo.isPngFix();
+ },
+
+ draw: function() {
+ this._lastSrc = src;
+ this.hideActualImg();
+
+ var shape = this.getShape( 'img', 'fill', this.getBox() ),
+ fill = shape.fill,
+ bounds = this.boundsInfo.getBounds(),
+ w = bounds.w,
+ h = bounds.h,
+ borderProps = this.styleInfos.borderInfo.getProps(),
+ borderWidths = borderProps && borderProps.widths,
+ el = this.targetElement,
+ src = el.src,
+ round = Math.round,
+ cs = el.currentStyle,
+ getLength = PIE.getLength,
+ s, zero;
+
+ // In IE6, the BorderRenderer will have hidden the border by moving the border-width to
+ // the padding; therefore we want to pretend the borders have no width so they aren't doubled
+ // when adding in the current padding value below.
+ if( !borderWidths || PIE.ieVersion < 7 ) {
+ zero = PIE.getLength( '0' );
+ borderWidths = { 't': zero, 'r': zero, 'b': zero, 'l': zero };
+ }
+
+ shape.stroked = false;
+ fill.type = 'frame';
+ fill.src = src;
+ fill.position = (w ? 0.5 / w : 0) + ',' + (h ? 0.5 / h : 0);
+ shape.coordsize = w * 2 + ',' + h * 2;
+ shape.coordorigin = '1,1';
+ shape.path = this.getBoxPath( {
+ t: round( borderWidths['t'].pixels( el ) + getLength( cs.paddingTop ).pixels( el ) ),
+ r: round( borderWidths['r'].pixels( el ) + getLength( cs.paddingRight ).pixels( el ) ),
+ b: round( borderWidths['b'].pixels( el ) + getLength( cs.paddingBottom ).pixels( el ) ),
+ l: round( borderWidths['l'].pixels( el ) + getLength( cs.paddingLeft ).pixels( el ) )
+ }, 2 );
+ s = shape.style;
+ s.width = w;
+ s.height = h;
+ },
+
+ hideActualImg: function() {
+ this.targetElement.runtimeStyle.filter = 'alpha(opacity=0)';
+ },
+
+ destroy: function() {
+ PIE.RendererBase.destroy.call( this );
+ this.targetElement.runtimeStyle.filter = '';
+ }
+
+} );
+/**
+ * Root renderer for IE9; manages the rendering layers in the element's background
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ */
+PIE.IE9RootRenderer = PIE.RendererBase.newRenderer( {
+
+ updatePos: PIE.emptyFn,
+ updateSize: PIE.emptyFn,
+ updateVisibility: PIE.emptyFn,
+ updateProps: PIE.emptyFn,
+
+ outerCommasRE: /^,+|,+$/g,
+ innerCommasRE: /,+/g,
+
+ setBackgroundLayer: function(zIndex, bg) {
+ var me = this,
+ bgLayers = me._bgLayers || ( me._bgLayers = [] ),
+ undef;
+ bgLayers[zIndex] = bg || undef;
+ },
+
+ finishUpdate: function() {
+ var me = this,
+ bgLayers = me._bgLayers,
+ bg;
+ if( bgLayers && ( bg = bgLayers.join( ',' ).replace( me.outerCommasRE, '' ).replace( me.innerCommasRE, ',' ) ) !== me._lastBg ) {
+ me._lastBg = me.targetElement.runtimeStyle.background = bg;
+ }
+ },
+
+ destroy: function() {
+ this.targetElement.runtimeStyle.background = '';
+ delete this._bgLayers;
+ }
+
+} );
+/**
+ * Renderer for element backgrounds, specific for IE9. Only handles translating CSS3 gradients
+ * to an equivalent SVG data URI.
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ */
+PIE.IE9BackgroundRenderer = PIE.RendererBase.newRenderer( {
+
+ bgLayerZIndex: 1,
+
+ needsUpdate: function() {
+ var si = this.styleInfos;
+ return si.backgroundInfo.changed();
+ },
+
+ isActive: function() {
+ var si = this.styleInfos;
+ return si.backgroundInfo.isActive() || si.borderImageInfo.isActive();
+ },
+
+ draw: function() {
+ var me = this,
+ props = me.styleInfos.backgroundInfo.getProps(),
+ bg, images, i = 0, img, bgAreaSize, bgSize;
+
+ if ( props ) {
+ bg = [];
+
+ images = props.bgImages;
+ if ( images ) {
+ while( img = images[ i++ ] ) {
+ if (img.imgType === 'linear-gradient' ) {
+ bgAreaSize = me.getBgAreaSize( img.bgOrigin );
+ bgSize = ( img.bgSize || PIE.BgSize.DEFAULT ).pixels(
+ me.targetElement, bgAreaSize.w, bgAreaSize.h, bgAreaSize.w, bgAreaSize.h
+ ),
+ bg.push(
+ 'url(data:image/svg+xml,' + escape( me.getGradientSvg( img, bgSize.w, bgSize.h ) ) + ') ' +
+ me.bgPositionToString( img.bgPosition ) + ' / ' + bgSize.w + 'px ' + bgSize.h + 'px ' +
+ ( img.bgAttachment || '' ) + ' ' + ( img.bgOrigin || '' ) + ' ' + ( img.bgClip || '' )
+ );
+ } else {
+ bg.push( img.origString );
+ }
+ }
+ }
+
+ if ( props.color ) {
+ bg.push( props.color.val );
+ }
+
+ me.parent.setBackgroundLayer(me.bgLayerZIndex, bg.join(','));
+ }
+ },
+
+ bgPositionToString: function( bgPosition ) {
+ return bgPosition ? bgPosition.tokens.map(function(token) {
+ return token.tokenValue;
+ }).join(' ') : '0 0';
+ },
+
+ getBgAreaSize: function( bgOrigin ) {
+ var me = this,
+ el = me.targetElement,
+ bounds = me.boundsInfo.getBounds(),
+ elW = bounds.w,
+ elH = bounds.h,
+ w = elW,
+ h = elH,
+ borders, getLength, cs;
+
+ if( bgOrigin !== 'border-box' ) {
+ borders = me.styleInfos.borderInfo.getProps();
+ if( borders && ( borders = borders.widths ) ) {
+ w -= borders[ 'l' ].pixels( el ) + borders[ 'l' ].pixels( el );
+ h -= borders[ 't' ].pixels( el ) + borders[ 'b' ].pixels( el );
+ }
+ }
+
+ if ( bgOrigin === 'content-box' ) {
+ getLength = PIE.getLength;
+ cs = el.currentStyle;
+ w -= getLength( cs.paddingLeft ).pixels( el ) + getLength( cs.paddingRight ).pixels( el );
+ h -= getLength( cs.paddingTop ).pixels( el ) + getLength( cs.paddingBottom ).pixels( el );
+ }
+
+ return { w: w, h: h };
+ },
+
+ getGradientSvg: function( info, bgWidth, bgHeight ) {
+ var el = this.targetElement,
+ stopsInfo = info.stops,
+ stopCount = stopsInfo.length,
+ metrics = PIE.GradientUtil.getGradientMetrics( el, bgWidth, bgHeight, info ),
+ startX = metrics.startX,
+ startY = metrics.startY,
+ endX = metrics.endX,
+ endY = metrics.endY,
+ lineLength = metrics.lineLength,
+ stopPx,
+ i, j, before, after,
+ svg;
+
+ // Find the pixel offsets along the CSS3 gradient-line for each stop.
+ stopPx = [];
+ for( i = 0; i < stopCount; i++ ) {
+ stopPx.push( stopsInfo[i].offset ? stopsInfo[i].offset.pixels( el, lineLength ) :
+ i === 0 ? 0 : i === stopCount - 1 ? lineLength : null );
+ }
+ // Fill in gaps with evenly-spaced offsets
+ for( i = 1; i < stopCount; i++ ) {
+ if( stopPx[ i ] === null ) {
+ before = stopPx[ i - 1 ];
+ j = i;
+ do {
+ after = stopPx[ ++j ];
+ } while( after === null );
+ stopPx[ i ] = before + ( after - before ) / ( j - i + 1 );
+ }
+ }
+
+ svg = [
+ '<svg width="' + bgWidth + '" height="' + bgHeight + '" xmlns="http://www.w3.org/2000/svg">' +
+ '<defs>' +
+ '<linearGradient id="g" gradientUnits="userSpaceOnUse"' +
+ ' x1="' + ( startX / bgWidth * 100 ) + '%" y1="' + ( startY / bgHeight * 100 ) + '%" x2="' + ( endX / bgWidth * 100 ) + '%" y2="' + ( endY / bgHeight * 100 ) + '%">'
+ ];
+
+ // Convert to percentage along the SVG gradient line and add to the stops list
+ for( i = 0; i < stopCount; i++ ) {
+ svg.push(
+ '<stop offset="' + ( stopPx[ i ] / lineLength ) +
+ '" stop-color="' + stopsInfo[i].color.colorValue( el ) +
+ '" stop-opacity="' + stopsInfo[i].color.alpha() + '"/>'
+ );
+ }
+
+ svg.push(
+ '</linearGradient>' +
+ '</defs>' +
+ '<rect width="100%" height="100%" fill="url(#g)"/>' +
+ '</svg>'
+ );
+
+ return svg.join( '' );
+ },
+
+ destroy: function() {
+ this.parent.setBackgroundLayer( this.bgLayerZIndex );
+ }
+
+} );
+/**
+ * Renderer for border-image
+ * @constructor
+ * @param {Element} el The target element
+ * @param {Object} styleInfos The StyleInfo objects
+ * @param {PIE.RootRenderer} parent
+ */
+PIE.IE9BorderImageRenderer = PIE.RendererBase.newRenderer( {
+
+ REPEAT: 'repeat',
+ STRETCH: 'stretch',
+ ROUND: 'round',
+
+ bgLayerZIndex: 0,
+
+ needsUpdate: function() {
+ return this.styleInfos.borderImageInfo.changed();
+ },
+
+ isActive: function() {
+ return this.styleInfos.borderImageInfo.isActive();
+ },
+
+ draw: function() {
+ var me = this,
+ props = me.styleInfos.borderImageInfo.getProps(),
+ borderProps = me.styleInfos.borderInfo.getProps(),
+ bounds = me.boundsInfo.getBounds(),
+ repeat = props.repeat,
+ repeatH = repeat.h,
+ repeatV = repeat.v,
+ el = me.targetElement,
+ isAsync = 0;
+
+ PIE.Util.withImageSize( props.src, function( imgSize ) {
+ var elW = bounds.w,
+ elH = bounds.h,
+ imgW = imgSize.w,
+ imgH = imgSize.h,
+
+ // The image cannot be referenced as a URL directly in the SVG because IE9 throws a strange
+ // security exception (perhaps due to cross-origin policy within data URIs?) Therefore we
+ // work around this by converting the image data into a data URI itself using a transient
+ // canvas. This unfortunately requires the border-image src to be within the same domain,
+ // which isn't a limitation in true border-image, so we need to try and find a better fix.
+ imgSrc = me.imageToDataURI( props.src, imgW, imgH ),
+
+ REPEAT = me.REPEAT,
+ STRETCH = me.STRETCH,
+ ROUND = me.ROUND,
+ ceil = Math.ceil,
+
+ zero = PIE.getLength( '0' ),
+ widths = props.widths || ( borderProps ? borderProps.widths : { 't': zero, 'r': zero, 'b': zero, 'l': zero } ),
+ widthT = widths['t'].pixels( el ),
+ widthR = widths['r'].pixels( el ),
+ widthB = widths['b'].pixels( el ),
+ widthL = widths['l'].pixels( el ),
+ slices = props.slice,
+ sliceT = slices['t'].pixels( el ),
+ sliceR = slices['r'].pixels( el ),
+ sliceB = slices['b'].pixels( el ),
+ sliceL = slices['l'].pixels( el ),
+ centerW = elW - widthL - widthR,
+ middleH = elH - widthT - widthB,
+ imgCenterW = imgW - sliceL - sliceR,
+ imgMiddleH = imgH - sliceT - sliceB,
+
+ // Determine the size of each tile - 'round' is handled below
+ tileSizeT = repeatH === STRETCH ? centerW : imgCenterW * widthT / sliceT,
+ tileSizeR = repeatV === STRETCH ? middleH : imgMiddleH * widthR / sliceR,
+ tileSizeB = repeatH === STRETCH ? centerW : imgCenterW * widthB / sliceB,
+ tileSizeL = repeatV === STRETCH ? middleH : imgMiddleH * widthL / sliceL,
+
+ svg,
+ patterns = [],
+ rects = [],
+ i = 0;
+
+ // For 'round', subtract from each tile's size enough so that they fill the space a whole number of times
+ if (repeatH === ROUND) {
+ tileSizeT -= (tileSizeT - (centerW % tileSizeT || tileSizeT)) / ceil(centerW / tileSizeT);
+ tileSizeB -= (tileSizeB - (centerW % tileSizeB || tileSizeB)) / ceil(centerW / tileSizeB);
+ }
+ if (repeatV === ROUND) {
+ tileSizeR -= (tileSizeR - (middleH % tileSizeR || tileSizeR)) / ceil(middleH / tileSizeR);
+ tileSizeL -= (tileSizeL - (middleH % tileSizeL || tileSizeL)) / ceil(middleH / tileSizeL);
+ }
+
+
+ // Build the SVG for the border-image rendering. Add each piece as a pattern, which is then stretched
+ // or repeated as the fill of a rect of appropriate size.
+ svg = [
+ '<svg width="' + elW + '" height="' + elH + '" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink">'
+ ];
+
+ function addImage( x, y, w, h, cropX, cropY, cropW, cropH, tileW, tileH ) {
+ patterns.push(
+ '<pattern patternUnits="userSpaceOnUse" id="pattern' + i + '" ' +
+ 'x="' + (repeatH === REPEAT ? x + w / 2 - tileW / 2 : x) + '" ' +
+ 'y="' + (repeatV === REPEAT ? y + h / 2 - tileH / 2 : y) + '" ' +
+ 'width="' + tileW + '" height="' + tileH + '">' +
+ '<svg width="' + tileW + '" height="' + tileH + '" viewBox="' + cropX + ' ' + cropY + ' ' + cropW + ' ' + cropH + '" preserveAspectRatio="none">' +
+ '<image xlink:href="' + imgSrc + '" x="0" y="0" width="' + imgW + '" height="' + imgH + '" />' +
+ '</svg>' +
+ '</pattern>'
+ );
+ rects.push(
+ '<rect x="' + x + '" y="' + y + '" width="' + w + '" height="' + h + '" fill="url(#pattern' + i + ')" />'
+ );
+ i++;
+ }
+ addImage( 0, 0, widthL, widthT, 0, 0, sliceL, sliceT, widthL, widthT ); // top left
+ addImage( widthL, 0, centerW, widthT, sliceL, 0, imgCenterW, sliceT, tileSizeT, widthT ); // top center
+ addImage( elW - widthR, 0, widthR, widthT, imgW - sliceR, 0, sliceR, sliceT, widthR, widthT ); // top right
+ addImage( 0, widthT, widthL, middleH, 0, sliceT, sliceL, imgMiddleH, widthL, tileSizeL ); // middle left
+ if ( props.fill ) { // center fill
+ addImage( widthL, widthT, centerW, middleH, sliceL, sliceT, imgCenterW, imgMiddleH,
+ tileSizeT || tileSizeB || imgCenterW, tileSizeL || tileSizeR || imgMiddleH );
+ }
+ addImage( elW - widthR, widthT, widthR, middleH, imgW - sliceR, sliceT, sliceR, imgMiddleH, widthR, tileSizeR ); // middle right
+ addImage( 0, elH - widthB, widthL, widthB, 0, imgH - sliceB, sliceL, sliceB, widthL, widthB ); // bottom left
+ addImage( widthL, elH - widthB, centerW, widthB, sliceL, imgH - sliceB, imgCenterW, sliceB, tileSizeB, widthB ); // bottom center
+ addImage( elW - widthR, elH - widthB, widthR, widthB, imgW - sliceR, imgH - sliceB, sliceR, sliceB, widthR, widthB ); // bottom right
+
+ svg.push(
+ '<defs>' +
+ patterns.join('\n') +
+ '</defs>' +
+ rects.join('\n') +
+ '</svg>'
+ );
+
+ me.parent.setBackgroundLayer( me.bgLayerZIndex, 'url(data:image/svg+xml,' + escape( svg.join( '' ) ) + ') no-repeat border-box border-box' );
+
+ // If the border-image's src wasn't immediately available, the SVG for its background layer
+ // will have been created asynchronously after the main element's update has finished; we'll
+ // therefore need to force the root renderer to sync to the final background once finished.
+ if( isAsync ) {
+ me.parent.finishUpdate();
+ }
+ }, me );
+
+ isAsync = 1;
+ },
+
+ /**
+ * Convert a given image to a data URI
+ */
+ imageToDataURI: (function() {
+ var uris = {};
+ return function( src, width, height ) {
+ var uri = uris[ src ],
+ image, canvas;
+ if ( !uri ) {
+ image = new Image();
+ canvas = doc.createElement( 'canvas' );
+ image.src = src;
+ canvas.width = width;
+ canvas.height = height;
+ canvas.getContext( '2d' ).drawImage( image, 0, 0 );
+ uri = uris[ src ] = canvas.toDataURL();
+ }
+ return uri;
+ }
+ })(),
+
+ prepareUpdate: PIE.BorderImageRenderer.prototype.prepareUpdate,
+
+ destroy: function() {
+ var me = this,
+ rs = me.targetElement.runtimeStyle;
+ me.parent.setBackgroundLayer( me.bgLayerZIndex );
+ rs.borderColor = rs.borderStyle = rs.borderWidth = '';
+ }
+
+} );
+
+PIE.Element = (function() {
+
+ var wrappers = {},
+ lazyInitCssProp = PIE.CSS_PREFIX + 'lazy-init',
+ pollCssProp = PIE.CSS_PREFIX + 'poll',
+ trackActiveCssProp = PIE.CSS_PREFIX + 'track-active',
+ trackHoverCssProp = PIE.CSS_PREFIX + 'track-hover',
+ hoverClass = PIE.CLASS_PREFIX + 'hover',
+ activeClass = PIE.CLASS_PREFIX + 'active',
+ focusClass = PIE.CLASS_PREFIX + 'focus',
+ firstChildClass = PIE.CLASS_PREFIX + 'first-child',
+ ignorePropertyNames = { 'background':1, 'bgColor':1, 'display': 1 },
+ classNameRegExes = {},
+ dummyArray = [];
+
+
+ function addClass( el, className ) {
+ el.className += ' ' + className;
+ }
+
+ function removeClass( el, className ) {
+ var re = classNameRegExes[ className ] ||
+ ( classNameRegExes[ className ] = new RegExp( '\\b' + className + '\\b', 'g' ) );
+ el.className = el.className.replace( re, '' );
+ }
+
+ function delayAddClass( el, className /*, className2*/ ) {
+ var classes = dummyArray.slice.call( arguments, 1 ),
+ i = classes.length;
+ setTimeout( function() {
+ if( el ) {
+ while( i-- ) {
+ addClass( el, classes[ i ] );
+ }
+ }
+ }, 0 );
+ }
+
+ function delayRemoveClass( el, className /*, className2*/ ) {
+ var classes = dummyArray.slice.call( arguments, 1 ),
+ i = classes.length;
+ setTimeout( function() {
+ if( el ) {
+ while( i-- ) {
+ removeClass( el, classes[ i ] );
+ }
+ }
+ }, 0 );
+ }
+
+
+
+ function Element( el ) {
+ var renderers,
+ rootRenderer,
+ boundsInfo = new PIE.BoundsInfo( el ),
+ styleInfos,
+ styleInfosArr,
+ initializing,
+ initialized,
+ eventsAttached,
+ eventListeners = [],
+ delayed,
+ destroyed,
+ poll;
+
+ /**
+ * Initialize PIE for this element.
+ */
+ function init() {
+ if( !initialized ) {
+ var docEl,
+ bounds,
+ ieDocMode = PIE.ieDocMode,
+ cs = el.currentStyle,
+ lazy = cs.getAttribute( lazyInitCssProp ) === 'true',
+ trackActive = cs.getAttribute( trackActiveCssProp ) !== 'false',
+ trackHover = cs.getAttribute( trackHoverCssProp ) !== 'false',
+ childRenderers;
+
+ // Polling for size/position changes: default to on in IE8, off otherwise, overridable by -pie-poll
+ poll = cs.getAttribute( pollCssProp );
+ poll = ieDocMode > 7 ? poll !== 'false' : poll === 'true';
+
+ // Force layout so move/resize events will fire. Set this as soon as possible to avoid layout changes
+ // after load, but make sure it only gets called the first time through to avoid recursive calls to init().
+ if( !initializing ) {
+ initializing = 1;
+ el.runtimeStyle.zoom = 1;
+ initFirstChildPseudoClass();
+ }
+
+ boundsInfo.lock();
+
+ // If the -pie-lazy-init:true flag is set, check if the element is outside the viewport and if so, delay initialization
+ if( lazy && ( bounds = boundsInfo.getBounds() ) && ( docEl = doc.documentElement || doc.body ) &&
+ ( bounds.y > docEl.clientHeight || bounds.x > docEl.clientWidth || bounds.y + bounds.h < 0 || bounds.x + bounds.w < 0 ) ) {
+ if( !delayed ) {
+ delayed = 1;
+ PIE.OnScroll.observe( init );
+ }
+ } else {
+ initialized = 1;
+ delayed = initializing = 0;
+ PIE.OnScroll.unobserve( init );
+
+ // Create the style infos and renderers
+ if ( ieDocMode === 9 ) {
+ styleInfos = {
+ backgroundInfo: new PIE.BackgroundStyleInfo( el ),
+ borderImageInfo: new PIE.BorderImageStyleInfo( el ),
+ borderInfo: new PIE.BorderStyleInfo( el )
+ };
+ styleInfosArr = [
+ styleInfos.backgroundInfo,
+ styleInfos.borderImageInfo
+ ];
+ rootRenderer = new PIE.IE9RootRenderer( el, boundsInfo, styleInfos );
+ childRenderers = [
+ new PIE.IE9BackgroundRenderer( el, boundsInfo, styleInfos, rootRenderer ),
+ new PIE.IE9BorderImageRenderer( el, boundsInfo, styleInfos, rootRenderer )
+ ];
+ } else {
+
+ styleInfos = {
+ backgroundInfo: new PIE.BackgroundStyleInfo( el ),
+ borderInfo: new PIE.BorderStyleInfo( el ),
+ borderImageInfo: new PIE.BorderImageStyleInfo( el ),
+ borderRadiusInfo: new PIE.BorderRadiusStyleInfo( el ),
+ boxShadowInfo: new PIE.BoxShadowStyleInfo( el ),
+ visibilityInfo: new PIE.VisibilityStyleInfo( el )
+ };
+ styleInfosArr = [
+ styleInfos.backgroundInfo,
+ styleInfos.borderInfo,
+ styleInfos.borderImageInfo,
+ styleInfos.borderRadiusInfo,
+ styleInfos.boxShadowInfo,
+ styleInfos.visibilityInfo
+ ];
+ rootRenderer = new PIE.RootRenderer( el, boundsInfo, styleInfos );
+ childRenderers = [
+ new PIE.BoxShadowOutsetRenderer( el, boundsInfo, styleInfos, rootRenderer ),
+ new PIE.BackgroundRenderer( el, boundsInfo, styleInfos, rootRenderer ),
+ //new PIE.BoxShadowInsetRenderer( el, boundsInfo, styleInfos, rootRenderer ),
+ new PIE.BorderRenderer( el, boundsInfo, styleInfos, rootRenderer ),
+ new PIE.BorderImageRenderer( el, boundsInfo, styleInfos, rootRenderer )
+ ];
+ if( el.tagName === 'IMG' ) {
+ childRenderers.push( new PIE.ImgRenderer( el, boundsInfo, styleInfos, rootRenderer ) );
+ }
+ rootRenderer.childRenderers = childRenderers; // circular reference, can't pass in constructor; TODO is there a cleaner way?
+ }
+ renderers = [ rootRenderer ].concat( childRenderers );
+
+ // Add property change listeners to ancestors if requested
+ initAncestorEventListeners();
+
+ // Add to list of polled elements in IE8
+ if( poll ) {
+ PIE.Heartbeat.observe( update );
+ PIE.Heartbeat.run();
+ }
+
+ // Trigger rendering
+ update( 1 );
+ }
+
+ if( !eventsAttached ) {
+ eventsAttached = 1;
+ if( ieDocMode < 9 ) {
+ addListener( el, 'onmove', handleMoveOrResize );
+ }
+ addListener( el, 'onresize', handleMoveOrResize );
+ addListener( el, 'onpropertychange', propChanged );
+ if( trackHover ) {
+ addListener( el, 'onmouseenter', mouseEntered );
+ }
+ if( trackHover || trackActive ) {
+ addListener( el, 'onmouseleave', mouseLeft );
+ }
+ if( trackActive ) {
+ addListener( el, 'onmousedown', mousePressed );
+ }
+ if( el.tagName in PIE.focusableElements ) {
+ addListener( el, 'onfocus', focused );
+ addListener( el, 'onblur', blurred );
+ }
+ PIE.OnResize.observe( handleMoveOrResize );
+
+ PIE.OnUnload.observe( removeEventListeners );
+ }
+
+ boundsInfo.unlock();
+ }
+ }
+
+
+
+
+ /**
+ * Event handler for onmove and onresize events. Invokes update() only if the element's
+ * bounds have previously been calculated, to prevent multiple runs during page load when
+ * the element has no initial CSS3 properties.
+ */
+ function handleMoveOrResize() {
+ if( boundsInfo && boundsInfo.hasBeenQueried() ) {
+ update();
+ }
+ }
+
+
+ /**
+ * Update position and/or size as necessary. Both move and resize events call
+ * this rather than the updatePos/Size functions because sometimes, particularly
+ * during page load, one will fire but the other won't.
+ */
+ function update( force ) {
+ if( !destroyed ) {
+ if( initialized ) {
+ var i, len = renderers.length;
+
+ lockAll();
+ for( i = 0; i < len; i++ ) {
+ renderers[i].prepareUpdate();
+ }
+ if( force || boundsInfo.positionChanged() ) {
+ /* TODO just using getBoundingClientRect (used internally by BoundsInfo) for detecting
+ position changes may not always be accurate; it's possible that
+ an element will actually move relative to its positioning parent, but its position
+ relative to the viewport will stay the same. Need to come up with a better way to
+ track movement. The most accurate would be the same logic used in RootRenderer.updatePos()
+ but that is a more expensive operation since it does some DOM walking, and we want this
+ check to be as fast as possible. */
+ for( i = 0; i < len; i++ ) {
+ renderers[i].updatePos();
+ }
+ }
+ if( force || boundsInfo.sizeChanged() ) {
+ for( i = 0; i < len; i++ ) {
+ renderers[i].updateSize();
+ }
+ }
+ rootRenderer.finishUpdate();
+ unlockAll();
+ }
+ else if( !initializing ) {
+ init();
+ }
+ }
+ }
+
+ /**
+ * Handle property changes to trigger update when appropriate.
+ */
+ function propChanged() {
+ var i, len = renderers.length,
+ renderer,
+ e = event;
+
+ // Some elements like <table> fire onpropertychange events for old-school background properties
+ // ('background', 'bgColor') when runtimeStyle background properties are changed, which
+ // results in an infinite loop; therefore we filter out those property names. Also, 'display'
+ // is ignored because size calculations don't work correctly immediately when its onpropertychange
+ // event fires, and because it will trigger an onresize event anyway.
+ if( !destroyed && !( e && e.propertyName in ignorePropertyNames ) ) {
+ if( initialized ) {
+ lockAll();
+ for( i = 0; i < len; i++ ) {
+ renderers[i].prepareUpdate();
+ }
+ for( i = 0; i < len; i++ ) {
+ renderer = renderers[i];
+ // Make sure position is synced if the element hasn't already been rendered.
+ // TODO this feels sloppy - look into merging propChanged and update functions
+ if( !renderer.isPositioned ) {
+ renderer.updatePos();
+ }
+ if( renderer.needsUpdate() ) {
+ renderer.updateProps();
+ }
+ }
+ rootRenderer.finishUpdate();
+ unlockAll();
+ }
+ else if( !initializing ) {
+ init();
+ }
+ }
+ }
+
+
+ /**
+ * Handle mouseenter events. Adds a custom class to the element to allow IE6 to add
+ * hover styles to non-link elements, and to trigger a propertychange update.
+ */
+ function mouseEntered() {
+ //must delay this because the mouseenter event fires before the :hover styles are added.
+ delayAddClass( el, hoverClass );
+ }
+
+ /**
+ * Handle mouseleave events
+ */
+ function mouseLeft() {
+ //must delay this because the mouseleave event fires before the :hover styles are removed.
+ delayRemoveClass( el, hoverClass, activeClass );
+ }
+
+ /**
+ * Handle mousedown events. Adds a custom class to the element to allow IE6 to add
+ * active styles to non-link elements, and to trigger a propertychange update.
+ */
+ function mousePressed() {
+ //must delay this because the mousedown event fires before the :active styles are added.
+ delayAddClass( el, activeClass );
+
+ // listen for mouseups on the document; can't just be on the element because the user might
+ // have dragged out of the element while the mouse button was held down
+ PIE.OnMouseup.observe( mouseReleased );
+ }
+
+ /**
+ * Handle mouseup events
+ */
+ function mouseReleased() {
+ //must delay this because the mouseup event fires before the :active styles are removed.
+ delayRemoveClass( el, activeClass );
+
+ PIE.OnMouseup.unobserve( mouseReleased );
+ }
+
+ /**
+ * Handle focus events. Adds a custom class to the element to trigger a propertychange update.
+ */
+ function focused() {
+ //must delay this because the focus event fires before the :focus styles are added.
+ delayAddClass( el, focusClass );
+ }
+
+ /**
+ * Handle blur events
+ */
+ function blurred() {
+ //must delay this because the blur event fires before the :focus styles are removed.
+ delayRemoveClass( el, focusClass );
+ }
+
+
+ /**
+ * Handle property changes on ancestors of the element; see initAncestorEventListeners()
+ * which adds these listeners as requested with the -pie-watch-ancestors CSS property.
+ */
+ function ancestorPropChanged() {
+ var name = event.propertyName;
+ if( name === 'className' || name === 'id' ) {
+ propChanged();
+ }
+ }
+
+ function lockAll() {
+ boundsInfo.lock();
+ for( var i = styleInfosArr.length; i--; ) {
+ styleInfosArr[i].lock();
+ }
+ }
+
+ function unlockAll() {
+ for( var i = styleInfosArr.length; i--; ) {
+ styleInfosArr[i].unlock();
+ }
+ boundsInfo.unlock();
+ }
+
+
+ function addListener( targetEl, type, handler ) {
+ targetEl.attachEvent( type, handler );
+ eventListeners.push( [ targetEl, type, handler ] );
+ }
+
+ /**
+ * Remove all event listeners from the element and any monitored ancestors.
+ */
+ function removeEventListeners() {
+ if (eventsAttached) {
+ var i = eventListeners.length,
+ listener;
+
+ while( i-- ) {
+ listener = eventListeners[ i ];
+ listener[ 0 ].detachEvent( listener[ 1 ], listener[ 2 ] );
+ }
+
+ PIE.OnUnload.unobserve( removeEventListeners );
+ eventsAttached = 0;
+ eventListeners = [];
+ }
+ }
+
+
+ /**
+ * Clean everything up when the behavior is removed from the element, or the element
+ * is manually destroyed.
+ */
+ function destroy() {
+ if( !destroyed ) {
+ var i, len;
+
+ removeEventListeners();
+
+ destroyed = 1;
+
+ // destroy any active renderers
+ if( renderers ) {
+ for( i = 0, len = renderers.length; i < len; i++ ) {
+ renderers[i].finalized = 1;
+ renderers[i].destroy();
+ }
+ }
+
+ // Remove from list of polled elements in IE8
+ if( poll ) {
+ PIE.Heartbeat.unobserve( update );
+ }
+ // Stop onresize listening
+ PIE.OnResize.unobserve( update );
+
+ // Kill references
+ renderers = boundsInfo = styleInfos = styleInfosArr = el = null;
+ }
+ }
+
+
+ /**
+ * If requested via the custom -pie-watch-ancestors CSS property, add onpropertychange and
+ * other event listeners to ancestor(s) of the element so we can pick up style changes
+ * based on CSS rules using descendant selectors.
+ */
+ function initAncestorEventListeners() {
+ var watch = el.currentStyle.getAttribute( PIE.CSS_PREFIX + 'watch-ancestors' ),
+ i, a;
+ if( watch ) {
+ watch = parseInt( watch, 10 );
+ i = 0;
+ a = el.parentNode;
+ while( a && ( watch === 'NaN' || i++ < watch ) ) {
+ addListener( a, 'onpropertychange', ancestorPropChanged );
+ addListener( a, 'onmouseenter', mouseEntered );
+ addListener( a, 'onmouseleave', mouseLeft );
+ addListener( a, 'onmousedown', mousePressed );
+ if( a.tagName in PIE.focusableElements ) {
+ addListener( a, 'onfocus', focused );
+ addListener( a, 'onblur', blurred );
+ }
+ a = a.parentNode;
+ }
+ }
+ }
+
+
+ /**
+ * If the target element is a first child, add a pie_first-child class to it. This allows using
+ * the added class as a workaround for the fact that PIE's rendering element breaks the :first-child
+ * pseudo-class selector.
+ */
+ function initFirstChildPseudoClass() {
+ var tmpEl = el,
+ isFirst = 1;
+ while( tmpEl = tmpEl.previousSibling ) {
+ if( tmpEl.nodeType === 1 ) {
+ isFirst = 0;
+ break;
+ }
+ }
+ if( isFirst ) {
+ addClass( el, firstChildClass );
+ }
+ }
+
+
+ // These methods are all already bound to this instance so there's no need to wrap them
+ // in a closure to maintain the 'this' scope object when calling them.
+ this.init = init;
+ this.update = update;
+ this.destroy = destroy;
+ this.el = el;
+ }
+
+ Element.getInstance = function( el ) {
+ var id = PIE.Util.getUID( el );
+ return wrappers[ id ] || ( wrappers[ id ] = new Element( el ) );
+ };
+
+ Element.destroy = function( el ) {
+ var id = PIE.Util.getUID( el ),
+ wrapper = wrappers[ id ];
+ if( wrapper ) {
+ wrapper.destroy();
+ delete wrappers[ id ];
+ }
+ };
+
+ Element.destroyAll = function() {
+ var els = [], wrapper;
+ if( wrappers ) {
+ for( var w in wrappers ) {
+ if( wrappers.hasOwnProperty( w ) ) {
+ wrapper = wrappers[ w ];
+ els.push( wrapper.el );
+ wrapper.destroy();
+ }
+ }
+ wrappers = {};
+ }
+ return els;
+ };
+
+ return Element;
+})();
+
+/*
+ * This file exposes the public API for invoking PIE.
+ */
+
+
+/**
+ * @property supportsVML
+ * True if the current IE browser environment has a functioning VML engine. Should be true
+ * in most IEs, but in rare cases may be false. If false, PIE will exit immediately when
+ * attached to an element; this property may be used for debugging or by external scripts
+ * to perform some special action when VML support is absent.
+ * @type {boolean}
+ */
+PIE[ 'supportsVML' ] = PIE.supportsVML;
+
+
+/**
+ * Programatically attach PIE to a single element.
+ * @param {Element} el
+ */
+PIE[ 'attach' ] = function( el ) {
+ if (PIE.ieDocMode < 10 && PIE.supportsVML) {
+ PIE.Element.getInstance( el ).init();
+ }
+};
+
+
+/**
+ * Programatically detach PIE from a single element.
+ * @param {Element} el
+ */
+PIE[ 'detach' ] = function( el ) {
+ PIE.Element.destroy( el );
+};
+
+
+} // if( !PIE )
+})(); \ No newline at end of file
diff --git a/themes/mantra/resources/js/frontend.js b/themes/mantra/resources/js/frontend.js
new file mode 100644
index 00000000..391a5550
--- /dev/null
+++ b/themes/mantra/resources/js/frontend.js
@@ -0,0 +1,190 @@
+/******************************
+ Mantra Theme
+ custom scripting
+ (c) Cryout Creations
+ www.cryoutcreations.eu
+*******************************/
+
+
+jQuery(document).ready(function() {
+
+/* Standard menu touch support for tablets */
+var custom_event = ('ontouchstart' in window) ? 'touchstart' : 'click'; /* check touch support */
+var ios = /iPhone|iPad|iPod/i.test(navigator.userAgent);
+ jQuery('#access .menu > ul > li a').on('click', function(e){
+ var $link_id = jQuery(this).attr('href');
+ if (jQuery(this).parent().data('clicked') == $link_id) { /* second touch */
+ jQuery(this).parent().data('clicked', null);
+ }
+ else { /* first touch */
+ if (custom_event != 'click' && !ios && (jQuery(this).parent().children('ul').length >0)) {e.preventDefault();}
+ jQuery(this).parent().data('clicked', $link_id);
+ }
+ });
+
+/* Back to top button animation */
+jQuery(function() {
+ jQuery(window).scroll(function() {
+ var x=jQuery(this).scrollTop();
+
+ if(x != 0) {
+ jQuery('#toTop').addClass('showtop')
+ } else {
+ jQuery('#toTop').removeClass('showtop');
+ }
+
+ });
+ jQuery('#toTop').click(function() { jQuery('body,html').animate({scrollTop:0},800); });
+});
+
+
+/* Menu animation */
+jQuery("#access ul ul").css({display: "none"}); /* Opera Fix */
+jQuery("#access").removeClass("jssafe"); /* JS failsafe */
+jQuery("#access .menu ul li").hoverIntent({
+ over: function(){jQuery(this).children("ul").fadeIn(300);},
+ out: function(){ jQuery(this).children('ul').fadeOut();},
+ timeout:300}
+);
+
+
+/* detect and apply custom class for safari */
+if (navigator.userAgent.indexOf('Safari') != -1 && navigator.userAgent.indexOf('Chrome') == -1) {
+ jQuery('body').addClass('safari');
+}
+
+/* Add custom borders to images */
+jQuery("img.alignnone, img.alignleft, img.aligncenter, img.alignright").addClass(mantra_options.image_class);
+
+
+});
+/* end document.ready */
+
+/* Mobile Menu v2 */
+function mantra_mobilemenu_init() {
+ var state = false;
+ jQuery("#nav-toggle").click(function(){
+ jQuery("#access").slideToggle(function(){ if (state) {jQuery(this).removeAttr( 'style' )}; state = ! state; } );
+ });
+}
+
+jQuery(window).load(function() {
+ mantra_mobilemenu_init();
+});
+
+/* Columns equalizer, used if at least one sidebar has a bg color */
+function equalizeHeights(){
+ var h1 = jQuery("#primary").height();
+ var h2 = jQuery("#secondary").height();
+ var h3 = jQuery("#content").height();
+ var max = Math.max(h1,h2,h3);
+ if (h1<max) { jQuery("#primary").height(max); };
+ if (h2<max) { jQuery("#secondary").height(max); };
+}
+
+function makeDoubleDelegate(function1, function2) {
+// concatenate functions
+ return function() { if (function1) function1(); if (function2) function2(); }
+}
+
+function mantra_onload() {
+ if ( mantra_options.responsive == 1 ) {
+ /* Add responsive videos */
+ if (jQuery(window).width() < 800) jQuery(".entry-content").fitVids();
+ }
+ if ( mantra_options.equalizesidebars = 1 ) {
+ /* Check if sidebars have user colors and if so equalize their heights */
+ equalizeHeights();
+ }
+}; // mantra_onload
+
+// make sure not to lose previous onload events
+window.onload = makeDoubleDelegate(window.onload, mantra_onload );
+
+/*!
+* FitVids 1.0
+*
+* Copyright 2011, Chris Coyier - http://css-tricks.com + Dave Rupert - http://daverupert.com
+* Credit to Thierry Koblentz - http://www.alistapart.com/articles/creating-intrinsic-ratios-for-video/
+* Released under the WTFPL license - http://sam.zoy.org/wtfpl/
+*
+* Date: Thu Sept 01 18:00:00 2011 -0500
+*/
+
+(function( $ ){
+
+ $.fn.fitVids = function( options ) {
+ var settings = {
+ customSelector: null
+ }
+
+ var div = document.createElement('div'),
+ ref = document.getElementsByTagName('base')[0] || document.getElementsByTagName('script')[0];
+
+ div.className = 'fit-vids-style';
+ div.innerHTML = '&shy;<style> .fluid-width-video-wrapper { width: 100%; position: relative; padding: 0; } .fluid-width-video-wrapper iframe, .fluid-width-video-wrapper object, .fluid-width-video-wrapper embed { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } </style>';
+
+ ref.parentNode.insertBefore(div,ref);
+
+ if ( options ) {
+ $.extend( settings, options );
+ }
+
+ return this.each(function(){
+ var selectors = [
+ "iframe[src*='player.vimeo.com']",
+ "iframe[src*='www.youtube.com']",
+ "iframe[src*='www.kickstarter.com']",
+ "object",
+ "embed"
+ ];
+
+ if (settings.customSelector) {
+ selectors.push(settings.customSelector);
+ }
+
+ var $allVideos = $(this).find(selectors.join(','));
+
+ $allVideos.each(function(){
+ var $this = $(this);
+ if (this.tagName.toLowerCase() == 'embed' && $this.parent('object').length || $this.parent('.fluid-width-video-wrapper').length) { return; }
+ var height = this.tagName.toLowerCase() == 'object' ? $this.attr('height') : $this.height(),
+ aspectRatio = height / $this.width();
+ if(!$this.attr('id')){
+ var videoID = 'fitvid' + Math.floor(Math.random()*999999);
+ $this.attr('id', videoID);
+ }
+ $this.wrap('<div class="fluid-width-video-wrapper"></div>').parent('.fluid-width-video-wrapper').css('padding-top', (aspectRatio * 100)+"%");
+ $this.removeAttr('height').removeAttr('width');
+ });
+ });
+
+ }
+})( jQuery );
+
+
+/*!
+ * hoverIntent r7 // 2013.03.11 // jQuery 1.9.1+
+ * http://cherne.net/brian/resources/jquery.hoverIntent.html
+ *
+ * You may use hoverIntent under the terms of the MIT license.
+ * Copyright 2007, 2013 Brian Cherne
+ */
+(function(e){e.fn.hoverIntent=function(t,n,r){var i={interval:100,sensitivity:7,timeout:0};if(typeof t==="object"){i=e.extend(i,t)}else if(e.isFunction(n)){i=e.extend(i,{over:t,out:n,selector:r})}else{i=e.extend(i,{over:t,out:t,selector:n})}var s,o,u,a;var f=function(e){s=e.pageX;o=e.pageY};var l=function(t,n){n.hoverIntent_t=clearTimeout(n.hoverIntent_t);if(Math.abs(u-s)+Math.abs(a-o)<i.sensitivity){e(n).off("mousemove.hoverIntent",f);n.hoverIntent_s=1;return i.over.apply(n,[t])}else{u=s;a=o;n.hoverIntent_t=setTimeout(function(){l(t,n)},i.interval)}};var c=function(e,t){t.hoverIntent_t=clearTimeout(t.hoverIntent_t);t.hoverIntent_s=0;return i.out.apply(t,[e])};var h=function(t){var n=jQuery.extend({},t);var r=this;if(r.hoverIntent_t){r.hoverIntent_t=clearTimeout(r.hoverIntent_t)}if(t.type=="mouseenter"){u=n.pageX;a=n.pageY;e(r).on("mousemove.hoverIntent",f);if(r.hoverIntent_s!=1){r.hoverIntent_t=setTimeout(function(){l(n,r)},i.interval)}}else{e(r).off("mousemove.hoverIntent",f);if(r.hoverIntent_s==1){r.hoverIntent_t=setTimeout(function(){c(n,r)},i.timeout)}}};return this.on({"mouseenter.hoverIntent":h,"mouseleave.hoverIntent":h},i.selector)}})(jQuery)
+
+
+/* Returns the version of Internet Explorer or a -1
+ * (indicating the use of another browser).
+ */
+function getInternetExplorerVersion()
+{
+ var rv = -1; /* Return value assumes failure. */
+ if (navigator.appName == 'Microsoft Internet Explorer')
+ {
+ var ua = navigator.userAgent;
+ var re = new RegExp("MSIE ([0-9]{1,}[\.0-9]{0,})");
+ if (re.exec(ua) != null)
+ rv = parseFloat( RegExp.$1 );
+ }
+ return rv;
+}
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png
new file mode 100644
index 00000000..954e22db
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png
new file mode 100644
index 00000000..64ece570
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png
new file mode 100644
index 00000000..abdc0108
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png
new file mode 100644
index 00000000..9b383f4d
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png
new file mode 100644
index 00000000..a23baad2
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png
new file mode 100644
index 00000000..42ccba26
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png
new file mode 100644
index 00000000..39d5824d
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png
new file mode 100644
index 00000000..f1273672
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png
new file mode 100644
index 00000000..359397ac
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_222222_256x240.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_222222_256x240.png
new file mode 100644
index 00000000..b273ff11
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_222222_256x240.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_228ef1_256x240.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_228ef1_256x240.png
new file mode 100644
index 00000000..a641a371
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_228ef1_256x240.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_ef8c08_256x240.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_ef8c08_256x240.png
new file mode 100644
index 00000000..85e63e9f
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_ef8c08_256x240.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_ffd27a_256x240.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_ffd27a_256x240.png
new file mode 100644
index 00000000..e117effa
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_ffd27a_256x240.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_ffffff_256x240.png b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_ffffff_256x240.png
new file mode 100644
index 00000000..42f8f992
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/images/ui-icons_ffffff_256x240.png
Binary files differ
diff --git a/themes/mantra/resources/js/jqueryui/css/ui-lightness/jquery-ui-1.8.16.custom.css b/themes/mantra/resources/js/jqueryui/css/ui-lightness/jquery-ui-1.8.16.custom.css
new file mode 100644
index 00000000..5547c7b9
--- /dev/null
+++ b/themes/mantra/resources/js/jqueryui/css/ui-lightness/jquery-ui-1.8.16.custom.css
@@ -0,0 +1,568 @@
+/*
+ * jQuery UI CSS Framework 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; }
+.ui-widget-content a { color: #333333; }
+.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); }
+.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -khtml-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/*
+ * jQuery UI Resizable 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizable#theming
+ */
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; }
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
+ * jQuery UI Selectable 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectable#theming
+ */
+.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
+/*
+ * jQuery UI Accordion 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion#theming
+ */
+/* IE/Win - Fix animation bug - #4615 */
+.ui-accordion { width: 100%; }
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }
+/*
+ * jQuery UI Autocomplete 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu 1.8.16
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+ float: left;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
+/*
+ * jQuery UI Button 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+/*
+ * jQuery UI Dialog 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/*
+ * jQuery UI Slider 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider#theming
+ */
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/*
+ * jQuery UI Tabs 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs#theming
+ */
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+/*
+ * jQuery UI Datepicker 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker#theming
+ */
+.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/*
+ * jQuery UI Progressbar 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar#theming
+ */
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file
diff --git a/themes/mantra/resources/js/nivo-slider.js b/themes/mantra/resources/js/nivo-slider.js
new file mode 100644
index 00000000..039f3cfb
--- /dev/null
+++ b/themes/mantra/resources/js/nivo-slider.js
@@ -0,0 +1,10 @@
+/*
+ * jQuery Nivo Slider v3.2
+ * http://nivo.dev7studios.com
+ *
+ * Copyright 2012, Dev7studios
+ * Free to use and abuse under the MIT license.
+ * http://www.opensource.org/licenses/mit-license.php
+ */
+
+(function(e){var t=function(t,n){var r=e.extend({},e.fn.nivoSlider.defaults,n);var i={currentSlide:0,currentImage:"",totalSlides:0,running:false,paused:false,stop:false,controlNavEl:false};var s=e(t);s.data("nivo:vars",i).addClass("nivoSlider");var o=s.children();o.each(function(){var t=e(this);var n="";if(!t.is("img")){if(t.is("a")){t.addClass("nivo-imageLink");n=t}t=t.find("img:first")}var r=r===0?t.attr("width"):t.width(),s=s===0?t.attr("height"):t.height();if(n!==""){n.css("display","none")}t.css("display","none");i.totalSlides++});if(r.randomStart){r.startSlide=Math.floor(Math.random()*i.totalSlides)}if(r.startSlide>0){if(r.startSlide>=i.totalSlides){r.startSlide=i.totalSlides-1}i.currentSlide=r.startSlide}if(e(o[i.currentSlide]).is("img")){i.currentImage=e(o[i.currentSlide])}else{i.currentImage=e(o[i.currentSlide]).find("img:first")}if(e(o[i.currentSlide]).is("a")){e(o[i.currentSlide]).css("display","block")}var u=e("<img/>").addClass("nivo-main-image");u.attr("src",i.currentImage.attr("src")).show();s.append(u);e(window).resize(function(){s.children("img").width(s.width());u.attr("src",i.currentImage.attr("src"));u.stop().height("auto");e(".nivo-slice").remove();e(".nivo-box").remove()});s.append(e('<div class="nivo-caption"></div>'));var a=function(t){var n=e(".nivo-caption",s);if(i.currentImage.attr("title")!=""&&i.currentImage.attr("title")!=undefined){var r=i.currentImage.attr("title");if(r.substr(0,1)=="#")r=e(r).html();if(n.css("display")=="block"){setTimeout(function(){n.html(r)},t.animSpeed)}else{n.html(r);n.stop().fadeIn(t.animSpeed)}}else{n.stop().fadeOut(t.animSpeed)}};a(r);var f=0;if(!r.manualAdvance&&o.length>1){f=setInterval(function(){d(s,o,r,false)},r.pauseTime)}if(r.directionNav){s.append('<div class="nivo-directionNav"><a class="nivo-prevNav">'+r.prevText+'</a><a class="nivo-nextNav">'+r.nextText+"</a></div>");e(s).on("click","a.nivo-prevNav",function(){if(i.running){return false}clearInterval(f);f="";i.currentSlide-=2;d(s,o,r,"prev")});e(s).on("click","a.nivo-nextNav",function(){if(i.running){return false}clearInterval(f);f="";d(s,o,r,"next")})}if(r.controlNav){i.controlNavEl=e('<div class="nivo-controlNav"></div>');s.after(i.controlNavEl);for(var l=0;l<o.length;l++){if(r.controlNavThumbs){i.controlNavEl.addClass("nivo-thumbs-enabled");var c=o.eq(l);if(!c.is("img")){c=c.find("img:first")}if(c.attr("data-thumb"))i.controlNavEl.append('<a class="nivo-control" rel="'+l+'"><img src="'+c.attr("data-thumb")+'" alt="" /></a>')}else{i.controlNavEl.append('<a class="nivo-control" rel="'+l+'">'+(l+1)+"</a>")}}e("a:eq("+i.currentSlide+")",i.controlNavEl).addClass("active");e("a",i.controlNavEl).bind("click",function(){if(i.running)return false;if(e(this).hasClass("active"))return false;clearInterval(f);f="";u.attr("src",i.currentImage.attr("src"));i.currentSlide=e(this).attr("rel")-1;d(s,o,r,"control")})}if(r.pauseOnHover){s.hover(function(){i.paused=true;clearInterval(f);f=""},function(){i.paused=false;if(f===""&&!r.manualAdvance){f=setInterval(function(){d(s,o,r,false)},r.pauseTime)}})}s.bind("nivo:animFinished",function(){u.attr("src",i.currentImage.attr("src"));i.running=false;e(o).each(function(){if(e(this).is("a")){e(this).css("display","none")}});if(e(o[i.currentSlide]).is("a")){e(o[i.currentSlide]).css("display","block")}if(f===""&&!i.paused&&!r.manualAdvance){f=setInterval(function(){d(s,o,r,false)},r.pauseTime)}r.afterChange.call(this)});var h=function(t,n,r){if(e(r.currentImage).parent().is("a"))e(r.currentImage).parent().css("display","block");e('img[src="'+r.currentImage.attr("src")+'"]',t).not(".nivo-main-image,.nivo-control img").width(t.width()).css("visibility","hidden").show();var i=e('img[src="'+r.currentImage.attr("src")+'"]',t).not(".nivo-main-image,.nivo-control img").parent().is("a")?e('img[src="'+r.currentImage.attr("src")+'"]',t).not(".nivo-main-image,.nivo-control img").parent().height():e('img[src="'+r.currentImage.attr("src")+'"]',t).not(".nivo-main-image,.nivo-control img").height();for(var s=0;s<n.slices;s++){var o=Math.round(t.width()/n.slices);if(s===n.slices-1){t.append(e('<div class="nivo-slice" name="'+s+'"><img src="'+r.currentImage.attr("src")+'" style="position:absolute; width:'+t.width()+"px; height:auto; display:block !important; top:0; left:-"+(o+s*o-o)+'px;" /></div>').css({left:o*s+"px",width:t.width()-o*s+"px",height:i+"px",opacity:"0",overflow:"hidden"}))}else{t.append(e('<div class="nivo-slice" name="'+s+'"><img src="'+r.currentImage.attr("src")+'" style="position:absolute; width:'+t.width()+"px; height:auto; display:block !important; top:0; left:-"+(o+s*o-o)+'px;" /></div>').css({left:o*s+"px",width:o+"px",height:i+"px",opacity:"0",overflow:"hidden"}))}}e(".nivo-slice",t).height(i);u.stop().animate({height:e(r.currentImage).height()},n.animSpeed)};var p=function(t,n,r){if(e(r.currentImage).parent().is("a"))e(r.currentImage).parent().css("display","block");e('img[src="'+r.currentImage.attr("src")+'"]',t).not(".nivo-main-image,.nivo-control img").width(t.width()).css("visibility","hidden").show();var i=Math.round(t.width()/n.boxCols),s=Math.round(e('img[src="'+r.currentImage.attr("src")+'"]',t).not(".nivo-main-image,.nivo-control img").height()/n.boxRows);for(var o=0;o<n.boxRows;o++){for(var a=0;a<n.boxCols;a++){if(a===n.boxCols-1){t.append(e('<div class="nivo-box" name="'+a+'" rel="'+o+'"><img src="'+r.currentImage.attr("src")+'" style="position:absolute; width:'+t.width()+"px; height:auto; display:block; top:-"+s*o+"px; left:-"+i*a+'px;" /></div>').css({opacity:0,left:i*a+"px",top:s*o+"px",width:t.width()-i*a+"px"}));e('.nivo-box[name="'+a+'"]',t).height(e('.nivo-box[name="'+a+'"] img',t).height()+"px")}else{t.append(e('<div class="nivo-box" name="'+a+'" rel="'+o+'"><img src="'+r.currentImage.attr("src")+'" style="position:absolute; width:'+t.width()+"px; height:auto; display:block; top:-"+s*o+"px; left:-"+i*a+'px;" /></div>').css({opacity:0,left:i*a+"px",top:s*o+"px",width:i+"px"}));e('.nivo-box[name="'+a+'"]',t).height(e('.nivo-box[name="'+a+'"] img',t).height()+"px")}}}u.stop().animate({height:e(r.currentImage).height()},n.animSpeed)};var d=function(t,n,r,i){var s=t.data("nivo:vars");if(s&&s.currentSlide===s.totalSlides-1){r.lastSlide.call(this)}if((!s||s.stop)&&!i){return false}r.beforeChange.call(this);if(!i){u.attr("src",s.currentImage.attr("src"))}else{if(i==="prev"){u.attr("src",s.currentImage.attr("src"))}if(i==="next"){u.attr("src",s.currentImage.attr("src"))}}s.currentSlide++;if(s.currentSlide===s.totalSlides){s.currentSlide=0;r.slideshowEnd.call(this)}if(s.currentSlide<0){s.currentSlide=s.totalSlides-1}if(e(n[s.currentSlide]).is("img")){s.currentImage=e(n[s.currentSlide])}else{s.currentImage=e(n[s.currentSlide]).find("img:first")}if(r.controlNav){e("a",s.controlNavEl).removeClass("active");e("a:eq("+s.currentSlide+")",s.controlNavEl).addClass("active")}a(r);e(".nivo-slice",t).remove();e(".nivo-box",t).remove();var o=r.effect,f="";if(r.effect==="random"){f=new Array("sliceDownRight","sliceDownLeft","sliceUpRight","sliceUpLeft","sliceUpDown","sliceUpDownLeft","fold","fade","boxRandom","boxRain","boxRainReverse","boxRainGrow","boxRainGrowReverse");o=f[Math.floor(Math.random()*(f.length+1))];if(o===undefined){o="fade"}}if(r.effect.indexOf(",")!==-1){f=r.effect.split(",");o=f[Math.floor(Math.random()*f.length)];if(o===undefined){o="fade"}}if(s.currentImage.attr("data-transition")){o=s.currentImage.attr("data-transition")}s.running=true;var l=0,c=0,d="",m="",g="",y="";if(o==="sliceDown"||o==="sliceDownRight"||o==="sliceDownLeft"){h(t,r,s);l=0;c=0;d=e(".nivo-slice",t);if(o==="sliceDownLeft"){d=e(".nivo-slice",t)._reverse()}d.each(function(){var n=e(this);n.css({top:"0px"});if(c===r.slices-1){setTimeout(function(){n.animate({opacity:"1.0"},r.animSpeed,"",function(){t.trigger("nivo:animFinished")})},100+l)}else{setTimeout(function(){n.animate({opacity:"1.0"},r.animSpeed)},100+l)}l+=50;c++})}else if(o==="sliceUp"||o==="sliceUpRight"||o==="sliceUpLeft"){h(t,r,s);l=0;c=0;d=e(".nivo-slice",t);if(o==="sliceUpLeft"){d=e(".nivo-slice",t)._reverse()}d.each(function(){var n=e(this);n.css({bottom:"0px"});if(c===r.slices-1){setTimeout(function(){n.animate({opacity:"1.0"},r.animSpeed,"",function(){t.trigger("nivo:animFinished")})},100+l)}else{setTimeout(function(){n.animate({opacity:"1.0"},r.animSpeed)},100+l)}l+=50;c++})}else if(o==="sliceUpDown"||o==="sliceUpDownRight"||o==="sliceUpDownLeft"){h(t,r,s);l=0;c=0;var b=0;d=e(".nivo-slice",t);if(o==="sliceUpDownLeft"){d=e(".nivo-slice",t)._reverse()}d.each(function(){var n=e(this);if(c===0){n.css("top","0px");c++}else{n.css("bottom","0px");c=0}if(b===r.slices-1){setTimeout(function(){n.animate({opacity:"1.0"},r.animSpeed,"",function(){t.trigger("nivo:animFinished")})},100+l)}else{setTimeout(function(){n.animate({opacity:"1.0"},r.animSpeed)},100+l)}l+=50;b++})}else if(o==="fold"){h(t,r,s);l=0;c=0;e(".nivo-slice",t).each(function(){var n=e(this);var i=n.width();n.css({top:"0px",width:"0px"});if(c===r.slices-1){setTimeout(function(){n.animate({width:i,opacity:"1.0"},r.animSpeed,"",function(){t.trigger("nivo:animFinished")})},100+l)}else{setTimeout(function(){n.animate({width:i,opacity:"1.0"},r.animSpeed)},100+l)}l+=50;c++})}else if(o==="fade"){h(t,r,s);m=e(".nivo-slice:first",t);m.css({width:t.width()+"px"});m.animate({opacity:"1.0"},r.animSpeed*2,"",function(){t.trigger("nivo:animFinished")})}else if(o==="slideInRight"){h(t,r,s);m=e(".nivo-slice:first",t);m.css({width:"0px",opacity:"1"});m.animate({width:t.width()+"px"},r.animSpeed*2,"",function(){t.trigger("nivo:animFinished")})}else if(o==="slideInLeft"){h(t,r,s);m=e(".nivo-slice:first",t);m.css({width:"0px",opacity:"1",left:"",right:"0px"});m.animate({width:t.width()+"px"},r.animSpeed*2,"",function(){m.css({left:"0px",right:""});t.trigger("nivo:animFinished")})}else if(o==="boxRandom"){p(t,r,s);g=r.boxCols*r.boxRows;c=0;l=0;y=v(e(".nivo-box",t));y.each(function(){var n=e(this);if(c===g-1){setTimeout(function(){n.animate({opacity:"1"},r.animSpeed,"",function(){t.trigger("nivo:animFinished")})},100+l)}else{setTimeout(function(){n.animate({opacity:"1"},r.animSpeed)},100+l)}l+=20;c++})}else if(o==="boxRain"||o==="boxRainReverse"||o==="boxRainGrow"||o==="boxRainGrowReverse"){p(t,r,s);g=r.boxCols*r.boxRows;c=0;l=0;var w=0;var E=0;var S=[];S[w]=[];y=e(".nivo-box",t);if(o==="boxRainReverse"||o==="boxRainGrowReverse"){y=e(".nivo-box",t)._reverse()}y.each(function(){S[w][E]=e(this);E++;if(E===r.boxCols){w++;E=0;S[w]=[]}});for(var x=0;x<r.boxCols*2;x++){var T=x;for(var N=0;N<r.boxRows;N++){if(T>=0&&T<r.boxCols){(function(n,i,s,u,a){var f=e(S[n][i]);var l=f.width();var c=f.height();if(o==="boxRainGrow"||o==="boxRainGrowReverse"){f.width(0).height(0)}if(u===a-1){setTimeout(function(){f.animate({opacity:"1",width:l,height:c},r.animSpeed/1.3,"",function(){t.trigger("nivo:animFinished")})},100+s)}else{setTimeout(function(){f.animate({opacity:"1",width:l,height:c},r.animSpeed/1.3)},100+s)}})(N,T,l,c,g);c++}T--}l+=100}}};var v=function(e){for(var t,n,r=e.length;r;t=parseInt(Math.random()*r,10),n=e[--r],e[r]=e[t],e[t]=n);return e};var m=function(e){if(this.console&&typeof console.log!=="undefined"){console.log(e)}};this.stop=function(){if(!e(t).data("nivo:vars").stop){e(t).data("nivo:vars").stop=true;m("Stop Slider")}};this.start=function(){if(e(t).data("nivo:vars").stop){e(t).data("nivo:vars").stop=false;m("Start Slider")}};r.afterLoad.call(this);return this};e.fn.nivoSlider=function(n){return this.each(function(r,i){var s=e(this);if(s.data("nivoslider")){return s.data("nivoslider")}var o=new t(this,n);s.data("nivoslider",o)})};e.fn.nivoSlider.defaults={effect:"random",slices:15,boxCols:8,boxRows:4,animSpeed:500,pauseTime:3e3,startSlide:0,directionNav:true,controlNav:true,controlNavThumbs:false,pauseOnHover:true,manualAdvance:false,prevText:"Prev",nextText:"Next",randomStart:false,beforeChange:function(){},afterChange:function(){},slideshowEnd:function(){},lastSlide:function(){},afterLoad:function(){}};e.fn._reverse=[].reverse})(jQuery)